diff --git a/README.md b/README.md index 00a150e..efab644 100644 --- a/README.md +++ b/README.md @@ -1,5 +1,19 @@ # js-basic-list +## Préambules + +Liste de la doc utile pour les (l') exercices de la journée + +## Consignes + +Consignes globales : +- contraintes et bonnes pratiques en relation avec les exercices de la journée +- Si tu as une question, demande à ton voisin de droite +- Autrement ton voisin de gauche +- ... + +## Enoncés d'exercice + ### 1. Afficher les données ci-dessous sous forme de liste dans une page html : diff --git a/css/index.css b/css/index.css new file mode 100644 index 0000000..1cdb8f9 --- /dev/null +++ b/css/index.css @@ -0,0 +1,25 @@ +.page-title { + position: absolute; + display:block; + font-size: 2.2em; + left: 50%; + transform: translateX(-50%); +} + +.header { + font-size: 1.5em; + display: inline-block; + padding: 10px 10px 10px 10px; + color: #fff; + margin-bottom: 0; +} + +.book-filter { + margin-top: 20px; +} + +.book-link { + display: block; + top: 50% !important; + transform: translateY(-50%); +} diff --git a/css/materialize.css b/css/materialize.css new file mode 100644 index 0000000..1535d76 --- /dev/null +++ b/css/materialize.css @@ -0,0 +1,8544 @@ +/*! + * Materialize v0.97.8 (http://materializecss.com) + * Copyright 2014-2015 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +.materialize-red { + background-color: #e51c23 !important; +} + +.materialize-red-text { + color: #e51c23 !important; +} + +.materialize-red.lighten-5 { + background-color: #fdeaeb !important; +} + +.materialize-red-text.text-lighten-5 { + color: #fdeaeb !important; +} + +.materialize-red.lighten-4 { + background-color: #f8c1c3 !important; +} + +.materialize-red-text.text-lighten-4 { + color: #f8c1c3 !important; +} + +.materialize-red.lighten-3 { + background-color: #f3989b !important; +} + +.materialize-red-text.text-lighten-3 { + color: #f3989b !important; +} + +.materialize-red.lighten-2 { + background-color: #ee6e73 !important; +} + +.materialize-red-text.text-lighten-2 { + color: #ee6e73 !important; +} + +.materialize-red.lighten-1 { + background-color: #ea454b !important; +} + +.materialize-red-text.text-lighten-1 { + color: #ea454b !important; +} + +.materialize-red.darken-1 { + background-color: #d0181e !important; +} + +.materialize-red-text.text-darken-1 { + color: #d0181e !important; +} + +.materialize-red.darken-2 { + background-color: #b9151b !important; +} + +.materialize-red-text.text-darken-2 { + color: #b9151b !important; +} + +.materialize-red.darken-3 { + background-color: #a21318 !important; +} + +.materialize-red-text.text-darken-3 { + color: #a21318 !important; +} + +.materialize-red.darken-4 { + background-color: #8b1014 !important; +} + +.materialize-red-text.text-darken-4 { + color: #8b1014 !important; +} + +.red { + background-color: #F44336 !important; +} + +.red-text { + color: #F44336 !important; +} + +.red.lighten-5 { + background-color: #FFEBEE !important; +} + +.red-text.text-lighten-5 { + color: #FFEBEE !important; +} + +.red.lighten-4 { + background-color: #FFCDD2 !important; +} + +.red-text.text-lighten-4 { + color: #FFCDD2 !important; +} + +.red.lighten-3 { + background-color: #EF9A9A !important; +} + +.red-text.text-lighten-3 { + color: #EF9A9A !important; +} + +.red.lighten-2 { + background-color: #E57373 !important; +} + +.red-text.text-lighten-2 { + color: #E57373 !important; +} + +.red.lighten-1 { + background-color: #EF5350 !important; +} + +.red-text.text-lighten-1 { + color: #EF5350 !important; +} + +.red.darken-1 { + background-color: #E53935 !important; +} + +.red-text.text-darken-1 { + color: #E53935 !important; +} + +.red.darken-2 { + background-color: #D32F2F !important; +} + +.red-text.text-darken-2 { + color: #D32F2F !important; +} + +.red.darken-3 { + background-color: #C62828 !important; +} + +.red-text.text-darken-3 { + color: #C62828 !important; +} + +.red.darken-4 { + background-color: #B71C1C !important; +} + +.red-text.text-darken-4 { + color: #B71C1C !important; +} + +.red.accent-1 { + background-color: #FF8A80 !important; +} + +.red-text.text-accent-1 { + color: #FF8A80 !important; +} + +.red.accent-2 { + background-color: #FF5252 !important; +} + +.red-text.text-accent-2 { + color: #FF5252 !important; +} + +.red.accent-3 { + background-color: #FF1744 !important; +} + +.red-text.text-accent-3 { + color: #FF1744 !important; +} + +.red.accent-4 { + background-color: #D50000 !important; +} + +.red-text.text-accent-4 { + color: #D50000 !important; +} + +.pink { + background-color: #e91e63 !important; +} + +.pink-text { + color: #e91e63 !important; +} + +.pink.lighten-5 { + background-color: #fce4ec !important; +} + +.pink-text.text-lighten-5 { + color: #fce4ec !important; +} + +.pink.lighten-4 { + background-color: #f8bbd0 !important; +} + +.pink-text.text-lighten-4 { + color: #f8bbd0 !important; +} + +.pink.lighten-3 { + background-color: #f48fb1 !important; +} + +.pink-text.text-lighten-3 { + color: #f48fb1 !important; +} + +.pink.lighten-2 { + background-color: #f06292 !important; +} + +.pink-text.text-lighten-2 { + color: #f06292 !important; +} + +.pink.lighten-1 { + background-color: #ec407a !important; +} + +.pink-text.text-lighten-1 { + color: #ec407a !important; +} + +.pink.darken-1 { + background-color: #d81b60 !important; +} + +.pink-text.text-darken-1 { + color: #d81b60 !important; +} + +.pink.darken-2 { + background-color: #c2185b !important; +} + +.pink-text.text-darken-2 { + color: #c2185b !important; +} + +.pink.darken-3 { + background-color: #ad1457 !important; +} + +.pink-text.text-darken-3 { + color: #ad1457 !important; +} + +.pink.darken-4 { + background-color: #880e4f !important; +} + +.pink-text.text-darken-4 { + color: #880e4f !important; +} + +.pink.accent-1 { + background-color: #ff80ab !important; +} + +.pink-text.text-accent-1 { + color: #ff80ab !important; +} + +.pink.accent-2 { + background-color: #ff4081 !important; +} + +.pink-text.text-accent-2 { + color: #ff4081 !important; +} + +.pink.accent-3 { + background-color: #f50057 !important; +} + +.pink-text.text-accent-3 { + color: #f50057 !important; +} + +.pink.accent-4 { + background-color: #c51162 !important; +} + +.pink-text.text-accent-4 { + color: #c51162 !important; +} + +.purple { + background-color: #9c27b0 !important; +} + +.purple-text { + color: #9c27b0 !important; +} + +.purple.lighten-5 { + background-color: #f3e5f5 !important; +} + +.purple-text.text-lighten-5 { + color: #f3e5f5 !important; +} + +.purple.lighten-4 { + background-color: #e1bee7 !important; +} + +.purple-text.text-lighten-4 { + color: #e1bee7 !important; +} + +.purple.lighten-3 { + background-color: #ce93d8 !important; +} + +.purple-text.text-lighten-3 { + color: #ce93d8 !important; +} + +.purple.lighten-2 { + background-color: #ba68c8 !important; +} + +.purple-text.text-lighten-2 { + color: #ba68c8 !important; +} + +.purple.lighten-1 { + background-color: #ab47bc !important; +} + +.purple-text.text-lighten-1 { + color: #ab47bc !important; +} + +.purple.darken-1 { + background-color: #8e24aa !important; +} + +.purple-text.text-darken-1 { + color: #8e24aa !important; +} + +.purple.darken-2 { + background-color: #7b1fa2 !important; +} + +.purple-text.text-darken-2 { + color: #7b1fa2 !important; +} + +.purple.darken-3 { + background-color: #6a1b9a !important; +} + +.purple-text.text-darken-3 { + color: #6a1b9a !important; +} + +.purple.darken-4 { + background-color: #4a148c !important; +} + +.purple-text.text-darken-4 { + color: #4a148c !important; +} + +.purple.accent-1 { + background-color: #ea80fc !important; +} + +.purple-text.text-accent-1 { + color: #ea80fc !important; +} + +.purple.accent-2 { + background-color: #e040fb !important; +} + +.purple-text.text-accent-2 { + color: #e040fb !important; +} + +.purple.accent-3 { + background-color: #d500f9 !important; +} + +.purple-text.text-accent-3 { + color: #d500f9 !important; +} + +.purple.accent-4 { + background-color: #aa00ff !important; +} + +.purple-text.text-accent-4 { + color: #aa00ff !important; +} + +.deep-purple { + background-color: #673ab7 !important; +} + +.deep-purple-text { + color: #673ab7 !important; +} + +.deep-purple.lighten-5 { + background-color: #ede7f6 !important; +} + +.deep-purple-text.text-lighten-5 { + color: #ede7f6 !important; +} + +.deep-purple.lighten-4 { + background-color: #d1c4e9 !important; +} + +.deep-purple-text.text-lighten-4 { + color: #d1c4e9 !important; +} + +.deep-purple.lighten-3 { + background-color: #b39ddb !important; +} + +.deep-purple-text.text-lighten-3 { + color: #b39ddb !important; +} + +.deep-purple.lighten-2 { + background-color: #9575cd !important; +} + +.deep-purple-text.text-lighten-2 { + color: #9575cd !important; +} + +.deep-purple.lighten-1 { + background-color: #7e57c2 !important; +} + +.deep-purple-text.text-lighten-1 { + color: #7e57c2 !important; +} + +.deep-purple.darken-1 { + background-color: #5e35b1 !important; +} + +.deep-purple-text.text-darken-1 { + color: #5e35b1 !important; +} + +.deep-purple.darken-2 { + background-color: #512da8 !important; +} + +.deep-purple-text.text-darken-2 { + color: #512da8 !important; +} + +.deep-purple.darken-3 { + background-color: #4527a0 !important; +} + +.deep-purple-text.text-darken-3 { + color: #4527a0 !important; +} + +.deep-purple.darken-4 { + background-color: #311b92 !important; +} + +.deep-purple-text.text-darken-4 { + color: #311b92 !important; +} + +.deep-purple.accent-1 { + background-color: #b388ff !important; +} + +.deep-purple-text.text-accent-1 { + color: #b388ff !important; +} + +.deep-purple.accent-2 { + background-color: #7c4dff !important; +} + +.deep-purple-text.text-accent-2 { + color: #7c4dff !important; +} + +.deep-purple.accent-3 { + background-color: #651fff !important; +} + +.deep-purple-text.text-accent-3 { + color: #651fff !important; +} + +.deep-purple.accent-4 { + background-color: #6200ea !important; +} + +.deep-purple-text.text-accent-4 { + color: #6200ea !important; +} + +.indigo { + background-color: #3f51b5 !important; +} + +.indigo-text { + color: #3f51b5 !important; +} + +.indigo.lighten-5 { + background-color: #e8eaf6 !important; +} + +.indigo-text.text-lighten-5 { + color: #e8eaf6 !important; +} + +.indigo.lighten-4 { + background-color: #c5cae9 !important; +} + +.indigo-text.text-lighten-4 { + color: #c5cae9 !important; +} + +.indigo.lighten-3 { + background-color: #9fa8da !important; +} + +.indigo-text.text-lighten-3 { + color: #9fa8da !important; +} + +.indigo.lighten-2 { + background-color: #7986cb !important; +} + +.indigo-text.text-lighten-2 { + color: #7986cb !important; +} + +.indigo.lighten-1 { + background-color: #5c6bc0 !important; +} + +.indigo-text.text-lighten-1 { + color: #5c6bc0 !important; +} + +.indigo.darken-1 { + background-color: #3949ab !important; +} + +.indigo-text.text-darken-1 { + color: #3949ab !important; +} + +.indigo.darken-2 { + background-color: #303f9f !important; +} + +.indigo-text.text-darken-2 { + color: #303f9f !important; +} + +.indigo.darken-3 { + background-color: #283593 !important; +} + +.indigo-text.text-darken-3 { + color: #283593 !important; +} + +.indigo.darken-4 { + background-color: #1a237e !important; +} + +.indigo-text.text-darken-4 { + color: #1a237e !important; +} + +.indigo.accent-1 { + background-color: #8c9eff !important; +} + +.indigo-text.text-accent-1 { + color: #8c9eff !important; +} + +.indigo.accent-2 { + background-color: #536dfe !important; +} + +.indigo-text.text-accent-2 { + color: #536dfe !important; +} + +.indigo.accent-3 { + background-color: #3d5afe !important; +} + +.indigo-text.text-accent-3 { + color: #3d5afe !important; +} + +.indigo.accent-4 { + background-color: #304ffe !important; +} + +.indigo-text.text-accent-4 { + color: #304ffe !important; +} + +.blue { + background-color: #2196F3 !important; +} + +.blue-text { + color: #2196F3 !important; +} + +.blue.lighten-5 { + background-color: #E3F2FD !important; +} + +.blue-text.text-lighten-5 { + color: #E3F2FD !important; +} + +.blue.lighten-4 { + background-color: #BBDEFB !important; +} + +.blue-text.text-lighten-4 { + color: #BBDEFB !important; +} + +.blue.lighten-3 { + background-color: #90CAF9 !important; +} + +.blue-text.text-lighten-3 { + color: #90CAF9 !important; +} + +.blue.lighten-2 { + background-color: #64B5F6 !important; +} + +.blue-text.text-lighten-2 { + color: #64B5F6 !important; +} + +.blue.lighten-1 { + background-color: #42A5F5 !important; +} + +.blue-text.text-lighten-1 { + color: #42A5F5 !important; +} + +.blue.darken-1 { + background-color: #1E88E5 !important; +} + +.blue-text.text-darken-1 { + color: #1E88E5 !important; +} + +.blue.darken-2 { + background-color: #1976D2 !important; +} + +.blue-text.text-darken-2 { + color: #1976D2 !important; +} + +.blue.darken-3 { + background-color: #1565C0 !important; +} + +.blue-text.text-darken-3 { + color: #1565C0 !important; +} + +.blue.darken-4 { + background-color: #0D47A1 !important; +} + +.blue-text.text-darken-4 { + color: #0D47A1 !important; +} + +.blue.accent-1 { + background-color: #82B1FF !important; +} + +.blue-text.text-accent-1 { + color: #82B1FF !important; +} + +.blue.accent-2 { + background-color: #448AFF !important; +} + +.blue-text.text-accent-2 { + color: #448AFF !important; +} + +.blue.accent-3 { + background-color: #2979FF !important; +} + +.blue-text.text-accent-3 { + color: #2979FF !important; +} + +.blue.accent-4 { + background-color: #2962FF !important; +} + +.blue-text.text-accent-4 { + color: #2962FF !important; +} + +.light-blue { + background-color: #03a9f4 !important; +} + +.light-blue-text { + color: #03a9f4 !important; +} + +.light-blue.lighten-5 { + background-color: #e1f5fe !important; +} + +.light-blue-text.text-lighten-5 { + color: #e1f5fe !important; +} + +.light-blue.lighten-4 { + background-color: #b3e5fc !important; +} + +.light-blue-text.text-lighten-4 { + color: #b3e5fc !important; +} + +.light-blue.lighten-3 { + background-color: #81d4fa !important; +} + +.light-blue-text.text-lighten-3 { + color: #81d4fa !important; +} + +.light-blue.lighten-2 { + background-color: #4fc3f7 !important; +} + +.light-blue-text.text-lighten-2 { + color: #4fc3f7 !important; +} + +.light-blue.lighten-1 { + background-color: #29b6f6 !important; +} + +.light-blue-text.text-lighten-1 { + color: #29b6f6 !important; +} + +.light-blue.darken-1 { + background-color: #039be5 !important; +} + +.light-blue-text.text-darken-1 { + color: #039be5 !important; +} + +.light-blue.darken-2 { + background-color: #0288d1 !important; +} + +.light-blue-text.text-darken-2 { + color: #0288d1 !important; +} + +.light-blue.darken-3 { + background-color: #0277bd !important; +} + +.light-blue-text.text-darken-3 { + color: #0277bd !important; +} + +.light-blue.darken-4 { + background-color: #01579b !important; +} + +.light-blue-text.text-darken-4 { + color: #01579b !important; +} + +.light-blue.accent-1 { + background-color: #80d8ff !important; +} + +.light-blue-text.text-accent-1 { + color: #80d8ff !important; +} + +.light-blue.accent-2 { + background-color: #40c4ff !important; +} + +.light-blue-text.text-accent-2 { + color: #40c4ff !important; +} + +.light-blue.accent-3 { + background-color: #00b0ff !important; +} + +.light-blue-text.text-accent-3 { + color: #00b0ff !important; +} + +.light-blue.accent-4 { + background-color: #0091ea !important; +} + +.light-blue-text.text-accent-4 { + color: #0091ea !important; +} + +.cyan { + background-color: #00bcd4 !important; +} + +.cyan-text { + color: #00bcd4 !important; +} + +.cyan.lighten-5 { + background-color: #e0f7fa !important; +} + +.cyan-text.text-lighten-5 { + color: #e0f7fa !important; +} + +.cyan.lighten-4 { + background-color: #b2ebf2 !important; +} + +.cyan-text.text-lighten-4 { + color: #b2ebf2 !important; +} + +.cyan.lighten-3 { + background-color: #80deea !important; +} + +.cyan-text.text-lighten-3 { + color: #80deea !important; +} + +.cyan.lighten-2 { + background-color: #4dd0e1 !important; +} + +.cyan-text.text-lighten-2 { + color: #4dd0e1 !important; +} + +.cyan.lighten-1 { + background-color: #26c6da !important; +} + +.cyan-text.text-lighten-1 { + color: #26c6da !important; +} + +.cyan.darken-1 { + background-color: #00acc1 !important; +} + +.cyan-text.text-darken-1 { + color: #00acc1 !important; +} + +.cyan.darken-2 { + background-color: #0097a7 !important; +} + +.cyan-text.text-darken-2 { + color: #0097a7 !important; +} + +.cyan.darken-3 { + background-color: #00838f !important; +} + +.cyan-text.text-darken-3 { + color: #00838f !important; +} + +.cyan.darken-4 { + background-color: #006064 !important; +} + +.cyan-text.text-darken-4 { + color: #006064 !important; +} + +.cyan.accent-1 { + background-color: #84ffff !important; +} + +.cyan-text.text-accent-1 { + color: #84ffff !important; +} + +.cyan.accent-2 { + background-color: #18ffff !important; +} + +.cyan-text.text-accent-2 { + color: #18ffff !important; +} + +.cyan.accent-3 { + background-color: #00e5ff !important; +} + +.cyan-text.text-accent-3 { + color: #00e5ff !important; +} + +.cyan.accent-4 { + background-color: #00b8d4 !important; +} + +.cyan-text.text-accent-4 { + color: #00b8d4 !important; +} + +.teal { + background-color: #009688 !important; +} + +.teal-text { + color: #009688 !important; +} + +.teal.lighten-5 { + background-color: #e0f2f1 !important; +} + +.teal-text.text-lighten-5 { + color: #e0f2f1 !important; +} + +.teal.lighten-4 { + background-color: #b2dfdb !important; +} + +.teal-text.text-lighten-4 { + color: #b2dfdb !important; +} + +.teal.lighten-3 { + background-color: #80cbc4 !important; +} + +.teal-text.text-lighten-3 { + color: #80cbc4 !important; +} + +.teal.lighten-2 { + background-color: #4db6ac !important; +} + +.teal-text.text-lighten-2 { + color: #4db6ac !important; +} + +.teal.lighten-1 { + background-color: #26a69a !important; +} + +.teal-text.text-lighten-1 { + color: #26a69a !important; +} + +.teal.darken-1 { + background-color: #00897b !important; +} + +.teal-text.text-darken-1 { + color: #00897b !important; +} + +.teal.darken-2 { + background-color: #00796b !important; +} + +.teal-text.text-darken-2 { + color: #00796b !important; +} + +.teal.darken-3 { + background-color: #00695c !important; +} + +.teal-text.text-darken-3 { + color: #00695c !important; +} + +.teal.darken-4 { + background-color: #004d40 !important; +} + +.teal-text.text-darken-4 { + color: #004d40 !important; +} + +.teal.accent-1 { + background-color: #a7ffeb !important; +} + +.teal-text.text-accent-1 { + color: #a7ffeb !important; +} + +.teal.accent-2 { + background-color: #64ffda !important; +} + +.teal-text.text-accent-2 { + color: #64ffda !important; +} + +.teal.accent-3 { + background-color: #1de9b6 !important; +} + +.teal-text.text-accent-3 { + color: #1de9b6 !important; +} + +.teal.accent-4 { + background-color: #00bfa5 !important; +} + +.teal-text.text-accent-4 { + color: #00bfa5 !important; +} + +.green { + background-color: #4CAF50 !important; +} + +.green-text { + color: #4CAF50 !important; +} + +.green.lighten-5 { + background-color: #E8F5E9 !important; +} + +.green-text.text-lighten-5 { + color: #E8F5E9 !important; +} + +.green.lighten-4 { + background-color: #C8E6C9 !important; +} + +.green-text.text-lighten-4 { + color: #C8E6C9 !important; +} + +.green.lighten-3 { + background-color: #A5D6A7 !important; +} + +.green-text.text-lighten-3 { + color: #A5D6A7 !important; +} + +.green.lighten-2 { + background-color: #81C784 !important; +} + +.green-text.text-lighten-2 { + color: #81C784 !important; +} + +.green.lighten-1 { + background-color: #66BB6A !important; +} + +.green-text.text-lighten-1 { + color: #66BB6A !important; +} + +.green.darken-1 { + background-color: #43A047 !important; +} + +.green-text.text-darken-1 { + color: #43A047 !important; +} + +.green.darken-2 { + background-color: #388E3C !important; +} + +.green-text.text-darken-2 { + color: #388E3C !important; +} + +.green.darken-3 { + background-color: #2E7D32 !important; +} + +.green-text.text-darken-3 { + color: #2E7D32 !important; +} + +.green.darken-4 { + background-color: #1B5E20 !important; +} + +.green-text.text-darken-4 { + color: #1B5E20 !important; +} + +.green.accent-1 { + background-color: #B9F6CA !important; +} + +.green-text.text-accent-1 { + color: #B9F6CA !important; +} + +.green.accent-2 { + background-color: #69F0AE !important; +} + +.green-text.text-accent-2 { + color: #69F0AE !important; +} + +.green.accent-3 { + background-color: #00E676 !important; +} + +.green-text.text-accent-3 { + color: #00E676 !important; +} + +.green.accent-4 { + background-color: #00C853 !important; +} + +.green-text.text-accent-4 { + color: #00C853 !important; +} + +.light-green { + background-color: #8bc34a !important; +} + +.light-green-text { + color: #8bc34a !important; +} + +.light-green.lighten-5 { + background-color: #f1f8e9 !important; +} + +.light-green-text.text-lighten-5 { + color: #f1f8e9 !important; +} + +.light-green.lighten-4 { + background-color: #dcedc8 !important; +} + +.light-green-text.text-lighten-4 { + color: #dcedc8 !important; +} + +.light-green.lighten-3 { + background-color: #c5e1a5 !important; +} + +.light-green-text.text-lighten-3 { + color: #c5e1a5 !important; +} + +.light-green.lighten-2 { + background-color: #aed581 !important; +} + +.light-green-text.text-lighten-2 { + color: #aed581 !important; +} + +.light-green.lighten-1 { + background-color: #9ccc65 !important; +} + +.light-green-text.text-lighten-1 { + color: #9ccc65 !important; +} + +.light-green.darken-1 { + background-color: #7cb342 !important; +} + +.light-green-text.text-darken-1 { + color: #7cb342 !important; +} + +.light-green.darken-2 { + background-color: #689f38 !important; +} + +.light-green-text.text-darken-2 { + color: #689f38 !important; +} + +.light-green.darken-3 { + background-color: #558b2f !important; +} + +.light-green-text.text-darken-3 { + color: #558b2f !important; +} + +.light-green.darken-4 { + background-color: #33691e !important; +} + +.light-green-text.text-darken-4 { + color: #33691e !important; +} + +.light-green.accent-1 { + background-color: #ccff90 !important; +} + +.light-green-text.text-accent-1 { + color: #ccff90 !important; +} + +.light-green.accent-2 { + background-color: #b2ff59 !important; +} + +.light-green-text.text-accent-2 { + color: #b2ff59 !important; +} + +.light-green.accent-3 { + background-color: #76ff03 !important; +} + +.light-green-text.text-accent-3 { + color: #76ff03 !important; +} + +.light-green.accent-4 { + background-color: #64dd17 !important; +} + +.light-green-text.text-accent-4 { + color: #64dd17 !important; +} + +.lime { + background-color: #cddc39 !important; +} + +.lime-text { + color: #cddc39 !important; +} + +.lime.lighten-5 { + background-color: #f9fbe7 !important; +} + +.lime-text.text-lighten-5 { + color: #f9fbe7 !important; +} + +.lime.lighten-4 { + background-color: #f0f4c3 !important; +} + +.lime-text.text-lighten-4 { + color: #f0f4c3 !important; +} + +.lime.lighten-3 { + background-color: #e6ee9c !important; +} + +.lime-text.text-lighten-3 { + color: #e6ee9c !important; +} + +.lime.lighten-2 { + background-color: #dce775 !important; +} + +.lime-text.text-lighten-2 { + color: #dce775 !important; +} + +.lime.lighten-1 { + background-color: #d4e157 !important; +} + +.lime-text.text-lighten-1 { + color: #d4e157 !important; +} + +.lime.darken-1 { + background-color: #c0ca33 !important; +} + +.lime-text.text-darken-1 { + color: #c0ca33 !important; +} + +.lime.darken-2 { + background-color: #afb42b !important; +} + +.lime-text.text-darken-2 { + color: #afb42b !important; +} + +.lime.darken-3 { + background-color: #9e9d24 !important; +} + +.lime-text.text-darken-3 { + color: #9e9d24 !important; +} + +.lime.darken-4 { + background-color: #827717 !important; +} + +.lime-text.text-darken-4 { + color: #827717 !important; +} + +.lime.accent-1 { + background-color: #f4ff81 !important; +} + +.lime-text.text-accent-1 { + color: #f4ff81 !important; +} + +.lime.accent-2 { + background-color: #eeff41 !important; +} + +.lime-text.text-accent-2 { + color: #eeff41 !important; +} + +.lime.accent-3 { + background-color: #c6ff00 !important; +} + +.lime-text.text-accent-3 { + color: #c6ff00 !important; +} + +.lime.accent-4 { + background-color: #aeea00 !important; +} + +.lime-text.text-accent-4 { + color: #aeea00 !important; +} + +.yellow { + background-color: #ffeb3b !important; +} + +.yellow-text { + color: #ffeb3b !important; +} + +.yellow.lighten-5 { + background-color: #fffde7 !important; +} + +.yellow-text.text-lighten-5 { + color: #fffde7 !important; +} + +.yellow.lighten-4 { + background-color: #fff9c4 !important; +} + +.yellow-text.text-lighten-4 { + color: #fff9c4 !important; +} + +.yellow.lighten-3 { + background-color: #fff59d !important; +} + +.yellow-text.text-lighten-3 { + color: #fff59d !important; +} + +.yellow.lighten-2 { + background-color: #fff176 !important; +} + +.yellow-text.text-lighten-2 { + color: #fff176 !important; +} + +.yellow.lighten-1 { + background-color: #ffee58 !important; +} + +.yellow-text.text-lighten-1 { + color: #ffee58 !important; +} + +.yellow.darken-1 { + background-color: #fdd835 !important; +} + +.yellow-text.text-darken-1 { + color: #fdd835 !important; +} + +.yellow.darken-2 { + background-color: #fbc02d !important; +} + +.yellow-text.text-darken-2 { + color: #fbc02d !important; +} + +.yellow.darken-3 { + background-color: #f9a825 !important; +} + +.yellow-text.text-darken-3 { + color: #f9a825 !important; +} + +.yellow.darken-4 { + background-color: #f57f17 !important; +} + +.yellow-text.text-darken-4 { + color: #f57f17 !important; +} + +.yellow.accent-1 { + background-color: #ffff8d !important; +} + +.yellow-text.text-accent-1 { + color: #ffff8d !important; +} + +.yellow.accent-2 { + background-color: #ffff00 !important; +} + +.yellow-text.text-accent-2 { + color: #ffff00 !important; +} + +.yellow.accent-3 { + background-color: #ffea00 !important; +} + +.yellow-text.text-accent-3 { + color: #ffea00 !important; +} + +.yellow.accent-4 { + background-color: #ffd600 !important; +} + +.yellow-text.text-accent-4 { + color: #ffd600 !important; +} + +.amber { + background-color: #ffc107 !important; +} + +.amber-text { + color: #ffc107 !important; +} + +.amber.lighten-5 { + background-color: #fff8e1 !important; +} + +.amber-text.text-lighten-5 { + color: #fff8e1 !important; +} + +.amber.lighten-4 { + background-color: #ffecb3 !important; +} + +.amber-text.text-lighten-4 { + color: #ffecb3 !important; +} + +.amber.lighten-3 { + background-color: #ffe082 !important; +} + +.amber-text.text-lighten-3 { + color: #ffe082 !important; +} + +.amber.lighten-2 { + background-color: #ffd54f !important; +} + +.amber-text.text-lighten-2 { + color: #ffd54f !important; +} + +.amber.lighten-1 { + background-color: #ffca28 !important; +} + +.amber-text.text-lighten-1 { + color: #ffca28 !important; +} + +.amber.darken-1 { + background-color: #ffb300 !important; +} + +.amber-text.text-darken-1 { + color: #ffb300 !important; +} + +.amber.darken-2 { + background-color: #ffa000 !important; +} + +.amber-text.text-darken-2 { + color: #ffa000 !important; +} + +.amber.darken-3 { + background-color: #ff8f00 !important; +} + +.amber-text.text-darken-3 { + color: #ff8f00 !important; +} + +.amber.darken-4 { + background-color: #ff6f00 !important; +} + +.amber-text.text-darken-4 { + color: #ff6f00 !important; +} + +.amber.accent-1 { + background-color: #ffe57f !important; +} + +.amber-text.text-accent-1 { + color: #ffe57f !important; +} + +.amber.accent-2 { + background-color: #ffd740 !important; +} + +.amber-text.text-accent-2 { + color: #ffd740 !important; +} + +.amber.accent-3 { + background-color: #ffc400 !important; +} + +.amber-text.text-accent-3 { + color: #ffc400 !important; +} + +.amber.accent-4 { + background-color: #ffab00 !important; +} + +.amber-text.text-accent-4 { + color: #ffab00 !important; +} + +.orange { + background-color: #ff9800 !important; +} + +.orange-text { + color: #ff9800 !important; +} + +.orange.lighten-5 { + background-color: #fff3e0 !important; +} + +.orange-text.text-lighten-5 { + color: #fff3e0 !important; +} + +.orange.lighten-4 { + background-color: #ffe0b2 !important; +} + +.orange-text.text-lighten-4 { + color: #ffe0b2 !important; +} + +.orange.lighten-3 { + background-color: #ffcc80 !important; +} + +.orange-text.text-lighten-3 { + color: #ffcc80 !important; +} + +.orange.lighten-2 { + background-color: #ffb74d !important; +} + +.orange-text.text-lighten-2 { + color: #ffb74d !important; +} + +.orange.lighten-1 { + background-color: #ffa726 !important; +} + +.orange-text.text-lighten-1 { + color: #ffa726 !important; +} + +.orange.darken-1 { + background-color: #fb8c00 !important; +} + +.orange-text.text-darken-1 { + color: #fb8c00 !important; +} + +.orange.darken-2 { + background-color: #f57c00 !important; +} + +.orange-text.text-darken-2 { + color: #f57c00 !important; +} + +.orange.darken-3 { + background-color: #ef6c00 !important; +} + +.orange-text.text-darken-3 { + color: #ef6c00 !important; +} + +.orange.darken-4 { + background-color: #e65100 !important; +} + +.orange-text.text-darken-4 { + color: #e65100 !important; +} + +.orange.accent-1 { + background-color: #ffd180 !important; +} + +.orange-text.text-accent-1 { + color: #ffd180 !important; +} + +.orange.accent-2 { + background-color: #ffab40 !important; +} + +.orange-text.text-accent-2 { + color: #ffab40 !important; +} + +.orange.accent-3 { + background-color: #ff9100 !important; +} + +.orange-text.text-accent-3 { + color: #ff9100 !important; +} + +.orange.accent-4 { + background-color: #ff6d00 !important; +} + +.orange-text.text-accent-4 { + color: #ff6d00 !important; +} + +.deep-orange { + background-color: #ff5722 !important; +} + +.deep-orange-text { + color: #ff5722 !important; +} + +.deep-orange.lighten-5 { + background-color: #fbe9e7 !important; +} + +.deep-orange-text.text-lighten-5 { + color: #fbe9e7 !important; +} + +.deep-orange.lighten-4 { + background-color: #ffccbc !important; +} + +.deep-orange-text.text-lighten-4 { + color: #ffccbc !important; +} + +.deep-orange.lighten-3 { + background-color: #ffab91 !important; +} + +.deep-orange-text.text-lighten-3 { + color: #ffab91 !important; +} + +.deep-orange.lighten-2 { + background-color: #ff8a65 !important; +} + +.deep-orange-text.text-lighten-2 { + color: #ff8a65 !important; +} + +.deep-orange.lighten-1 { + background-color: #ff7043 !important; +} + +.deep-orange-text.text-lighten-1 { + color: #ff7043 !important; +} + +.deep-orange.darken-1 { + background-color: #f4511e !important; +} + +.deep-orange-text.text-darken-1 { + color: #f4511e !important; +} + +.deep-orange.darken-2 { + background-color: #e64a19 !important; +} + +.deep-orange-text.text-darken-2 { + color: #e64a19 !important; +} + +.deep-orange.darken-3 { + background-color: #d84315 !important; +} + +.deep-orange-text.text-darken-3 { + color: #d84315 !important; +} + +.deep-orange.darken-4 { + background-color: #bf360c !important; +} + +.deep-orange-text.text-darken-4 { + color: #bf360c !important; +} + +.deep-orange.accent-1 { + background-color: #ff9e80 !important; +} + +.deep-orange-text.text-accent-1 { + color: #ff9e80 !important; +} + +.deep-orange.accent-2 { + background-color: #ff6e40 !important; +} + +.deep-orange-text.text-accent-2 { + color: #ff6e40 !important; +} + +.deep-orange.accent-3 { + background-color: #ff3d00 !important; +} + +.deep-orange-text.text-accent-3 { + color: #ff3d00 !important; +} + +.deep-orange.accent-4 { + background-color: #dd2c00 !important; +} + +.deep-orange-text.text-accent-4 { + color: #dd2c00 !important; +} + +.brown { + background-color: #795548 !important; +} + +.brown-text { + color: #795548 !important; +} + +.brown.lighten-5 { + background-color: #efebe9 !important; +} + +.brown-text.text-lighten-5 { + color: #efebe9 !important; +} + +.brown.lighten-4 { + background-color: #d7ccc8 !important; +} + +.brown-text.text-lighten-4 { + color: #d7ccc8 !important; +} + +.brown.lighten-3 { + background-color: #bcaaa4 !important; +} + +.brown-text.text-lighten-3 { + color: #bcaaa4 !important; +} + +.brown.lighten-2 { + background-color: #a1887f !important; +} + +.brown-text.text-lighten-2 { + color: #a1887f !important; +} + +.brown.lighten-1 { + background-color: #8d6e63 !important; +} + +.brown-text.text-lighten-1 { + color: #8d6e63 !important; +} + +.brown.darken-1 { + background-color: #6d4c41 !important; +} + +.brown-text.text-darken-1 { + color: #6d4c41 !important; +} + +.brown.darken-2 { + background-color: #5d4037 !important; +} + +.brown-text.text-darken-2 { + color: #5d4037 !important; +} + +.brown.darken-3 { + background-color: #4e342e !important; +} + +.brown-text.text-darken-3 { + color: #4e342e !important; +} + +.brown.darken-4 { + background-color: #3e2723 !important; +} + +.brown-text.text-darken-4 { + color: #3e2723 !important; +} + +.blue-grey { + background-color: #607d8b !important; +} + +.blue-grey-text { + color: #607d8b !important; +} + +.blue-grey.lighten-5 { + background-color: #eceff1 !important; +} + +.blue-grey-text.text-lighten-5 { + color: #eceff1 !important; +} + +.blue-grey.lighten-4 { + background-color: #cfd8dc !important; +} + +.blue-grey-text.text-lighten-4 { + color: #cfd8dc !important; +} + +.blue-grey.lighten-3 { + background-color: #b0bec5 !important; +} + +.blue-grey-text.text-lighten-3 { + color: #b0bec5 !important; +} + +.blue-grey.lighten-2 { + background-color: #90a4ae !important; +} + +.blue-grey-text.text-lighten-2 { + color: #90a4ae !important; +} + +.blue-grey.lighten-1 { + background-color: #78909c !important; +} + +.blue-grey-text.text-lighten-1 { + color: #78909c !important; +} + +.blue-grey.darken-1 { + background-color: #546e7a !important; +} + +.blue-grey-text.text-darken-1 { + color: #546e7a !important; +} + +.blue-grey.darken-2 { + background-color: #455a64 !important; +} + +.blue-grey-text.text-darken-2 { + color: #455a64 !important; +} + +.blue-grey.darken-3 { + background-color: #37474f !important; +} + +.blue-grey-text.text-darken-3 { + color: #37474f !important; +} + +.blue-grey.darken-4 { + background-color: #263238 !important; +} + +.blue-grey-text.text-darken-4 { + color: #263238 !important; +} + +.grey { + background-color: #9e9e9e !important; +} + +.grey-text { + color: #9e9e9e !important; +} + +.grey.lighten-5 { + background-color: #fafafa !important; +} + +.grey-text.text-lighten-5 { + color: #fafafa !important; +} + +.grey.lighten-4 { + background-color: #f5f5f5 !important; +} + +.grey-text.text-lighten-4 { + color: #f5f5f5 !important; +} + +.grey.lighten-3 { + background-color: #eeeeee !important; +} + +.grey-text.text-lighten-3 { + color: #eeeeee !important; +} + +.grey.lighten-2 { + background-color: #e0e0e0 !important; +} + +.grey-text.text-lighten-2 { + color: #e0e0e0 !important; +} + +.grey.lighten-1 { + background-color: #bdbdbd !important; +} + +.grey-text.text-lighten-1 { + color: #bdbdbd !important; +} + +.grey.darken-1 { + background-color: #757575 !important; +} + +.grey-text.text-darken-1 { + color: #757575 !important; +} + +.grey.darken-2 { + background-color: #616161 !important; +} + +.grey-text.text-darken-2 { + color: #616161 !important; +} + +.grey.darken-3 { + background-color: #424242 !important; +} + +.grey-text.text-darken-3 { + color: #424242 !important; +} + +.grey.darken-4 { + background-color: #212121 !important; +} + +.grey-text.text-darken-4 { + color: #212121 !important; +} + +.black { + background-color: #000000 !important; +} + +.black-text { + color: #000000 !important; +} + +.white { + background-color: #FFFFFF !important; +} + +.white-text { + color: #FFFFFF !important; +} + +.transparent { + background-color: transparent !important; +} + +.transparent-text { + color: transparent !important; +} + +/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */ +/** + * 1. Set default font family to sans-serif. + * 2. Prevent iOS and IE text size adjust after device orientation change, + * without disabling user zoom. + */ +html { + font-family: sans-serif; + /* 1 */ + -ms-text-size-adjust: 100%; + /* 2 */ + -webkit-text-size-adjust: 100%; + /* 2 */ +} + +/** + * Remove default margin. + */ +body { + margin: 0; +} + +/* HTML5 display definitions + ========================================================================== */ +/** + * Correct `block` display not defined for any HTML5 element in IE 8/9. + * Correct `block` display not defined for `details` or `summary` in IE 10/11 + * and Firefox. + * Correct `block` display not defined for `main` in IE 11. + */ +article, +aside, +details, +figcaption, +figure, +footer, +header, +hgroup, +main, +menu, +nav, +section, +summary { + display: block; +} + +/** + * 1. Correct `inline-block` display not defined in IE 8/9. + * 2. Normalize vertical alignment of `progress` in Chrome, Firefox, and Opera. + */ +audio, +canvas, +progress, +video { + display: inline-block; + /* 1 */ + vertical-align: baseline; + /* 2 */ +} + +/** + * Prevent modern browsers from displaying `audio` without controls. + * Remove excess height in iOS 5 devices. + */ +audio:not([controls]) { + display: none; + height: 0; +} + +/** + * Address `[hidden]` styling not present in IE 8/9/10. + * Hide the `template` element in IE 8/9/10/11, Safari, and Firefox < 22. + */ +[hidden], +template { + display: none; +} + +/* Links + ========================================================================== */ +/** + * Remove the gray background color from active links in IE 10. + */ +a { + background-color: transparent; +} + +/** + * Improve readability of focused elements when they are also in an + * active/hover state. + */ +a:active, +a:hover { + outline: 0; +} + +/* Text-level semantics + ========================================================================== */ +/** + * Address styling not present in IE 8/9/10/11, Safari, and Chrome. + */ +abbr[title] { + border-bottom: 1px dotted; +} + +/** + * Address style set to `bolder` in Firefox 4+, Safari, and Chrome. + */ +b, +strong { + font-weight: bold; +} + +/** + * Address styling not present in Safari and Chrome. + */ +dfn { + font-style: italic; +} + +/** + * Address variable `h1` font-size and margin within `section` and `article` + * contexts in Firefox 4+, Safari, and Chrome. + */ +h1 { + font-size: 2em; + margin: 0.67em 0; +} + +/** + * Address styling not present in IE 8/9. + */ +mark { + background: #ff0; + color: #000; +} + +/** + * Address inconsistent and variable font size in all browsers. + */ +small { + font-size: 80%; +} + +/** + * Prevent `sub` and `sup` affecting `line-height` in all browsers. + */ +sub, +sup { + font-size: 75%; + line-height: 0; + position: relative; + vertical-align: baseline; +} + +sup { + top: -0.5em; +} + +sub { + bottom: -0.25em; +} + +/* Embedded content + ========================================================================== */ +/** + * Remove border when inside `a` element in IE 8/9/10. + */ +img { + border: 0; +} + +/** + * Correct overflow not hidden in IE 9/10/11. + */ +svg:not(:root) { + overflow: hidden; +} + +/* Grouping content + ========================================================================== */ +/** + * Address margin not present in IE 8/9 and Safari. + */ +figure { + margin: 1em 40px; +} + +/** + * Address differences between Firefox and other browsers. + */ +hr { + box-sizing: content-box; + height: 0; +} + +/** + * Contain overflow in all browsers. + */ +pre { + overflow: auto; +} + +/** + * Address odd `em`-unit font size rendering in all browsers. + */ +code, +kbd, +pre, +samp { + font-family: monospace, monospace; + font-size: 1em; +} + +/* Forms + ========================================================================== */ +/** + * Known limitation: by default, Chrome and Safari on OS X allow very limited + * styling of `select`, unless a `border` property is set. + */ +/** + * 1. Correct color not being inherited. + * Known issue: affects color of disabled elements. + * 2. Correct font properties not being inherited. + * 3. Address margins set differently in Firefox 4+, Safari, and Chrome. + */ +button, +input, +optgroup, +select, +textarea { + color: inherit; + /* 1 */ + font: inherit; + /* 2 */ + margin: 0; + /* 3 */ +} + +/** + * Address `overflow` set to `hidden` in IE 8/9/10/11. + */ +button { + overflow: visible; +} + +/** + * Address inconsistent `text-transform` inheritance for `button` and `select`. + * All other form control elements do not inherit `text-transform` values. + * Correct `button` style inheritance in Firefox, IE 8/9/10/11, and Opera. + * Correct `select` style inheritance in Firefox. + */ +button, +select { + text-transform: none; +} + +/** + * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio` + * and `video` controls. + * 2. Correct inability to style clickable `input` types in iOS. + * 3. Improve usability and consistency of cursor style between image-type + * `input` and others. + */ +button, +html input[type="button"], +input[type="reset"], +input[type="submit"] { + -webkit-appearance: button; + /* 2 */ + cursor: pointer; + /* 3 */ +} + +/** + * Re-set default cursor for disabled elements. + */ +button[disabled], +html input[disabled] { + cursor: default; +} + +/** + * Remove inner padding and border in Firefox 4+. + */ +button::-moz-focus-inner, +input::-moz-focus-inner { + border: 0; + padding: 0; +} + +/** + * Address Firefox 4+ setting `line-height` on `input` using `!important` in + * the UA stylesheet. + */ +input { + line-height: normal; +} + +/** + * It's recommended that you don't attempt to style these elements. + * Firefox's implementation doesn't respect box-sizing, padding, or width. + * + * 1. Address box sizing set to `content-box` in IE 8/9/10. + * 2. Remove excess padding in IE 8/9/10. + */ +input[type="checkbox"], +input[type="radio"] { + box-sizing: border-box; + /* 1 */ + padding: 0; + /* 2 */ +} + +/** + * Fix the cursor style for Chrome's increment/decrement buttons. For certain + * `font-size` values of the `input`, it causes the cursor style of the + * decrement button to change from `default` to `text`. + */ +input[type="number"]::-webkit-inner-spin-button, +input[type="number"]::-webkit-outer-spin-button { + height: auto; +} + +/** + * 1. Address `appearance` set to `searchfield` in Safari and Chrome. + * 2. Address `box-sizing` set to `border-box` in Safari and Chrome. + */ +input[type="search"] { + -webkit-appearance: textfield; + /* 1 */ + box-sizing: content-box; + /* 2 */ +} + +/** + * Remove inner padding and search cancel button in Safari and Chrome on OS X. + * Safari (but not Chrome) clips the cancel button when the search input has + * padding (and `textfield` appearance). + */ +input[type="search"]::-webkit-search-cancel-button, +input[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} + +/** + * Define consistent border, margin, and padding. + */ +fieldset { + border: 1px solid #c0c0c0; + margin: 0 2px; + padding: 0.35em 0.625em 0.75em; +} + +/** + * 1. Correct `color` not being inherited in IE 8/9/10/11. + * 2. Remove padding so people aren't caught out if they zero out fieldsets. + */ +legend { + border: 0; + /* 1 */ + padding: 0; + /* 2 */ +} + +/** + * Remove default vertical scrollbar in IE 8/9/10/11. + */ +textarea { + overflow: auto; +} + +/** + * Don't inherit the `font-weight` (applied by a rule above). + * NOTE: the default cannot safely be changed in Chrome and Safari on OS X. + */ +optgroup { + font-weight: bold; +} + +/* Tables + ========================================================================== */ +/** + * Remove most spacing between table cells. + */ +table { + border-collapse: collapse; + border-spacing: 0; +} + +td, +th { + padding: 0; +} + +html { + box-sizing: border-box; +} + +*, *:before, *:after { + box-sizing: inherit; +} + +ul:not(.browser-default) { + padding-left: 0; + list-style-type: none; +} + +ul:not(.browser-default) li { + list-style-type: none; +} + +a { + color: #039be5; + text-decoration: none; + -webkit-tap-highlight-color: transparent; +} + +.valign-wrapper { + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-align-items: center; + -ms-flex-align: center; + align-items: center; +} + +.valign-wrapper .valign { + display: block; +} + +.clearfix { + clear: both; +} + +.z-depth-0 { + box-shadow: none !important; +} + +.z-depth-1, nav, .card-panel, .card, .toast, .btn, .btn-large, .btn-floating, .dropdown-content, .collapsible, .side-nav { + box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2); +} + +.z-depth-1-half, .btn:hover, .btn-large:hover, .btn-floating:hover { + box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2); +} + +.z-depth-2 { + box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3); +} + +.z-depth-3 { + box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3); +} + +.z-depth-4, .modal { + box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3); +} + +.z-depth-5 { + box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3); +} + +.hoverable { + transition: box-shadow .25s; + box-shadow: 0; +} + +.hoverable:hover { + transition: box-shadow .25s; + box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19); +} + +.divider { + height: 1px; + overflow: hidden; + background-color: #e0e0e0; +} + +blockquote { + margin: 20px 0; + padding-left: 1.5rem; + border-left: 5px solid #ee6e73; +} + +i { + line-height: inherit; +} + +i.left { + float: left; + margin-right: 15px; +} + +i.right { + float: right; + margin-left: 15px; +} + +i.tiny { + font-size: 1rem; +} + +i.small { + font-size: 2rem; +} + +i.medium { + font-size: 4rem; +} + +i.large { + font-size: 6rem; +} + +img.responsive-img, +video.responsive-video { + max-width: 100%; + height: auto; +} + +.pagination li { + display: inline-block; + border-radius: 2px; + text-align: center; + vertical-align: top; + height: 30px; +} + +.pagination li a { + color: #444; + display: inline-block; + font-size: 1.2rem; + padding: 0 10px; + line-height: 30px; +} + +.pagination li.active a { + color: #fff; +} + +.pagination li.active { + background-color: #ee6e73; +} + +.pagination li.disabled a { + cursor: default; + color: #999; +} + +.pagination li i { + font-size: 2rem; +} + +.pagination li.pages ul li { + display: inline-block; + float: none; +} + +@media only screen and (max-width: 992px) { + .pagination { + width: 100%; + } + .pagination li.prev, + .pagination li.next { + width: 10%; + } + .pagination li.pages { + width: 80%; + overflow: hidden; + white-space: nowrap; + } +} + +.breadcrumb { + font-size: 18px; + color: rgba(255, 255, 255, 0.7); +} + +.breadcrumb i, +.breadcrumb [class^="mdi-"], .breadcrumb [class*="mdi-"], +.breadcrumb i.material-icons { + display: inline-block; + float: left; + font-size: 24px; +} + +.breadcrumb:before { + content: '\E5CC'; + color: rgba(255, 255, 255, 0.7); + vertical-align: top; + display: inline-block; + font-family: 'Material Icons'; + font-weight: normal; + font-style: normal; + font-size: 25px; + margin: 0 10px 0 8px; + -webkit-font-smoothing: antialiased; +} + +.breadcrumb:first-child:before { + display: none; +} + +.breadcrumb:last-child { + color: #fff; +} + +.parallax-container { + position: relative; + overflow: hidden; + height: 500px; +} + +.parallax { + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; + z-index: -1; +} + +.parallax img { + display: none; + position: absolute; + left: 50%; + bottom: 0; + min-width: 100%; + min-height: 100%; + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + -webkit-transform: translateX(-50%); + transform: translateX(-50%); +} + +.pin-top, .pin-bottom { + position: relative; +} + +.pinned { + position: fixed !important; +} + +/********************* + Transition Classes +**********************/ +ul.staggered-list li { + opacity: 0; +} + +.fade-in { + opacity: 0; + -webkit-transform-origin: 0 50%; + transform-origin: 0 50%; +} + +/********************* + Media Query Classes +**********************/ +@media only screen and (max-width: 600px) { + .hide-on-small-only, .hide-on-small-and-down { + display: none !important; + } +} + +@media only screen and (max-width: 992px) { + .hide-on-med-and-down { + display: none !important; + } +} + +@media only screen and (min-width: 601px) { + .hide-on-med-and-up { + display: none !important; + } +} + +@media only screen and (min-width: 600px) and (max-width: 992px) { + .hide-on-med-only { + display: none !important; + } +} + +@media only screen and (min-width: 993px) { + .hide-on-large-only { + display: none !important; + } +} + +@media only screen and (min-width: 993px) { + .show-on-large { + display: block !important; + } +} + +@media only screen and (min-width: 600px) and (max-width: 992px) { + .show-on-medium { + display: block !important; + } +} + +@media only screen and (max-width: 600px) { + .show-on-small { + display: block !important; + } +} + +@media only screen and (min-width: 601px) { + .show-on-medium-and-up { + display: block !important; + } +} + +@media only screen and (max-width: 992px) { + .show-on-medium-and-down { + display: block !important; + } +} + +@media only screen and (max-width: 600px) { + .center-on-small-only { + text-align: center; + } +} + +footer.page-footer { + margin-top: 20px; + padding-top: 20px; + background-color: #ee6e73; +} + +footer.page-footer .footer-copyright { + overflow: hidden; + height: 50px; + line-height: 50px; + color: rgba(255, 255, 255, 0.8); + background-color: rgba(51, 51, 51, 0.08); +} + +table, th, td { + border: none; +} + +table { + width: 100%; + display: table; +} + +table.bordered > thead > tr, +table.bordered > tbody > tr { + border-bottom: 1px solid #d0d0d0; +} + +table.striped > tbody > tr:nth-child(odd) { + background-color: #f2f2f2; +} + +table.striped > tbody > tr > td { + border-radius: 0; +} + +table.highlight > tbody > tr { + transition: background-color .25s ease; +} + +table.highlight > tbody > tr:hover { + background-color: #f2f2f2; +} + +table.centered thead tr th, table.centered tbody tr td { + text-align: center; +} + +thead { + border-bottom: 1px solid #d0d0d0; +} + +td, th { + padding: 15px 5px; + display: table-cell; + text-align: left; + vertical-align: middle; + border-radius: 2px; +} + +@media only screen and (max-width: 992px) { + table.responsive-table { + width: 100%; + border-collapse: collapse; + border-spacing: 0; + display: block; + position: relative; + /* sort out borders */ + } + table.responsive-table td:empty:before { + content: '\00a0'; + } + table.responsive-table th, + table.responsive-table td { + margin: 0; + vertical-align: top; + } + table.responsive-table th { + text-align: left; + } + table.responsive-table thead { + display: block; + float: left; + } + table.responsive-table thead tr { + display: block; + padding: 0 10px 0 0; + } + table.responsive-table thead tr th::before { + content: "\00a0"; + } + table.responsive-table tbody { + display: block; + width: auto; + position: relative; + overflow-x: auto; + white-space: nowrap; + } + table.responsive-table tbody tr { + display: inline-block; + vertical-align: top; + } + table.responsive-table th { + display: block; + text-align: right; + } + table.responsive-table td { + display: block; + min-height: 1.25em; + text-align: left; + } + table.responsive-table tr { + padding: 0 10px; + } + table.responsive-table thead { + border: 0; + border-right: 1px solid #d0d0d0; + } + table.responsive-table.bordered th { + border-bottom: 0; + border-left: 0; + } + table.responsive-table.bordered td { + border-left: 0; + border-right: 0; + border-bottom: 0; + } + table.responsive-table.bordered tr { + border: 0; + } + table.responsive-table.bordered tbody tr { + border-right: 1px solid #d0d0d0; + } +} + +.collection { + margin: 0.5rem 0 1rem 0; + border: 1px solid #e0e0e0; + border-radius: 2px; + overflow: hidden; + position: relative; +} + +.collection .collection-item { + background-color: #fff; + line-height: 1.5rem; + padding: 10px 20px; + margin: 0; + border-bottom: 1px solid #e0e0e0; +} + +.collection .collection-item.avatar { + min-height: 84px; + padding-left: 72px; + position: relative; +} + +.collection .collection-item.avatar .circle { + position: absolute; + width: 42px; + height: 42px; + overflow: hidden; + left: 15px; + display: inline-block; + vertical-align: middle; +} + +.collection .collection-item.avatar i.circle { + font-size: 18px; + line-height: 42px; + color: #fff; + background-color: #999; + text-align: center; +} + +.collection .collection-item.avatar .title { + font-size: 16px; +} + +.collection .collection-item.avatar p { + margin: 0; +} + +.collection .collection-item.avatar .secondary-content { + position: absolute; + top: 16px; + right: 16px; +} + +.collection .collection-item:last-child { + border-bottom: none; +} + +.collection .collection-item.active { + background-color: #26a69a; + color: #eafaf9; +} + +.collection .collection-item.active .secondary-content { + color: #fff; +} + +.collection a.collection-item { + display: block; + transition: .25s; + color: #26a69a; +} + +.collection a.collection-item:not(.active):hover { + background-color: #ddd; +} + +.collection.with-header .collection-header { + background-color: #fff; + border-bottom: 1px solid #e0e0e0; + padding: 10px 20px; +} + +.collection.with-header .collection-item { + padding-left: 30px; +} + +.collection.with-header .collection-item.avatar { + padding-left: 72px; +} + +.secondary-content { + float: right; + color: #26a69a; +} + +.collapsible .collection { + margin: 0; + border: none; +} + +span.badge { + min-width: 3rem; + padding: 0 6px; + margin-left: 14px; + text-align: center; + font-size: 1rem; + line-height: inherit; + color: #757575; + float: right; + box-sizing: border-box; +} + +span.badge.new { + font-weight: 300; + font-size: 0.8rem; + color: #fff; + background-color: #26a69a; + border-radius: 2px; +} + +span.badge.new:after { + content: " new"; +} + +span.badge[data-badge-caption]::after { + content: " " attr(data-badge-caption); +} + +nav ul a span.badge { + display: inline-block; + float: none; + margin-left: 4px; + line-height: 22px; + height: 22px; +} + +.side-nav span.badge.new, +.collapsible span.badge.new { + position: relative; + background-color: transparent; +} + +.side-nav span.badge.new::before, +.collapsible span.badge.new::before { + content: ''; + position: absolute; + top: 10px; + right: 0; + bottom: 10px; + left: 0; + background-color: #26a69a; + border-radius: 2px; + z-index: -1; +} + +.collapsible span.badge.new { + z-index: 1; +} + +.video-container { + position: relative; + padding-bottom: 56.25%; + height: 0; + overflow: hidden; +} + +.video-container iframe, .video-container object, .video-container embed { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 100%; +} + +.progress { + position: relative; + height: 4px; + display: block; + width: 100%; + background-color: #acece6; + border-radius: 2px; + margin: 0.5rem 0 1rem 0; + overflow: hidden; +} + +.progress .determinate { + position: absolute; + top: 0; + left: 0; + bottom: 0; + background-color: #26a69a; + transition: width .3s linear; +} + +.progress .indeterminate { + background-color: #26a69a; +} + +.progress .indeterminate:before { + content: ''; + position: absolute; + background-color: inherit; + top: 0; + left: 0; + bottom: 0; + will-change: left, right; + -webkit-animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; + animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; +} + +.progress .indeterminate:after { + content: ''; + position: absolute; + background-color: inherit; + top: 0; + left: 0; + bottom: 0; + will-change: left, right; + -webkit-animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + -webkit-animation-delay: 1.15s; + animation-delay: 1.15s; +} + +@-webkit-keyframes indeterminate { + 0% { + left: -35%; + right: 100%; + } + 60% { + left: 100%; + right: -90%; + } + 100% { + left: 100%; + right: -90%; + } +} + +@keyframes indeterminate { + 0% { + left: -35%; + right: 100%; + } + 60% { + left: 100%; + right: -90%; + } + 100% { + left: 100%; + right: -90%; + } +} + +@-webkit-keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 60% { + left: 107%; + right: -8%; + } + 100% { + left: 107%; + right: -8%; + } +} + +@keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 60% { + left: 107%; + right: -8%; + } + 100% { + left: 107%; + right: -8%; + } +} + +/******************* + Utility Classes +*******************/ +.hide { + display: none !important; +} + +.left-align { + text-align: left; +} + +.right-align { + text-align: right; +} + +.center, .center-align { + text-align: center; +} + +.left { + float: left !important; +} + +.right { + float: right !important; +} + +.no-select, input[type=range], +input[type=range] + .thumb { + -webkit-touch-callout: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.circle { + border-radius: 50%; +} + +.center-block { + display: block; + margin-left: auto; + margin-right: auto; +} + +.truncate { + display: block; + white-space: nowrap; + overflow: hidden; + text-overflow: ellipsis; +} + +.no-padding { + padding: 0 !important; +} + +/* This is needed for some mobile phones to display the Google Icon font properly */ +.material-icons { + text-rendering: optimizeLegibility; + -webkit-font-feature-settings: 'liga'; + -moz-font-feature-settings: 'liga'; + font-feature-settings: 'liga'; +} + +.container { + margin: 0 auto; + max-width: 1280px; + width: 90%; +} + +@media only screen and (min-width: 601px) { + .container { + width: 85%; + } +} + +@media only screen and (min-width: 993px) { + .container { + width: 70%; + } +} + +.container .row { + margin-left: -0.75rem; + margin-right: -0.75rem; +} + +.section { + padding-top: 1rem; + padding-bottom: 1rem; +} + +.section.no-pad { + padding: 0; +} + +.section.no-pad-bot { + padding-bottom: 0; +} + +.section.no-pad-top { + padding-top: 0; +} + +.row { + margin-left: auto; + margin-right: auto; + margin-bottom: 20px; +} + +.row:after { + content: ""; + display: table; + clear: both; +} + +.row .col { + float: left; + box-sizing: border-box; + padding: 0 0.75rem; + min-height: 1px; +} + +.row .col[class*="push-"], .row .col[class*="pull-"] { + position: relative; +} + +.row .col.s1 { + width: 8.3333333333%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s2 { + width: 16.6666666667%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s3 { + width: 25%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s4 { + width: 33.3333333333%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s5 { + width: 41.6666666667%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s6 { + width: 50%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s7 { + width: 58.3333333333%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s8 { + width: 66.6666666667%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s9 { + width: 75%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s10 { + width: 83.3333333333%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s11 { + width: 91.6666666667%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.s12 { + width: 100%; + margin-left: auto; + left: auto; + right: auto; +} + +.row .col.offset-s1 { + margin-left: 8.3333333333%; +} + +.row .col.pull-s1 { + right: 8.3333333333%; +} + +.row .col.push-s1 { + left: 8.3333333333%; +} + +.row .col.offset-s2 { + margin-left: 16.6666666667%; +} + +.row .col.pull-s2 { + right: 16.6666666667%; +} + +.row .col.push-s2 { + left: 16.6666666667%; +} + +.row .col.offset-s3 { + margin-left: 25%; +} + +.row .col.pull-s3 { + right: 25%; +} + +.row .col.push-s3 { + left: 25%; +} + +.row .col.offset-s4 { + margin-left: 33.3333333333%; +} + +.row .col.pull-s4 { + right: 33.3333333333%; +} + +.row .col.push-s4 { + left: 33.3333333333%; +} + +.row .col.offset-s5 { + margin-left: 41.6666666667%; +} + +.row .col.pull-s5 { + right: 41.6666666667%; +} + +.row .col.push-s5 { + left: 41.6666666667%; +} + +.row .col.offset-s6 { + margin-left: 50%; +} + +.row .col.pull-s6 { + right: 50%; +} + +.row .col.push-s6 { + left: 50%; +} + +.row .col.offset-s7 { + margin-left: 58.3333333333%; +} + +.row .col.pull-s7 { + right: 58.3333333333%; +} + +.row .col.push-s7 { + left: 58.3333333333%; +} + +.row .col.offset-s8 { + margin-left: 66.6666666667%; +} + +.row .col.pull-s8 { + right: 66.6666666667%; +} + +.row .col.push-s8 { + left: 66.6666666667%; +} + +.row .col.offset-s9 { + margin-left: 75%; +} + +.row .col.pull-s9 { + right: 75%; +} + +.row .col.push-s9 { + left: 75%; +} + +.row .col.offset-s10 { + margin-left: 83.3333333333%; +} + +.row .col.pull-s10 { + right: 83.3333333333%; +} + +.row .col.push-s10 { + left: 83.3333333333%; +} + +.row .col.offset-s11 { + margin-left: 91.6666666667%; +} + +.row .col.pull-s11 { + right: 91.6666666667%; +} + +.row .col.push-s11 { + left: 91.6666666667%; +} + +.row .col.offset-s12 { + margin-left: 100%; +} + +.row .col.pull-s12 { + right: 100%; +} + +.row .col.push-s12 { + left: 100%; +} + +@media only screen and (min-width: 601px) { + .row .col.m1 { + width: 8.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m2 { + width: 16.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m3 { + width: 25%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m4 { + width: 33.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m5 { + width: 41.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m6 { + width: 50%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m7 { + width: 58.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m8 { + width: 66.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m9 { + width: 75%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m10 { + width: 83.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m11 { + width: 91.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.m12 { + width: 100%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.offset-m1 { + margin-left: 8.3333333333%; + } + .row .col.pull-m1 { + right: 8.3333333333%; + } + .row .col.push-m1 { + left: 8.3333333333%; + } + .row .col.offset-m2 { + margin-left: 16.6666666667%; + } + .row .col.pull-m2 { + right: 16.6666666667%; + } + .row .col.push-m2 { + left: 16.6666666667%; + } + .row .col.offset-m3 { + margin-left: 25%; + } + .row .col.pull-m3 { + right: 25%; + } + .row .col.push-m3 { + left: 25%; + } + .row .col.offset-m4 { + margin-left: 33.3333333333%; + } + .row .col.pull-m4 { + right: 33.3333333333%; + } + .row .col.push-m4 { + left: 33.3333333333%; + } + .row .col.offset-m5 { + margin-left: 41.6666666667%; + } + .row .col.pull-m5 { + right: 41.6666666667%; + } + .row .col.push-m5 { + left: 41.6666666667%; + } + .row .col.offset-m6 { + margin-left: 50%; + } + .row .col.pull-m6 { + right: 50%; + } + .row .col.push-m6 { + left: 50%; + } + .row .col.offset-m7 { + margin-left: 58.3333333333%; + } + .row .col.pull-m7 { + right: 58.3333333333%; + } + .row .col.push-m7 { + left: 58.3333333333%; + } + .row .col.offset-m8 { + margin-left: 66.6666666667%; + } + .row .col.pull-m8 { + right: 66.6666666667%; + } + .row .col.push-m8 { + left: 66.6666666667%; + } + .row .col.offset-m9 { + margin-left: 75%; + } + .row .col.pull-m9 { + right: 75%; + } + .row .col.push-m9 { + left: 75%; + } + .row .col.offset-m10 { + margin-left: 83.3333333333%; + } + .row .col.pull-m10 { + right: 83.3333333333%; + } + .row .col.push-m10 { + left: 83.3333333333%; + } + .row .col.offset-m11 { + margin-left: 91.6666666667%; + } + .row .col.pull-m11 { + right: 91.6666666667%; + } + .row .col.push-m11 { + left: 91.6666666667%; + } + .row .col.offset-m12 { + margin-left: 100%; + } + .row .col.pull-m12 { + right: 100%; + } + .row .col.push-m12 { + left: 100%; + } +} + +@media only screen and (min-width: 993px) { + .row .col.l1 { + width: 8.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l2 { + width: 16.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l3 { + width: 25%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l4 { + width: 33.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l5 { + width: 41.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l6 { + width: 50%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l7 { + width: 58.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l8 { + width: 66.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l9 { + width: 75%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l10 { + width: 83.3333333333%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l11 { + width: 91.6666666667%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.l12 { + width: 100%; + margin-left: auto; + left: auto; + right: auto; + } + .row .col.offset-l1 { + margin-left: 8.3333333333%; + } + .row .col.pull-l1 { + right: 8.3333333333%; + } + .row .col.push-l1 { + left: 8.3333333333%; + } + .row .col.offset-l2 { + margin-left: 16.6666666667%; + } + .row .col.pull-l2 { + right: 16.6666666667%; + } + .row .col.push-l2 { + left: 16.6666666667%; + } + .row .col.offset-l3 { + margin-left: 25%; + } + .row .col.pull-l3 { + right: 25%; + } + .row .col.push-l3 { + left: 25%; + } + .row .col.offset-l4 { + margin-left: 33.3333333333%; + } + .row .col.pull-l4 { + right: 33.3333333333%; + } + .row .col.push-l4 { + left: 33.3333333333%; + } + .row .col.offset-l5 { + margin-left: 41.6666666667%; + } + .row .col.pull-l5 { + right: 41.6666666667%; + } + .row .col.push-l5 { + left: 41.6666666667%; + } + .row .col.offset-l6 { + margin-left: 50%; + } + .row .col.pull-l6 { + right: 50%; + } + .row .col.push-l6 { + left: 50%; + } + .row .col.offset-l7 { + margin-left: 58.3333333333%; + } + .row .col.pull-l7 { + right: 58.3333333333%; + } + .row .col.push-l7 { + left: 58.3333333333%; + } + .row .col.offset-l8 { + margin-left: 66.6666666667%; + } + .row .col.pull-l8 { + right: 66.6666666667%; + } + .row .col.push-l8 { + left: 66.6666666667%; + } + .row .col.offset-l9 { + margin-left: 75%; + } + .row .col.pull-l9 { + right: 75%; + } + .row .col.push-l9 { + left: 75%; + } + .row .col.offset-l10 { + margin-left: 83.3333333333%; + } + .row .col.pull-l10 { + right: 83.3333333333%; + } + .row .col.push-l10 { + left: 83.3333333333%; + } + .row .col.offset-l11 { + margin-left: 91.6666666667%; + } + .row .col.pull-l11 { + right: 91.6666666667%; + } + .row .col.push-l11 { + left: 91.6666666667%; + } + .row .col.offset-l12 { + margin-left: 100%; + } + .row .col.pull-l12 { + right: 100%; + } + .row .col.push-l12 { + left: 100%; + } +} + +nav { + color: #fff; + background-color: #ee6e73; + width: 100%; + height: 56px; + line-height: 56px; +} + +nav.nav-extended { + height: auto; +} + +nav.nav-extended .nav-wrapper { + height: auto; +} + +nav a { + color: #fff; +} + +nav i, +nav [class^="mdi-"], nav [class*="mdi-"], +nav i.material-icons { + display: block; + font-size: 24px; + height: 56px; + line-height: 56px; +} + +nav .nav-wrapper { + position: relative; + height: 100%; +} + +@media only screen and (min-width: 993px) { + nav a.button-collapse { + display: none; + } +} + +nav .button-collapse { + float: left; + position: relative; + z-index: 1; + height: 56px; + margin: 0 18px; +} + +nav .button-collapse i { + height: 56px; + line-height: 56px; +} + +nav .brand-logo { + position: absolute; + color: #fff; + display: inline-block; + font-size: 2.1rem; + padding: 0; + white-space: nowrap; +} + +nav .brand-logo.center { + left: 50%; + -webkit-transform: translateX(-50%); + transform: translateX(-50%); +} + +@media only screen and (max-width: 992px) { + nav .brand-logo { + left: 50%; + -webkit-transform: translateX(-50%); + transform: translateX(-50%); + } + nav .brand-logo.left, nav .brand-logo.right { + padding: 0; + -webkit-transform: none; + transform: none; + } + nav .brand-logo.left { + left: 0.5rem; + } + nav .brand-logo.right { + right: 0.5rem; + left: auto; + } +} + +nav .brand-logo.right { + right: 0.5rem; + padding: 0; +} + +nav .brand-logo i, +nav .brand-logo [class^="mdi-"], nav .brand-logo [class*="mdi-"], +nav .brand-logo i.material-icons { + float: left; + margin-right: 15px; +} + +nav ul { + margin: 0; +} + +nav ul li { + transition: background-color .3s; + float: left; + padding: 0; +} + +nav ul li.active { + background-color: rgba(0, 0, 0, 0.1); +} + +nav ul a { + transition: background-color .3s; + font-size: 1rem; + color: #fff; + display: block; + padding: 0 15px; + cursor: pointer; +} + +nav ul a.btn, nav ul a.btn-large, nav ul a.btn-large, nav ul a.btn-flat, nav ul a.btn-floating { + margin-top: -2px; + margin-left: 15px; + margin-right: 15px; +} + +nav ul a:hover { + background-color: rgba(0, 0, 0, 0.1); +} + +nav ul.left { + float: left; +} + +nav form { + height: 100%; +} + +nav .input-field { + margin: 0; + height: 100%; +} + +nav .input-field input { + height: 100%; + font-size: 1.2rem; + border: none; + padding-left: 2rem; +} + +nav .input-field input:focus, nav .input-field input[type=text]:valid, nav .input-field input[type=password]:valid, nav .input-field input[type=email]:valid, nav .input-field input[type=url]:valid, nav .input-field input[type=date]:valid { + border: none; + box-shadow: none; +} + +nav .input-field label { + top: 0; + left: 0; +} + +nav .input-field label i { + color: rgba(255, 255, 255, 0.7); + transition: color .3s; +} + +nav .input-field label.active i { + color: #fff; +} + +nav .input-field label.active { + -webkit-transform: translateY(0); + transform: translateY(0); +} + +.navbar-fixed { + position: relative; + height: 56px; + z-index: 997; +} + +.navbar-fixed nav { + position: fixed; +} + +@media only screen and (min-width: 601px) { + nav, nav .nav-wrapper i, nav a.button-collapse, nav a.button-collapse i { + height: 64px; + line-height: 64px; + } + .navbar-fixed { + height: 64px; + } +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Thin), url("../fonts/roboto/Roboto-Thin.eot"); + src: url("../fonts/roboto/Roboto-Thin.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Thin.woff2") format("woff2"), url("../fonts/roboto/Roboto-Thin.woff") format("woff"), url("../fonts/roboto/Roboto-Thin.ttf") format("truetype"); + font-weight: 200; +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Light), url("../fonts/roboto/Roboto-Light.eot"); + src: url("../fonts/roboto/Roboto-Light.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Light.woff2") format("woff2"), url("../fonts/roboto/Roboto-Light.woff") format("woff"), url("../fonts/roboto/Roboto-Light.ttf") format("truetype"); + font-weight: 300; +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Regular), url("../fonts/roboto/Roboto-Regular.eot"); + src: url("../fonts/roboto/Roboto-Regular.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Regular.woff2") format("woff2"), url("../fonts/roboto/Roboto-Regular.woff") format("woff"), url("../fonts/roboto/Roboto-Regular.ttf") format("truetype"); + font-weight: 400; +} + +@font-face { + font-family: "Roboto"; + src: url("../fonts/roboto/Roboto-Medium.eot"); + src: url("../fonts/roboto/Roboto-Medium.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Medium.woff2") format("woff2"), url("../fonts/roboto/Roboto-Medium.woff") format("woff"), url("../fonts/roboto/Roboto-Medium.ttf") format("truetype"); + font-weight: 500; +} + +@font-face { + font-family: "Roboto"; + src: url("../fonts/roboto/Roboto-Bold.eot"); + src: url("../fonts/roboto/Roboto-Bold.eot?#iefix") format("embedded-opentype"), url("../fonts/roboto/Roboto-Bold.woff2") format("woff2"), url("../fonts/roboto/Roboto-Bold.woff") format("woff"), url("../fonts/roboto/Roboto-Bold.ttf") format("truetype"); + font-weight: 700; +} + +a { + text-decoration: none; +} + +html { + line-height: 1.5; + font-family: "Roboto", sans-serif; + font-weight: normal; + color: rgba(0, 0, 0, 0.87); +} + +@media only screen and (min-width: 0) { + html { + font-size: 14px; + } +} + +@media only screen and (min-width: 992px) { + html { + font-size: 14.5px; + } +} + +@media only screen and (min-width: 1200px) { + html { + font-size: 15px; + } +} + +h1, h2, h3, h4, h5, h6 { + font-weight: 400; + line-height: 1.1; +} + +h1 a, h2 a, h3 a, h4 a, h5 a, h6 a { + font-weight: inherit; +} + +h1 { + font-size: 4.2rem; + line-height: 110%; + margin: 2.1rem 0 1.68rem 0; +} + +h2 { + font-size: 3.56rem; + line-height: 110%; + margin: 1.78rem 0 1.424rem 0; +} + +h3 { + font-size: 2.92rem; + line-height: 110%; + margin: 1.46rem 0 1.168rem 0; +} + +h4 { + font-size: 2.28rem; + line-height: 110%; + margin: 1.14rem 0 0.912rem 0; +} + +h5 { + font-size: 1.64rem; + line-height: 110%; + margin: 0.82rem 0 0.656rem 0; +} + +h6 { + font-size: 1rem; + line-height: 110%; + margin: 0.5rem 0 0.4rem 0; +} + +em { + font-style: italic; +} + +strong { + font-weight: 500; +} + +small { + font-size: 75%; +} + +.light, footer.page-footer .footer-copyright { + font-weight: 300; +} + +.thin { + font-weight: 200; +} + +.flow-text { + font-weight: 300; +} + +@media only screen and (min-width: 360px) { + .flow-text { + font-size: 1.2rem; + } +} + +@media only screen and (min-width: 390px) { + .flow-text { + font-size: 1.224rem; + } +} + +@media only screen and (min-width: 420px) { + .flow-text { + font-size: 1.248rem; + } +} + +@media only screen and (min-width: 450px) { + .flow-text { + font-size: 1.272rem; + } +} + +@media only screen and (min-width: 480px) { + .flow-text { + font-size: 1.296rem; + } +} + +@media only screen and (min-width: 510px) { + .flow-text { + font-size: 1.32rem; + } +} + +@media only screen and (min-width: 540px) { + .flow-text { + font-size: 1.344rem; + } +} + +@media only screen and (min-width: 570px) { + .flow-text { + font-size: 1.368rem; + } +} + +@media only screen and (min-width: 600px) { + .flow-text { + font-size: 1.392rem; + } +} + +@media only screen and (min-width: 630px) { + .flow-text { + font-size: 1.416rem; + } +} + +@media only screen and (min-width: 660px) { + .flow-text { + font-size: 1.44rem; + } +} + +@media only screen and (min-width: 690px) { + .flow-text { + font-size: 1.464rem; + } +} + +@media only screen and (min-width: 720px) { + .flow-text { + font-size: 1.488rem; + } +} + +@media only screen and (min-width: 750px) { + .flow-text { + font-size: 1.512rem; + } +} + +@media only screen and (min-width: 780px) { + .flow-text { + font-size: 1.536rem; + } +} + +@media only screen and (min-width: 810px) { + .flow-text { + font-size: 1.56rem; + } +} + +@media only screen and (min-width: 840px) { + .flow-text { + font-size: 1.584rem; + } +} + +@media only screen and (min-width: 870px) { + .flow-text { + font-size: 1.608rem; + } +} + +@media only screen and (min-width: 900px) { + .flow-text { + font-size: 1.632rem; + } +} + +@media only screen and (min-width: 930px) { + .flow-text { + font-size: 1.656rem; + } +} + +@media only screen and (min-width: 960px) { + .flow-text { + font-size: 1.68rem; + } +} + +@media only screen and (max-width: 360px) { + .flow-text { + font-size: 1.2rem; + } +} + +.card-panel { + transition: box-shadow .25s; + padding: 20px; + margin: 0.5rem 0 1rem 0; + border-radius: 2px; + background-color: #fff; +} + +.card { + position: relative; + margin: 0.5rem 0 1rem 0; + background-color: #fff; + transition: box-shadow .25s; + border-radius: 2px; +} + +.card .card-title { + font-size: 24px; + font-weight: 300; +} + +.card .card-title.activator { + cursor: pointer; +} + +.card.small, .card.medium, .card.large { + position: relative; +} + +.card.small .card-image, .card.medium .card-image, .card.large .card-image { + max-height: 60%; + overflow: hidden; +} + +.card.small .card-image + .card-content, .card.medium .card-image + .card-content, .card.large .card-image + .card-content { + max-height: 40%; +} + +.card.small .card-content, .card.medium .card-content, .card.large .card-content { + max-height: 100%; + overflow: hidden; +} + +.card.small .card-action, .card.medium .card-action, .card.large .card-action { + position: absolute; + bottom: 0; + left: 0; + right: 0; +} + +.card.small { + height: 300px; +} + +.card.medium { + height: 400px; +} + +.card.large { + height: 500px; +} + +.card.horizontal { + display: -webkit-flex; + display: -ms-flexbox; + display: flex; +} + +.card.horizontal.small .card-image, .card.horizontal.medium .card-image, .card.horizontal.large .card-image { + height: 100%; + max-height: none; + overflow: visible; +} + +.card.horizontal.small .card-image img, .card.horizontal.medium .card-image img, .card.horizontal.large .card-image img { + height: 100%; +} + +.card.horizontal .card-image { + max-width: 50%; +} + +.card.horizontal .card-image img { + border-radius: 2px 0 0 2px; + max-width: 100%; + width: auto; +} + +.card.horizontal .card-stacked { + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-flex-direction: column; + -ms-flex-direction: column; + flex-direction: column; + -webkit-flex: 1; + -ms-flex: 1; + flex: 1; + position: relative; +} + +.card.horizontal .card-stacked .card-content { + -webkit-flex-grow: 1; + -ms-flex-positive: 1; + flex-grow: 1; +} + +.card.sticky-action .card-action { + z-index: 2; +} + +.card.sticky-action .card-reveal { + z-index: 1; + padding-bottom: 64px; +} + +.card .card-image { + position: relative; +} + +.card .card-image img { + display: block; + border-radius: 2px 2px 0 0; + position: relative; + left: 0; + right: 0; + top: 0; + bottom: 0; + width: 100%; +} + +.card .card-image .card-title { + color: #fff; + position: absolute; + bottom: 0; + left: 0; + padding: 20px; +} + +.card .card-content { + padding: 20px; + border-radius: 0 0 2px 2px; +} + +.card .card-content p { + margin: 0; + color: inherit; +} + +.card .card-content .card-title { + line-height: 48px; +} + +.card .card-action { + position: relative; + background-color: inherit; + border-top: 1px solid rgba(160, 160, 160, 0.2); + padding: 20px; +} + +.card .card-action a:not(.btn):not(.btn-large):not(.btn-floating) { + color: #ffab40; + margin-right: 20px; + transition: color .3s ease; + text-transform: uppercase; +} + +.card .card-action a:not(.btn):not(.btn-large):not(.btn-floating):hover { + color: #ffd8a6; +} + +.card .card-reveal { + padding: 20px; + position: absolute; + background-color: #fff; + width: 100%; + overflow-y: auto; + left: 0; + top: 100%; + height: 100%; + z-index: 3; + display: none; +} + +.card .card-reveal .card-title { + cursor: pointer; + display: block; +} + +#toast-container { + display: block; + position: fixed; + z-index: 10000; +} + +@media only screen and (max-width: 600px) { + #toast-container { + min-width: 100%; + bottom: 0%; + } +} + +@media only screen and (min-width: 601px) and (max-width: 992px) { + #toast-container { + left: 5%; + bottom: 7%; + max-width: 90%; + } +} + +@media only screen and (min-width: 993px) { + #toast-container { + top: 10%; + right: 7%; + max-width: 86%; + } +} + +.toast { + border-radius: 2px; + top: 0; + width: auto; + clear: both; + margin-top: 10px; + position: relative; + max-width: 100%; + height: auto; + min-height: 48px; + line-height: 1.5em; + word-break: break-all; + background-color: #323232; + padding: 10px 25px; + font-size: 1.1rem; + font-weight: 300; + color: #fff; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-align-items: center; + -ms-flex-align: center; + align-items: center; + -webkit-justify-content: space-between; + -ms-flex-pack: justify; + justify-content: space-between; +} + +.toast .btn, .toast .btn-large, .toast .btn-flat { + margin: 0; + margin-left: 3rem; +} + +.toast.rounded { + border-radius: 24px; +} + +@media only screen and (max-width: 600px) { + .toast { + width: 100%; + border-radius: 0; + } +} + +@media only screen and (min-width: 601px) and (max-width: 992px) { + .toast { + float: left; + } +} + +@media only screen and (min-width: 993px) { + .toast { + float: right; + } +} + +.tabs { + position: relative; + overflow-x: auto; + overflow-y: hidden; + height: 48px; + width: 100%; + background-color: #fff; + margin: 0 auto; + white-space: nowrap; +} + +.tabs.tabs-transparent { + background-color: transparent; +} + +.tabs.tabs-transparent .tab a, +.tabs.tabs-transparent .tab.disabled a, +.tabs.tabs-transparent .tab.disabled a:hover { + color: rgba(255, 255, 255, 0.7); +} + +.tabs.tabs-transparent .tab a:hover, +.tabs.tabs-transparent .tab a.active { + color: #fff; +} + +.tabs.tabs-transparent .indicator { + background-color: #fff; +} + +.tabs.tabs-fixed-width { + display: -webkit-flex; + display: -ms-flexbox; + display: flex; +} + +.tabs.tabs-fixed-width .tab { + -webkit-box-flex: 1; + -webkit-flex-grow: 1; + -ms-flex-positive: 1; + flex-grow: 1; +} + +.tabs .tab { + display: inline-block; + text-align: center; + line-height: 48px; + height: 48px; + padding: 0; + margin: 0; + text-transform: uppercase; +} + +.tabs .tab a { + color: rgba(238, 110, 115, 0.7); + display: block; + width: 100%; + height: 100%; + padding: 0 24px; + font-size: 14px; + text-overflow: ellipsis; + overflow: hidden; + transition: color .28s ease; +} + +.tabs .tab a:hover, .tabs .tab a.active { + background-color: transparent; + color: #ee6e73; +} + +.tabs .tab.disabled a, +.tabs .tab.disabled a:hover { + color: rgba(238, 110, 115, 0.7); + cursor: default; +} + +.tabs .indicator { + position: absolute; + bottom: 0; + height: 2px; + background-color: #f6b2b5; + will-change: left, right; +} + +@media only screen and (max-width: 992px) { + .tabs { + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + } + .tabs .tab { + -webkit-box-flex: 1; + -webkit-flex-grow: 1; + -ms-flex-positive: 1; + flex-grow: 1; + } + .tabs .tab a { + padding: 0 12px; + } +} + +.material-tooltip { + padding: 10px 8px; + font-size: 1rem; + z-index: 2000; + background-color: transparent; + border-radius: 2px; + color: #fff; + min-height: 36px; + line-height: 120%; + opacity: 0; + display: none; + position: absolute; + text-align: center; + max-width: calc(100% - 4px); + overflow: hidden; + left: 0; + top: 0; + pointer-events: none; +} + +.backdrop { + position: absolute; + opacity: 0; + display: none; + height: 7px; + width: 14px; + border-radius: 0 0 50% 50%; + background-color: #323232; + z-index: -1; + -webkit-transform-origin: 50% 0%; + transform-origin: 50% 0%; + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); +} + +.btn, .btn-large, +.btn-flat { + border: none; + border-radius: 2px; + display: inline-block; + height: 36px; + line-height: 36px; + padding: 0 2rem; + text-transform: uppercase; + vertical-align: middle; + -webkit-tap-highlight-color: transparent; +} + +.btn.disabled, .disabled.btn-large, +.btn-floating.disabled, +.btn-large.disabled, +.btn-flat.disabled, +.btn:disabled, +.btn-large:disabled, +.btn-floating:disabled, +.btn-large:disabled, +.btn-flat:disabled, +.btn[disabled], +[disabled].btn-large, +.btn-floating[disabled], +.btn-large[disabled], +.btn-flat[disabled] { + pointer-events: none; + background-color: #DFDFDF !important; + box-shadow: none; + color: #9F9F9F !important; + cursor: default; +} + +.btn.disabled:hover, .disabled.btn-large:hover, +.btn-floating.disabled:hover, +.btn-large.disabled:hover, +.btn-flat.disabled:hover, +.btn:disabled:hover, +.btn-large:disabled:hover, +.btn-floating:disabled:hover, +.btn-large:disabled:hover, +.btn-flat:disabled:hover, +.btn[disabled]:hover, +[disabled].btn-large:hover, +.btn-floating[disabled]:hover, +.btn-large[disabled]:hover, +.btn-flat[disabled]:hover { + background-color: #DFDFDF !important; + color: #9F9F9F !important; +} + +.btn, .btn-large, +.btn-floating, +.btn-large, +.btn-flat { + outline: 0; +} + +.btn i, .btn-large i, +.btn-floating i, +.btn-large i, +.btn-flat i { + font-size: 1.3rem; + line-height: inherit; +} + +.btn:focus, .btn-large:focus, +.btn-floating:focus { + background-color: #1d7d74; +} + +.btn, .btn-large { + text-decoration: none; + color: #fff; + background-color: #26a69a; + text-align: center; + letter-spacing: .5px; + transition: .2s ease-out; + cursor: pointer; +} + +.btn:hover, .btn-large:hover { + background-color: #2bbbad; +} + +.btn-floating { + display: inline-block; + color: #fff; + position: relative; + overflow: hidden; + z-index: 1; + width: 40px; + height: 40px; + line-height: 40px; + padding: 0; + background-color: #26a69a; + border-radius: 50%; + transition: .3s; + cursor: pointer; + vertical-align: middle; +} + +.btn-floating i { + width: inherit; + display: inline-block; + text-align: center; + color: #fff; + font-size: 1.6rem; + line-height: 40px; +} + +.btn-floating:hover { + background-color: #26a69a; +} + +.btn-floating:before { + border-radius: 0; +} + +.btn-floating.btn-large { + width: 56px; + height: 56px; +} + +.btn-floating.btn-large i { + line-height: 56px; +} + +button.btn-floating { + border: none; +} + +.fixed-action-btn { + position: fixed; + right: 23px; + bottom: 23px; + padding-top: 15px; + margin-bottom: 0; + z-index: 998; +} + +.fixed-action-btn.active ul { + visibility: visible; +} + +.fixed-action-btn.horizontal { + padding: 0 0 0 15px; +} + +.fixed-action-btn.horizontal ul { + text-align: right; + right: 64px; + top: 50%; + -webkit-transform: translateY(-50%); + transform: translateY(-50%); + height: 100%; + left: auto; + width: 500px; + /*width 100% only goes to width of button container */ +} + +.fixed-action-btn.horizontal ul li { + display: inline-block; + margin: 15px 15px 0 0; +} + +.fixed-action-btn.toolbar { + padding: 0; + height: 56px; +} + +.fixed-action-btn.toolbar.active > a i { + opacity: 0; +} + +.fixed-action-btn.toolbar ul { + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + top: 0; + bottom: 0; +} + +.fixed-action-btn.toolbar ul li { + -webkit-flex: 1; + -ms-flex: 1; + flex: 1; + display: inline-block; + margin: 0; + height: 100%; + transition: none; +} + +.fixed-action-btn.toolbar ul li a { + display: block; + overflow: hidden; + position: relative; + width: 100%; + height: 100%; + background-color: transparent; + box-shadow: none; + color: #fff; + line-height: 56px; + z-index: 1; +} + +.fixed-action-btn.toolbar ul li a i { + line-height: inherit; +} + +.fixed-action-btn ul { + left: 0; + right: 0; + text-align: center; + position: absolute; + bottom: 64px; + margin: 0; + visibility: hidden; +} + +.fixed-action-btn ul li { + margin-bottom: 15px; +} + +.fixed-action-btn ul a.btn-floating { + opacity: 0; +} + +.fixed-action-btn .fab-backdrop { + position: absolute; + top: 0; + left: 0; + z-index: -1; + width: 40px; + height: 40px; + background-color: #26a69a; + border-radius: 50%; + -webkit-transform: scale(0); + transform: scale(0); +} + +.btn-flat { + box-shadow: none; + background-color: transparent; + color: #343434; + cursor: pointer; + transition: background-color .2s; +} + +.btn-flat:focus, .btn-flat:active { + background-color: transparent; +} + +.btn-flat:focus, .btn-flat:hover { + background-color: rgba(0, 0, 0, 0.1); + box-shadow: none; +} + +.btn-flat:active { + background-color: rgba(0, 0, 0, 0.2); +} + +.btn-flat.disabled { + background-color: transparent !important; + color: #b3b3b3 !important; + cursor: default; +} + +.btn-large { + height: 54px; + line-height: 54px; +} + +.btn-large i { + font-size: 1.6rem; +} + +.btn-block { + display: block; +} + +.dropdown-content { + background-color: #fff; + margin: 0; + display: none; + min-width: 100px; + max-height: 650px; + overflow-y: auto; + opacity: 0; + position: absolute; + z-index: 999; + will-change: width, height; +} + +.dropdown-content li { + clear: both; + color: rgba(0, 0, 0, 0.87); + cursor: pointer; + min-height: 50px; + line-height: 1.5rem; + width: 100%; + text-align: left; + text-transform: none; +} + +.dropdown-content li:hover, .dropdown-content li.active, .dropdown-content li.selected { + background-color: #eee; +} + +.dropdown-content li.active.selected { + background-color: #e1e1e1; +} + +.dropdown-content li.divider { + min-height: 0; + height: 1px; +} + +.dropdown-content li > a, .dropdown-content li > span { + font-size: 16px; + color: #26a69a; + display: block; + line-height: 22px; + padding: 14px 16px; +} + +.dropdown-content li > span > label { + top: 1px; + left: 0; + height: 18px; +} + +.dropdown-content li > a > i { + height: inherit; + line-height: inherit; +} + +.input-field.col .dropdown-content [type="checkbox"] + label { + top: 1px; + left: 0; + height: 18px; +} + +/*! + * Waves v0.6.0 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */ +.waves-effect { + position: relative; + cursor: pointer; + display: inline-block; + overflow: hidden; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + -webkit-tap-highlight-color: transparent; + vertical-align: middle; + z-index: 1; + will-change: opacity, transform; + transition: .3s ease-out; +} + +.waves-effect .waves-ripple { + position: absolute; + border-radius: 50%; + width: 20px; + height: 20px; + margin-top: -10px; + margin-left: -10px; + opacity: 0; + background: rgba(0, 0, 0, 0.2); + transition: all 0.7s ease-out; + transition-property: opacity, -webkit-transform; + transition-property: transform, opacity; + transition-property: transform, opacity, -webkit-transform; + -webkit-transform: scale(0); + transform: scale(0); + pointer-events: none; +} + +.waves-effect.waves-light .waves-ripple { + background-color: rgba(255, 255, 255, 0.45); +} + +.waves-effect.waves-red .waves-ripple { + background-color: rgba(244, 67, 54, 0.7); +} + +.waves-effect.waves-yellow .waves-ripple { + background-color: rgba(255, 235, 59, 0.7); +} + +.waves-effect.waves-orange .waves-ripple { + background-color: rgba(255, 152, 0, 0.7); +} + +.waves-effect.waves-purple .waves-ripple { + background-color: rgba(156, 39, 176, 0.7); +} + +.waves-effect.waves-green .waves-ripple { + background-color: rgba(76, 175, 80, 0.7); +} + +.waves-effect.waves-teal .waves-ripple { + background-color: rgba(0, 150, 136, 0.7); +} + +.waves-effect input[type="button"], .waves-effect input[type="reset"], .waves-effect input[type="submit"] { + border: 0; + font-style: normal; + font-size: inherit; + text-transform: inherit; + background: none; +} + +.waves-effect img { + position: relative; + z-index: -1; +} + +.waves-notransition { + transition: none !important; +} + +.waves-circle { + -webkit-transform: translateZ(0); + transform: translateZ(0); + -webkit-mask-image: -webkit-radial-gradient(circle, white 100%, black 100%); +} + +.waves-input-wrapper { + border-radius: 0.2em; + vertical-align: bottom; +} + +.waves-input-wrapper .waves-button-input { + position: relative; + top: 0; + left: 0; + z-index: 1; +} + +.waves-circle { + text-align: center; + width: 2.5em; + height: 2.5em; + line-height: 2.5em; + border-radius: 50%; + -webkit-mask-image: none; +} + +.waves-block { + display: block; +} + +/* Firefox Bug: link not triggered */ +.waves-effect .waves-ripple { + z-index: -1; +} + +.modal { + display: none; + position: fixed; + left: 0; + right: 0; + background-color: #fafafa; + padding: 0; + max-height: 70%; + width: 55%; + margin: auto; + overflow-y: auto; + border-radius: 2px; + will-change: top, opacity; +} + +@media only screen and (max-width: 992px) { + .modal { + width: 80%; + } +} + +.modal h1, .modal h2, .modal h3, .modal h4 { + margin-top: 0; +} + +.modal .modal-content { + padding: 24px; +} + +.modal .modal-close { + cursor: pointer; +} + +.modal .modal-footer { + border-radius: 0 0 2px 2px; + background-color: #fafafa; + padding: 4px 6px; + height: 56px; + width: 100%; +} + +.modal .modal-footer .btn, .modal .modal-footer .btn-large, .modal .modal-footer .btn-flat { + float: right; + margin: 6px 0; +} + +.modal-overlay { + position: fixed; + z-index: 999; + top: -100px; + left: 0; + bottom: 0; + right: 0; + height: 125%; + width: 100%; + background: #000; + display: none; + will-change: opacity; +} + +.modal.modal-fixed-footer { + padding: 0; + height: 70%; +} + +.modal.modal-fixed-footer .modal-content { + position: absolute; + height: calc(100% - 56px); + max-height: 100%; + width: 100%; + overflow-y: auto; +} + +.modal.modal-fixed-footer .modal-footer { + border-top: 1px solid rgba(0, 0, 0, 0.1); + position: absolute; + bottom: 0; +} + +.modal.bottom-sheet { + top: auto; + bottom: -100%; + margin: 0; + width: 100%; + max-height: 45%; + border-radius: 0; + will-change: bottom, opacity; +} + +.collapsible { + border-top: 1px solid #ddd; + border-right: 1px solid #ddd; + border-left: 1px solid #ddd; + margin: 0.5rem 0 1rem 0; +} + +.collapsible-header { + display: block; + cursor: pointer; + min-height: 3rem; + line-height: 3rem; + padding: 0 1rem; + background-color: #fff; + border-bottom: 1px solid #ddd; +} + +.collapsible-header i { + width: 2rem; + font-size: 1.6rem; + line-height: 3rem; + display: block; + float: left; + text-align: center; + margin-right: 1rem; +} + +.collapsible-body { + display: none; + border-bottom: 1px solid #ddd; + box-sizing: border-box; +} + +.collapsible-body p { + margin: 0; + padding: 2rem; +} + +.side-nav .collapsible, +.side-nav.fixed .collapsible { + border: none; + box-shadow: none; +} + +.side-nav .collapsible li, +.side-nav.fixed .collapsible li { + padding: 0; +} + +.side-nav .collapsible-header, +.side-nav.fixed .collapsible-header { + background-color: transparent; + border: none; + line-height: inherit; + height: inherit; + padding: 0 16px; +} + +.side-nav .collapsible-header:hover, +.side-nav.fixed .collapsible-header:hover { + background-color: rgba(0, 0, 0, 0.05); +} + +.side-nav .collapsible-header i, +.side-nav.fixed .collapsible-header i { + line-height: inherit; +} + +.side-nav .collapsible-body, +.side-nav.fixed .collapsible-body { + border: 0; + background-color: #fff; +} + +.side-nav .collapsible-body li a, +.side-nav.fixed .collapsible-body li a { + padding: 0 23.5px 0 31px; +} + +.collapsible.popout { + border: none; + box-shadow: none; +} + +.collapsible.popout > li { + box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12); + margin: 0 24px; + transition: margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94); +} + +.collapsible.popout > li.active { + box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15); + margin: 16px 0; +} + +.chip { + display: inline-block; + height: 32px; + font-size: 13px; + font-weight: 500; + color: rgba(0, 0, 0, 0.6); + line-height: 32px; + padding: 0 12px; + border-radius: 16px; + background-color: #e4e4e4; + margin-bottom: 5px; + margin-right: 5px; +} + +.chip img { + float: left; + margin: 0 8px 0 -12px; + height: 32px; + width: 32px; + border-radius: 50%; +} + +.chip .close { + cursor: pointer; + float: right; + font-size: 16px; + line-height: 32px; + padding-left: 8px; +} + +.chips { + border: none; + border-bottom: 1px solid #9e9e9e; + box-shadow: none; + margin: 0 0 20px 0; + min-height: 45px; + outline: none; + transition: all .3s; +} + +.chips.focus { + border-bottom: 1px solid #26a69a; + box-shadow: 0 1px 0 0 #26a69a; +} + +.chips:hover { + cursor: text; +} + +.chips .chip.selected { + background-color: #26a69a; + color: #fff; +} + +.chips .input { + background: none; + border: 0; + color: rgba(0, 0, 0, 0.6); + display: inline-block; + font-size: 1rem; + height: 3rem; + line-height: 32px; + outline: 0; + margin: 0; + padding: 0 !important; + width: 120px !important; +} + +.chips .input:focus { + border: 0 !important; + box-shadow: none !important; +} + +.prefix ~ .chips { + margin-left: 3rem; + width: 92%; + width: calc(100% - 3rem); +} + +.chips:empty ~ label { + font-size: 0.8rem; + -webkit-transform: translateY(-140%); + transform: translateY(-140%); +} + +.materialboxed { + display: block; + cursor: -webkit-zoom-in; + cursor: zoom-in; + position: relative; + transition: opacity .4s; +} + +.materialboxed:hover { + will-change: left, top, width, height; +} + +.materialboxed:hover:not(.active) { + opacity: .8; +} + +.materialboxed.active { + cursor: -webkit-zoom-out; + cursor: zoom-out; +} + +#materialbox-overlay { + position: fixed; + top: 0; + left: 0; + right: 0; + bottom: 0; + background-color: #292929; + z-index: 1000; + will-change: opacity; +} + +.materialbox-caption { + position: fixed; + display: none; + color: #fff; + line-height: 50px; + bottom: 0; + width: 100%; + text-align: center; + padding: 0% 15%; + height: 50px; + z-index: 1000; + -webkit-font-smoothing: antialiased; +} + +select:focus { + outline: 1px solid #c9f3ef; +} + +button:focus { + outline: none; + background-color: #2ab7a9; +} + +label { + font-size: 0.8rem; + color: #9e9e9e; +} + +/* Text Inputs + Textarea + ========================================================================== */ +/* Style Placeholders */ +::-webkit-input-placeholder { + color: #d1d1d1; +} + +:-moz-placeholder { + /* Firefox 18- */ + color: #d1d1d1; +} + +::-moz-placeholder { + /* Firefox 19+ */ + color: #d1d1d1; +} + +:-ms-input-placeholder { + color: #d1d1d1; +} + +/* Text inputs */ +input:not([type]), +input[type=text], +input[type=password], +input[type=email], +input[type=url], +input[type=time], +input[type=date], +input[type=datetime], +input[type=datetime-local], +input[type=tel], +input[type=number], +input[type=search], +textarea.materialize-textarea { + background-color: transparent; + border: none; + border-bottom: 1px solid #9e9e9e; + border-radius: 0; + outline: none; + height: 3rem; + width: 100%; + font-size: 1rem; + margin: 0 0 20px 0; + padding: 0; + box-shadow: none; + box-sizing: content-box; + transition: all 0.3s; +} + +input:not([type]):disabled, input:not([type])[readonly="readonly"], +input[type=text]:disabled, +input[type=text][readonly="readonly"], +input[type=password]:disabled, +input[type=password][readonly="readonly"], +input[type=email]:disabled, +input[type=email][readonly="readonly"], +input[type=url]:disabled, +input[type=url][readonly="readonly"], +input[type=time]:disabled, +input[type=time][readonly="readonly"], +input[type=date]:disabled, +input[type=date][readonly="readonly"], +input[type=datetime]:disabled, +input[type=datetime][readonly="readonly"], +input[type=datetime-local]:disabled, +input[type=datetime-local][readonly="readonly"], +input[type=tel]:disabled, +input[type=tel][readonly="readonly"], +input[type=number]:disabled, +input[type=number][readonly="readonly"], +input[type=search]:disabled, +input[type=search][readonly="readonly"], +textarea.materialize-textarea:disabled, +textarea.materialize-textarea[readonly="readonly"] { + color: rgba(0, 0, 0, 0.26); + border-bottom: 1px dotted rgba(0, 0, 0, 0.26); +} + +input:not([type]):disabled + label, +input:not([type])[readonly="readonly"] + label, +input[type=text]:disabled + label, +input[type=text][readonly="readonly"] + label, +input[type=password]:disabled + label, +input[type=password][readonly="readonly"] + label, +input[type=email]:disabled + label, +input[type=email][readonly="readonly"] + label, +input[type=url]:disabled + label, +input[type=url][readonly="readonly"] + label, +input[type=time]:disabled + label, +input[type=time][readonly="readonly"] + label, +input[type=date]:disabled + label, +input[type=date][readonly="readonly"] + label, +input[type=datetime]:disabled + label, +input[type=datetime][readonly="readonly"] + label, +input[type=datetime-local]:disabled + label, +input[type=datetime-local][readonly="readonly"] + label, +input[type=tel]:disabled + label, +input[type=tel][readonly="readonly"] + label, +input[type=number]:disabled + label, +input[type=number][readonly="readonly"] + label, +input[type=search]:disabled + label, +input[type=search][readonly="readonly"] + label, +textarea.materialize-textarea:disabled + label, +textarea.materialize-textarea[readonly="readonly"] + label { + color: rgba(0, 0, 0, 0.26); +} + +input:not([type]):focus:not([readonly]), +input[type=text]:focus:not([readonly]), +input[type=password]:focus:not([readonly]), +input[type=email]:focus:not([readonly]), +input[type=url]:focus:not([readonly]), +input[type=time]:focus:not([readonly]), +input[type=date]:focus:not([readonly]), +input[type=datetime]:focus:not([readonly]), +input[type=datetime-local]:focus:not([readonly]), +input[type=tel]:focus:not([readonly]), +input[type=number]:focus:not([readonly]), +input[type=search]:focus:not([readonly]), +textarea.materialize-textarea:focus:not([readonly]) { + border-bottom: 1px solid #26a69a; + box-shadow: 0 1px 0 0 #26a69a; +} + +input:not([type]):focus:not([readonly]) + label, +input[type=text]:focus:not([readonly]) + label, +input[type=password]:focus:not([readonly]) + label, +input[type=email]:focus:not([readonly]) + label, +input[type=url]:focus:not([readonly]) + label, +input[type=time]:focus:not([readonly]) + label, +input[type=date]:focus:not([readonly]) + label, +input[type=datetime]:focus:not([readonly]) + label, +input[type=datetime-local]:focus:not([readonly]) + label, +input[type=tel]:focus:not([readonly]) + label, +input[type=number]:focus:not([readonly]) + label, +input[type=search]:focus:not([readonly]) + label, +textarea.materialize-textarea:focus:not([readonly]) + label { + color: #26a69a; +} + +input:not([type]).valid, input:not([type]):focus.valid, +input[type=text].valid, +input[type=text]:focus.valid, +input[type=password].valid, +input[type=password]:focus.valid, +input[type=email].valid, +input[type=email]:focus.valid, +input[type=url].valid, +input[type=url]:focus.valid, +input[type=time].valid, +input[type=time]:focus.valid, +input[type=date].valid, +input[type=date]:focus.valid, +input[type=datetime].valid, +input[type=datetime]:focus.valid, +input[type=datetime-local].valid, +input[type=datetime-local]:focus.valid, +input[type=tel].valid, +input[type=tel]:focus.valid, +input[type=number].valid, +input[type=number]:focus.valid, +input[type=search].valid, +input[type=search]:focus.valid, +textarea.materialize-textarea.valid, +textarea.materialize-textarea:focus.valid { + border-bottom: 1px solid #4CAF50; + box-shadow: 0 1px 0 0 #4CAF50; +} + +input:not([type]).valid + label:after, +input:not([type]):focus.valid + label:after, +input[type=text].valid + label:after, +input[type=text]:focus.valid + label:after, +input[type=password].valid + label:after, +input[type=password]:focus.valid + label:after, +input[type=email].valid + label:after, +input[type=email]:focus.valid + label:after, +input[type=url].valid + label:after, +input[type=url]:focus.valid + label:after, +input[type=time].valid + label:after, +input[type=time]:focus.valid + label:after, +input[type=date].valid + label:after, +input[type=date]:focus.valid + label:after, +input[type=datetime].valid + label:after, +input[type=datetime]:focus.valid + label:after, +input[type=datetime-local].valid + label:after, +input[type=datetime-local]:focus.valid + label:after, +input[type=tel].valid + label:after, +input[type=tel]:focus.valid + label:after, +input[type=number].valid + label:after, +input[type=number]:focus.valid + label:after, +input[type=search].valid + label:after, +input[type=search]:focus.valid + label:after, +textarea.materialize-textarea.valid + label:after, +textarea.materialize-textarea:focus.valid + label:after { + content: attr(data-success); + color: #4CAF50; + opacity: 1; +} + +input:not([type]).invalid, input:not([type]):focus.invalid, +input[type=text].invalid, +input[type=text]:focus.invalid, +input[type=password].invalid, +input[type=password]:focus.invalid, +input[type=email].invalid, +input[type=email]:focus.invalid, +input[type=url].invalid, +input[type=url]:focus.invalid, +input[type=time].invalid, +input[type=time]:focus.invalid, +input[type=date].invalid, +input[type=date]:focus.invalid, +input[type=datetime].invalid, +input[type=datetime]:focus.invalid, +input[type=datetime-local].invalid, +input[type=datetime-local]:focus.invalid, +input[type=tel].invalid, +input[type=tel]:focus.invalid, +input[type=number].invalid, +input[type=number]:focus.invalid, +input[type=search].invalid, +input[type=search]:focus.invalid, +textarea.materialize-textarea.invalid, +textarea.materialize-textarea:focus.invalid { + border-bottom: 1px solid #F44336; + box-shadow: 0 1px 0 0 #F44336; +} + +input:not([type]).invalid + label:after, +input:not([type]):focus.invalid + label:after, +input[type=text].invalid + label:after, +input[type=text]:focus.invalid + label:after, +input[type=password].invalid + label:after, +input[type=password]:focus.invalid + label:after, +input[type=email].invalid + label:after, +input[type=email]:focus.invalid + label:after, +input[type=url].invalid + label:after, +input[type=url]:focus.invalid + label:after, +input[type=time].invalid + label:after, +input[type=time]:focus.invalid + label:after, +input[type=date].invalid + label:after, +input[type=date]:focus.invalid + label:after, +input[type=datetime].invalid + label:after, +input[type=datetime]:focus.invalid + label:after, +input[type=datetime-local].invalid + label:after, +input[type=datetime-local]:focus.invalid + label:after, +input[type=tel].invalid + label:after, +input[type=tel]:focus.invalid + label:after, +input[type=number].invalid + label:after, +input[type=number]:focus.invalid + label:after, +input[type=search].invalid + label:after, +input[type=search]:focus.invalid + label:after, +textarea.materialize-textarea.invalid + label:after, +textarea.materialize-textarea:focus.invalid + label:after { + content: attr(data-error); + color: #F44336; + opacity: 1; +} + +input:not([type]).validate + label, +input[type=text].validate + label, +input[type=password].validate + label, +input[type=email].validate + label, +input[type=url].validate + label, +input[type=time].validate + label, +input[type=date].validate + label, +input[type=datetime].validate + label, +input[type=datetime-local].validate + label, +input[type=tel].validate + label, +input[type=number].validate + label, +input[type=search].validate + label, +textarea.materialize-textarea.validate + label { + width: 100%; + pointer-events: none; +} + +input:not([type]) + label:after, +input[type=text] + label:after, +input[type=password] + label:after, +input[type=email] + label:after, +input[type=url] + label:after, +input[type=time] + label:after, +input[type=date] + label:after, +input[type=datetime] + label:after, +input[type=datetime-local] + label:after, +input[type=tel] + label:after, +input[type=number] + label:after, +input[type=search] + label:after, +textarea.materialize-textarea + label:after { + display: block; + content: ""; + position: absolute; + top: 60px; + opacity: 0; + transition: .2s opacity ease-out, .2s color ease-out; +} + +.input-field { + position: relative; + margin-top: 1rem; +} + +.input-field.inline { + display: inline-block; + vertical-align: middle; + margin-left: 5px; +} + +.input-field.inline input, +.input-field.inline .select-dropdown { + margin-bottom: 1rem; +} + +.input-field.col label { + left: 0.75rem; +} + +.input-field.col .prefix ~ label, +.input-field.col .prefix ~ .validate ~ label { + width: calc(100% - 3rem - 1.5rem); +} + +.input-field label { + color: #9e9e9e; + position: absolute; + top: 0.8rem; + left: 0; + font-size: 1rem; + cursor: text; + transition: .2s ease-out; +} + +.input-field label.active { + font-size: 0.8rem; + -webkit-transform: translateY(-140%); + transform: translateY(-140%); +} + +.input-field .prefix { + position: absolute; + width: 3rem; + font-size: 2rem; + transition: color .2s; +} + +.input-field .prefix.active { + color: #26a69a; +} + +.input-field .prefix ~ input, +.input-field .prefix ~ textarea, +.input-field .prefix ~ label, +.input-field .prefix ~ .validate ~ label, +.input-field .prefix ~ .autocomplete-content { + margin-left: 3rem; + width: 92%; + width: calc(100% - 3rem); +} + +.input-field .prefix ~ label { + margin-left: 3rem; +} + +@media only screen and (max-width: 992px) { + .input-field .prefix ~ input { + width: 86%; + width: calc(100% - 3rem); + } +} + +@media only screen and (max-width: 600px) { + .input-field .prefix ~ input { + width: 80%; + width: calc(100% - 3rem); + } +} + +/* Search Field */ +.input-field input[type=search] { + display: block; + line-height: inherit; + padding-left: 4rem; + width: calc(100% - 4rem); +} + +.input-field input[type=search]:focus { + background-color: #fff; + border: 0; + box-shadow: none; + color: #444; +} + +.input-field input[type=search]:focus + label i, +.input-field input[type=search]:focus ~ .mdi-navigation-close, +.input-field input[type=search]:focus ~ .material-icons { + color: #444; +} + +.input-field input[type=search] + label { + left: 1rem; +} + +.input-field input[type=search] ~ .mdi-navigation-close, +.input-field input[type=search] ~ .material-icons { + position: absolute; + top: 0; + right: 1rem; + color: transparent; + cursor: pointer; + font-size: 2rem; + transition: .3s color; +} + +/* Textarea */ +textarea { + width: 100%; + height: 3rem; + background-color: transparent; +} + +textarea.materialize-textarea { + overflow-y: hidden; + /* prevents scroll bar flash */ + padding: .8rem 0 1.6rem 0; + /* prevents text jump on Enter keypress */ + resize: none; + min-height: 3rem; +} + +.hiddendiv { + display: none; + white-space: pre-wrap; + word-wrap: break-word; + overflow-wrap: break-word; + /* future version of deprecated 'word-wrap' */ + padding-top: 1.2rem; + /* prevents text jump on Enter keypress */ +} + +/* Autocomplete */ +.autocomplete-content { + margin-top: -15px; + display: block; + opacity: 1; + position: static; +} + +.autocomplete-content li .highlight { + color: #444; +} + +.autocomplete-content li img { + height: 40px; + width: 40px; + margin: 5px 15px; +} + +/* Radio Buttons + ========================================================================== */ +[type="radio"]:not(:checked), +[type="radio"]:checked { + position: absolute; + left: -9999px; + opacity: 0; +} + +[type="radio"]:not(:checked) + label, +[type="radio"]:checked + label { + position: relative; + padding-left: 35px; + cursor: pointer; + display: inline-block; + height: 25px; + line-height: 25px; + font-size: 1rem; + transition: .28s ease; + /* webkit (konqueror) browsers */ + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +[type="radio"] + label:before, +[type="radio"] + label:after { + content: ''; + position: absolute; + left: 0; + top: 0; + margin: 4px; + width: 16px; + height: 16px; + z-index: 0; + transition: .28s ease; +} + +/* Unchecked styles */ +[type="radio"]:not(:checked) + label:before, +[type="radio"]:not(:checked) + label:after, +[type="radio"]:checked + label:before, +[type="radio"]:checked + label:after, +[type="radio"].with-gap:checked + label:before, +[type="radio"].with-gap:checked + label:after { + border-radius: 50%; +} + +[type="radio"]:not(:checked) + label:before, +[type="radio"]:not(:checked) + label:after { + border: 2px solid #5a5a5a; +} + +[type="radio"]:not(:checked) + label:after { + -webkit-transform: scale(0); + transform: scale(0); +} + +/* Checked styles */ +[type="radio"]:checked + label:before { + border: 2px solid transparent; +} + +[type="radio"]:checked + label:after, +[type="radio"].with-gap:checked + label:before, +[type="radio"].with-gap:checked + label:after { + border: 2px solid #26a69a; +} + +[type="radio"]:checked + label:after, +[type="radio"].with-gap:checked + label:after { + background-color: #26a69a; +} + +[type="radio"]:checked + label:after { + -webkit-transform: scale(1.02); + transform: scale(1.02); +} + +/* Radio With gap */ +[type="radio"].with-gap:checked + label:after { + -webkit-transform: scale(0.5); + transform: scale(0.5); +} + +/* Focused styles */ +[type="radio"].tabbed:focus + label:before { + box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1); +} + +/* Disabled Radio With gap */ +[type="radio"].with-gap:disabled:checked + label:before { + border: 2px solid rgba(0, 0, 0, 0.26); +} + +[type="radio"].with-gap:disabled:checked + label:after { + border: none; + background-color: rgba(0, 0, 0, 0.26); +} + +/* Disabled style */ +[type="radio"]:disabled:not(:checked) + label:before, +[type="radio"]:disabled:checked + label:before { + background-color: transparent; + border-color: rgba(0, 0, 0, 0.26); +} + +[type="radio"]:disabled + label { + color: rgba(0, 0, 0, 0.26); +} + +[type="radio"]:disabled:not(:checked) + label:before { + border-color: rgba(0, 0, 0, 0.26); +} + +[type="radio"]:disabled:checked + label:after { + background-color: rgba(0, 0, 0, 0.26); + border-color: #BDBDBD; +} + +/* Checkboxes + ========================================================================== */ +/* CUSTOM CSS CHECKBOXES */ +form p { + margin-bottom: 10px; + text-align: left; +} + +form p:last-child { + margin-bottom: 0; +} + +/* Remove default checkbox */ +[type="checkbox"]:not(:checked), +[type="checkbox"]:checked { + position: absolute; + left: -9999px; + opacity: 0; +} + +[type="checkbox"] { + /* checkbox aspect */ +} + +[type="checkbox"] + label { + position: relative; + padding-left: 35px; + cursor: pointer; + display: inline-block; + height: 25px; + line-height: 25px; + font-size: 1rem; + -webkit-user-select: none; + /* webkit (safari, chrome) browsers */ + -moz-user-select: none; + /* mozilla browsers */ + -khtml-user-select: none; + /* webkit (konqueror) browsers */ + -ms-user-select: none; + /* IE10+ */ +} + +[type="checkbox"] + label:before, +[type="checkbox"]:not(.filled-in) + label:after { + content: ''; + position: absolute; + top: 0; + left: 0; + width: 18px; + height: 18px; + z-index: 0; + border: 2px solid #5a5a5a; + border-radius: 1px; + margin-top: 2px; + transition: .2s; +} + +[type="checkbox"]:not(.filled-in) + label:after { + border: 0; + -webkit-transform: scale(0); + transform: scale(0); +} + +[type="checkbox"]:not(:checked):disabled + label:before { + border: none; + background-color: rgba(0, 0, 0, 0.26); +} + +[type="checkbox"].tabbed:focus + label:after { + -webkit-transform: scale(1); + transform: scale(1); + border: 0; + border-radius: 50%; + box-shadow: 0 0 0 10px rgba(0, 0, 0, 0.1); + background-color: rgba(0, 0, 0, 0.1); +} + +[type="checkbox"]:checked + label:before { + top: -4px; + left: -5px; + width: 12px; + height: 22px; + border-top: 2px solid transparent; + border-left: 2px solid transparent; + border-right: 2px solid #26a69a; + border-bottom: 2px solid #26a69a; + -webkit-transform: rotate(40deg); + transform: rotate(40deg); + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-transform-origin: 100% 100%; + transform-origin: 100% 100%; +} + +[type="checkbox"]:checked:disabled + label:before { + border-right: 2px solid rgba(0, 0, 0, 0.26); + border-bottom: 2px solid rgba(0, 0, 0, 0.26); +} + +/* Indeterminate checkbox */ +[type="checkbox"]:indeterminate + label:before { + top: -11px; + left: -12px; + width: 10px; + height: 22px; + border-top: none; + border-left: none; + border-right: 2px solid #26a69a; + border-bottom: none; + -webkit-transform: rotate(90deg); + transform: rotate(90deg); + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-transform-origin: 100% 100%; + transform-origin: 100% 100%; +} + +[type="checkbox"]:indeterminate:disabled + label:before { + border-right: 2px solid rgba(0, 0, 0, 0.26); + background-color: transparent; +} + +[type="checkbox"].filled-in + label:after { + border-radius: 2px; +} + +[type="checkbox"].filled-in + label:before, +[type="checkbox"].filled-in + label:after { + content: ''; + left: 0; + position: absolute; + /* .1s delay is for check animation */ + transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s; + z-index: 1; +} + +[type="checkbox"].filled-in:not(:checked) + label:before { + width: 0; + height: 0; + border: 3px solid transparent; + left: 6px; + top: 10px; + -webkit-transform: rotateZ(37deg); + transform: rotateZ(37deg); + -webkit-transform-origin: 20% 40%; + transform-origin: 100% 100%; +} + +[type="checkbox"].filled-in:not(:checked) + label:after { + height: 20px; + width: 20px; + background-color: transparent; + border: 2px solid #5a5a5a; + top: 0px; + z-index: 0; +} + +[type="checkbox"].filled-in:checked + label:before { + top: 0; + left: 1px; + width: 8px; + height: 13px; + border-top: 2px solid transparent; + border-left: 2px solid transparent; + border-right: 2px solid #fff; + border-bottom: 2px solid #fff; + -webkit-transform: rotateZ(37deg); + transform: rotateZ(37deg); + -webkit-transform-origin: 100% 100%; + transform-origin: 100% 100%; +} + +[type="checkbox"].filled-in:checked + label:after { + top: 0; + width: 20px; + height: 20px; + border: 2px solid #26a69a; + background-color: #26a69a; + z-index: 0; +} + +[type="checkbox"].filled-in.tabbed:focus + label:after { + border-radius: 2px; + border-color: #5a5a5a; + background-color: rgba(0, 0, 0, 0.1); +} + +[type="checkbox"].filled-in.tabbed:checked:focus + label:after { + border-radius: 2px; + background-color: #26a69a; + border-color: #26a69a; +} + +[type="checkbox"].filled-in:disabled:not(:checked) + label:before { + background-color: transparent; + border: 2px solid transparent; +} + +[type="checkbox"].filled-in:disabled:not(:checked) + label:after { + border-color: transparent; + background-color: #BDBDBD; +} + +[type="checkbox"].filled-in:disabled:checked + label:before { + background-color: transparent; +} + +[type="checkbox"].filled-in:disabled:checked + label:after { + background-color: #BDBDBD; + border-color: #BDBDBD; +} + +/* Switch + ========================================================================== */ +.switch, +.switch * { + -webkit-user-select: none; + -moz-user-select: none; + -khtml-user-select: none; + -ms-user-select: none; +} + +.switch label { + cursor: pointer; +} + +.switch label input[type=checkbox] { + opacity: 0; + width: 0; + height: 0; +} + +.switch label input[type=checkbox]:checked + .lever { + background-color: #84c7c1; +} + +.switch label input[type=checkbox]:checked + .lever:after { + background-color: #26a69a; + left: 24px; +} + +.switch label .lever { + content: ""; + display: inline-block; + position: relative; + width: 40px; + height: 15px; + background-color: #818181; + border-radius: 15px; + margin-right: 10px; + transition: background 0.3s ease; + vertical-align: middle; + margin: 0 16px; +} + +.switch label .lever:after { + content: ""; + position: absolute; + display: inline-block; + width: 21px; + height: 21px; + background-color: #F1F1F1; + border-radius: 21px; + box-shadow: 0 1px 3px 1px rgba(0, 0, 0, 0.4); + left: -5px; + top: -3px; + transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease; +} + +input[type=checkbox]:checked:not(:disabled) ~ .lever:active::after, +input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::after { + box-shadow: 0 1px 3px 1px rgba(0, 0, 0, 0.4), 0 0 0 15px rgba(38, 166, 154, 0.1); +} + +input[type=checkbox]:not(:disabled) ~ .lever:active:after, +input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::after { + box-shadow: 0 1px 3px 1px rgba(0, 0, 0, 0.4), 0 0 0 15px rgba(0, 0, 0, 0.08); +} + +.switch input[type=checkbox][disabled] + .lever { + cursor: default; +} + +.switch label input[type=checkbox][disabled] + .lever:after, +.switch label input[type=checkbox][disabled]:checked + .lever:after { + background-color: #BDBDBD; +} + +/* Select Field + ========================================================================== */ +select { + display: none; +} + +select.browser-default { + display: block; +} + +select { + background-color: rgba(255, 255, 255, 0.9); + width: 100%; + padding: 5px; + border: 1px solid #f2f2f2; + border-radius: 2px; + height: 3rem; +} + +.select-label { + position: absolute; +} + +.select-wrapper { + position: relative; +} + +.select-wrapper input.select-dropdown { + position: relative; + cursor: pointer; + background-color: transparent; + border: none; + border-bottom: 1px solid #9e9e9e; + outline: none; + height: 3rem; + line-height: 3rem; + width: 100%; + font-size: 1rem; + margin: 0 0 20px 0; + padding: 0; + display: block; +} + +.select-wrapper span.caret { + color: initial; + position: absolute; + right: 0; + top: 0; + bottom: 0; + height: 10px; + margin: auto 0; + font-size: 10px; + line-height: 10px; +} + +.select-wrapper span.caret.disabled { + color: rgba(0, 0, 0, 0.26); +} + +.select-wrapper + label { + position: absolute; + top: -14px; + font-size: 0.8rem; +} + +select:disabled { + color: rgba(0, 0, 0, 0.3); +} + +.select-wrapper input.select-dropdown:disabled { + color: rgba(0, 0, 0, 0.3); + cursor: default; + -webkit-user-select: none; + /* webkit (safari, chrome) browsers */ + -moz-user-select: none; + /* mozilla browsers */ + -ms-user-select: none; + /* IE10+ */ + border-bottom: 1px solid rgba(0, 0, 0, 0.3); +} + +.select-wrapper i { + color: rgba(0, 0, 0, 0.3); +} + +.select-dropdown li.disabled, +.select-dropdown li.disabled > span, +.select-dropdown li.optgroup { + color: rgba(0, 0, 0, 0.3); + background-color: transparent; +} + +.prefix ~ .select-wrapper { + margin-left: 3rem; + width: 92%; + width: calc(100% - 3rem); +} + +.prefix ~ label { + margin-left: 3rem; +} + +.select-dropdown li img { + height: 40px; + width: 40px; + margin: 5px 15px; + float: right; +} + +.select-dropdown li.optgroup { + border-top: 1px solid #eee; +} + +.select-dropdown li.optgroup.selected > span { + color: rgba(0, 0, 0, 0.7); +} + +.select-dropdown li.optgroup > span { + color: rgba(0, 0, 0, 0.4); +} + +.select-dropdown li.optgroup ~ li.optgroup-option { + padding-left: 1rem; +} + +/* File Input + ========================================================================== */ +.file-field { + position: relative; +} + +.file-field .file-path-wrapper { + overflow: hidden; + padding-left: 10px; +} + +.file-field input.file-path { + width: 100%; +} + +.file-field .btn, .file-field .btn-large { + float: left; + height: 3rem; + line-height: 3rem; +} + +.file-field span { + cursor: pointer; +} + +.file-field input[type=file] { + position: absolute; + top: 0; + right: 0; + left: 0; + bottom: 0; + width: 100%; + margin: 0; + padding: 0; + font-size: 20px; + cursor: pointer; + opacity: 0; + filter: alpha(opacity=0); +} + +/* Range + ========================================================================== */ +.range-field { + position: relative; +} + +input[type=range], +input[type=range] + .thumb { + cursor: pointer; +} + +input[type=range] { + position: relative; + background-color: transparent; + border: none; + outline: none; + width: 100%; + margin: 15px 0; + padding: 0; +} + +input[type=range]:focus { + outline: none; +} + +input[type=range] + .thumb { + position: absolute; + border: none; + height: 0; + width: 0; + border-radius: 50%; + background-color: #26a69a; + top: 10px; + margin-left: -6px; + -webkit-transform-origin: 50% 50%; + transform-origin: 50% 50%; + -webkit-transform: rotate(-45deg); + transform: rotate(-45deg); +} + +input[type=range] + .thumb .value { + display: block; + width: 30px; + text-align: center; + color: #26a69a; + font-size: 0; + -webkit-transform: rotate(45deg); + transform: rotate(45deg); +} + +input[type=range] + .thumb.active { + border-radius: 50% 50% 50% 0; +} + +input[type=range] + .thumb.active .value { + color: #fff; + margin-left: -1px; + margin-top: 8px; + font-size: 10px; +} + +input[type=range] { + -webkit-appearance: none; +} + +input[type=range]::-webkit-slider-runnable-track { + height: 3px; + background: #c2c0c2; + border: none; +} + +input[type=range]::-webkit-slider-thumb { + -webkit-appearance: none; + border: none; + height: 14px; + width: 14px; + border-radius: 50%; + background-color: #26a69a; + -webkit-transform-origin: 50% 50%; + transform-origin: 50% 50%; + margin: -5px 0 0 0; + transition: .3s; +} + +input[type=range]:focus::-webkit-slider-runnable-track { + background: #ccc; +} + +input[type=range] { + /* fix for FF unable to apply focus style bug */ + border: 1px solid white; + /*required for proper track sizing in FF*/ +} + +input[type=range]::-moz-range-track { + height: 3px; + background: #ddd; + border: none; +} + +input[type=range]::-moz-range-thumb { + border: none; + height: 14px; + width: 14px; + border-radius: 50%; + background: #26a69a; + margin-top: -5px; +} + +input[type=range]:-moz-focusring { + outline: 1px solid #fff; + outline-offset: -1px; +} + +input[type=range]:focus::-moz-range-track { + background: #ccc; +} + +input[type=range]::-ms-track { + height: 3px; + background: transparent; + border-color: transparent; + border-width: 6px 0; + /*remove default tick marks*/ + color: transparent; +} + +input[type=range]::-ms-fill-lower { + background: #777; +} + +input[type=range]::-ms-fill-upper { + background: #ddd; +} + +input[type=range]::-ms-thumb { + border: none; + height: 14px; + width: 14px; + border-radius: 50%; + background: #26a69a; +} + +input[type=range]:focus::-ms-fill-lower { + background: #888; +} + +input[type=range]:focus::-ms-fill-upper { + background: #ccc; +} + +/*************** + Nav List +***************/ +.table-of-contents.fixed { + position: fixed; +} + +.table-of-contents li { + padding: 2px 0; +} + +.table-of-contents a { + display: inline-block; + font-weight: 300; + color: #757575; + padding-left: 20px; + height: 1.5rem; + line-height: 1.5rem; + letter-spacing: .4; + display: inline-block; +} + +.table-of-contents a:hover { + color: #a8a8a8; + padding-left: 19px; + border-left: 1px solid #ea4a4f; +} + +.table-of-contents a.active { + font-weight: 500; + padding-left: 18px; + border-left: 2px solid #ea4a4f; +} + +.side-nav { + position: fixed; + width: 300px; + left: 0; + top: 0; + margin: 0; + -webkit-transform: translateX(-100%); + transform: translateX(-100%); + height: 100%; + height: calc(100% + 60px); + height: -moz-calc(100%); + padding-bottom: 60px; + background-color: #fff; + z-index: 999; + overflow-y: auto; + will-change: transform; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-transform: translateX(-105%); + transform: translateX(-105%); +} + +.side-nav.right-aligned { + right: 0; + -webkit-transform: translateX(105%); + transform: translateX(105%); + left: auto; + -webkit-transform: translateX(100%); + transform: translateX(100%); +} + +.side-nav .collapsible { + margin: 0; +} + +.side-nav li { + float: none; + line-height: 48px; +} + +.side-nav li.active { + background-color: rgba(0, 0, 0, 0.05); +} + +.side-nav a { + color: rgba(0, 0, 0, 0.87); + display: block; + font-size: 14px; + font-weight: 500; + height: 48px; + line-height: 48px; + padding: 0 32px; +} + +.side-nav a:hover { + background-color: rgba(0, 0, 0, 0.05); +} + +.side-nav a.btn, .side-nav a.btn-large, .side-nav a.btn-large, .side-nav a.btn-flat, .side-nav a.btn-floating { + margin: 10px 15px; +} + +.side-nav a.btn, .side-nav a.btn-large, .side-nav a.btn-large, .side-nav a.btn-floating { + color: #fff; +} + +.side-nav a.btn-flat { + color: #343434; +} + +.side-nav a.btn:hover, .side-nav a.btn-large:hover, .side-nav a.btn-large:hover { + background-color: #2bbbad; +} + +.side-nav a.btn-floating:hover { + background-color: #26a69a; +} + +.side-nav li > a > i, +.side-nav li > a > [class^="mdi-"], .side-nav li > a > [class*="mdi-"], +.side-nav li > a > i.material-icons { + float: left; + height: 48px; + line-height: 48px; + margin: 0 32px 0 0; + width: 24px; + color: rgba(0, 0, 0, 0.54); +} + +.side-nav .divider { + margin: 8px 0 0 0; +} + +.side-nav .subheader { + cursor: initial; + pointer-events: none; + color: rgba(0, 0, 0, 0.54); + font-size: 14px; + font-weight: 500; + line-height: 48px; +} + +.side-nav .subheader:hover { + background-color: transparent; +} + +.side-nav .userView { + position: relative; + padding: 32px 32px 0; + margin-bottom: 8px; +} + +.side-nav .userView > a { + height: auto; + padding: 0; +} + +.side-nav .userView > a:hover { + background-color: transparent; +} + +.side-nav .userView .background { + overflow: hidden; + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: -1; +} + +.side-nav .userView .circle, .side-nav .userView .name, .side-nav .userView .email { + display: block; +} + +.side-nav .userView .circle { + height: 64px; + width: 64px; +} + +.side-nav .userView .name, +.side-nav .userView .email { + font-size: 14px; + line-height: 24px; +} + +.side-nav .userView .name { + margin-top: 16px; + font-weight: 500; +} + +.side-nav .userView .email { + padding-bottom: 16px; + font-weight: 400; +} + +.drag-target { + height: 100%; + width: 10px; + position: fixed; + top: 0; + z-index: 998; +} + +.side-nav.fixed { + left: 0; + -webkit-transform: translateX(0); + transform: translateX(0); + position: fixed; +} + +.side-nav.fixed.right-aligned { + right: 0; + left: auto; +} + +@media only screen and (max-width: 992px) { + .side-nav.fixed { + -webkit-transform: translateX(-105%); + transform: translateX(-105%); + } + .side-nav.fixed.right-aligned { + -webkit-transform: translateX(105%); + transform: translateX(105%); + } + .side-nav a { + padding: 0 16px; + } + .side-nav .userView { + padding: 16px 16px 0; + } +} + +.side-nav .collapsible-body > ul:not(.collapsible) > li.active, +.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active { + background-color: #ee6e73; +} + +.side-nav .collapsible-body > ul:not(.collapsible) > li.active a, +.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active a { + color: #fff; +} + +#sidenav-overlay { + position: fixed; + top: 0; + left: 0; + right: 0; + height: 120vh; + background-color: rgba(0, 0, 0, 0.5); + z-index: 997; + will-change: opacity; +} + +/* + @license + Copyright (c) 2014 The Polymer Project Authors. All rights reserved. + This code may only be used under the BSD style license found at http://polymer.github.io/LICENSE.txt + The complete set of authors may be found at http://polymer.github.io/AUTHORS.txt + The complete set of contributors may be found at http://polymer.github.io/CONTRIBUTORS.txt + Code distributed by Google as part of the polymer project is also + subject to an additional IP rights grant found at http://polymer.github.io/PATENTS.txt + */ +/**************************/ +/* STYLES FOR THE SPINNER */ +/**************************/ +/* + * Constants: + * STROKEWIDTH = 3px + * ARCSIZE = 270 degrees (amount of circle the arc takes up) + * ARCTIME = 1333ms (time it takes to expand and contract arc) + * ARCSTARTROT = 216 degrees (how much the start location of the arc + * should rotate each time, 216 gives us a + * 5 pointed star shape (it's 360/5 * 3). + * For a 7 pointed star, we might do + * 360/7 * 3 = 154.286) + * CONTAINERWIDTH = 28px + * SHRINK_TIME = 400ms + */ +.preloader-wrapper { + display: inline-block; + position: relative; + width: 48px; + height: 48px; +} + +.preloader-wrapper.small { + width: 36px; + height: 36px; +} + +.preloader-wrapper.big { + width: 64px; + height: 64px; +} + +.preloader-wrapper.active { + /* duration: 360 * ARCTIME / (ARCSTARTROT + (360-ARCSIZE)) */ + -webkit-animation: container-rotate 1568ms linear infinite; + animation: container-rotate 1568ms linear infinite; +} + +@-webkit-keyframes container-rotate { + to { + -webkit-transform: rotate(360deg); + } +} + +@keyframes container-rotate { + to { + -webkit-transform: rotate(360deg); + transform: rotate(360deg); + } +} + +.spinner-layer { + position: absolute; + width: 100%; + height: 100%; + opacity: 0; + border-color: #26a69a; +} + +.spinner-blue, +.spinner-blue-only { + border-color: #4285f4; +} + +.spinner-red, +.spinner-red-only { + border-color: #db4437; +} + +.spinner-yellow, +.spinner-yellow-only { + border-color: #f4b400; +} + +.spinner-green, +.spinner-green-only { + border-color: #0f9d58; +} + +/** + * IMPORTANT NOTE ABOUT CSS ANIMATION PROPERTIES (keanulee): + * + * iOS Safari (tested on iOS 8.1) does not handle animation-delay very well - it doesn't + * guarantee that the animation will start _exactly_ after that value. So we avoid using + * animation-delay and instead set custom keyframes for each color (as redundant as it + * seems). + * + * We write out each animation in full (instead of separating animation-name, + * animation-duration, etc.) because under the polyfill, Safari does not recognize those + * specific properties properly, treats them as -webkit-animation, and overrides the + * other animation rules. See https://github.com/Polymer/platform/issues/53. + */ +.active .spinner-layer.spinner-blue { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .spinner-layer.spinner-red { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .spinner-layer.spinner-yellow { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .spinner-layer.spinner-green { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .spinner-layer, +.active .spinner-layer.spinner-blue-only, +.active .spinner-layer.spinner-red-only, +.active .spinner-layer.spinner-yellow-only, +.active .spinner-layer.spinner-green-only { + /* durations: 4 * ARCTIME */ + opacity: 1; + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +@-webkit-keyframes fill-unfill-rotate { + 12.5% { + -webkit-transform: rotate(135deg); + } + /* 0.5 * ARCSIZE */ + 25% { + -webkit-transform: rotate(270deg); + } + /* 1 * ARCSIZE */ + 37.5% { + -webkit-transform: rotate(405deg); + } + /* 1.5 * ARCSIZE */ + 50% { + -webkit-transform: rotate(540deg); + } + /* 2 * ARCSIZE */ + 62.5% { + -webkit-transform: rotate(675deg); + } + /* 2.5 * ARCSIZE */ + 75% { + -webkit-transform: rotate(810deg); + } + /* 3 * ARCSIZE */ + 87.5% { + -webkit-transform: rotate(945deg); + } + /* 3.5 * ARCSIZE */ + to { + -webkit-transform: rotate(1080deg); + } + /* 4 * ARCSIZE */ +} + +@keyframes fill-unfill-rotate { + 12.5% { + -webkit-transform: rotate(135deg); + transform: rotate(135deg); + } + /* 0.5 * ARCSIZE */ + 25% { + -webkit-transform: rotate(270deg); + transform: rotate(270deg); + } + /* 1 * ARCSIZE */ + 37.5% { + -webkit-transform: rotate(405deg); + transform: rotate(405deg); + } + /* 1.5 * ARCSIZE */ + 50% { + -webkit-transform: rotate(540deg); + transform: rotate(540deg); + } + /* 2 * ARCSIZE */ + 62.5% { + -webkit-transform: rotate(675deg); + transform: rotate(675deg); + } + /* 2.5 * ARCSIZE */ + 75% { + -webkit-transform: rotate(810deg); + transform: rotate(810deg); + } + /* 3 * ARCSIZE */ + 87.5% { + -webkit-transform: rotate(945deg); + transform: rotate(945deg); + } + /* 3.5 * ARCSIZE */ + to { + -webkit-transform: rotate(1080deg); + transform: rotate(1080deg); + } + /* 4 * ARCSIZE */ +} + +@-webkit-keyframes blue-fade-in-out { + from { + opacity: 1; + } + 25% { + opacity: 1; + } + 26% { + opacity: 0; + } + 89% { + opacity: 0; + } + 90% { + opacity: 1; + } + 100% { + opacity: 1; + } +} + +@keyframes blue-fade-in-out { + from { + opacity: 1; + } + 25% { + opacity: 1; + } + 26% { + opacity: 0; + } + 89% { + opacity: 0; + } + 90% { + opacity: 1; + } + 100% { + opacity: 1; + } +} + +@-webkit-keyframes red-fade-in-out { + from { + opacity: 0; + } + 15% { + opacity: 0; + } + 25% { + opacity: 1; + } + 50% { + opacity: 1; + } + 51% { + opacity: 0; + } +} + +@keyframes red-fade-in-out { + from { + opacity: 0; + } + 15% { + opacity: 0; + } + 25% { + opacity: 1; + } + 50% { + opacity: 1; + } + 51% { + opacity: 0; + } +} + +@-webkit-keyframes yellow-fade-in-out { + from { + opacity: 0; + } + 40% { + opacity: 0; + } + 50% { + opacity: 1; + } + 75% { + opacity: 1; + } + 76% { + opacity: 0; + } +} + +@keyframes yellow-fade-in-out { + from { + opacity: 0; + } + 40% { + opacity: 0; + } + 50% { + opacity: 1; + } + 75% { + opacity: 1; + } + 76% { + opacity: 0; + } +} + +@-webkit-keyframes green-fade-in-out { + from { + opacity: 0; + } + 65% { + opacity: 0; + } + 75% { + opacity: 1; + } + 90% { + opacity: 1; + } + 100% { + opacity: 0; + } +} + +@keyframes green-fade-in-out { + from { + opacity: 0; + } + 65% { + opacity: 0; + } + 75% { + opacity: 1; + } + 90% { + opacity: 1; + } + 100% { + opacity: 0; + } +} + +/** + * Patch the gap that appear between the two adjacent div.circle-clipper while the + * spinner is rotating (appears on Chrome 38, Safari 7.1, and IE 11). + */ +.gap-patch { + position: absolute; + top: 0; + left: 45%; + width: 10%; + height: 100%; + overflow: hidden; + border-color: inherit; +} + +.gap-patch .circle { + width: 1000%; + left: -450%; +} + +.circle-clipper { + display: inline-block; + position: relative; + width: 50%; + height: 100%; + overflow: hidden; + border-color: inherit; +} + +.circle-clipper .circle { + width: 200%; + height: 100%; + border-width: 3px; + /* STROKEWIDTH */ + border-style: solid; + border-color: inherit; + border-bottom-color: transparent !important; + border-radius: 50%; + -webkit-animation: none; + animation: none; + position: absolute; + top: 0; + right: 0; + bottom: 0; +} + +.circle-clipper.left .circle { + left: 0; + border-right-color: transparent !important; + -webkit-transform: rotate(129deg); + transform: rotate(129deg); +} + +.circle-clipper.right .circle { + left: -100%; + border-left-color: transparent !important; + -webkit-transform: rotate(-129deg); + transform: rotate(-129deg); +} + +.active .circle-clipper.left .circle { + /* duration: ARCTIME */ + -webkit-animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +.active .circle-clipper.right .circle { + /* duration: ARCTIME */ + -webkit-animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; + animation: right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both; +} + +@-webkit-keyframes left-spin { + from { + -webkit-transform: rotate(130deg); + } + 50% { + -webkit-transform: rotate(-5deg); + } + to { + -webkit-transform: rotate(130deg); + } +} + +@keyframes left-spin { + from { + -webkit-transform: rotate(130deg); + transform: rotate(130deg); + } + 50% { + -webkit-transform: rotate(-5deg); + transform: rotate(-5deg); + } + to { + -webkit-transform: rotate(130deg); + transform: rotate(130deg); + } +} + +@-webkit-keyframes right-spin { + from { + -webkit-transform: rotate(-130deg); + } + 50% { + -webkit-transform: rotate(5deg); + } + to { + -webkit-transform: rotate(-130deg); + } +} + +@keyframes right-spin { + from { + -webkit-transform: rotate(-130deg); + transform: rotate(-130deg); + } + 50% { + -webkit-transform: rotate(5deg); + transform: rotate(5deg); + } + to { + -webkit-transform: rotate(-130deg); + transform: rotate(-130deg); + } +} + +#spinnerContainer.cooldown { + /* duration: SHRINK_TIME */ + -webkit-animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1); + animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1); +} + +@-webkit-keyframes fade-out { + from { + opacity: 1; + } + to { + opacity: 0; + } +} + +@keyframes fade-out { + from { + opacity: 1; + } + to { + opacity: 0; + } +} + +.slider { + position: relative; + height: 400px; + width: 100%; +} + +.slider.fullscreen { + height: 100%; + width: 100%; + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; +} + +.slider.fullscreen ul.slides { + height: 100%; +} + +.slider.fullscreen ul.indicators { + z-index: 2; + bottom: 30px; +} + +.slider .slides { + background-color: #9e9e9e; + margin: 0; + height: 400px; +} + +.slider .slides li { + opacity: 0; + position: absolute; + top: 0; + left: 0; + z-index: 1; + width: 100%; + height: inherit; + overflow: hidden; +} + +.slider .slides li img { + height: 100%; + width: 100%; + background-size: cover; + background-position: center; +} + +.slider .slides li .caption { + color: #fff; + position: absolute; + top: 15%; + left: 15%; + width: 70%; + opacity: 0; +} + +.slider .slides li .caption p { + color: #e0e0e0; +} + +.slider .slides li.active { + z-index: 2; +} + +.slider .indicators { + position: absolute; + text-align: center; + left: 0; + right: 0; + bottom: 0; + margin: 0; +} + +.slider .indicators .indicator-item { + display: inline-block; + position: relative; + cursor: pointer; + height: 16px; + width: 16px; + margin: 0 12px; + background-color: #e0e0e0; + transition: background-color .3s; + border-radius: 50%; +} + +.slider .indicators .indicator-item.active { + background-color: #4CAF50; +} + +.carousel { + overflow: hidden; + position: relative; + width: 100%; + height: 400px; + -webkit-perspective: 500px; + perspective: 500px; + -webkit-transform-style: preserve-3d; + transform-style: preserve-3d; + -webkit-transform-origin: 0% 50%; + transform-origin: 0% 50%; +} + +.carousel.carousel-slider { + top: 0; + left: 0; + height: 0; +} + +.carousel.carousel-slider .carousel-fixed-item { + position: absolute; + left: 0; + right: 0; + bottom: 20px; + z-index: 1; +} + +.carousel.carousel-slider .carousel-fixed-item.with-indicators { + bottom: 68px; +} + +.carousel.carousel-slider .carousel-item { + width: 100%; + height: 100%; + min-height: 400px; + position: absolute; + top: 0; + left: 0; +} + +.carousel.carousel-slider .carousel-item h2 { + font-size: 24px; + font-weight: 500; + line-height: 32px; +} + +.carousel.carousel-slider .carousel-item p { + font-size: 15px; +} + +.carousel .carousel-item { + display: none; + width: 200px; + height: 400px; + position: absolute; + top: 0; + left: 0; +} + +.carousel .carousel-item img { + width: 100%; +} + +.carousel .indicators { + position: absolute; + text-align: center; + left: 0; + right: 0; + bottom: 0; + margin: 0; +} + +.carousel .indicators .indicator-item { + display: inline-block; + position: relative; + cursor: pointer; + height: 8px; + width: 8px; + margin: 24px 4px; + background-color: rgba(255, 255, 255, 0.5); + transition: background-color .3s; + border-radius: 50%; +} + +.carousel .indicators .indicator-item.active { + background-color: #fff; +} + +/* ========================================================================== + $BASE-PICKER + ========================================================================== */ +/** + * Note: the root picker element should *NOT* be styled more than what's here. + */ +.picker { + font-size: 16px; + text-align: left; + line-height: 1.2; + color: #000000; + position: absolute; + z-index: 10000; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +/** + * The picker input element. + */ +.picker__input { + cursor: default; +} + +/** + * When the picker is opened, the input element is "activated". + */ +.picker__input.picker__input--active { + border-color: #0089ec; +} + +/** + * The holder is the only "scrollable" top-level container element. + */ +.picker__holder { + width: 100%; + overflow-y: auto; + -webkit-overflow-scrolling: touch; +} + +/*! + * Default mobile-first, responsive styling for pickadate.js + * Demo: http://amsul.github.io/pickadate.js + */ +/** + * Note: the root picker element should *NOT* be styled more than what's here. + */ +/** + * Make the holder and frame fullscreen. + */ +.picker__holder, +.picker__frame { + bottom: 0; + left: 0; + right: 0; + top: 100%; +} + +/** + * The holder should overlay the entire screen. + */ +.picker__holder { + position: fixed; + transition: background 0.15s ease-out, top 0s 0.15s; + -webkit-backface-visibility: hidden; +} + +/** + * The frame that bounds the box contents of the picker. + */ +.picker__frame { + position: absolute; + margin: 0 auto; + min-width: 256px; + width: 300px; + max-height: 350px; + -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; + filter: alpha(opacity=0); + -moz-opacity: 0; + opacity: 0; + transition: all 0.15s ease-out; +} + +@media (min-height: 28.875em) { + .picker__frame { + overflow: visible; + top: auto; + bottom: -100%; + max-height: 80%; + } +} + +@media (min-height: 40.125em) { + .picker__frame { + margin-bottom: 7.5%; + } +} + +/** + * The wrapper sets the stage to vertically align the box contents. + */ +.picker__wrap { + display: table; + width: 100%; + height: 100%; +} + +@media (min-height: 28.875em) { + .picker__wrap { + display: block; + } +} + +/** + * The box contains all the picker contents. + */ +.picker__box { + background: #ffffff; + display: table-cell; + vertical-align: middle; +} + +@media (min-height: 28.875em) { + .picker__box { + display: block; + border: 1px solid #777777; + border-top-color: #898989; + border-bottom-width: 0; + border-radius: 5px 5px 0 0; + box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24); + } +} + +/** + * When the picker opens... + */ +.picker--opened .picker__holder { + top: 0; + background: transparent; + -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)"; + zoom: 1; + background: rgba(0, 0, 0, 0.32); + transition: background 0.15s ease-out; +} + +.picker--opened .picker__frame { + top: 0; + -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)"; + filter: alpha(opacity=100); + -moz-opacity: 1; + opacity: 1; +} + +@media (min-height: 35.875em) { + .picker--opened .picker__frame { + top: 10%; + bottom: auto; + } +} + +/** + * For `large` screens, transform into an inline picker. + */ +/* ========================================================================== + CUSTOM MATERIALIZE STYLES + ========================================================================== */ +.picker__input.picker__input--active { + border-color: #E3F2FD; +} + +.picker__frame { + margin: 0 auto; + max-width: 325px; +} + +@media (min-height: 38.875em) { + .picker--opened .picker__frame { + top: 10%; + bottom: auto; + } +} + +/* ========================================================================== + $BASE-DATE-PICKER + ========================================================================== */ +/** + * The picker box. + */ +.picker__box { + padding: 0 1em; +} + +/** + * The header containing the month and year stuff. + */ +.picker__header { + text-align: center; + position: relative; + margin-top: .75em; +} + +/** + * The month and year labels. + */ +.picker__month, +.picker__year { + display: inline-block; + margin-left: .25em; + margin-right: .25em; +} + +/** + * The month and year selectors. + */ +.picker__select--month, +.picker__select--year { + height: 2em; + padding: 0; + margin-left: .25em; + margin-right: .25em; +} + +.picker__select--month.browser-default { + display: inline; + background-color: #FFFFFF; + width: 40%; +} + +.picker__select--year.browser-default { + display: inline; + background-color: #FFFFFF; + width: 26%; +} + +.picker__select--month:focus, +.picker__select--year:focus { + border-color: rgba(0, 0, 0, 0.05); +} + +/** + * The month navigation buttons. + */ +.picker__nav--prev, +.picker__nav--next { + position: absolute; + padding: .5em 1.25em; + width: 1em; + height: 1em; + box-sizing: content-box; + top: -0.25em; +} + +.picker__nav--prev { + left: -1em; + padding-right: 1.25em; +} + +.picker__nav--next { + right: -1em; + padding-left: 1.25em; +} + +.picker__nav--disabled, +.picker__nav--disabled:hover, +.picker__nav--disabled:before, +.picker__nav--disabled:before:hover { + cursor: default; + background: none; + border-right-color: #f5f5f5; + border-left-color: #f5f5f5; +} + +/** + * The calendar table of dates + */ +.picker__table { + text-align: center; + border-collapse: collapse; + border-spacing: 0; + table-layout: fixed; + font-size: 1rem; + width: 100%; + margin-top: .75em; + margin-bottom: .5em; +} + +.picker__table th, .picker__table td { + text-align: center; +} + +.picker__table td { + margin: 0; + padding: 0; +} + +/** + * The weekday labels + */ +.picker__weekday { + width: 14.285714286%; + font-size: .75em; + padding-bottom: .25em; + color: #999999; + font-weight: 500; + /* Increase the spacing a tad */ +} + +@media (min-height: 33.875em) { + .picker__weekday { + padding-bottom: .5em; + } +} + +/** + * The days on the calendar + */ +.picker__day--today { + position: relative; + color: #595959; + letter-spacing: -.3; + padding: .75rem 0; + font-weight: 400; + border: 1px solid transparent; +} + +.picker__day--disabled:before { + border-top-color: #aaaaaa; +} + +.picker__day--infocus:hover { + cursor: pointer; + color: #000; + font-weight: 500; +} + +.picker__day--outfocus { + display: none; + padding: .75rem 0; + color: #fff; +} + +.picker__day--outfocus:hover { + cursor: pointer; + color: #dddddd; + font-weight: 500; +} + +.picker__day--highlighted:hover, +.picker--focused .picker__day--highlighted { + cursor: pointer; +} + +.picker__day--selected, +.picker__day--selected:hover, +.picker--focused .picker__day--selected { + border-radius: 50%; + -webkit-transform: scale(0.75); + transform: scale(0.75); + background: #0089ec; + color: #ffffff; +} + +.picker__day--disabled, +.picker__day--disabled:hover, +.picker--focused .picker__day--disabled { + background: #f5f5f5; + border-color: #f5f5f5; + color: #dddddd; + cursor: default; +} + +.picker__day--highlighted.picker__day--disabled, +.picker__day--highlighted.picker__day--disabled:hover { + background: #bbbbbb; +} + +/** + * The footer containing the "today", "clear", and "close" buttons. + */ +.picker__footer { + text-align: center; + display: -webkit-flex; + display: -ms-flexbox; + display: flex; + -webkit-align-items: center; + -ms-flex-align: center; + align-items: center; + -webkit-justify-content: space-between; + -ms-flex-pack: justify; + justify-content: space-between; +} + +.picker__button--today, +.picker__button--clear, +.picker__button--close { + border: 1px solid #ffffff; + background: #ffffff; + font-size: .8em; + padding: .66em 0; + font-weight: bold; + width: 33%; + display: inline-block; + vertical-align: bottom; +} + +.picker__button--today:hover, +.picker__button--clear:hover, +.picker__button--close:hover { + cursor: pointer; + color: #000000; + background: #b1dcfb; + border-bottom-color: #b1dcfb; +} + +.picker__button--today:focus, +.picker__button--clear:focus, +.picker__button--close:focus { + background: #b1dcfb; + border-color: rgba(0, 0, 0, 0.05); + outline: none; +} + +.picker__button--today:before, +.picker__button--clear:before, +.picker__button--close:before { + position: relative; + display: inline-block; + height: 0; +} + +.picker__button--today:before, +.picker__button--clear:before { + content: " "; + margin-right: .45em; +} + +.picker__button--today:before { + top: -0.05em; + width: 0; + border-top: 0.66em solid #0059bc; + border-left: .66em solid transparent; +} + +.picker__button--clear:before { + top: -0.25em; + width: .66em; + border-top: 3px solid #ee2200; +} + +.picker__button--close:before { + content: "\D7"; + top: -0.1em; + vertical-align: top; + font-size: 1.1em; + margin-right: .35em; + color: #777777; +} + +.picker__button--today[disabled], +.picker__button--today[disabled]:hover { + background: #f5f5f5; + border-color: #f5f5f5; + color: #dddddd; + cursor: default; +} + +.picker__button--today[disabled]:before { + border-top-color: #aaaaaa; +} + +/* ========================================================================== + CUSTOM MATERIALIZE STYLES + ========================================================================== */ +.picker__box { + border-radius: 2px; + overflow: hidden; +} + +.picker__date-display { + text-align: center; + background-color: #26a69a; + color: #fff; + padding-bottom: 15px; + font-weight: 300; +} + +.picker__nav--prev:hover, +.picker__nav--next:hover { + cursor: pointer; + color: #000000; + background: #a1ded8; +} + +.picker__weekday-display { + background-color: #1f897f; + padding: 10px; + font-weight: 200; + letter-spacing: .5; + font-size: 1rem; + margin-bottom: 15px; +} + +.picker__month-display { + text-transform: uppercase; + font-size: 2rem; +} + +.picker__day-display { + font-size: 4.5rem; + font-weight: 400; +} + +.picker__year-display { + font-size: 1.8rem; + color: rgba(255, 255, 255, 0.4); +} + +.picker__box { + padding: 0; +} + +.picker__calendar-container { + padding: 0 1rem; +} + +.picker__calendar-container thead { + border: none; +} + +.picker__table { + margin-top: 0; + margin-bottom: .5em; +} + +.picker__day--infocus { + color: #595959; + letter-spacing: -.3; + padding: .75rem 0; + font-weight: 400; + border: 1px solid transparent; +} + +.picker__day.picker__day--today { + color: #26a69a; +} + +.picker__day.picker__day--today.picker__day--selected { + color: #fff; +} + +.picker__weekday { + font-size: .9rem; +} + +.picker__day--selected, +.picker__day--selected:hover, +.picker--focused .picker__day--selected { + border-radius: 50%; + -webkit-transform: scale(0.9); + transform: scale(0.9); + background-color: #26a69a; + color: #ffffff; +} + +.picker__day--selected.picker__day--outfocus, +.picker__day--selected:hover.picker__day--outfocus, +.picker--focused .picker__day--selected.picker__day--outfocus { + background-color: #a1ded8; +} + +.picker__footer { + text-align: right; + padding: 5px 10px; +} + +.picker__close, .picker__today { + font-size: 1.1rem; + padding: 0 1rem; + color: #26a69a; +} + +.picker__nav--prev:before, +.picker__nav--next:before { + content: " "; + border-top: .5em solid transparent; + border-bottom: .5em solid transparent; + border-right: 0.75em solid #676767; + width: 0; + height: 0; + display: block; + margin: 0 auto; +} + +.picker__nav--next:before { + border-right: 0; + border-left: 0.75em solid #676767; +} + +button.picker__today:focus, button.picker__clear:focus, button.picker__close:focus { + background-color: #a1ded8; +} + +/* ========================================================================== + $BASE-TIME-PICKER + ========================================================================== */ +/** + * The list of times. + */ +.picker__list { + list-style: none; + padding: 0.75em 0 4.2em; + margin: 0; +} + +/** + * The times on the clock. + */ +.picker__list-item { + border-bottom: 1px solid #dddddd; + border-top: 1px solid #dddddd; + margin-bottom: -1px; + position: relative; + background: #ffffff; + padding: .75em 1.25em; +} + +@media (min-height: 46.75em) { + .picker__list-item { + padding: .5em 1em; + } +} + +/* Hovered time */ +.picker__list-item:hover { + cursor: pointer; + color: #000000; + background: #b1dcfb; + border-color: #0089ec; + z-index: 10; +} + +/* Highlighted and hovered/focused time */ +.picker__list-item--highlighted { + border-color: #0089ec; + z-index: 10; +} + +.picker__list-item--highlighted:hover, +.picker--focused .picker__list-item--highlighted { + cursor: pointer; + color: #000000; + background: #b1dcfb; +} + +/* Selected and hovered/focused time */ +.picker__list-item--selected, +.picker__list-item--selected:hover, +.picker--focused .picker__list-item--selected { + background: #0089ec; + color: #ffffff; + z-index: 10; +} + +/* Disabled time */ +.picker__list-item--disabled, +.picker__list-item--disabled:hover, +.picker--focused .picker__list-item--disabled { + background: #f5f5f5; + border-color: #f5f5f5; + color: #dddddd; + cursor: default; + border-color: #dddddd; + z-index: auto; +} + +/** + * The clear button + */ +.picker--time .picker__button--clear { + display: block; + width: 80%; + margin: 1em auto 0; + padding: 1em 1.25em; + background: none; + border: 0; + font-weight: 500; + font-size: .67em; + text-align: center; + text-transform: uppercase; + color: #666; +} + +.picker--time .picker__button--clear:hover, +.picker--time .picker__button--clear:focus { + color: #000000; + background: #b1dcfb; + background: #ee2200; + border-color: #ee2200; + cursor: pointer; + color: #ffffff; + outline: none; +} + +.picker--time .picker__button--clear:before { + top: -0.25em; + color: #666; + font-size: 1.25em; + font-weight: bold; +} + +.picker--time .picker__button--clear:hover:before, +.picker--time .picker__button--clear:focus:before { + color: #ffffff; +} + +/* ========================================================================== + $DEFAULT-TIME-PICKER + ========================================================================== */ +/** + * The frame the bounds the time picker. + */ +.picker--time .picker__frame { + min-width: 256px; + max-width: 320px; +} + +/** + * The picker box. + */ +.picker--time .picker__box { + font-size: 1em; + background: #f2f2f2; + padding: 0; +} + +@media (min-height: 40.125em) { + .picker--time .picker__box { + margin-bottom: 5em; + } +} diff --git a/css/materialize.min.css b/css/materialize.min.css new file mode 100644 index 0000000..f985c13 --- /dev/null +++ b/css/materialize.min.css @@ -0,0 +1,16 @@ +/*! + * Materialize v0.97.8 (http://materializecss.com) + * Copyright 2014-2015 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +.materialize-red{background-color:#e51c23 !important}.materialize-red-text{color:#e51c23 !important}.materialize-red.lighten-5{background-color:#fdeaeb !important}.materialize-red-text.text-lighten-5{color:#fdeaeb !important}.materialize-red.lighten-4{background-color:#f8c1c3 !important}.materialize-red-text.text-lighten-4{color:#f8c1c3 !important}.materialize-red.lighten-3{background-color:#f3989b !important}.materialize-red-text.text-lighten-3{color:#f3989b !important}.materialize-red.lighten-2{background-color:#ee6e73 !important}.materialize-red-text.text-lighten-2{color:#ee6e73 !important}.materialize-red.lighten-1{background-color:#ea454b !important}.materialize-red-text.text-lighten-1{color:#ea454b !important}.materialize-red.darken-1{background-color:#d0181e !important}.materialize-red-text.text-darken-1{color:#d0181e !important}.materialize-red.darken-2{background-color:#b9151b !important}.materialize-red-text.text-darken-2{color:#b9151b !important}.materialize-red.darken-3{background-color:#a21318 !important}.materialize-red-text.text-darken-3{color:#a21318 !important}.materialize-red.darken-4{background-color:#8b1014 !important}.materialize-red-text.text-darken-4{color:#8b1014 !important}.red{background-color:#F44336 !important}.red-text{color:#F44336 !important}.red.lighten-5{background-color:#FFEBEE !important}.red-text.text-lighten-5{color:#FFEBEE !important}.red.lighten-4{background-color:#FFCDD2 !important}.red-text.text-lighten-4{color:#FFCDD2 !important}.red.lighten-3{background-color:#EF9A9A !important}.red-text.text-lighten-3{color:#EF9A9A !important}.red.lighten-2{background-color:#E57373 !important}.red-text.text-lighten-2{color:#E57373 !important}.red.lighten-1{background-color:#EF5350 !important}.red-text.text-lighten-1{color:#EF5350 !important}.red.darken-1{background-color:#E53935 !important}.red-text.text-darken-1{color:#E53935 !important}.red.darken-2{background-color:#D32F2F !important}.red-text.text-darken-2{color:#D32F2F !important}.red.darken-3{background-color:#C62828 !important}.red-text.text-darken-3{color:#C62828 !important}.red.darken-4{background-color:#B71C1C !important}.red-text.text-darken-4{color:#B71C1C !important}.red.accent-1{background-color:#FF8A80 !important}.red-text.text-accent-1{color:#FF8A80 !important}.red.accent-2{background-color:#FF5252 !important}.red-text.text-accent-2{color:#FF5252 !important}.red.accent-3{background-color:#FF1744 !important}.red-text.text-accent-3{color:#FF1744 !important}.red.accent-4{background-color:#D50000 !important}.red-text.text-accent-4{color:#D50000 !important}.pink{background-color:#e91e63 !important}.pink-text{color:#e91e63 !important}.pink.lighten-5{background-color:#fce4ec !important}.pink-text.text-lighten-5{color:#fce4ec !important}.pink.lighten-4{background-color:#f8bbd0 !important}.pink-text.text-lighten-4{color:#f8bbd0 !important}.pink.lighten-3{background-color:#f48fb1 !important}.pink-text.text-lighten-3{color:#f48fb1 !important}.pink.lighten-2{background-color:#f06292 !important}.pink-text.text-lighten-2{color:#f06292 !important}.pink.lighten-1{background-color:#ec407a !important}.pink-text.text-lighten-1{color:#ec407a !important}.pink.darken-1{background-color:#d81b60 !important}.pink-text.text-darken-1{color:#d81b60 !important}.pink.darken-2{background-color:#c2185b !important}.pink-text.text-darken-2{color:#c2185b !important}.pink.darken-3{background-color:#ad1457 !important}.pink-text.text-darken-3{color:#ad1457 !important}.pink.darken-4{background-color:#880e4f !important}.pink-text.text-darken-4{color:#880e4f !important}.pink.accent-1{background-color:#ff80ab !important}.pink-text.text-accent-1{color:#ff80ab !important}.pink.accent-2{background-color:#ff4081 !important}.pink-text.text-accent-2{color:#ff4081 !important}.pink.accent-3{background-color:#f50057 !important}.pink-text.text-accent-3{color:#f50057 !important}.pink.accent-4{background-color:#c51162 !important}.pink-text.text-accent-4{color:#c51162 !important}.purple{background-color:#9c27b0 !important}.purple-text{color:#9c27b0 !important}.purple.lighten-5{background-color:#f3e5f5 !important}.purple-text.text-lighten-5{color:#f3e5f5 !important}.purple.lighten-4{background-color:#e1bee7 !important}.purple-text.text-lighten-4{color:#e1bee7 !important}.purple.lighten-3{background-color:#ce93d8 !important}.purple-text.text-lighten-3{color:#ce93d8 !important}.purple.lighten-2{background-color:#ba68c8 !important}.purple-text.text-lighten-2{color:#ba68c8 !important}.purple.lighten-1{background-color:#ab47bc !important}.purple-text.text-lighten-1{color:#ab47bc !important}.purple.darken-1{background-color:#8e24aa !important}.purple-text.text-darken-1{color:#8e24aa !important}.purple.darken-2{background-color:#7b1fa2 !important}.purple-text.text-darken-2{color:#7b1fa2 !important}.purple.darken-3{background-color:#6a1b9a !important}.purple-text.text-darken-3{color:#6a1b9a !important}.purple.darken-4{background-color:#4a148c !important}.purple-text.text-darken-4{color:#4a148c !important}.purple.accent-1{background-color:#ea80fc !important}.purple-text.text-accent-1{color:#ea80fc !important}.purple.accent-2{background-color:#e040fb !important}.purple-text.text-accent-2{color:#e040fb !important}.purple.accent-3{background-color:#d500f9 !important}.purple-text.text-accent-3{color:#d500f9 !important}.purple.accent-4{background-color:#a0f !important}.purple-text.text-accent-4{color:#a0f !important}.deep-purple{background-color:#673ab7 !important}.deep-purple-text{color:#673ab7 !important}.deep-purple.lighten-5{background-color:#ede7f6 !important}.deep-purple-text.text-lighten-5{color:#ede7f6 !important}.deep-purple.lighten-4{background-color:#d1c4e9 !important}.deep-purple-text.text-lighten-4{color:#d1c4e9 !important}.deep-purple.lighten-3{background-color:#b39ddb !important}.deep-purple-text.text-lighten-3{color:#b39ddb !important}.deep-purple.lighten-2{background-color:#9575cd !important}.deep-purple-text.text-lighten-2{color:#9575cd !important}.deep-purple.lighten-1{background-color:#7e57c2 !important}.deep-purple-text.text-lighten-1{color:#7e57c2 !important}.deep-purple.darken-1{background-color:#5e35b1 !important}.deep-purple-text.text-darken-1{color:#5e35b1 !important}.deep-purple.darken-2{background-color:#512da8 !important}.deep-purple-text.text-darken-2{color:#512da8 !important}.deep-purple.darken-3{background-color:#4527a0 !important}.deep-purple-text.text-darken-3{color:#4527a0 !important}.deep-purple.darken-4{background-color:#311b92 !important}.deep-purple-text.text-darken-4{color:#311b92 !important}.deep-purple.accent-1{background-color:#b388ff !important}.deep-purple-text.text-accent-1{color:#b388ff !important}.deep-purple.accent-2{background-color:#7c4dff !important}.deep-purple-text.text-accent-2{color:#7c4dff !important}.deep-purple.accent-3{background-color:#651fff !important}.deep-purple-text.text-accent-3{color:#651fff !important}.deep-purple.accent-4{background-color:#6200ea !important}.deep-purple-text.text-accent-4{color:#6200ea !important}.indigo{background-color:#3f51b5 !important}.indigo-text{color:#3f51b5 !important}.indigo.lighten-5{background-color:#e8eaf6 !important}.indigo-text.text-lighten-5{color:#e8eaf6 !important}.indigo.lighten-4{background-color:#c5cae9 !important}.indigo-text.text-lighten-4{color:#c5cae9 !important}.indigo.lighten-3{background-color:#9fa8da !important}.indigo-text.text-lighten-3{color:#9fa8da !important}.indigo.lighten-2{background-color:#7986cb !important}.indigo-text.text-lighten-2{color:#7986cb !important}.indigo.lighten-1{background-color:#5c6bc0 !important}.indigo-text.text-lighten-1{color:#5c6bc0 !important}.indigo.darken-1{background-color:#3949ab !important}.indigo-text.text-darken-1{color:#3949ab !important}.indigo.darken-2{background-color:#303f9f !important}.indigo-text.text-darken-2{color:#303f9f !important}.indigo.darken-3{background-color:#283593 !important}.indigo-text.text-darken-3{color:#283593 !important}.indigo.darken-4{background-color:#1a237e !important}.indigo-text.text-darken-4{color:#1a237e !important}.indigo.accent-1{background-color:#8c9eff !important}.indigo-text.text-accent-1{color:#8c9eff !important}.indigo.accent-2{background-color:#536dfe !important}.indigo-text.text-accent-2{color:#536dfe !important}.indigo.accent-3{background-color:#3d5afe !important}.indigo-text.text-accent-3{color:#3d5afe !important}.indigo.accent-4{background-color:#304ffe !important}.indigo-text.text-accent-4{color:#304ffe !important}.blue{background-color:#2196F3 !important}.blue-text{color:#2196F3 !important}.blue.lighten-5{background-color:#E3F2FD !important}.blue-text.text-lighten-5{color:#E3F2FD !important}.blue.lighten-4{background-color:#BBDEFB !important}.blue-text.text-lighten-4{color:#BBDEFB !important}.blue.lighten-3{background-color:#90CAF9 !important}.blue-text.text-lighten-3{color:#90CAF9 !important}.blue.lighten-2{background-color:#64B5F6 !important}.blue-text.text-lighten-2{color:#64B5F6 !important}.blue.lighten-1{background-color:#42A5F5 !important}.blue-text.text-lighten-1{color:#42A5F5 !important}.blue.darken-1{background-color:#1E88E5 !important}.blue-text.text-darken-1{color:#1E88E5 !important}.blue.darken-2{background-color:#1976D2 !important}.blue-text.text-darken-2{color:#1976D2 !important}.blue.darken-3{background-color:#1565C0 !important}.blue-text.text-darken-3{color:#1565C0 !important}.blue.darken-4{background-color:#0D47A1 !important}.blue-text.text-darken-4{color:#0D47A1 !important}.blue.accent-1{background-color:#82B1FF !important}.blue-text.text-accent-1{color:#82B1FF !important}.blue.accent-2{background-color:#448AFF !important}.blue-text.text-accent-2{color:#448AFF !important}.blue.accent-3{background-color:#2979FF !important}.blue-text.text-accent-3{color:#2979FF !important}.blue.accent-4{background-color:#2962FF !important}.blue-text.text-accent-4{color:#2962FF !important}.light-blue{background-color:#03a9f4 !important}.light-blue-text{color:#03a9f4 !important}.light-blue.lighten-5{background-color:#e1f5fe !important}.light-blue-text.text-lighten-5{color:#e1f5fe !important}.light-blue.lighten-4{background-color:#b3e5fc !important}.light-blue-text.text-lighten-4{color:#b3e5fc !important}.light-blue.lighten-3{background-color:#81d4fa !important}.light-blue-text.text-lighten-3{color:#81d4fa !important}.light-blue.lighten-2{background-color:#4fc3f7 !important}.light-blue-text.text-lighten-2{color:#4fc3f7 !important}.light-blue.lighten-1{background-color:#29b6f6 !important}.light-blue-text.text-lighten-1{color:#29b6f6 !important}.light-blue.darken-1{background-color:#039be5 !important}.light-blue-text.text-darken-1{color:#039be5 !important}.light-blue.darken-2{background-color:#0288d1 !important}.light-blue-text.text-darken-2{color:#0288d1 !important}.light-blue.darken-3{background-color:#0277bd !important}.light-blue-text.text-darken-3{color:#0277bd !important}.light-blue.darken-4{background-color:#01579b !important}.light-blue-text.text-darken-4{color:#01579b !important}.light-blue.accent-1{background-color:#80d8ff !important}.light-blue-text.text-accent-1{color:#80d8ff !important}.light-blue.accent-2{background-color:#40c4ff !important}.light-blue-text.text-accent-2{color:#40c4ff !important}.light-blue.accent-3{background-color:#00b0ff !important}.light-blue-text.text-accent-3{color:#00b0ff !important}.light-blue.accent-4{background-color:#0091ea !important}.light-blue-text.text-accent-4{color:#0091ea !important}.cyan{background-color:#00bcd4 !important}.cyan-text{color:#00bcd4 !important}.cyan.lighten-5{background-color:#e0f7fa !important}.cyan-text.text-lighten-5{color:#e0f7fa !important}.cyan.lighten-4{background-color:#b2ebf2 !important}.cyan-text.text-lighten-4{color:#b2ebf2 !important}.cyan.lighten-3{background-color:#80deea !important}.cyan-text.text-lighten-3{color:#80deea !important}.cyan.lighten-2{background-color:#4dd0e1 !important}.cyan-text.text-lighten-2{color:#4dd0e1 !important}.cyan.lighten-1{background-color:#26c6da !important}.cyan-text.text-lighten-1{color:#26c6da !important}.cyan.darken-1{background-color:#00acc1 !important}.cyan-text.text-darken-1{color:#00acc1 !important}.cyan.darken-2{background-color:#0097a7 !important}.cyan-text.text-darken-2{color:#0097a7 !important}.cyan.darken-3{background-color:#00838f !important}.cyan-text.text-darken-3{color:#00838f !important}.cyan.darken-4{background-color:#006064 !important}.cyan-text.text-darken-4{color:#006064 !important}.cyan.accent-1{background-color:#84ffff !important}.cyan-text.text-accent-1{color:#84ffff !important}.cyan.accent-2{background-color:#18ffff !important}.cyan-text.text-accent-2{color:#18ffff !important}.cyan.accent-3{background-color:#00e5ff !important}.cyan-text.text-accent-3{color:#00e5ff !important}.cyan.accent-4{background-color:#00b8d4 !important}.cyan-text.text-accent-4{color:#00b8d4 !important}.teal{background-color:#009688 !important}.teal-text{color:#009688 !important}.teal.lighten-5{background-color:#e0f2f1 !important}.teal-text.text-lighten-5{color:#e0f2f1 !important}.teal.lighten-4{background-color:#b2dfdb !important}.teal-text.text-lighten-4{color:#b2dfdb !important}.teal.lighten-3{background-color:#80cbc4 !important}.teal-text.text-lighten-3{color:#80cbc4 !important}.teal.lighten-2{background-color:#4db6ac !important}.teal-text.text-lighten-2{color:#4db6ac !important}.teal.lighten-1{background-color:#26a69a !important}.teal-text.text-lighten-1{color:#26a69a !important}.teal.darken-1{background-color:#00897b !important}.teal-text.text-darken-1{color:#00897b !important}.teal.darken-2{background-color:#00796b !important}.teal-text.text-darken-2{color:#00796b !important}.teal.darken-3{background-color:#00695c !important}.teal-text.text-darken-3{color:#00695c !important}.teal.darken-4{background-color:#004d40 !important}.teal-text.text-darken-4{color:#004d40 !important}.teal.accent-1{background-color:#a7ffeb !important}.teal-text.text-accent-1{color:#a7ffeb !important}.teal.accent-2{background-color:#64ffda !important}.teal-text.text-accent-2{color:#64ffda !important}.teal.accent-3{background-color:#1de9b6 !important}.teal-text.text-accent-3{color:#1de9b6 !important}.teal.accent-4{background-color:#00bfa5 !important}.teal-text.text-accent-4{color:#00bfa5 !important}.green{background-color:#4CAF50 !important}.green-text{color:#4CAF50 !important}.green.lighten-5{background-color:#E8F5E9 !important}.green-text.text-lighten-5{color:#E8F5E9 !important}.green.lighten-4{background-color:#C8E6C9 !important}.green-text.text-lighten-4{color:#C8E6C9 !important}.green.lighten-3{background-color:#A5D6A7 !important}.green-text.text-lighten-3{color:#A5D6A7 !important}.green.lighten-2{background-color:#81C784 !important}.green-text.text-lighten-2{color:#81C784 !important}.green.lighten-1{background-color:#66BB6A !important}.green-text.text-lighten-1{color:#66BB6A !important}.green.darken-1{background-color:#43A047 !important}.green-text.text-darken-1{color:#43A047 !important}.green.darken-2{background-color:#388E3C !important}.green-text.text-darken-2{color:#388E3C !important}.green.darken-3{background-color:#2E7D32 !important}.green-text.text-darken-3{color:#2E7D32 !important}.green.darken-4{background-color:#1B5E20 !important}.green-text.text-darken-4{color:#1B5E20 !important}.green.accent-1{background-color:#B9F6CA !important}.green-text.text-accent-1{color:#B9F6CA !important}.green.accent-2{background-color:#69F0AE !important}.green-text.text-accent-2{color:#69F0AE !important}.green.accent-3{background-color:#00E676 !important}.green-text.text-accent-3{color:#00E676 !important}.green.accent-4{background-color:#00C853 !important}.green-text.text-accent-4{color:#00C853 !important}.light-green{background-color:#8bc34a !important}.light-green-text{color:#8bc34a !important}.light-green.lighten-5{background-color:#f1f8e9 !important}.light-green-text.text-lighten-5{color:#f1f8e9 !important}.light-green.lighten-4{background-color:#dcedc8 !important}.light-green-text.text-lighten-4{color:#dcedc8 !important}.light-green.lighten-3{background-color:#c5e1a5 !important}.light-green-text.text-lighten-3{color:#c5e1a5 !important}.light-green.lighten-2{background-color:#aed581 !important}.light-green-text.text-lighten-2{color:#aed581 !important}.light-green.lighten-1{background-color:#9ccc65 !important}.light-green-text.text-lighten-1{color:#9ccc65 !important}.light-green.darken-1{background-color:#7cb342 !important}.light-green-text.text-darken-1{color:#7cb342 !important}.light-green.darken-2{background-color:#689f38 !important}.light-green-text.text-darken-2{color:#689f38 !important}.light-green.darken-3{background-color:#558b2f !important}.light-green-text.text-darken-3{color:#558b2f !important}.light-green.darken-4{background-color:#33691e !important}.light-green-text.text-darken-4{color:#33691e !important}.light-green.accent-1{background-color:#ccff90 !important}.light-green-text.text-accent-1{color:#ccff90 !important}.light-green.accent-2{background-color:#b2ff59 !important}.light-green-text.text-accent-2{color:#b2ff59 !important}.light-green.accent-3{background-color:#76ff03 !important}.light-green-text.text-accent-3{color:#76ff03 !important}.light-green.accent-4{background-color:#64dd17 !important}.light-green-text.text-accent-4{color:#64dd17 !important}.lime{background-color:#cddc39 !important}.lime-text{color:#cddc39 !important}.lime.lighten-5{background-color:#f9fbe7 !important}.lime-text.text-lighten-5{color:#f9fbe7 !important}.lime.lighten-4{background-color:#f0f4c3 !important}.lime-text.text-lighten-4{color:#f0f4c3 !important}.lime.lighten-3{background-color:#e6ee9c !important}.lime-text.text-lighten-3{color:#e6ee9c !important}.lime.lighten-2{background-color:#dce775 !important}.lime-text.text-lighten-2{color:#dce775 !important}.lime.lighten-1{background-color:#d4e157 !important}.lime-text.text-lighten-1{color:#d4e157 !important}.lime.darken-1{background-color:#c0ca33 !important}.lime-text.text-darken-1{color:#c0ca33 !important}.lime.darken-2{background-color:#afb42b !important}.lime-text.text-darken-2{color:#afb42b !important}.lime.darken-3{background-color:#9e9d24 !important}.lime-text.text-darken-3{color:#9e9d24 !important}.lime.darken-4{background-color:#827717 !important}.lime-text.text-darken-4{color:#827717 !important}.lime.accent-1{background-color:#f4ff81 !important}.lime-text.text-accent-1{color:#f4ff81 !important}.lime.accent-2{background-color:#eeff41 !important}.lime-text.text-accent-2{color:#eeff41 !important}.lime.accent-3{background-color:#c6ff00 !important}.lime-text.text-accent-3{color:#c6ff00 !important}.lime.accent-4{background-color:#aeea00 !important}.lime-text.text-accent-4{color:#aeea00 !important}.yellow{background-color:#ffeb3b !important}.yellow-text{color:#ffeb3b !important}.yellow.lighten-5{background-color:#fffde7 !important}.yellow-text.text-lighten-5{color:#fffde7 !important}.yellow.lighten-4{background-color:#fff9c4 !important}.yellow-text.text-lighten-4{color:#fff9c4 !important}.yellow.lighten-3{background-color:#fff59d !important}.yellow-text.text-lighten-3{color:#fff59d !important}.yellow.lighten-2{background-color:#fff176 !important}.yellow-text.text-lighten-2{color:#fff176 !important}.yellow.lighten-1{background-color:#ffee58 !important}.yellow-text.text-lighten-1{color:#ffee58 !important}.yellow.darken-1{background-color:#fdd835 !important}.yellow-text.text-darken-1{color:#fdd835 !important}.yellow.darken-2{background-color:#fbc02d !important}.yellow-text.text-darken-2{color:#fbc02d !important}.yellow.darken-3{background-color:#f9a825 !important}.yellow-text.text-darken-3{color:#f9a825 !important}.yellow.darken-4{background-color:#f57f17 !important}.yellow-text.text-darken-4{color:#f57f17 !important}.yellow.accent-1{background-color:#ffff8d !important}.yellow-text.text-accent-1{color:#ffff8d !important}.yellow.accent-2{background-color:#ff0 !important}.yellow-text.text-accent-2{color:#ff0 !important}.yellow.accent-3{background-color:#ffea00 !important}.yellow-text.text-accent-3{color:#ffea00 !important}.yellow.accent-4{background-color:#ffd600 !important}.yellow-text.text-accent-4{color:#ffd600 !important}.amber{background-color:#ffc107 !important}.amber-text{color:#ffc107 !important}.amber.lighten-5{background-color:#fff8e1 !important}.amber-text.text-lighten-5{color:#fff8e1 !important}.amber.lighten-4{background-color:#ffecb3 !important}.amber-text.text-lighten-4{color:#ffecb3 !important}.amber.lighten-3{background-color:#ffe082 !important}.amber-text.text-lighten-3{color:#ffe082 !important}.amber.lighten-2{background-color:#ffd54f !important}.amber-text.text-lighten-2{color:#ffd54f !important}.amber.lighten-1{background-color:#ffca28 !important}.amber-text.text-lighten-1{color:#ffca28 !important}.amber.darken-1{background-color:#ffb300 !important}.amber-text.text-darken-1{color:#ffb300 !important}.amber.darken-2{background-color:#ffa000 !important}.amber-text.text-darken-2{color:#ffa000 !important}.amber.darken-3{background-color:#ff8f00 !important}.amber-text.text-darken-3{color:#ff8f00 !important}.amber.darken-4{background-color:#ff6f00 !important}.amber-text.text-darken-4{color:#ff6f00 !important}.amber.accent-1{background-color:#ffe57f !important}.amber-text.text-accent-1{color:#ffe57f !important}.amber.accent-2{background-color:#ffd740 !important}.amber-text.text-accent-2{color:#ffd740 !important}.amber.accent-3{background-color:#ffc400 !important}.amber-text.text-accent-3{color:#ffc400 !important}.amber.accent-4{background-color:#ffab00 !important}.amber-text.text-accent-4{color:#ffab00 !important}.orange{background-color:#ff9800 !important}.orange-text{color:#ff9800 !important}.orange.lighten-5{background-color:#fff3e0 !important}.orange-text.text-lighten-5{color:#fff3e0 !important}.orange.lighten-4{background-color:#ffe0b2 !important}.orange-text.text-lighten-4{color:#ffe0b2 !important}.orange.lighten-3{background-color:#ffcc80 !important}.orange-text.text-lighten-3{color:#ffcc80 !important}.orange.lighten-2{background-color:#ffb74d !important}.orange-text.text-lighten-2{color:#ffb74d !important}.orange.lighten-1{background-color:#ffa726 !important}.orange-text.text-lighten-1{color:#ffa726 !important}.orange.darken-1{background-color:#fb8c00 !important}.orange-text.text-darken-1{color:#fb8c00 !important}.orange.darken-2{background-color:#f57c00 !important}.orange-text.text-darken-2{color:#f57c00 !important}.orange.darken-3{background-color:#ef6c00 !important}.orange-text.text-darken-3{color:#ef6c00 !important}.orange.darken-4{background-color:#e65100 !important}.orange-text.text-darken-4{color:#e65100 !important}.orange.accent-1{background-color:#ffd180 !important}.orange-text.text-accent-1{color:#ffd180 !important}.orange.accent-2{background-color:#ffab40 !important}.orange-text.text-accent-2{color:#ffab40 !important}.orange.accent-3{background-color:#ff9100 !important}.orange-text.text-accent-3{color:#ff9100 !important}.orange.accent-4{background-color:#ff6d00 !important}.orange-text.text-accent-4{color:#ff6d00 !important}.deep-orange{background-color:#ff5722 !important}.deep-orange-text{color:#ff5722 !important}.deep-orange.lighten-5{background-color:#fbe9e7 !important}.deep-orange-text.text-lighten-5{color:#fbe9e7 !important}.deep-orange.lighten-4{background-color:#ffccbc !important}.deep-orange-text.text-lighten-4{color:#ffccbc !important}.deep-orange.lighten-3{background-color:#ffab91 !important}.deep-orange-text.text-lighten-3{color:#ffab91 !important}.deep-orange.lighten-2{background-color:#ff8a65 !important}.deep-orange-text.text-lighten-2{color:#ff8a65 !important}.deep-orange.lighten-1{background-color:#ff7043 !important}.deep-orange-text.text-lighten-1{color:#ff7043 !important}.deep-orange.darken-1{background-color:#f4511e !important}.deep-orange-text.text-darken-1{color:#f4511e !important}.deep-orange.darken-2{background-color:#e64a19 !important}.deep-orange-text.text-darken-2{color:#e64a19 !important}.deep-orange.darken-3{background-color:#d84315 !important}.deep-orange-text.text-darken-3{color:#d84315 !important}.deep-orange.darken-4{background-color:#bf360c !important}.deep-orange-text.text-darken-4{color:#bf360c !important}.deep-orange.accent-1{background-color:#ff9e80 !important}.deep-orange-text.text-accent-1{color:#ff9e80 !important}.deep-orange.accent-2{background-color:#ff6e40 !important}.deep-orange-text.text-accent-2{color:#ff6e40 !important}.deep-orange.accent-3{background-color:#ff3d00 !important}.deep-orange-text.text-accent-3{color:#ff3d00 !important}.deep-orange.accent-4{background-color:#dd2c00 !important}.deep-orange-text.text-accent-4{color:#dd2c00 !important}.brown{background-color:#795548 !important}.brown-text{color:#795548 !important}.brown.lighten-5{background-color:#efebe9 !important}.brown-text.text-lighten-5{color:#efebe9 !important}.brown.lighten-4{background-color:#d7ccc8 !important}.brown-text.text-lighten-4{color:#d7ccc8 !important}.brown.lighten-3{background-color:#bcaaa4 !important}.brown-text.text-lighten-3{color:#bcaaa4 !important}.brown.lighten-2{background-color:#a1887f !important}.brown-text.text-lighten-2{color:#a1887f !important}.brown.lighten-1{background-color:#8d6e63 !important}.brown-text.text-lighten-1{color:#8d6e63 !important}.brown.darken-1{background-color:#6d4c41 !important}.brown-text.text-darken-1{color:#6d4c41 !important}.brown.darken-2{background-color:#5d4037 !important}.brown-text.text-darken-2{color:#5d4037 !important}.brown.darken-3{background-color:#4e342e !important}.brown-text.text-darken-3{color:#4e342e !important}.brown.darken-4{background-color:#3e2723 !important}.brown-text.text-darken-4{color:#3e2723 !important}.blue-grey{background-color:#607d8b !important}.blue-grey-text{color:#607d8b !important}.blue-grey.lighten-5{background-color:#eceff1 !important}.blue-grey-text.text-lighten-5{color:#eceff1 !important}.blue-grey.lighten-4{background-color:#cfd8dc !important}.blue-grey-text.text-lighten-4{color:#cfd8dc !important}.blue-grey.lighten-3{background-color:#b0bec5 !important}.blue-grey-text.text-lighten-3{color:#b0bec5 !important}.blue-grey.lighten-2{background-color:#90a4ae !important}.blue-grey-text.text-lighten-2{color:#90a4ae !important}.blue-grey.lighten-1{background-color:#78909c !important}.blue-grey-text.text-lighten-1{color:#78909c !important}.blue-grey.darken-1{background-color:#546e7a !important}.blue-grey-text.text-darken-1{color:#546e7a !important}.blue-grey.darken-2{background-color:#455a64 !important}.blue-grey-text.text-darken-2{color:#455a64 !important}.blue-grey.darken-3{background-color:#37474f !important}.blue-grey-text.text-darken-3{color:#37474f !important}.blue-grey.darken-4{background-color:#263238 !important}.blue-grey-text.text-darken-4{color:#263238 !important}.grey{background-color:#9e9e9e !important}.grey-text{color:#9e9e9e !important}.grey.lighten-5{background-color:#fafafa !important}.grey-text.text-lighten-5{color:#fafafa !important}.grey.lighten-4{background-color:#f5f5f5 !important}.grey-text.text-lighten-4{color:#f5f5f5 !important}.grey.lighten-3{background-color:#eee !important}.grey-text.text-lighten-3{color:#eee !important}.grey.lighten-2{background-color:#e0e0e0 !important}.grey-text.text-lighten-2{color:#e0e0e0 !important}.grey.lighten-1{background-color:#bdbdbd !important}.grey-text.text-lighten-1{color:#bdbdbd !important}.grey.darken-1{background-color:#757575 !important}.grey-text.text-darken-1{color:#757575 !important}.grey.darken-2{background-color:#616161 !important}.grey-text.text-darken-2{color:#616161 !important}.grey.darken-3{background-color:#424242 !important}.grey-text.text-darken-3{color:#424242 !important}.grey.darken-4{background-color:#212121 !important}.grey-text.text-darken-4{color:#212121 !important}.black{background-color:#000 !important}.black-text{color:#000 !important}.white{background-color:#fff !important}.white-text{color:#fff !important}.transparent{background-color:transparent !important}.transparent-text{color:transparent !important}/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */html{font-family:sans-serif;-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%}body{margin:0}article,aside,details,figcaption,figure,footer,header,hgroup,main,menu,nav,section,summary{display:block}audio,canvas,progress,video{display:inline-block;vertical-align:baseline}audio:not([controls]){display:none;height:0}[hidden],template{display:none}a{background-color:transparent}a:active,a:hover{outline:0}abbr[title]{border-bottom:1px dotted}b,strong{font-weight:bold}dfn{font-style:italic}h1{font-size:2em;margin:0.67em 0}mark{background:#ff0;color:#000}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sup{top:-0.5em}sub{bottom:-0.25em}img{border:0}svg:not(:root){overflow:hidden}figure{margin:1em 40px}hr{box-sizing:content-box;height:0}pre{overflow:auto}code,kbd,pre,samp{font-family:monospace, monospace;font-size:1em}button,input,optgroup,select,textarea{color:inherit;font:inherit;margin:0}button{overflow:visible}button,select{text-transform:none}button,html input[type="button"],input[type="reset"],input[type="submit"]{-webkit-appearance:button;cursor:pointer}button[disabled],html input[disabled]{cursor:default}button::-moz-focus-inner,input::-moz-focus-inner{border:0;padding:0}input{line-height:normal}input[type="checkbox"],input[type="radio"]{box-sizing:border-box;padding:0}input[type="number"]::-webkit-inner-spin-button,input[type="number"]::-webkit-outer-spin-button{height:auto}input[type="search"]{-webkit-appearance:textfield;box-sizing:content-box}input[type="search"]::-webkit-search-cancel-button,input[type="search"]::-webkit-search-decoration{-webkit-appearance:none}fieldset{border:1px solid #c0c0c0;margin:0 2px;padding:0.35em 0.625em 0.75em}legend{border:0;padding:0}textarea{overflow:auto}optgroup{font-weight:bold}table{border-collapse:collapse;border-spacing:0}td,th{padding:0}html{box-sizing:border-box}*,*:before,*:after{box-sizing:inherit}ul:not(.browser-default){padding-left:0;list-style-type:none}ul:not(.browser-default) li{list-style-type:none}a{color:#039be5;text-decoration:none;-webkit-tap-highlight-color:transparent}.valign-wrapper{display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center}.valign-wrapper .valign{display:block}.clearfix{clear:both}.z-depth-0{box-shadow:none !important}.z-depth-1,nav,.card-panel,.card,.toast,.btn,.btn-large,.btn-floating,.dropdown-content,.collapsible,.side-nav{box-shadow:0 2px 2px 0 rgba(0,0,0,0.14),0 1px 5px 0 rgba(0,0,0,0.12),0 3px 1px -2px rgba(0,0,0,0.2)}.z-depth-1-half,.btn:hover,.btn-large:hover,.btn-floating:hover{box-shadow:0 3px 3px 0 rgba(0,0,0,0.14),0 1px 7px 0 rgba(0,0,0,0.12),0 3px 1px -1px rgba(0,0,0,0.2)}.z-depth-2{box-shadow:0 4px 5px 0 rgba(0,0,0,0.14),0 1px 10px 0 rgba(0,0,0,0.12),0 2px 4px -1px rgba(0,0,0,0.3)}.z-depth-3{box-shadow:0 6px 10px 0 rgba(0,0,0,0.14),0 1px 18px 0 rgba(0,0,0,0.12),0 3px 5px -1px rgba(0,0,0,0.3)}.z-depth-4,.modal{box-shadow:0 8px 10px 1px rgba(0,0,0,0.14),0 3px 14px 2px rgba(0,0,0,0.12),0 5px 5px -3px rgba(0,0,0,0.3)}.z-depth-5{box-shadow:0 16px 24px 2px rgba(0,0,0,0.14),0 6px 30px 5px rgba(0,0,0,0.12),0 8px 10px -5px rgba(0,0,0,0.3)}.hoverable{transition:box-shadow .25s;box-shadow:0}.hoverable:hover{transition:box-shadow .25s;box-shadow:0 8px 17px 0 rgba(0,0,0,0.2),0 6px 20px 0 rgba(0,0,0,0.19)}.divider{height:1px;overflow:hidden;background-color:#e0e0e0}blockquote{margin:20px 0;padding-left:1.5rem;border-left:5px solid #ee6e73}i{line-height:inherit}i.left{float:left;margin-right:15px}i.right{float:right;margin-left:15px}i.tiny{font-size:1rem}i.small{font-size:2rem}i.medium{font-size:4rem}i.large{font-size:6rem}img.responsive-img,video.responsive-video{max-width:100%;height:auto}.pagination li{display:inline-block;border-radius:2px;text-align:center;vertical-align:top;height:30px}.pagination li a{color:#444;display:inline-block;font-size:1.2rem;padding:0 10px;line-height:30px}.pagination li.active a{color:#fff}.pagination li.active{background-color:#ee6e73}.pagination li.disabled a{cursor:default;color:#999}.pagination li i{font-size:2rem}.pagination li.pages ul li{display:inline-block;float:none}@media only screen and (max-width: 992px){.pagination{width:100%}.pagination li.prev,.pagination li.next{width:10%}.pagination li.pages{width:80%;overflow:hidden;white-space:nowrap}}.breadcrumb{font-size:18px;color:rgba(255,255,255,0.7)}.breadcrumb i,.breadcrumb [class^="mdi-"],.breadcrumb [class*="mdi-"],.breadcrumb i.material-icons{display:inline-block;float:left;font-size:24px}.breadcrumb:before{content:'\E5CC';color:rgba(255,255,255,0.7);vertical-align:top;display:inline-block;font-family:'Material Icons';font-weight:normal;font-style:normal;font-size:25px;margin:0 10px 0 8px;-webkit-font-smoothing:antialiased}.breadcrumb:first-child:before{display:none}.breadcrumb:last-child{color:#fff}.parallax-container{position:relative;overflow:hidden;height:500px}.parallax{position:absolute;top:0;left:0;right:0;bottom:0;z-index:-1}.parallax img{display:none;position:absolute;left:50%;bottom:0;min-width:100%;min-height:100%;-webkit-transform:translate3d(0, 0, 0);transform:translate3d(0, 0, 0);-webkit-transform:translateX(-50%);transform:translateX(-50%)}.pin-top,.pin-bottom{position:relative}.pinned{position:fixed !important}ul.staggered-list li{opacity:0}.fade-in{opacity:0;-webkit-transform-origin:0 50%;transform-origin:0 50%}@media only screen and (max-width: 600px){.hide-on-small-only,.hide-on-small-and-down{display:none !important}}@media only screen and (max-width: 992px){.hide-on-med-and-down{display:none !important}}@media only screen and (min-width: 601px){.hide-on-med-and-up{display:none !important}}@media only screen and (min-width: 600px) and (max-width: 992px){.hide-on-med-only{display:none !important}}@media only screen and (min-width: 993px){.hide-on-large-only{display:none !important}}@media only screen and (min-width: 993px){.show-on-large{display:block !important}}@media only screen and (min-width: 600px) and (max-width: 992px){.show-on-medium{display:block !important}}@media only screen and (max-width: 600px){.show-on-small{display:block !important}}@media only screen and (min-width: 601px){.show-on-medium-and-up{display:block !important}}@media only screen and (max-width: 992px){.show-on-medium-and-down{display:block !important}}@media only screen and (max-width: 600px){.center-on-small-only{text-align:center}}footer.page-footer{margin-top:20px;padding-top:20px;background-color:#ee6e73}footer.page-footer .footer-copyright{overflow:hidden;height:50px;line-height:50px;color:rgba(255,255,255,0.8);background-color:rgba(51,51,51,0.08)}table,th,td{border:none}table{width:100%;display:table}table.bordered>thead>tr,table.bordered>tbody>tr{border-bottom:1px solid #d0d0d0}table.striped>tbody>tr:nth-child(odd){background-color:#f2f2f2}table.striped>tbody>tr>td{border-radius:0}table.highlight>tbody>tr{transition:background-color .25s ease}table.highlight>tbody>tr:hover{background-color:#f2f2f2}table.centered thead tr th,table.centered tbody tr td{text-align:center}thead{border-bottom:1px solid #d0d0d0}td,th{padding:15px 5px;display:table-cell;text-align:left;vertical-align:middle;border-radius:2px}@media only screen and (max-width: 992px){table.responsive-table{width:100%;border-collapse:collapse;border-spacing:0;display:block;position:relative}table.responsive-table td:empty:before{content:'\00a0'}table.responsive-table th,table.responsive-table td{margin:0;vertical-align:top}table.responsive-table th{text-align:left}table.responsive-table thead{display:block;float:left}table.responsive-table thead tr{display:block;padding:0 10px 0 0}table.responsive-table thead tr th::before{content:"\00a0"}table.responsive-table tbody{display:block;width:auto;position:relative;overflow-x:auto;white-space:nowrap}table.responsive-table tbody tr{display:inline-block;vertical-align:top}table.responsive-table th{display:block;text-align:right}table.responsive-table td{display:block;min-height:1.25em;text-align:left}table.responsive-table tr{padding:0 10px}table.responsive-table thead{border:0;border-right:1px solid #d0d0d0}table.responsive-table.bordered th{border-bottom:0;border-left:0}table.responsive-table.bordered td{border-left:0;border-right:0;border-bottom:0}table.responsive-table.bordered tr{border:0}table.responsive-table.bordered tbody tr{border-right:1px solid #d0d0d0}}.collection{margin:0.5rem 0 1rem 0;border:1px solid #e0e0e0;border-radius:2px;overflow:hidden;position:relative}.collection .collection-item{background-color:#fff;line-height:1.5rem;padding:10px 20px;margin:0;border-bottom:1px solid #e0e0e0}.collection .collection-item.avatar{min-height:84px;padding-left:72px;position:relative}.collection .collection-item.avatar .circle{position:absolute;width:42px;height:42px;overflow:hidden;left:15px;display:inline-block;vertical-align:middle}.collection .collection-item.avatar i.circle{font-size:18px;line-height:42px;color:#fff;background-color:#999;text-align:center}.collection .collection-item.avatar .title{font-size:16px}.collection .collection-item.avatar p{margin:0}.collection .collection-item.avatar .secondary-content{position:absolute;top:16px;right:16px}.collection .collection-item:last-child{border-bottom:none}.collection .collection-item.active{background-color:#26a69a;color:#eafaf9}.collection .collection-item.active .secondary-content{color:#fff}.collection a.collection-item{display:block;transition:.25s;color:#26a69a}.collection a.collection-item:not(.active):hover{background-color:#ddd}.collection.with-header .collection-header{background-color:#fff;border-bottom:1px solid #e0e0e0;padding:10px 20px}.collection.with-header .collection-item{padding-left:30px}.collection.with-header .collection-item.avatar{padding-left:72px}.secondary-content{float:right;color:#26a69a}.collapsible .collection{margin:0;border:none}span.badge{min-width:3rem;padding:0 6px;margin-left:14px;text-align:center;font-size:1rem;line-height:inherit;color:#757575;float:right;box-sizing:border-box}span.badge.new{font-weight:300;font-size:0.8rem;color:#fff;background-color:#26a69a;border-radius:2px}span.badge.new:after{content:" new"}span.badge[data-badge-caption]::after{content:" " attr(data-badge-caption)}nav ul a span.badge{display:inline-block;float:none;margin-left:4px;line-height:22px;height:22px}.side-nav span.badge.new,.collapsible span.badge.new{position:relative;background-color:transparent}.side-nav span.badge.new::before,.collapsible span.badge.new::before{content:'';position:absolute;top:10px;right:0;bottom:10px;left:0;background-color:#26a69a;border-radius:2px;z-index:-1}.collapsible span.badge.new{z-index:1}.video-container{position:relative;padding-bottom:56.25%;height:0;overflow:hidden}.video-container iframe,.video-container object,.video-container embed{position:absolute;top:0;left:0;width:100%;height:100%}.progress{position:relative;height:4px;display:block;width:100%;background-color:#acece6;border-radius:2px;margin:0.5rem 0 1rem 0;overflow:hidden}.progress .determinate{position:absolute;top:0;left:0;bottom:0;background-color:#26a69a;transition:width .3s linear}.progress .indeterminate{background-color:#26a69a}.progress .indeterminate:before{content:'';position:absolute;background-color:inherit;top:0;left:0;bottom:0;will-change:left, right;-webkit-animation:indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite;animation:indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite}.progress .indeterminate:after{content:'';position:absolute;background-color:inherit;top:0;left:0;bottom:0;will-change:left, right;-webkit-animation:indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;animation:indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite;-webkit-animation-delay:1.15s;animation-delay:1.15s}@-webkit-keyframes indeterminate{0%{left:-35%;right:100%}60%{left:100%;right:-90%}100%{left:100%;right:-90%}}@keyframes indeterminate{0%{left:-35%;right:100%}60%{left:100%;right:-90%}100%{left:100%;right:-90%}}@-webkit-keyframes indeterminate-short{0%{left:-200%;right:100%}60%{left:107%;right:-8%}100%{left:107%;right:-8%}}@keyframes indeterminate-short{0%{left:-200%;right:100%}60%{left:107%;right:-8%}100%{left:107%;right:-8%}}.hide{display:none !important}.left-align{text-align:left}.right-align{text-align:right}.center,.center-align{text-align:center}.left{float:left !important}.right{float:right !important}.no-select,input[type=range],input[type=range]+.thumb{-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.circle{border-radius:50%}.center-block{display:block;margin-left:auto;margin-right:auto}.truncate{display:block;white-space:nowrap;overflow:hidden;text-overflow:ellipsis}.no-padding{padding:0 !important}.material-icons{text-rendering:optimizeLegibility;-webkit-font-feature-settings:'liga';-moz-font-feature-settings:'liga';font-feature-settings:'liga'}.container{margin:0 auto;max-width:1280px;width:90%}@media only screen and (min-width: 601px){.container{width:85%}}@media only screen and (min-width: 993px){.container{width:70%}}.container .row{margin-left:-0.75rem;margin-right:-0.75rem}.section{padding-top:1rem;padding-bottom:1rem}.section.no-pad{padding:0}.section.no-pad-bot{padding-bottom:0}.section.no-pad-top{padding-top:0}.row{margin-left:auto;margin-right:auto;margin-bottom:20px}.row:after{content:"";display:table;clear:both}.row .col{float:left;box-sizing:border-box;padding:0 0.75rem;min-height:1px}.row .col[class*="push-"],.row .col[class*="pull-"]{position:relative}.row .col.s1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.s4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.s7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.s10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.s11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.s12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-s1{margin-left:8.3333333333%}.row .col.pull-s1{right:8.3333333333%}.row .col.push-s1{left:8.3333333333%}.row .col.offset-s2{margin-left:16.6666666667%}.row .col.pull-s2{right:16.6666666667%}.row .col.push-s2{left:16.6666666667%}.row .col.offset-s3{margin-left:25%}.row .col.pull-s3{right:25%}.row .col.push-s3{left:25%}.row .col.offset-s4{margin-left:33.3333333333%}.row .col.pull-s4{right:33.3333333333%}.row .col.push-s4{left:33.3333333333%}.row .col.offset-s5{margin-left:41.6666666667%}.row .col.pull-s5{right:41.6666666667%}.row .col.push-s5{left:41.6666666667%}.row .col.offset-s6{margin-left:50%}.row .col.pull-s6{right:50%}.row .col.push-s6{left:50%}.row .col.offset-s7{margin-left:58.3333333333%}.row .col.pull-s7{right:58.3333333333%}.row .col.push-s7{left:58.3333333333%}.row .col.offset-s8{margin-left:66.6666666667%}.row .col.pull-s8{right:66.6666666667%}.row .col.push-s8{left:66.6666666667%}.row .col.offset-s9{margin-left:75%}.row .col.pull-s9{right:75%}.row .col.push-s9{left:75%}.row .col.offset-s10{margin-left:83.3333333333%}.row .col.pull-s10{right:83.3333333333%}.row .col.push-s10{left:83.3333333333%}.row .col.offset-s11{margin-left:91.6666666667%}.row .col.pull-s11{right:91.6666666667%}.row .col.push-s11{left:91.6666666667%}.row .col.offset-s12{margin-left:100%}.row .col.pull-s12{right:100%}.row .col.push-s12{left:100%}@media only screen and (min-width: 601px){.row .col.m1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.m4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.m7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.m10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.m11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.m12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-m1{margin-left:8.3333333333%}.row .col.pull-m1{right:8.3333333333%}.row .col.push-m1{left:8.3333333333%}.row .col.offset-m2{margin-left:16.6666666667%}.row .col.pull-m2{right:16.6666666667%}.row .col.push-m2{left:16.6666666667%}.row .col.offset-m3{margin-left:25%}.row .col.pull-m3{right:25%}.row .col.push-m3{left:25%}.row .col.offset-m4{margin-left:33.3333333333%}.row .col.pull-m4{right:33.3333333333%}.row .col.push-m4{left:33.3333333333%}.row .col.offset-m5{margin-left:41.6666666667%}.row .col.pull-m5{right:41.6666666667%}.row .col.push-m5{left:41.6666666667%}.row .col.offset-m6{margin-left:50%}.row .col.pull-m6{right:50%}.row .col.push-m6{left:50%}.row .col.offset-m7{margin-left:58.3333333333%}.row .col.pull-m7{right:58.3333333333%}.row .col.push-m7{left:58.3333333333%}.row .col.offset-m8{margin-left:66.6666666667%}.row .col.pull-m8{right:66.6666666667%}.row .col.push-m8{left:66.6666666667%}.row .col.offset-m9{margin-left:75%}.row .col.pull-m9{right:75%}.row .col.push-m9{left:75%}.row .col.offset-m10{margin-left:83.3333333333%}.row .col.pull-m10{right:83.3333333333%}.row .col.push-m10{left:83.3333333333%}.row .col.offset-m11{margin-left:91.6666666667%}.row .col.pull-m11{right:91.6666666667%}.row .col.push-m11{left:91.6666666667%}.row .col.offset-m12{margin-left:100%}.row .col.pull-m12{right:100%}.row .col.push-m12{left:100%}}@media only screen and (min-width: 993px){.row .col.l1{width:8.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l2{width:16.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l3{width:25%;margin-left:auto;left:auto;right:auto}.row .col.l4{width:33.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l5{width:41.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l6{width:50%;margin-left:auto;left:auto;right:auto}.row .col.l7{width:58.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l8{width:66.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l9{width:75%;margin-left:auto;left:auto;right:auto}.row .col.l10{width:83.3333333333%;margin-left:auto;left:auto;right:auto}.row .col.l11{width:91.6666666667%;margin-left:auto;left:auto;right:auto}.row .col.l12{width:100%;margin-left:auto;left:auto;right:auto}.row .col.offset-l1{margin-left:8.3333333333%}.row .col.pull-l1{right:8.3333333333%}.row .col.push-l1{left:8.3333333333%}.row .col.offset-l2{margin-left:16.6666666667%}.row .col.pull-l2{right:16.6666666667%}.row .col.push-l2{left:16.6666666667%}.row .col.offset-l3{margin-left:25%}.row .col.pull-l3{right:25%}.row .col.push-l3{left:25%}.row .col.offset-l4{margin-left:33.3333333333%}.row .col.pull-l4{right:33.3333333333%}.row .col.push-l4{left:33.3333333333%}.row .col.offset-l5{margin-left:41.6666666667%}.row .col.pull-l5{right:41.6666666667%}.row .col.push-l5{left:41.6666666667%}.row .col.offset-l6{margin-left:50%}.row .col.pull-l6{right:50%}.row .col.push-l6{left:50%}.row .col.offset-l7{margin-left:58.3333333333%}.row .col.pull-l7{right:58.3333333333%}.row .col.push-l7{left:58.3333333333%}.row .col.offset-l8{margin-left:66.6666666667%}.row .col.pull-l8{right:66.6666666667%}.row .col.push-l8{left:66.6666666667%}.row .col.offset-l9{margin-left:75%}.row .col.pull-l9{right:75%}.row .col.push-l9{left:75%}.row .col.offset-l10{margin-left:83.3333333333%}.row .col.pull-l10{right:83.3333333333%}.row .col.push-l10{left:83.3333333333%}.row .col.offset-l11{margin-left:91.6666666667%}.row .col.pull-l11{right:91.6666666667%}.row .col.push-l11{left:91.6666666667%}.row .col.offset-l12{margin-left:100%}.row .col.pull-l12{right:100%}.row .col.push-l12{left:100%}}nav{color:#fff;background-color:#ee6e73;width:100%;height:56px;line-height:56px}nav.nav-extended{height:auto}nav.nav-extended .nav-wrapper{height:auto}nav a{color:#fff}nav i,nav [class^="mdi-"],nav [class*="mdi-"],nav i.material-icons{display:block;font-size:24px;height:56px;line-height:56px}nav .nav-wrapper{position:relative;height:100%}@media only screen and (min-width: 993px){nav a.button-collapse{display:none}}nav .button-collapse{float:left;position:relative;z-index:1;height:56px;margin:0 18px}nav .button-collapse i{height:56px;line-height:56px}nav .brand-logo{position:absolute;color:#fff;display:inline-block;font-size:2.1rem;padding:0;white-space:nowrap}nav .brand-logo.center{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}@media only screen and (max-width: 992px){nav .brand-logo{left:50%;-webkit-transform:translateX(-50%);transform:translateX(-50%)}nav .brand-logo.left,nav .brand-logo.right{padding:0;-webkit-transform:none;transform:none}nav .brand-logo.left{left:0.5rem}nav .brand-logo.right{right:0.5rem;left:auto}}nav .brand-logo.right{right:0.5rem;padding:0}nav .brand-logo i,nav .brand-logo [class^="mdi-"],nav .brand-logo [class*="mdi-"],nav .brand-logo i.material-icons{float:left;margin-right:15px}nav ul{margin:0}nav ul li{transition:background-color .3s;float:left;padding:0}nav ul li.active{background-color:rgba(0,0,0,0.1)}nav ul a{transition:background-color .3s;font-size:1rem;color:#fff;display:block;padding:0 15px;cursor:pointer}nav ul a.btn,nav ul a.btn-large,nav ul a.btn-large,nav ul a.btn-flat,nav ul a.btn-floating{margin-top:-2px;margin-left:15px;margin-right:15px}nav ul a:hover{background-color:rgba(0,0,0,0.1)}nav ul.left{float:left}nav form{height:100%}nav .input-field{margin:0;height:100%}nav .input-field input{height:100%;font-size:1.2rem;border:none;padding-left:2rem}nav .input-field input:focus,nav .input-field input[type=text]:valid,nav .input-field input[type=password]:valid,nav .input-field input[type=email]:valid,nav .input-field input[type=url]:valid,nav .input-field input[type=date]:valid{border:none;box-shadow:none}nav .input-field label{top:0;left:0}nav .input-field label i{color:rgba(255,255,255,0.7);transition:color .3s}nav .input-field label.active i{color:#fff}nav .input-field label.active{-webkit-transform:translateY(0);transform:translateY(0)}.navbar-fixed{position:relative;height:56px;z-index:997}.navbar-fixed nav{position:fixed}@media only screen and (min-width: 601px){nav,nav .nav-wrapper i,nav a.button-collapse,nav a.button-collapse i{height:64px;line-height:64px}.navbar-fixed{height:64px}}@font-face{font-family:"Roboto";src:local(Roboto Thin),url("../fonts/roboto/Roboto-Thin.eot");src:url("../fonts/roboto/Roboto-Thin.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Thin.woff2") format("woff2"),url("../fonts/roboto/Roboto-Thin.woff") format("woff"),url("../fonts/roboto/Roboto-Thin.ttf") format("truetype");font-weight:200}@font-face{font-family:"Roboto";src:local(Roboto Light),url("../fonts/roboto/Roboto-Light.eot");src:url("../fonts/roboto/Roboto-Light.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Light.woff2") format("woff2"),url("../fonts/roboto/Roboto-Light.woff") format("woff"),url("../fonts/roboto/Roboto-Light.ttf") format("truetype");font-weight:300}@font-face{font-family:"Roboto";src:local(Roboto Regular),url("../fonts/roboto/Roboto-Regular.eot");src:url("../fonts/roboto/Roboto-Regular.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Regular.woff2") format("woff2"),url("../fonts/roboto/Roboto-Regular.woff") format("woff"),url("../fonts/roboto/Roboto-Regular.ttf") format("truetype");font-weight:400}@font-face{font-family:"Roboto";src:url("../fonts/roboto/Roboto-Medium.eot");src:url("../fonts/roboto/Roboto-Medium.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Medium.woff2") format("woff2"),url("../fonts/roboto/Roboto-Medium.woff") format("woff"),url("../fonts/roboto/Roboto-Medium.ttf") format("truetype");font-weight:500}@font-face{font-family:"Roboto";src:url("../fonts/roboto/Roboto-Bold.eot");src:url("../fonts/roboto/Roboto-Bold.eot?#iefix") format("embedded-opentype"),url("../fonts/roboto/Roboto-Bold.woff2") format("woff2"),url("../fonts/roboto/Roboto-Bold.woff") format("woff"),url("../fonts/roboto/Roboto-Bold.ttf") format("truetype");font-weight:700}a{text-decoration:none}html{line-height:1.5;font-family:"Roboto", sans-serif;font-weight:normal;color:rgba(0,0,0,0.87)}@media only screen and (min-width: 0){html{font-size:14px}}@media only screen and (min-width: 992px){html{font-size:14.5px}}@media only screen and (min-width: 1200px){html{font-size:15px}}h1,h2,h3,h4,h5,h6{font-weight:400;line-height:1.1}h1 a,h2 a,h3 a,h4 a,h5 a,h6 a{font-weight:inherit}h1{font-size:4.2rem;line-height:110%;margin:2.1rem 0 1.68rem 0}h2{font-size:3.56rem;line-height:110%;margin:1.78rem 0 1.424rem 0}h3{font-size:2.92rem;line-height:110%;margin:1.46rem 0 1.168rem 0}h4{font-size:2.28rem;line-height:110%;margin:1.14rem 0 0.912rem 0}h5{font-size:1.64rem;line-height:110%;margin:0.82rem 0 0.656rem 0}h6{font-size:1rem;line-height:110%;margin:0.5rem 0 0.4rem 0}em{font-style:italic}strong{font-weight:500}small{font-size:75%}.light,footer.page-footer .footer-copyright{font-weight:300}.thin{font-weight:200}.flow-text{font-weight:300}@media only screen and (min-width: 360px){.flow-text{font-size:1.2rem}}@media only screen and (min-width: 390px){.flow-text{font-size:1.224rem}}@media only screen and (min-width: 420px){.flow-text{font-size:1.248rem}}@media only screen and (min-width: 450px){.flow-text{font-size:1.272rem}}@media only screen and (min-width: 480px){.flow-text{font-size:1.296rem}}@media only screen and (min-width: 510px){.flow-text{font-size:1.32rem}}@media only screen and (min-width: 540px){.flow-text{font-size:1.344rem}}@media only screen and (min-width: 570px){.flow-text{font-size:1.368rem}}@media only screen and (min-width: 600px){.flow-text{font-size:1.392rem}}@media only screen and (min-width: 630px){.flow-text{font-size:1.416rem}}@media only screen and (min-width: 660px){.flow-text{font-size:1.44rem}}@media only screen and (min-width: 690px){.flow-text{font-size:1.464rem}}@media only screen and (min-width: 720px){.flow-text{font-size:1.488rem}}@media only screen and (min-width: 750px){.flow-text{font-size:1.512rem}}@media only screen and (min-width: 780px){.flow-text{font-size:1.536rem}}@media only screen and (min-width: 810px){.flow-text{font-size:1.56rem}}@media only screen and (min-width: 840px){.flow-text{font-size:1.584rem}}@media only screen and (min-width: 870px){.flow-text{font-size:1.608rem}}@media only screen and (min-width: 900px){.flow-text{font-size:1.632rem}}@media only screen and (min-width: 930px){.flow-text{font-size:1.656rem}}@media only screen and (min-width: 960px){.flow-text{font-size:1.68rem}}@media only screen and (max-width: 360px){.flow-text{font-size:1.2rem}}.card-panel{transition:box-shadow .25s;padding:20px;margin:0.5rem 0 1rem 0;border-radius:2px;background-color:#fff}.card{position:relative;margin:0.5rem 0 1rem 0;background-color:#fff;transition:box-shadow .25s;border-radius:2px}.card .card-title{font-size:24px;font-weight:300}.card .card-title.activator{cursor:pointer}.card.small,.card.medium,.card.large{position:relative}.card.small .card-image,.card.medium .card-image,.card.large .card-image{max-height:60%;overflow:hidden}.card.small .card-image+.card-content,.card.medium .card-image+.card-content,.card.large .card-image+.card-content{max-height:40%}.card.small .card-content,.card.medium .card-content,.card.large .card-content{max-height:100%;overflow:hidden}.card.small .card-action,.card.medium .card-action,.card.large .card-action{position:absolute;bottom:0;left:0;right:0}.card.small{height:300px}.card.medium{height:400px}.card.large{height:500px}.card.horizontal{display:-webkit-flex;display:-ms-flexbox;display:flex}.card.horizontal.small .card-image,.card.horizontal.medium .card-image,.card.horizontal.large .card-image{height:100%;max-height:none;overflow:visible}.card.horizontal.small .card-image img,.card.horizontal.medium .card-image img,.card.horizontal.large .card-image img{height:100%}.card.horizontal .card-image{max-width:50%}.card.horizontal .card-image img{border-radius:2px 0 0 2px;max-width:100%;width:auto}.card.horizontal .card-stacked{display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-flex:1;-ms-flex:1;flex:1;position:relative}.card.horizontal .card-stacked .card-content{-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.card.sticky-action .card-action{z-index:2}.card.sticky-action .card-reveal{z-index:1;padding-bottom:64px}.card .card-image{position:relative}.card .card-image img{display:block;border-radius:2px 2px 0 0;position:relative;left:0;right:0;top:0;bottom:0;width:100%}.card .card-image .card-title{color:#fff;position:absolute;bottom:0;left:0;padding:20px}.card .card-content{padding:20px;border-radius:0 0 2px 2px}.card .card-content p{margin:0;color:inherit}.card .card-content .card-title{line-height:48px}.card .card-action{position:relative;background-color:inherit;border-top:1px solid rgba(160,160,160,0.2);padding:20px}.card .card-action a:not(.btn):not(.btn-large):not(.btn-floating){color:#ffab40;margin-right:20px;transition:color .3s ease;text-transform:uppercase}.card .card-action a:not(.btn):not(.btn-large):not(.btn-floating):hover{color:#ffd8a6}.card .card-reveal{padding:20px;position:absolute;background-color:#fff;width:100%;overflow-y:auto;left:0;top:100%;height:100%;z-index:3;display:none}.card .card-reveal .card-title{cursor:pointer;display:block}#toast-container{display:block;position:fixed;z-index:10000}@media only screen and (max-width: 600px){#toast-container{min-width:100%;bottom:0%}}@media only screen and (min-width: 601px) and (max-width: 992px){#toast-container{left:5%;bottom:7%;max-width:90%}}@media only screen and (min-width: 993px){#toast-container{top:10%;right:7%;max-width:86%}}.toast{border-radius:2px;top:0;width:auto;clear:both;margin-top:10px;position:relative;max-width:100%;height:auto;min-height:48px;line-height:1.5em;word-break:break-all;background-color:#323232;padding:10px 25px;font-size:1.1rem;font-weight:300;color:#fff;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}.toast .btn,.toast .btn-large,.toast .btn-flat{margin:0;margin-left:3rem}.toast.rounded{border-radius:24px}@media only screen and (max-width: 600px){.toast{width:100%;border-radius:0}}@media only screen and (min-width: 601px) and (max-width: 992px){.toast{float:left}}@media only screen and (min-width: 993px){.toast{float:right}}.tabs{position:relative;overflow-x:auto;overflow-y:hidden;height:48px;width:100%;background-color:#fff;margin:0 auto;white-space:nowrap}.tabs.tabs-transparent{background-color:transparent}.tabs.tabs-transparent .tab a,.tabs.tabs-transparent .tab.disabled a,.tabs.tabs-transparent .tab.disabled a:hover{color:rgba(255,255,255,0.7)}.tabs.tabs-transparent .tab a:hover,.tabs.tabs-transparent .tab a.active{color:#fff}.tabs.tabs-transparent .indicator{background-color:#fff}.tabs.tabs-fixed-width{display:-webkit-flex;display:-ms-flexbox;display:flex}.tabs.tabs-fixed-width .tab{-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.tabs .tab{display:inline-block;text-align:center;line-height:48px;height:48px;padding:0;margin:0;text-transform:uppercase}.tabs .tab a{color:rgba(238,110,115,0.7);display:block;width:100%;height:100%;padding:0 24px;font-size:14px;text-overflow:ellipsis;overflow:hidden;transition:color .28s ease}.tabs .tab a:hover,.tabs .tab a.active{background-color:transparent;color:#ee6e73}.tabs .tab.disabled a,.tabs .tab.disabled a:hover{color:rgba(238,110,115,0.7);cursor:default}.tabs .indicator{position:absolute;bottom:0;height:2px;background-color:#f6b2b5;will-change:left, right}@media only screen and (max-width: 992px){.tabs{display:-webkit-flex;display:-ms-flexbox;display:flex}.tabs .tab{-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.tabs .tab a{padding:0 12px}}.material-tooltip{padding:10px 8px;font-size:1rem;z-index:2000;background-color:transparent;border-radius:2px;color:#fff;min-height:36px;line-height:120%;opacity:0;display:none;position:absolute;text-align:center;max-width:calc(100% - 4px);overflow:hidden;left:0;top:0;pointer-events:none}.backdrop{position:absolute;opacity:0;display:none;height:7px;width:14px;border-radius:0 0 50% 50%;background-color:#323232;z-index:-1;-webkit-transform-origin:50% 0%;transform-origin:50% 0%;-webkit-transform:translate3d(0, 0, 0);transform:translate3d(0, 0, 0)}.btn,.btn-large,.btn-flat{border:none;border-radius:2px;display:inline-block;height:36px;line-height:36px;padding:0 2rem;text-transform:uppercase;vertical-align:middle;-webkit-tap-highlight-color:transparent}.btn.disabled,.disabled.btn-large,.btn-floating.disabled,.btn-large.disabled,.btn-flat.disabled,.btn:disabled,.btn-large:disabled,.btn-floating:disabled,.btn-large:disabled,.btn-flat:disabled,.btn[disabled],[disabled].btn-large,.btn-floating[disabled],.btn-large[disabled],.btn-flat[disabled]{pointer-events:none;background-color:#DFDFDF !important;box-shadow:none;color:#9F9F9F !important;cursor:default}.btn.disabled:hover,.disabled.btn-large:hover,.btn-floating.disabled:hover,.btn-large.disabled:hover,.btn-flat.disabled:hover,.btn:disabled:hover,.btn-large:disabled:hover,.btn-floating:disabled:hover,.btn-large:disabled:hover,.btn-flat:disabled:hover,.btn[disabled]:hover,[disabled].btn-large:hover,.btn-floating[disabled]:hover,.btn-large[disabled]:hover,.btn-flat[disabled]:hover{background-color:#DFDFDF !important;color:#9F9F9F !important}.btn,.btn-large,.btn-floating,.btn-large,.btn-flat{outline:0}.btn i,.btn-large i,.btn-floating i,.btn-large i,.btn-flat i{font-size:1.3rem;line-height:inherit}.btn:focus,.btn-large:focus,.btn-floating:focus{background-color:#1d7d74}.btn,.btn-large{text-decoration:none;color:#fff;background-color:#26a69a;text-align:center;letter-spacing:.5px;transition:.2s ease-out;cursor:pointer}.btn:hover,.btn-large:hover{background-color:#2bbbad}.btn-floating{display:inline-block;color:#fff;position:relative;overflow:hidden;z-index:1;width:40px;height:40px;line-height:40px;padding:0;background-color:#26a69a;border-radius:50%;transition:.3s;cursor:pointer;vertical-align:middle}.btn-floating i{width:inherit;display:inline-block;text-align:center;color:#fff;font-size:1.6rem;line-height:40px}.btn-floating:hover{background-color:#26a69a}.btn-floating:before{border-radius:0}.btn-floating.btn-large{width:56px;height:56px}.btn-floating.btn-large i{line-height:56px}button.btn-floating{border:none}.fixed-action-btn{position:fixed;right:23px;bottom:23px;padding-top:15px;margin-bottom:0;z-index:998}.fixed-action-btn.active ul{visibility:visible}.fixed-action-btn.horizontal{padding:0 0 0 15px}.fixed-action-btn.horizontal ul{text-align:right;right:64px;top:50%;-webkit-transform:translateY(-50%);transform:translateY(-50%);height:100%;left:auto;width:500px}.fixed-action-btn.horizontal ul li{display:inline-block;margin:15px 15px 0 0}.fixed-action-btn.toolbar{padding:0;height:56px}.fixed-action-btn.toolbar.active>a i{opacity:0}.fixed-action-btn.toolbar ul{display:-webkit-flex;display:-ms-flexbox;display:flex;top:0;bottom:0}.fixed-action-btn.toolbar ul li{-webkit-flex:1;-ms-flex:1;flex:1;display:inline-block;margin:0;height:100%;transition:none}.fixed-action-btn.toolbar ul li a{display:block;overflow:hidden;position:relative;width:100%;height:100%;background-color:transparent;box-shadow:none;color:#fff;line-height:56px;z-index:1}.fixed-action-btn.toolbar ul li a i{line-height:inherit}.fixed-action-btn ul{left:0;right:0;text-align:center;position:absolute;bottom:64px;margin:0;visibility:hidden}.fixed-action-btn ul li{margin-bottom:15px}.fixed-action-btn ul a.btn-floating{opacity:0}.fixed-action-btn .fab-backdrop{position:absolute;top:0;left:0;z-index:-1;width:40px;height:40px;background-color:#26a69a;border-radius:50%;-webkit-transform:scale(0);transform:scale(0)}.btn-flat{box-shadow:none;background-color:transparent;color:#343434;cursor:pointer;transition:background-color .2s}.btn-flat:focus,.btn-flat:active{background-color:transparent}.btn-flat:focus,.btn-flat:hover{background-color:rgba(0,0,0,0.1);box-shadow:none}.btn-flat:active{background-color:rgba(0,0,0,0.2)}.btn-flat.disabled{background-color:transparent !important;color:#b3b3b3 !important;cursor:default}.btn-large{height:54px;line-height:54px}.btn-large i{font-size:1.6rem}.btn-block{display:block}.dropdown-content{background-color:#fff;margin:0;display:none;min-width:100px;max-height:650px;overflow-y:auto;opacity:0;position:absolute;z-index:999;will-change:width, height}.dropdown-content li{clear:both;color:rgba(0,0,0,0.87);cursor:pointer;min-height:50px;line-height:1.5rem;width:100%;text-align:left;text-transform:none}.dropdown-content li:hover,.dropdown-content li.active,.dropdown-content li.selected{background-color:#eee}.dropdown-content li.active.selected{background-color:#e1e1e1}.dropdown-content li.divider{min-height:0;height:1px}.dropdown-content li>a,.dropdown-content li>span{font-size:16px;color:#26a69a;display:block;line-height:22px;padding:14px 16px}.dropdown-content li>span>label{top:1px;left:0;height:18px}.dropdown-content li>a>i{height:inherit;line-height:inherit}.input-field.col .dropdown-content [type="checkbox"]+label{top:1px;left:0;height:18px}/*! + * Waves v0.6.0 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */.waves-effect{position:relative;cursor:pointer;display:inline-block;overflow:hidden;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;-webkit-tap-highlight-color:transparent;vertical-align:middle;z-index:1;will-change:opacity, transform;transition:.3s ease-out}.waves-effect .waves-ripple{position:absolute;border-radius:50%;width:20px;height:20px;margin-top:-10px;margin-left:-10px;opacity:0;background:rgba(0,0,0,0.2);transition:all 0.7s ease-out;transition-property:opacity, -webkit-transform;transition-property:transform, opacity;transition-property:transform, opacity, -webkit-transform;-webkit-transform:scale(0);transform:scale(0);pointer-events:none}.waves-effect.waves-light .waves-ripple{background-color:rgba(255,255,255,0.45)}.waves-effect.waves-red .waves-ripple{background-color:rgba(244,67,54,0.7)}.waves-effect.waves-yellow .waves-ripple{background-color:rgba(255,235,59,0.7)}.waves-effect.waves-orange .waves-ripple{background-color:rgba(255,152,0,0.7)}.waves-effect.waves-purple .waves-ripple{background-color:rgba(156,39,176,0.7)}.waves-effect.waves-green .waves-ripple{background-color:rgba(76,175,80,0.7)}.waves-effect.waves-teal .waves-ripple{background-color:rgba(0,150,136,0.7)}.waves-effect input[type="button"],.waves-effect input[type="reset"],.waves-effect input[type="submit"]{border:0;font-style:normal;font-size:inherit;text-transform:inherit;background:none}.waves-effect img{position:relative;z-index:-1}.waves-notransition{transition:none !important}.waves-circle{-webkit-transform:translateZ(0);transform:translateZ(0);-webkit-mask-image:-webkit-radial-gradient(circle, #fff 100%, #000 100%)}.waves-input-wrapper{border-radius:0.2em;vertical-align:bottom}.waves-input-wrapper .waves-button-input{position:relative;top:0;left:0;z-index:1}.waves-circle{text-align:center;width:2.5em;height:2.5em;line-height:2.5em;border-radius:50%;-webkit-mask-image:none}.waves-block{display:block}.waves-effect .waves-ripple{z-index:-1}.modal{display:none;position:fixed;left:0;right:0;background-color:#fafafa;padding:0;max-height:70%;width:55%;margin:auto;overflow-y:auto;border-radius:2px;will-change:top, opacity}@media only screen and (max-width: 992px){.modal{width:80%}}.modal h1,.modal h2,.modal h3,.modal h4{margin-top:0}.modal .modal-content{padding:24px}.modal .modal-close{cursor:pointer}.modal .modal-footer{border-radius:0 0 2px 2px;background-color:#fafafa;padding:4px 6px;height:56px;width:100%}.modal .modal-footer .btn,.modal .modal-footer .btn-large,.modal .modal-footer .btn-flat{float:right;margin:6px 0}.modal-overlay{position:fixed;z-index:999;top:-100px;left:0;bottom:0;right:0;height:125%;width:100%;background:#000;display:none;will-change:opacity}.modal.modal-fixed-footer{padding:0;height:70%}.modal.modal-fixed-footer .modal-content{position:absolute;height:calc(100% - 56px);max-height:100%;width:100%;overflow-y:auto}.modal.modal-fixed-footer .modal-footer{border-top:1px solid rgba(0,0,0,0.1);position:absolute;bottom:0}.modal.bottom-sheet{top:auto;bottom:-100%;margin:0;width:100%;max-height:45%;border-radius:0;will-change:bottom, opacity}.collapsible{border-top:1px solid #ddd;border-right:1px solid #ddd;border-left:1px solid #ddd;margin:0.5rem 0 1rem 0}.collapsible-header{display:block;cursor:pointer;min-height:3rem;line-height:3rem;padding:0 1rem;background-color:#fff;border-bottom:1px solid #ddd}.collapsible-header i{width:2rem;font-size:1.6rem;line-height:3rem;display:block;float:left;text-align:center;margin-right:1rem}.collapsible-body{display:none;border-bottom:1px solid #ddd;box-sizing:border-box}.collapsible-body p{margin:0;padding:2rem}.side-nav .collapsible,.side-nav.fixed .collapsible{border:none;box-shadow:none}.side-nav .collapsible li,.side-nav.fixed .collapsible li{padding:0}.side-nav .collapsible-header,.side-nav.fixed .collapsible-header{background-color:transparent;border:none;line-height:inherit;height:inherit;padding:0 16px}.side-nav .collapsible-header:hover,.side-nav.fixed .collapsible-header:hover{background-color:rgba(0,0,0,0.05)}.side-nav .collapsible-header i,.side-nav.fixed .collapsible-header i{line-height:inherit}.side-nav .collapsible-body,.side-nav.fixed .collapsible-body{border:0;background-color:#fff}.side-nav .collapsible-body li a,.side-nav.fixed .collapsible-body li a{padding:0 23.5px 0 31px}.collapsible.popout{border:none;box-shadow:none}.collapsible.popout>li{box-shadow:0 2px 5px 0 rgba(0,0,0,0.16),0 2px 10px 0 rgba(0,0,0,0.12);margin:0 24px;transition:margin 0.35s cubic-bezier(0.25, 0.46, 0.45, 0.94)}.collapsible.popout>li.active{box-shadow:0 5px 11px 0 rgba(0,0,0,0.18),0 4px 15px 0 rgba(0,0,0,0.15);margin:16px 0}.chip{display:inline-block;height:32px;font-size:13px;font-weight:500;color:rgba(0,0,0,0.6);line-height:32px;padding:0 12px;border-radius:16px;background-color:#e4e4e4;margin-bottom:5px;margin-right:5px}.chip img{float:left;margin:0 8px 0 -12px;height:32px;width:32px;border-radius:50%}.chip .close{cursor:pointer;float:right;font-size:16px;line-height:32px;padding-left:8px}.chips{border:none;border-bottom:1px solid #9e9e9e;box-shadow:none;margin:0 0 20px 0;min-height:45px;outline:none;transition:all .3s}.chips.focus{border-bottom:1px solid #26a69a;box-shadow:0 1px 0 0 #26a69a}.chips:hover{cursor:text}.chips .chip.selected{background-color:#26a69a;color:#fff}.chips .input{background:none;border:0;color:rgba(0,0,0,0.6);display:inline-block;font-size:1rem;height:3rem;line-height:32px;outline:0;margin:0;padding:0 !important;width:120px !important}.chips .input:focus{border:0 !important;box-shadow:none !important}.prefix ~ .chips{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.chips:empty ~ label{font-size:0.8rem;-webkit-transform:translateY(-140%);transform:translateY(-140%)}.materialboxed{display:block;cursor:-webkit-zoom-in;cursor:zoom-in;position:relative;transition:opacity .4s}.materialboxed:hover{will-change:left, top, width, height}.materialboxed:hover:not(.active){opacity:.8}.materialboxed.active{cursor:-webkit-zoom-out;cursor:zoom-out}#materialbox-overlay{position:fixed;top:0;left:0;right:0;bottom:0;background-color:#292929;z-index:1000;will-change:opacity}.materialbox-caption{position:fixed;display:none;color:#fff;line-height:50px;bottom:0;width:100%;text-align:center;padding:0% 15%;height:50px;z-index:1000;-webkit-font-smoothing:antialiased}select:focus{outline:1px solid #c9f3ef}button:focus{outline:none;background-color:#2ab7a9}label{font-size:0.8rem;color:#9e9e9e}::-webkit-input-placeholder{color:#d1d1d1}:-moz-placeholder{color:#d1d1d1}::-moz-placeholder{color:#d1d1d1}:-ms-input-placeholder{color:#d1d1d1}input:not([type]),input[type=text],input[type=password],input[type=email],input[type=url],input[type=time],input[type=date],input[type=datetime],input[type=datetime-local],input[type=tel],input[type=number],input[type=search],textarea.materialize-textarea{background-color:transparent;border:none;border-bottom:1px solid #9e9e9e;border-radius:0;outline:none;height:3rem;width:100%;font-size:1rem;margin:0 0 20px 0;padding:0;box-shadow:none;box-sizing:content-box;transition:all 0.3s}input:not([type]):disabled,input:not([type])[readonly="readonly"],input[type=text]:disabled,input[type=text][readonly="readonly"],input[type=password]:disabled,input[type=password][readonly="readonly"],input[type=email]:disabled,input[type=email][readonly="readonly"],input[type=url]:disabled,input[type=url][readonly="readonly"],input[type=time]:disabled,input[type=time][readonly="readonly"],input[type=date]:disabled,input[type=date][readonly="readonly"],input[type=datetime]:disabled,input[type=datetime][readonly="readonly"],input[type=datetime-local]:disabled,input[type=datetime-local][readonly="readonly"],input[type=tel]:disabled,input[type=tel][readonly="readonly"],input[type=number]:disabled,input[type=number][readonly="readonly"],input[type=search]:disabled,input[type=search][readonly="readonly"],textarea.materialize-textarea:disabled,textarea.materialize-textarea[readonly="readonly"]{color:rgba(0,0,0,0.26);border-bottom:1px dotted rgba(0,0,0,0.26)}input:not([type]):disabled+label,input:not([type])[readonly="readonly"]+label,input[type=text]:disabled+label,input[type=text][readonly="readonly"]+label,input[type=password]:disabled+label,input[type=password][readonly="readonly"]+label,input[type=email]:disabled+label,input[type=email][readonly="readonly"]+label,input[type=url]:disabled+label,input[type=url][readonly="readonly"]+label,input[type=time]:disabled+label,input[type=time][readonly="readonly"]+label,input[type=date]:disabled+label,input[type=date][readonly="readonly"]+label,input[type=datetime]:disabled+label,input[type=datetime][readonly="readonly"]+label,input[type=datetime-local]:disabled+label,input[type=datetime-local][readonly="readonly"]+label,input[type=tel]:disabled+label,input[type=tel][readonly="readonly"]+label,input[type=number]:disabled+label,input[type=number][readonly="readonly"]+label,input[type=search]:disabled+label,input[type=search][readonly="readonly"]+label,textarea.materialize-textarea:disabled+label,textarea.materialize-textarea[readonly="readonly"]+label{color:rgba(0,0,0,0.26)}input:not([type]):focus:not([readonly]),input[type=text]:focus:not([readonly]),input[type=password]:focus:not([readonly]),input[type=email]:focus:not([readonly]),input[type=url]:focus:not([readonly]),input[type=time]:focus:not([readonly]),input[type=date]:focus:not([readonly]),input[type=datetime]:focus:not([readonly]),input[type=datetime-local]:focus:not([readonly]),input[type=tel]:focus:not([readonly]),input[type=number]:focus:not([readonly]),input[type=search]:focus:not([readonly]),textarea.materialize-textarea:focus:not([readonly]){border-bottom:1px solid #26a69a;box-shadow:0 1px 0 0 #26a69a}input:not([type]):focus:not([readonly])+label,input[type=text]:focus:not([readonly])+label,input[type=password]:focus:not([readonly])+label,input[type=email]:focus:not([readonly])+label,input[type=url]:focus:not([readonly])+label,input[type=time]:focus:not([readonly])+label,input[type=date]:focus:not([readonly])+label,input[type=datetime]:focus:not([readonly])+label,input[type=datetime-local]:focus:not([readonly])+label,input[type=tel]:focus:not([readonly])+label,input[type=number]:focus:not([readonly])+label,input[type=search]:focus:not([readonly])+label,textarea.materialize-textarea:focus:not([readonly])+label{color:#26a69a}input:not([type]).valid,input:not([type]):focus.valid,input[type=text].valid,input[type=text]:focus.valid,input[type=password].valid,input[type=password]:focus.valid,input[type=email].valid,input[type=email]:focus.valid,input[type=url].valid,input[type=url]:focus.valid,input[type=time].valid,input[type=time]:focus.valid,input[type=date].valid,input[type=date]:focus.valid,input[type=datetime].valid,input[type=datetime]:focus.valid,input[type=datetime-local].valid,input[type=datetime-local]:focus.valid,input[type=tel].valid,input[type=tel]:focus.valid,input[type=number].valid,input[type=number]:focus.valid,input[type=search].valid,input[type=search]:focus.valid,textarea.materialize-textarea.valid,textarea.materialize-textarea:focus.valid{border-bottom:1px solid #4CAF50;box-shadow:0 1px 0 0 #4CAF50}input:not([type]).valid+label:after,input:not([type]):focus.valid+label:after,input[type=text].valid+label:after,input[type=text]:focus.valid+label:after,input[type=password].valid+label:after,input[type=password]:focus.valid+label:after,input[type=email].valid+label:after,input[type=email]:focus.valid+label:after,input[type=url].valid+label:after,input[type=url]:focus.valid+label:after,input[type=time].valid+label:after,input[type=time]:focus.valid+label:after,input[type=date].valid+label:after,input[type=date]:focus.valid+label:after,input[type=datetime].valid+label:after,input[type=datetime]:focus.valid+label:after,input[type=datetime-local].valid+label:after,input[type=datetime-local]:focus.valid+label:after,input[type=tel].valid+label:after,input[type=tel]:focus.valid+label:after,input[type=number].valid+label:after,input[type=number]:focus.valid+label:after,input[type=search].valid+label:after,input[type=search]:focus.valid+label:after,textarea.materialize-textarea.valid+label:after,textarea.materialize-textarea:focus.valid+label:after{content:attr(data-success);color:#4CAF50;opacity:1}input:not([type]).invalid,input:not([type]):focus.invalid,input[type=text].invalid,input[type=text]:focus.invalid,input[type=password].invalid,input[type=password]:focus.invalid,input[type=email].invalid,input[type=email]:focus.invalid,input[type=url].invalid,input[type=url]:focus.invalid,input[type=time].invalid,input[type=time]:focus.invalid,input[type=date].invalid,input[type=date]:focus.invalid,input[type=datetime].invalid,input[type=datetime]:focus.invalid,input[type=datetime-local].invalid,input[type=datetime-local]:focus.invalid,input[type=tel].invalid,input[type=tel]:focus.invalid,input[type=number].invalid,input[type=number]:focus.invalid,input[type=search].invalid,input[type=search]:focus.invalid,textarea.materialize-textarea.invalid,textarea.materialize-textarea:focus.invalid{border-bottom:1px solid #F44336;box-shadow:0 1px 0 0 #F44336}input:not([type]).invalid+label:after,input:not([type]):focus.invalid+label:after,input[type=text].invalid+label:after,input[type=text]:focus.invalid+label:after,input[type=password].invalid+label:after,input[type=password]:focus.invalid+label:after,input[type=email].invalid+label:after,input[type=email]:focus.invalid+label:after,input[type=url].invalid+label:after,input[type=url]:focus.invalid+label:after,input[type=time].invalid+label:after,input[type=time]:focus.invalid+label:after,input[type=date].invalid+label:after,input[type=date]:focus.invalid+label:after,input[type=datetime].invalid+label:after,input[type=datetime]:focus.invalid+label:after,input[type=datetime-local].invalid+label:after,input[type=datetime-local]:focus.invalid+label:after,input[type=tel].invalid+label:after,input[type=tel]:focus.invalid+label:after,input[type=number].invalid+label:after,input[type=number]:focus.invalid+label:after,input[type=search].invalid+label:after,input[type=search]:focus.invalid+label:after,textarea.materialize-textarea.invalid+label:after,textarea.materialize-textarea:focus.invalid+label:after{content:attr(data-error);color:#F44336;opacity:1}input:not([type]).validate+label,input[type=text].validate+label,input[type=password].validate+label,input[type=email].validate+label,input[type=url].validate+label,input[type=time].validate+label,input[type=date].validate+label,input[type=datetime].validate+label,input[type=datetime-local].validate+label,input[type=tel].validate+label,input[type=number].validate+label,input[type=search].validate+label,textarea.materialize-textarea.validate+label{width:100%;pointer-events:none}input:not([type])+label:after,input[type=text]+label:after,input[type=password]+label:after,input[type=email]+label:after,input[type=url]+label:after,input[type=time]+label:after,input[type=date]+label:after,input[type=datetime]+label:after,input[type=datetime-local]+label:after,input[type=tel]+label:after,input[type=number]+label:after,input[type=search]+label:after,textarea.materialize-textarea+label:after{display:block;content:"";position:absolute;top:60px;opacity:0;transition:.2s opacity ease-out, .2s color ease-out}.input-field{position:relative;margin-top:1rem}.input-field.inline{display:inline-block;vertical-align:middle;margin-left:5px}.input-field.inline input,.input-field.inline .select-dropdown{margin-bottom:1rem}.input-field.col label{left:0.75rem}.input-field.col .prefix ~ label,.input-field.col .prefix ~ .validate ~ label{width:calc(100% - 3rem - 1.5rem)}.input-field label{color:#9e9e9e;position:absolute;top:0.8rem;left:0;font-size:1rem;cursor:text;transition:.2s ease-out}.input-field label.active{font-size:0.8rem;-webkit-transform:translateY(-140%);transform:translateY(-140%)}.input-field .prefix{position:absolute;width:3rem;font-size:2rem;transition:color .2s}.input-field .prefix.active{color:#26a69a}.input-field .prefix ~ input,.input-field .prefix ~ textarea,.input-field .prefix ~ label,.input-field .prefix ~ .validate ~ label,.input-field .prefix ~ .autocomplete-content{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.input-field .prefix ~ label{margin-left:3rem}@media only screen and (max-width: 992px){.input-field .prefix ~ input{width:86%;width:calc(100% - 3rem)}}@media only screen and (max-width: 600px){.input-field .prefix ~ input{width:80%;width:calc(100% - 3rem)}}.input-field input[type=search]{display:block;line-height:inherit;padding-left:4rem;width:calc(100% - 4rem)}.input-field input[type=search]:focus{background-color:#fff;border:0;box-shadow:none;color:#444}.input-field input[type=search]:focus+label i,.input-field input[type=search]:focus ~ .mdi-navigation-close,.input-field input[type=search]:focus ~ .material-icons{color:#444}.input-field input[type=search]+label{left:1rem}.input-field input[type=search] ~ .mdi-navigation-close,.input-field input[type=search] ~ .material-icons{position:absolute;top:0;right:1rem;color:transparent;cursor:pointer;font-size:2rem;transition:.3s color}textarea{width:100%;height:3rem;background-color:transparent}textarea.materialize-textarea{overflow-y:hidden;padding:.8rem 0 1.6rem 0;resize:none;min-height:3rem}.hiddendiv{display:none;white-space:pre-wrap;word-wrap:break-word;overflow-wrap:break-word;padding-top:1.2rem}.autocomplete-content{margin-top:-15px;display:block;opacity:1;position:static}.autocomplete-content li .highlight{color:#444}.autocomplete-content li img{height:40px;width:40px;margin:5px 15px}[type="radio"]:not(:checked),[type="radio"]:checked{position:absolute;left:-9999px;opacity:0}[type="radio"]:not(:checked)+label,[type="radio"]:checked+label{position:relative;padding-left:35px;cursor:pointer;display:inline-block;height:25px;line-height:25px;font-size:1rem;transition:.28s ease;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}[type="radio"]+label:before,[type="radio"]+label:after{content:'';position:absolute;left:0;top:0;margin:4px;width:16px;height:16px;z-index:0;transition:.28s ease}[type="radio"]:not(:checked)+label:before,[type="radio"]:not(:checked)+label:after,[type="radio"]:checked+label:before,[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:before,[type="radio"].with-gap:checked+label:after{border-radius:50%}[type="radio"]:not(:checked)+label:before,[type="radio"]:not(:checked)+label:after{border:2px solid #5a5a5a}[type="radio"]:not(:checked)+label:after{-webkit-transform:scale(0);transform:scale(0)}[type="radio"]:checked+label:before{border:2px solid transparent}[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:before,[type="radio"].with-gap:checked+label:after{border:2px solid #26a69a}[type="radio"]:checked+label:after,[type="radio"].with-gap:checked+label:after{background-color:#26a69a}[type="radio"]:checked+label:after{-webkit-transform:scale(1.02);transform:scale(1.02)}[type="radio"].with-gap:checked+label:after{-webkit-transform:scale(0.5);transform:scale(0.5)}[type="radio"].tabbed:focus+label:before{box-shadow:0 0 0 10px rgba(0,0,0,0.1)}[type="radio"].with-gap:disabled:checked+label:before{border:2px solid rgba(0,0,0,0.26)}[type="radio"].with-gap:disabled:checked+label:after{border:none;background-color:rgba(0,0,0,0.26)}[type="radio"]:disabled:not(:checked)+label:before,[type="radio"]:disabled:checked+label:before{background-color:transparent;border-color:rgba(0,0,0,0.26)}[type="radio"]:disabled+label{color:rgba(0,0,0,0.26)}[type="radio"]:disabled:not(:checked)+label:before{border-color:rgba(0,0,0,0.26)}[type="radio"]:disabled:checked+label:after{background-color:rgba(0,0,0,0.26);border-color:#BDBDBD}form p{margin-bottom:10px;text-align:left}form p:last-child{margin-bottom:0}[type="checkbox"]:not(:checked),[type="checkbox"]:checked{position:absolute;left:-9999px;opacity:0}[type="checkbox"]+label{position:relative;padding-left:35px;cursor:pointer;display:inline-block;height:25px;line-height:25px;font-size:1rem;-webkit-user-select:none;-moz-user-select:none;-khtml-user-select:none;-ms-user-select:none}[type="checkbox"]+label:before,[type="checkbox"]:not(.filled-in)+label:after{content:'';position:absolute;top:0;left:0;width:18px;height:18px;z-index:0;border:2px solid #5a5a5a;border-radius:1px;margin-top:2px;transition:.2s}[type="checkbox"]:not(.filled-in)+label:after{border:0;-webkit-transform:scale(0);transform:scale(0)}[type="checkbox"]:not(:checked):disabled+label:before{border:none;background-color:rgba(0,0,0,0.26)}[type="checkbox"].tabbed:focus+label:after{-webkit-transform:scale(1);transform:scale(1);border:0;border-radius:50%;box-shadow:0 0 0 10px rgba(0,0,0,0.1);background-color:rgba(0,0,0,0.1)}[type="checkbox"]:checked+label:before{top:-4px;left:-5px;width:12px;height:22px;border-top:2px solid transparent;border-left:2px solid transparent;border-right:2px solid #26a69a;border-bottom:2px solid #26a69a;-webkit-transform:rotate(40deg);transform:rotate(40deg);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"]:checked:disabled+label:before{border-right:2px solid rgba(0,0,0,0.26);border-bottom:2px solid rgba(0,0,0,0.26)}[type="checkbox"]:indeterminate+label:before{top:-11px;left:-12px;width:10px;height:22px;border-top:none;border-left:none;border-right:2px solid #26a69a;border-bottom:none;-webkit-transform:rotate(90deg);transform:rotate(90deg);-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"]:indeterminate:disabled+label:before{border-right:2px solid rgba(0,0,0,0.26);background-color:transparent}[type="checkbox"].filled-in+label:after{border-radius:2px}[type="checkbox"].filled-in+label:before,[type="checkbox"].filled-in+label:after{content:'';left:0;position:absolute;transition:border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;z-index:1}[type="checkbox"].filled-in:not(:checked)+label:before{width:0;height:0;border:3px solid transparent;left:6px;top:10px;-webkit-transform:rotateZ(37deg);transform:rotateZ(37deg);-webkit-transform-origin:20% 40%;transform-origin:100% 100%}[type="checkbox"].filled-in:not(:checked)+label:after{height:20px;width:20px;background-color:transparent;border:2px solid #5a5a5a;top:0px;z-index:0}[type="checkbox"].filled-in:checked+label:before{top:0;left:1px;width:8px;height:13px;border-top:2px solid transparent;border-left:2px solid transparent;border-right:2px solid #fff;border-bottom:2px solid #fff;-webkit-transform:rotateZ(37deg);transform:rotateZ(37deg);-webkit-transform-origin:100% 100%;transform-origin:100% 100%}[type="checkbox"].filled-in:checked+label:after{top:0;width:20px;height:20px;border:2px solid #26a69a;background-color:#26a69a;z-index:0}[type="checkbox"].filled-in.tabbed:focus+label:after{border-radius:2px;border-color:#5a5a5a;background-color:rgba(0,0,0,0.1)}[type="checkbox"].filled-in.tabbed:checked:focus+label:after{border-radius:2px;background-color:#26a69a;border-color:#26a69a}[type="checkbox"].filled-in:disabled:not(:checked)+label:before{background-color:transparent;border:2px solid transparent}[type="checkbox"].filled-in:disabled:not(:checked)+label:after{border-color:transparent;background-color:#BDBDBD}[type="checkbox"].filled-in:disabled:checked+label:before{background-color:transparent}[type="checkbox"].filled-in:disabled:checked+label:after{background-color:#BDBDBD;border-color:#BDBDBD}.switch,.switch *{-webkit-user-select:none;-moz-user-select:none;-khtml-user-select:none;-ms-user-select:none}.switch label{cursor:pointer}.switch label input[type=checkbox]{opacity:0;width:0;height:0}.switch label input[type=checkbox]:checked+.lever{background-color:#84c7c1}.switch label input[type=checkbox]:checked+.lever:after{background-color:#26a69a;left:24px}.switch label .lever{content:"";display:inline-block;position:relative;width:40px;height:15px;background-color:#818181;border-radius:15px;margin-right:10px;transition:background 0.3s ease;vertical-align:middle;margin:0 16px}.switch label .lever:after{content:"";position:absolute;display:inline-block;width:21px;height:21px;background-color:#F1F1F1;border-radius:21px;box-shadow:0 1px 3px 1px rgba(0,0,0,0.4);left:-5px;top:-3px;transition:left 0.3s ease, background .3s ease, box-shadow 0.1s ease}input[type=checkbox]:checked:not(:disabled) ~ .lever:active::after,input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::after{box-shadow:0 1px 3px 1px rgba(0,0,0,0.4),0 0 0 15px rgba(38,166,154,0.1)}input[type=checkbox]:not(:disabled) ~ .lever:active:after,input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::after{box-shadow:0 1px 3px 1px rgba(0,0,0,0.4),0 0 0 15px rgba(0,0,0,0.08)}.switch input[type=checkbox][disabled]+.lever{cursor:default}.switch label input[type=checkbox][disabled]+.lever:after,.switch label input[type=checkbox][disabled]:checked+.lever:after{background-color:#BDBDBD}select{display:none}select.browser-default{display:block}select{background-color:rgba(255,255,255,0.9);width:100%;padding:5px;border:1px solid #f2f2f2;border-radius:2px;height:3rem}.select-label{position:absolute}.select-wrapper{position:relative}.select-wrapper input.select-dropdown{position:relative;cursor:pointer;background-color:transparent;border:none;border-bottom:1px solid #9e9e9e;outline:none;height:3rem;line-height:3rem;width:100%;font-size:1rem;margin:0 0 20px 0;padding:0;display:block}.select-wrapper span.caret{color:initial;position:absolute;right:0;top:0;bottom:0;height:10px;margin:auto 0;font-size:10px;line-height:10px}.select-wrapper span.caret.disabled{color:rgba(0,0,0,0.26)}.select-wrapper+label{position:absolute;top:-14px;font-size:0.8rem}select:disabled{color:rgba(0,0,0,0.3)}.select-wrapper input.select-dropdown:disabled{color:rgba(0,0,0,0.3);cursor:default;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;border-bottom:1px solid rgba(0,0,0,0.3)}.select-wrapper i{color:rgba(0,0,0,0.3)}.select-dropdown li.disabled,.select-dropdown li.disabled>span,.select-dropdown li.optgroup{color:rgba(0,0,0,0.3);background-color:transparent}.prefix ~ .select-wrapper{margin-left:3rem;width:92%;width:calc(100% - 3rem)}.prefix ~ label{margin-left:3rem}.select-dropdown li img{height:40px;width:40px;margin:5px 15px;float:right}.select-dropdown li.optgroup{border-top:1px solid #eee}.select-dropdown li.optgroup.selected>span{color:rgba(0,0,0,0.7)}.select-dropdown li.optgroup>span{color:rgba(0,0,0,0.4)}.select-dropdown li.optgroup ~ li.optgroup-option{padding-left:1rem}.file-field{position:relative}.file-field .file-path-wrapper{overflow:hidden;padding-left:10px}.file-field input.file-path{width:100%}.file-field .btn,.file-field .btn-large{float:left;height:3rem;line-height:3rem}.file-field span{cursor:pointer}.file-field input[type=file]{position:absolute;top:0;right:0;left:0;bottom:0;width:100%;margin:0;padding:0;font-size:20px;cursor:pointer;opacity:0;filter:alpha(opacity=0)}.range-field{position:relative}input[type=range],input[type=range]+.thumb{cursor:pointer}input[type=range]{position:relative;background-color:transparent;border:none;outline:none;width:100%;margin:15px 0;padding:0}input[type=range]:focus{outline:none}input[type=range]+.thumb{position:absolute;border:none;height:0;width:0;border-radius:50%;background-color:#26a69a;top:10px;margin-left:-6px;-webkit-transform-origin:50% 50%;transform-origin:50% 50%;-webkit-transform:rotate(-45deg);transform:rotate(-45deg)}input[type=range]+.thumb .value{display:block;width:30px;text-align:center;color:#26a69a;font-size:0;-webkit-transform:rotate(45deg);transform:rotate(45deg)}input[type=range]+.thumb.active{border-radius:50% 50% 50% 0}input[type=range]+.thumb.active .value{color:#fff;margin-left:-1px;margin-top:8px;font-size:10px}input[type=range]{-webkit-appearance:none}input[type=range]::-webkit-slider-runnable-track{height:3px;background:#c2c0c2;border:none}input[type=range]::-webkit-slider-thumb{-webkit-appearance:none;border:none;height:14px;width:14px;border-radius:50%;background-color:#26a69a;-webkit-transform-origin:50% 50%;transform-origin:50% 50%;margin:-5px 0 0 0;transition:.3s}input[type=range]:focus::-webkit-slider-runnable-track{background:#ccc}input[type=range]{border:1px solid white}input[type=range]::-moz-range-track{height:3px;background:#ddd;border:none}input[type=range]::-moz-range-thumb{border:none;height:14px;width:14px;border-radius:50%;background:#26a69a;margin-top:-5px}input[type=range]:-moz-focusring{outline:1px solid #fff;outline-offset:-1px}input[type=range]:focus::-moz-range-track{background:#ccc}input[type=range]::-ms-track{height:3px;background:transparent;border-color:transparent;border-width:6px 0;color:transparent}input[type=range]::-ms-fill-lower{background:#777}input[type=range]::-ms-fill-upper{background:#ddd}input[type=range]::-ms-thumb{border:none;height:14px;width:14px;border-radius:50%;background:#26a69a}input[type=range]:focus::-ms-fill-lower{background:#888}input[type=range]:focus::-ms-fill-upper{background:#ccc}.table-of-contents.fixed{position:fixed}.table-of-contents li{padding:2px 0}.table-of-contents a{display:inline-block;font-weight:300;color:#757575;padding-left:20px;height:1.5rem;line-height:1.5rem;letter-spacing:.4;display:inline-block}.table-of-contents a:hover{color:#a8a8a8;padding-left:19px;border-left:1px solid #ea4a4f}.table-of-contents a.active{font-weight:500;padding-left:18px;border-left:2px solid #ea4a4f}.side-nav{position:fixed;width:300px;left:0;top:0;margin:0;-webkit-transform:translateX(-100%);transform:translateX(-100%);height:100%;height:calc(100% + 60px);height:-moz-calc(100%);padding-bottom:60px;background-color:#fff;z-index:999;overflow-y:auto;will-change:transform;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-transform:translateX(-105%);transform:translateX(-105%)}.side-nav.right-aligned{right:0;-webkit-transform:translateX(105%);transform:translateX(105%);left:auto;-webkit-transform:translateX(100%);transform:translateX(100%)}.side-nav .collapsible{margin:0}.side-nav li{float:none;line-height:48px}.side-nav li.active{background-color:rgba(0,0,0,0.05)}.side-nav a{color:rgba(0,0,0,0.87);display:block;font-size:14px;font-weight:500;height:48px;line-height:48px;padding:0 32px}.side-nav a:hover{background-color:rgba(0,0,0,0.05)}.side-nav a.btn,.side-nav a.btn-large,.side-nav a.btn-large,.side-nav a.btn-flat,.side-nav a.btn-floating{margin:10px 15px}.side-nav a.btn,.side-nav a.btn-large,.side-nav a.btn-large,.side-nav a.btn-floating{color:#fff}.side-nav a.btn-flat{color:#343434}.side-nav a.btn:hover,.side-nav a.btn-large:hover,.side-nav a.btn-large:hover{background-color:#2bbbad}.side-nav a.btn-floating:hover{background-color:#26a69a}.side-nav li>a>i,.side-nav li>a>[class^="mdi-"],.side-nav li>a>[class*="mdi-"],.side-nav li>a>i.material-icons{float:left;height:48px;line-height:48px;margin:0 32px 0 0;width:24px;color:rgba(0,0,0,0.54)}.side-nav .divider{margin:8px 0 0 0}.side-nav .subheader{cursor:initial;pointer-events:none;color:rgba(0,0,0,0.54);font-size:14px;font-weight:500;line-height:48px}.side-nav .subheader:hover{background-color:transparent}.side-nav .userView{position:relative;padding:32px 32px 0;margin-bottom:8px}.side-nav .userView>a{height:auto;padding:0}.side-nav .userView>a:hover{background-color:transparent}.side-nav .userView .background{overflow:hidden;position:absolute;top:0;right:0;bottom:0;left:0;z-index:-1}.side-nav .userView .circle,.side-nav .userView .name,.side-nav .userView .email{display:block}.side-nav .userView .circle{height:64px;width:64px}.side-nav .userView .name,.side-nav .userView .email{font-size:14px;line-height:24px}.side-nav .userView .name{margin-top:16px;font-weight:500}.side-nav .userView .email{padding-bottom:16px;font-weight:400}.drag-target{height:100%;width:10px;position:fixed;top:0;z-index:998}.side-nav.fixed{left:0;-webkit-transform:translateX(0);transform:translateX(0);position:fixed}.side-nav.fixed.right-aligned{right:0;left:auto}@media only screen and (max-width: 992px){.side-nav.fixed{-webkit-transform:translateX(-105%);transform:translateX(-105%)}.side-nav.fixed.right-aligned{-webkit-transform:translateX(105%);transform:translateX(105%)}.side-nav a{padding:0 16px}.side-nav .userView{padding:16px 16px 0}}.side-nav .collapsible-body>ul:not(.collapsible)>li.active,.side-nav.fixed .collapsible-body>ul:not(.collapsible)>li.active{background-color:#ee6e73}.side-nav .collapsible-body>ul:not(.collapsible)>li.active a,.side-nav.fixed .collapsible-body>ul:not(.collapsible)>li.active a{color:#fff}#sidenav-overlay{position:fixed;top:0;left:0;right:0;height:120vh;background-color:rgba(0,0,0,0.5);z-index:997;will-change:opacity}.preloader-wrapper{display:inline-block;position:relative;width:48px;height:48px}.preloader-wrapper.small{width:36px;height:36px}.preloader-wrapper.big{width:64px;height:64px}.preloader-wrapper.active{-webkit-animation:container-rotate 1568ms linear infinite;animation:container-rotate 1568ms linear infinite}@-webkit-keyframes container-rotate{to{-webkit-transform:rotate(360deg)}}@keyframes container-rotate{to{-webkit-transform:rotate(360deg);transform:rotate(360deg)}}.spinner-layer{position:absolute;width:100%;height:100%;opacity:0;border-color:#26a69a}.spinner-blue,.spinner-blue-only{border-color:#4285f4}.spinner-red,.spinner-red-only{border-color:#db4437}.spinner-yellow,.spinner-yellow-only{border-color:#f4b400}.spinner-green,.spinner-green-only{border-color:#0f9d58}.active .spinner-layer.spinner-blue{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,blue-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-red{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,red-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-yellow{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,yellow-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer.spinner-green{-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both,green-fade-in-out 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .spinner-layer,.active .spinner-layer.spinner-blue-only,.active .spinner-layer.spinner-red-only,.active .spinner-layer.spinner-yellow-only,.active .spinner-layer.spinner-green-only{opacity:1;-webkit-animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:fill-unfill-rotate 5332ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}@-webkit-keyframes fill-unfill-rotate{12.5%{-webkit-transform:rotate(135deg)}25%{-webkit-transform:rotate(270deg)}37.5%{-webkit-transform:rotate(405deg)}50%{-webkit-transform:rotate(540deg)}62.5%{-webkit-transform:rotate(675deg)}75%{-webkit-transform:rotate(810deg)}87.5%{-webkit-transform:rotate(945deg)}to{-webkit-transform:rotate(1080deg)}}@keyframes fill-unfill-rotate{12.5%{-webkit-transform:rotate(135deg);transform:rotate(135deg)}25%{-webkit-transform:rotate(270deg);transform:rotate(270deg)}37.5%{-webkit-transform:rotate(405deg);transform:rotate(405deg)}50%{-webkit-transform:rotate(540deg);transform:rotate(540deg)}62.5%{-webkit-transform:rotate(675deg);transform:rotate(675deg)}75%{-webkit-transform:rotate(810deg);transform:rotate(810deg)}87.5%{-webkit-transform:rotate(945deg);transform:rotate(945deg)}to{-webkit-transform:rotate(1080deg);transform:rotate(1080deg)}}@-webkit-keyframes blue-fade-in-out{from{opacity:1}25%{opacity:1}26%{opacity:0}89%{opacity:0}90%{opacity:1}100%{opacity:1}}@keyframes blue-fade-in-out{from{opacity:1}25%{opacity:1}26%{opacity:0}89%{opacity:0}90%{opacity:1}100%{opacity:1}}@-webkit-keyframes red-fade-in-out{from{opacity:0}15%{opacity:0}25%{opacity:1}50%{opacity:1}51%{opacity:0}}@keyframes red-fade-in-out{from{opacity:0}15%{opacity:0}25%{opacity:1}50%{opacity:1}51%{opacity:0}}@-webkit-keyframes yellow-fade-in-out{from{opacity:0}40%{opacity:0}50%{opacity:1}75%{opacity:1}76%{opacity:0}}@keyframes yellow-fade-in-out{from{opacity:0}40%{opacity:0}50%{opacity:1}75%{opacity:1}76%{opacity:0}}@-webkit-keyframes green-fade-in-out{from{opacity:0}65%{opacity:0}75%{opacity:1}90%{opacity:1}100%{opacity:0}}@keyframes green-fade-in-out{from{opacity:0}65%{opacity:0}75%{opacity:1}90%{opacity:1}100%{opacity:0}}.gap-patch{position:absolute;top:0;left:45%;width:10%;height:100%;overflow:hidden;border-color:inherit}.gap-patch .circle{width:1000%;left:-450%}.circle-clipper{display:inline-block;position:relative;width:50%;height:100%;overflow:hidden;border-color:inherit}.circle-clipper .circle{width:200%;height:100%;border-width:3px;border-style:solid;border-color:inherit;border-bottom-color:transparent !important;border-radius:50%;-webkit-animation:none;animation:none;position:absolute;top:0;right:0;bottom:0}.circle-clipper.left .circle{left:0;border-right-color:transparent !important;-webkit-transform:rotate(129deg);transform:rotate(129deg)}.circle-clipper.right .circle{left:-100%;border-left-color:transparent !important;-webkit-transform:rotate(-129deg);transform:rotate(-129deg)}.active .circle-clipper.left .circle{-webkit-animation:left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:left-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}.active .circle-clipper.right .circle{-webkit-animation:right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both;animation:right-spin 1333ms cubic-bezier(0.4, 0, 0.2, 1) infinite both}@-webkit-keyframes left-spin{from{-webkit-transform:rotate(130deg)}50%{-webkit-transform:rotate(-5deg)}to{-webkit-transform:rotate(130deg)}}@keyframes left-spin{from{-webkit-transform:rotate(130deg);transform:rotate(130deg)}50%{-webkit-transform:rotate(-5deg);transform:rotate(-5deg)}to{-webkit-transform:rotate(130deg);transform:rotate(130deg)}}@-webkit-keyframes right-spin{from{-webkit-transform:rotate(-130deg)}50%{-webkit-transform:rotate(5deg)}to{-webkit-transform:rotate(-130deg)}}@keyframes right-spin{from{-webkit-transform:rotate(-130deg);transform:rotate(-130deg)}50%{-webkit-transform:rotate(5deg);transform:rotate(5deg)}to{-webkit-transform:rotate(-130deg);transform:rotate(-130deg)}}#spinnerContainer.cooldown{-webkit-animation:container-rotate 1568ms linear infinite,fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1);animation:container-rotate 1568ms linear infinite,fade-out 400ms cubic-bezier(0.4, 0, 0.2, 1)}@-webkit-keyframes fade-out{from{opacity:1}to{opacity:0}}@keyframes fade-out{from{opacity:1}to{opacity:0}}.slider{position:relative;height:400px;width:100%}.slider.fullscreen{height:100%;width:100%;position:absolute;top:0;left:0;right:0;bottom:0}.slider.fullscreen ul.slides{height:100%}.slider.fullscreen ul.indicators{z-index:2;bottom:30px}.slider .slides{background-color:#9e9e9e;margin:0;height:400px}.slider .slides li{opacity:0;position:absolute;top:0;left:0;z-index:1;width:100%;height:inherit;overflow:hidden}.slider .slides li img{height:100%;width:100%;background-size:cover;background-position:center}.slider .slides li .caption{color:#fff;position:absolute;top:15%;left:15%;width:70%;opacity:0}.slider .slides li .caption p{color:#e0e0e0}.slider .slides li.active{z-index:2}.slider .indicators{position:absolute;text-align:center;left:0;right:0;bottom:0;margin:0}.slider .indicators .indicator-item{display:inline-block;position:relative;cursor:pointer;height:16px;width:16px;margin:0 12px;background-color:#e0e0e0;transition:background-color .3s;border-radius:50%}.slider .indicators .indicator-item.active{background-color:#4CAF50}.carousel{overflow:hidden;position:relative;width:100%;height:400px;-webkit-perspective:500px;perspective:500px;-webkit-transform-style:preserve-3d;transform-style:preserve-3d;-webkit-transform-origin:0% 50%;transform-origin:0% 50%}.carousel.carousel-slider{top:0;left:0;height:0}.carousel.carousel-slider .carousel-fixed-item{position:absolute;left:0;right:0;bottom:20px;z-index:1}.carousel.carousel-slider .carousel-fixed-item.with-indicators{bottom:68px}.carousel.carousel-slider .carousel-item{width:100%;height:100%;min-height:400px;position:absolute;top:0;left:0}.carousel.carousel-slider .carousel-item h2{font-size:24px;font-weight:500;line-height:32px}.carousel.carousel-slider .carousel-item p{font-size:15px}.carousel .carousel-item{display:none;width:200px;height:400px;position:absolute;top:0;left:0}.carousel .carousel-item img{width:100%}.carousel .indicators{position:absolute;text-align:center;left:0;right:0;bottom:0;margin:0}.carousel .indicators .indicator-item{display:inline-block;position:relative;cursor:pointer;height:8px;width:8px;margin:24px 4px;background-color:rgba(255,255,255,0.5);transition:background-color .3s;border-radius:50%}.carousel .indicators .indicator-item.active{background-color:#fff}.picker{font-size:16px;text-align:left;line-height:1.2;color:#000000;position:absolute;z-index:10000;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.picker__input{cursor:default}.picker__input.picker__input--active{border-color:#0089ec}.picker__holder{width:100%;overflow-y:auto;-webkit-overflow-scrolling:touch}/*! + * Default mobile-first, responsive styling for pickadate.js + * Demo: http://amsul.github.io/pickadate.js + */.picker__holder,.picker__frame{bottom:0;left:0;right:0;top:100%}.picker__holder{position:fixed;transition:background 0.15s ease-out, top 0s 0.15s;-webkit-backface-visibility:hidden}.picker__frame{position:absolute;margin:0 auto;min-width:256px;width:300px;max-height:350px;-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";filter:alpha(opacity=0);-moz-opacity:0;opacity:0;transition:all 0.15s ease-out}@media (min-height: 28.875em){.picker__frame{overflow:visible;top:auto;bottom:-100%;max-height:80%}}@media (min-height: 40.125em){.picker__frame{margin-bottom:7.5%}}.picker__wrap{display:table;width:100%;height:100%}@media (min-height: 28.875em){.picker__wrap{display:block}}.picker__box{background:#ffffff;display:table-cell;vertical-align:middle}@media (min-height: 28.875em){.picker__box{display:block;border:1px solid #777777;border-top-color:#898989;border-bottom-width:0;border-radius:5px 5px 0 0;box-shadow:0 12px 36px 16px rgba(0,0,0,0.24)}}.picker--opened .picker__holder{top:0;background:transparent;-ms-filter:"progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)";zoom:1;background:rgba(0,0,0,0.32);transition:background 0.15s ease-out}.picker--opened .picker__frame{top:0;-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";filter:alpha(opacity=100);-moz-opacity:1;opacity:1}@media (min-height: 35.875em){.picker--opened .picker__frame{top:10%;bottom:auto}}.picker__input.picker__input--active{border-color:#E3F2FD}.picker__frame{margin:0 auto;max-width:325px}@media (min-height: 38.875em){.picker--opened .picker__frame{top:10%;bottom:auto}}.picker__box{padding:0 1em}.picker__header{text-align:center;position:relative;margin-top:.75em}.picker__month,.picker__year{display:inline-block;margin-left:.25em;margin-right:.25em}.picker__select--month,.picker__select--year{height:2em;padding:0;margin-left:.25em;margin-right:.25em}.picker__select--month.browser-default{display:inline;background-color:#FFFFFF;width:40%}.picker__select--year.browser-default{display:inline;background-color:#FFFFFF;width:26%}.picker__select--month:focus,.picker__select--year:focus{border-color:rgba(0,0,0,0.05)}.picker__nav--prev,.picker__nav--next{position:absolute;padding:.5em 1.25em;width:1em;height:1em;box-sizing:content-box;top:-0.25em}.picker__nav--prev{left:-1em;padding-right:1.25em}.picker__nav--next{right:-1em;padding-left:1.25em}.picker__nav--disabled,.picker__nav--disabled:hover,.picker__nav--disabled:before,.picker__nav--disabled:before:hover{cursor:default;background:none;border-right-color:#f5f5f5;border-left-color:#f5f5f5}.picker__table{text-align:center;border-collapse:collapse;border-spacing:0;table-layout:fixed;font-size:1rem;width:100%;margin-top:.75em;margin-bottom:.5em}.picker__table th,.picker__table td{text-align:center}.picker__table td{margin:0;padding:0}.picker__weekday{width:14.285714286%;font-size:.75em;padding-bottom:.25em;color:#999999;font-weight:500}@media (min-height: 33.875em){.picker__weekday{padding-bottom:.5em}}.picker__day--today{position:relative;color:#595959;letter-spacing:-.3;padding:.75rem 0;font-weight:400;border:1px solid transparent}.picker__day--disabled:before{border-top-color:#aaaaaa}.picker__day--infocus:hover{cursor:pointer;color:#000;font-weight:500}.picker__day--outfocus{display:none;padding:.75rem 0;color:#fff}.picker__day--outfocus:hover{cursor:pointer;color:#dddddd;font-weight:500}.picker__day--highlighted:hover,.picker--focused .picker__day--highlighted{cursor:pointer}.picker__day--selected,.picker__day--selected:hover,.picker--focused .picker__day--selected{border-radius:50%;-webkit-transform:scale(0.75);transform:scale(0.75);background:#0089ec;color:#ffffff}.picker__day--disabled,.picker__day--disabled:hover,.picker--focused .picker__day--disabled{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default}.picker__day--highlighted.picker__day--disabled,.picker__day--highlighted.picker__day--disabled:hover{background:#bbbbbb}.picker__footer{text-align:center;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}.picker__button--today,.picker__button--clear,.picker__button--close{border:1px solid #ffffff;background:#ffffff;font-size:.8em;padding:.66em 0;font-weight:bold;width:33%;display:inline-block;vertical-align:bottom}.picker__button--today:hover,.picker__button--clear:hover,.picker__button--close:hover{cursor:pointer;color:#000000;background:#b1dcfb;border-bottom-color:#b1dcfb}.picker__button--today:focus,.picker__button--clear:focus,.picker__button--close:focus{background:#b1dcfb;border-color:rgba(0,0,0,0.05);outline:none}.picker__button--today:before,.picker__button--clear:before,.picker__button--close:before{position:relative;display:inline-block;height:0}.picker__button--today:before,.picker__button--clear:before{content:" ";margin-right:.45em}.picker__button--today:before{top:-0.05em;width:0;border-top:0.66em solid #0059bc;border-left:.66em solid transparent}.picker__button--clear:before{top:-0.25em;width:.66em;border-top:3px solid #ee2200}.picker__button--close:before{content:"\D7";top:-0.1em;vertical-align:top;font-size:1.1em;margin-right:.35em;color:#777777}.picker__button--today[disabled],.picker__button--today[disabled]:hover{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default}.picker__button--today[disabled]:before{border-top-color:#aaaaaa}.picker__box{border-radius:2px;overflow:hidden}.picker__date-display{text-align:center;background-color:#26a69a;color:#fff;padding-bottom:15px;font-weight:300}.picker__nav--prev:hover,.picker__nav--next:hover{cursor:pointer;color:#000000;background:#a1ded8}.picker__weekday-display{background-color:#1f897f;padding:10px;font-weight:200;letter-spacing:.5;font-size:1rem;margin-bottom:15px}.picker__month-display{text-transform:uppercase;font-size:2rem}.picker__day-display{font-size:4.5rem;font-weight:400}.picker__year-display{font-size:1.8rem;color:rgba(255,255,255,0.4)}.picker__box{padding:0}.picker__calendar-container{padding:0 1rem}.picker__calendar-container thead{border:none}.picker__table{margin-top:0;margin-bottom:.5em}.picker__day--infocus{color:#595959;letter-spacing:-.3;padding:.75rem 0;font-weight:400;border:1px solid transparent}.picker__day.picker__day--today{color:#26a69a}.picker__day.picker__day--today.picker__day--selected{color:#fff}.picker__weekday{font-size:.9rem}.picker__day--selected,.picker__day--selected:hover,.picker--focused .picker__day--selected{border-radius:50%;-webkit-transform:scale(0.9);transform:scale(0.9);background-color:#26a69a;color:#ffffff}.picker__day--selected.picker__day--outfocus,.picker__day--selected:hover.picker__day--outfocus,.picker--focused .picker__day--selected.picker__day--outfocus{background-color:#a1ded8}.picker__footer{text-align:right;padding:5px 10px}.picker__close,.picker__today{font-size:1.1rem;padding:0 1rem;color:#26a69a}.picker__nav--prev:before,.picker__nav--next:before{content:" ";border-top:.5em solid transparent;border-bottom:.5em solid transparent;border-right:0.75em solid #676767;width:0;height:0;display:block;margin:0 auto}.picker__nav--next:before{border-right:0;border-left:0.75em solid #676767}button.picker__today:focus,button.picker__clear:focus,button.picker__close:focus{background-color:#a1ded8}.picker__list{list-style:none;padding:0.75em 0 4.2em;margin:0}.picker__list-item{border-bottom:1px solid #dddddd;border-top:1px solid #dddddd;margin-bottom:-1px;position:relative;background:#ffffff;padding:.75em 1.25em}@media (min-height: 46.75em){.picker__list-item{padding:.5em 1em}}.picker__list-item:hover{cursor:pointer;color:#000000;background:#b1dcfb;border-color:#0089ec;z-index:10}.picker__list-item--highlighted{border-color:#0089ec;z-index:10}.picker__list-item--highlighted:hover,.picker--focused .picker__list-item--highlighted{cursor:pointer;color:#000000;background:#b1dcfb}.picker__list-item--selected,.picker__list-item--selected:hover,.picker--focused .picker__list-item--selected{background:#0089ec;color:#ffffff;z-index:10}.picker__list-item--disabled,.picker__list-item--disabled:hover,.picker--focused .picker__list-item--disabled{background:#f5f5f5;border-color:#f5f5f5;color:#dddddd;cursor:default;border-color:#dddddd;z-index:auto}.picker--time .picker__button--clear{display:block;width:80%;margin:1em auto 0;padding:1em 1.25em;background:none;border:0;font-weight:500;font-size:.67em;text-align:center;text-transform:uppercase;color:#666}.picker--time .picker__button--clear:hover,.picker--time .picker__button--clear:focus{color:#000000;background:#b1dcfb;background:#ee2200;border-color:#ee2200;cursor:pointer;color:#ffffff;outline:none}.picker--time .picker__button--clear:before{top:-0.25em;color:#666;font-size:1.25em;font-weight:bold}.picker--time .picker__button--clear:hover:before,.picker--time .picker__button--clear:focus:before{color:#ffffff}.picker--time .picker__frame{min-width:256px;max-width:320px}.picker--time .picker__box{font-size:1em;background:#f2f2f2;padding:0}@media (min-height: 40.125em){.picker--time .picker__box{margin-bottom:5em}} diff --git a/fonts/roboto/Roboto-Bold.eot b/fonts/roboto/Roboto-Bold.eot new file mode 100644 index 0000000..b73776e Binary files /dev/null and b/fonts/roboto/Roboto-Bold.eot differ diff --git a/fonts/roboto/Roboto-Bold.ttf b/fonts/roboto/Roboto-Bold.ttf new file mode 100644 index 0000000..68822ca Binary files /dev/null and b/fonts/roboto/Roboto-Bold.ttf differ diff --git a/fonts/roboto/Roboto-Bold.woff b/fonts/roboto/Roboto-Bold.woff new file mode 100644 index 0000000..1f75afd Binary files /dev/null and b/fonts/roboto/Roboto-Bold.woff differ diff --git a/fonts/roboto/Roboto-Bold.woff2 b/fonts/roboto/Roboto-Bold.woff2 new file mode 100644 index 0000000..350d1c3 Binary files /dev/null and b/fonts/roboto/Roboto-Bold.woff2 differ diff --git a/fonts/roboto/Roboto-Light.eot b/fonts/roboto/Roboto-Light.eot new file mode 100644 index 0000000..072cdc4 Binary files /dev/null and b/fonts/roboto/Roboto-Light.eot differ diff --git a/fonts/roboto/Roboto-Light.ttf b/fonts/roboto/Roboto-Light.ttf new file mode 100644 index 0000000..aa45340 Binary files /dev/null and b/fonts/roboto/Roboto-Light.ttf differ diff --git a/fonts/roboto/Roboto-Light.woff b/fonts/roboto/Roboto-Light.woff new file mode 100644 index 0000000..3480c6c Binary files /dev/null and b/fonts/roboto/Roboto-Light.woff differ diff --git a/fonts/roboto/Roboto-Light.woff2 b/fonts/roboto/Roboto-Light.woff2 new file mode 100644 index 0000000..9a4d98c Binary files /dev/null and b/fonts/roboto/Roboto-Light.woff2 differ diff --git a/fonts/roboto/Roboto-Medium.eot b/fonts/roboto/Roboto-Medium.eot new file mode 100644 index 0000000..f9ad995 Binary files /dev/null and b/fonts/roboto/Roboto-Medium.eot differ diff --git a/fonts/roboto/Roboto-Medium.ttf b/fonts/roboto/Roboto-Medium.ttf new file mode 100644 index 0000000..a3c1a1f Binary files /dev/null and b/fonts/roboto/Roboto-Medium.ttf differ diff --git a/fonts/roboto/Roboto-Medium.woff b/fonts/roboto/Roboto-Medium.woff new file mode 100644 index 0000000..1186773 Binary files /dev/null and b/fonts/roboto/Roboto-Medium.woff differ diff --git a/fonts/roboto/Roboto-Medium.woff2 b/fonts/roboto/Roboto-Medium.woff2 new file mode 100644 index 0000000..d10a592 Binary files /dev/null and b/fonts/roboto/Roboto-Medium.woff2 differ diff --git a/fonts/roboto/Roboto-Regular.eot b/fonts/roboto/Roboto-Regular.eot new file mode 100644 index 0000000..9b5e8e4 Binary files /dev/null and b/fonts/roboto/Roboto-Regular.eot differ diff --git a/fonts/roboto/Roboto-Regular.ttf b/fonts/roboto/Roboto-Regular.ttf new file mode 100644 index 0000000..0e58508 Binary files /dev/null and b/fonts/roboto/Roboto-Regular.ttf differ diff --git a/fonts/roboto/Roboto-Regular.woff b/fonts/roboto/Roboto-Regular.woff new file mode 100644 index 0000000..f823258 Binary files /dev/null and b/fonts/roboto/Roboto-Regular.woff differ diff --git a/fonts/roboto/Roboto-Regular.woff2 b/fonts/roboto/Roboto-Regular.woff2 new file mode 100644 index 0000000..b7082ef Binary files /dev/null and b/fonts/roboto/Roboto-Regular.woff2 differ diff --git a/fonts/roboto/Roboto-Thin.eot b/fonts/roboto/Roboto-Thin.eot new file mode 100644 index 0000000..2284a3b Binary files /dev/null and b/fonts/roboto/Roboto-Thin.eot differ diff --git a/fonts/roboto/Roboto-Thin.ttf b/fonts/roboto/Roboto-Thin.ttf new file mode 100644 index 0000000..8779333 Binary files /dev/null and b/fonts/roboto/Roboto-Thin.ttf differ diff --git a/fonts/roboto/Roboto-Thin.woff b/fonts/roboto/Roboto-Thin.woff new file mode 100644 index 0000000..2a98c1e Binary files /dev/null and b/fonts/roboto/Roboto-Thin.woff differ diff --git a/fonts/roboto/Roboto-Thin.woff2 b/fonts/roboto/Roboto-Thin.woff2 new file mode 100644 index 0000000..a38025a Binary files /dev/null and b/fonts/roboto/Roboto-Thin.woff2 differ diff --git a/index.html b/index.html new file mode 100644 index 0000000..8d30bd1 --- /dev/null +++ b/index.html @@ -0,0 +1,46 @@ + + + + + Book list + + + + + + + +
+ +
+ +
+

Choose a type :

+
+ All + css + js +
+
+ +
+
+
+

Results :

+
    + +
+
+
+ + +
+ + + + + diff --git a/js/index.js b/js/index.js new file mode 100644 index 0000000..5610cde --- /dev/null +++ b/js/index.js @@ -0,0 +1,111 @@ +// datas +// infos : il manquait des virgules dans la consigne + +var books = [ + { + title: 'CSS: The Definitive Guide', + author: 'Eric Meyer', + link: 'http://shop.oreilly.com/product/0636920012726.do', + type: 'css' + }, + { + title: 'CSS Development with CSS3', + author: 'Zachary Kingston', + link: 'http://shop.oreilly.com/product/0636920057970.do', + type: 'css' + }, + { + title: 'You Don\'t Know JS: Up & Going', + author: 'Kyle Simpson', + link: 'http://shop.oreilly.com/product/0636920039303.do', + type: 'js' + }, + { + title: 'Programming JavaScript Applications', + author: 'Eric Elliott', + link: 'http://shop.oreilly.com/product/0636920033141.do', + type: 'js' + }, + { + title: 'Modern JavaScript', + author: 'unknown', + link: 'http://www.oreilly.com/web-platform/free/modern-javascript.csp', + type: 'js' + } +] ; + +// list ////////////////////////// + +var containerElement = document.getElementById('book-list'); +var bookElements = document.getElementsByClassName('book'); +// info : getElementsByClassName method returns a living nodelist +// whereas querySelectorAll method return a static nodelist + +var createTitleElement = function(title) { + var t = document.createElement('h3'); + t.classList.add('title'); + t.textContent = title; + return t; +}; + +var createAuthorElement = function(author) { + var t = document.createElement('p'); + t.classList.add('author'); + t.textContent = author; + return t; +}; + +var createButtonElement = function(link) { + var t = document.createElement('a'); + t.classList.add('book-link', 'secondary-content'); + t.setAttribute('href', link); + t.setAttribute('target', '_blank'); + t.innerHTML = 'info'; + return t; +}; + +var createBookElement = function(item) { + var book = document.createElement('li'); + book.classList.add('collection-item', 'avatar', 'book', item.type); + book.innerHTML = 'book'; + book.appendChild(createTitleElement(item.title)); + book.appendChild(createAuthorElement(item.author)); + book.appendChild(createButtonElement(item.link)); + return book; +} + +var listItem = books.forEach( function(item) { + containerElement.appendChild( createBookElement(item)); +}); + +// filters ////////////////////////// + +document.getElementById('filter-list').addEventListener('click', function(e) { + if(e.target) { + select(e.target.getAttribute('data-type')); + } +}); + +// Problem : The list returnned by 'getElementsByClassName' method isn't an array, it's a nodeList +/** Solutions : + - method forEach is not supported in ie + - jquery + - classic for loop + - More infos on : https://css-tricks.com/snippets/javascript/loop-queryselectorall-matches/ +*/ +var select = function(type) { + switch (type) { + case 'css': + case 'js': + for (var i = 0; i < bookElements.length; i++) { + var b = bookElements[i]; + b.style.display = (b.classList.contains(type)) ? 'list-item' : 'none'; + } + break; + default : + for (var i = 0; i < bookElements.length; i++) { + bookElements[i].style.display = 'list-item'; + } + break; + } +} diff --git a/js/materialize.js b/js/materialize.js new file mode 100644 index 0000000..82b1af6 --- /dev/null +++ b/js/materialize.js @@ -0,0 +1,7778 @@ +/*! + * Materialize v0.97.8 (http://materializecss.com) + * Copyright 2014-2015 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +// Check for jQuery. +if (typeof(jQuery) === 'undefined') { + var jQuery; + // Check if require is a defined function. + if (typeof(require) === 'function') { + jQuery = $ = require('jquery'); + // Else use the dollar sign alias. + } else { + jQuery = $; + } +} +;/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright © 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +jQuery.easing['jswing'] = jQuery.easing['swing']; + +jQuery.extend( jQuery.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert(jQuery.easing.default); + return jQuery.easing[jQuery.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - jQuery.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return jQuery.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return jQuery.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright © 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */; // Custom Easing + jQuery.extend( jQuery.easing, + { + easeInOutMaterial: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return c/4*((t-=2)*t*t + 2) + b; + } + }); + +;/*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ +/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ +/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ +jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(e){function t(e){var t=e.length,a=r.type(e);return"function"===a||r.isWindow(e)?!1:1===e.nodeType&&t?!0:"array"===a||0===t||"number"==typeof t&&t>0&&t-1 in e}if(!e.jQuery){var r=function(e,t){return new r.fn.init(e,t)};r.isWindow=function(e){return null!=e&&e==e.window},r.type=function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[i.call(e)]||"object":typeof e},r.isArray=Array.isArray||function(e){return"array"===r.type(e)},r.isPlainObject=function(e){var t;if(!e||"object"!==r.type(e)||e.nodeType||r.isWindow(e))return!1;try{if(e.constructor&&!o.call(e,"constructor")&&!o.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(a){return!1}for(t in e);return void 0===t||o.call(e,t)},r.each=function(e,r,a){var n,o=0,i=e.length,s=t(e);if(a){if(s)for(;i>o&&(n=r.apply(e[o],a),n!==!1);o++);else for(o in e)if(n=r.apply(e[o],a),n===!1)break}else if(s)for(;i>o&&(n=r.call(e[o],o,e[o]),n!==!1);o++);else for(o in e)if(n=r.call(e[o],o,e[o]),n===!1)break;return e},r.data=function(e,t,n){if(void 0===n){var o=e[r.expando],i=o&&a[o];if(void 0===t)return i;if(i&&t in i)return i[t]}else if(void 0!==t){var o=e[r.expando]||(e[r.expando]=++r.uuid);return a[o]=a[o]||{},a[o][t]=n,n}},r.removeData=function(e,t){var n=e[r.expando],o=n&&a[n];o&&r.each(t,function(e,t){delete o[t]})},r.extend=function(){var e,t,a,n,o,i,s=arguments[0]||{},l=1,u=arguments.length,c=!1;for("boolean"==typeof s&&(c=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==r.type(s)&&(s={}),l===u&&(s=this,l--);u>l;l++)if(null!=(o=arguments[l]))for(n in o)e=s[n],a=o[n],s!==a&&(c&&a&&(r.isPlainObject(a)||(t=r.isArray(a)))?(t?(t=!1,i=e&&r.isArray(e)?e:[]):i=e&&r.isPlainObject(e)?e:{},s[n]=r.extend(c,i,a)):void 0!==a&&(s[n]=a));return s},r.queue=function(e,a,n){function o(e,r){var a=r||[];return null!=e&&(t(Object(e))?!function(e,t){for(var r=+t.length,a=0,n=e.length;r>a;)e[n++]=t[a++];if(r!==r)for(;void 0!==t[a];)e[n++]=t[a++];return e.length=n,e}(a,"string"==typeof e?[e]:e):[].push.call(a,e)),a}if(e){a=(a||"fx")+"queue";var i=r.data(e,a);return n?(!i||r.isArray(n)?i=r.data(e,a,o(n)):i.push(n),i):i||[]}},r.dequeue=function(e,t){r.each(e.nodeType?[e]:e,function(e,a){t=t||"fx";var n=r.queue(a,t),o=n.shift();"inprogress"===o&&(o=n.shift()),o&&("fx"===t&&n.unshift("inprogress"),o.call(a,function(){r.dequeue(a,t)}))})},r.fn=r.prototype={init:function(e){if(e.nodeType)return this[0]=e,this;throw new Error("Not a DOM node.")},offset:function(){var t=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:t.top+(e.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:t.left+(e.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function e(){for(var e=this.offsetParent||document;e&&"html"===!e.nodeType.toLowerCase&&"static"===e.style.position;)e=e.offsetParent;return e||document}var t=this[0],e=e.apply(t),a=this.offset(),n=/^(?:body|html)$/i.test(e.nodeName)?{top:0,left:0}:r(e).offset();return a.top-=parseFloat(t.style.marginTop)||0,a.left-=parseFloat(t.style.marginLeft)||0,e.style&&(n.top+=parseFloat(e.style.borderTopWidth)||0,n.left+=parseFloat(e.style.borderLeftWidth)||0),{top:a.top-n.top,left:a.left-n.left}}};var a={};r.expando="velocity"+(new Date).getTime(),r.uuid=0;for(var n={},o=n.hasOwnProperty,i=n.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;ln;++n){var o=u(r,e,a);if(0===o)return r;var i=l(r,e,a)-t;r-=i/o}return r}function p(){for(var t=0;b>t;++t)w[t]=l(t*x,e,a)}function f(t,r,n){var o,i,s=0;do i=r+(n-r)/2,o=l(i,e,a)-t,o>0?n=i:r=i;while(Math.abs(o)>h&&++s=y?c(t,s):0==l?s:f(t,r,r+x)}function g(){V=!0,(e!=r||a!=n)&&p()}var m=4,y=.001,h=1e-7,v=10,b=11,x=1/(b-1),S="Float32Array"in t;if(4!==arguments.length)return!1;for(var P=0;4>P;++P)if("number"!=typeof arguments[P]||isNaN(arguments[P])||!isFinite(arguments[P]))return!1;e=Math.min(e,1),a=Math.min(a,1),e=Math.max(e,0),a=Math.max(a,0);var w=S?new Float32Array(b):new Array(b),V=!1,C=function(t){return V||g(),e===r&&a===n?t:0===t?0:1===t?1:l(d(t),r,n)};C.getControlPoints=function(){return[{x:e,y:r},{x:a,y:n}]};var T="generateBezier("+[e,r,a,n]+")";return C.toString=function(){return T},C}function u(e,t){var r=e;return m.isString(e)?b.Easings[e]||(r=!1):r=m.isArray(e)&&1===e.length?s.apply(null,e):m.isArray(e)&&2===e.length?x.apply(null,e.concat([t])):m.isArray(e)&&4===e.length?l.apply(null,e):!1,r===!1&&(r=b.Easings[b.defaults.easing]?b.defaults.easing:v),r}function c(e){if(e){var t=(new Date).getTime(),r=b.State.calls.length;r>1e4&&(b.State.calls=n(b.State.calls));for(var o=0;r>o;o++)if(b.State.calls[o]){var s=b.State.calls[o],l=s[0],u=s[2],d=s[3],g=!!d,y=null;d||(d=b.State.calls[o][3]=t-16);for(var h=Math.min((t-d)/u.duration,1),v=0,x=l.length;x>v;v++){var P=l[v],V=P.element;if(i(V)){var C=!1;if(u.display!==a&&null!==u.display&&"none"!==u.display){if("flex"===u.display){var T=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];f.each(T,function(e,t){S.setPropertyValue(V,"display",t)})}S.setPropertyValue(V,"display",u.display)}u.visibility!==a&&"hidden"!==u.visibility&&S.setPropertyValue(V,"visibility",u.visibility);for(var k in P)if("element"!==k){var A,F=P[k],j=m.isString(F.easing)?b.Easings[F.easing]:F.easing;if(1===h)A=F.endValue;else{var E=F.endValue-F.startValue;if(A=F.startValue+E*j(h,u,E),!g&&A===F.currentValue)continue}if(F.currentValue=A,"tween"===k)y=A;else{if(S.Hooks.registered[k]){var H=S.Hooks.getRoot(k),N=i(V).rootPropertyValueCache[H];N&&(F.rootPropertyValue=N)}var L=S.setPropertyValue(V,k,F.currentValue+(0===parseFloat(A)?"":F.unitType),F.rootPropertyValue,F.scrollData);S.Hooks.registered[k]&&(i(V).rootPropertyValueCache[H]=S.Normalizations.registered[H]?S.Normalizations.registered[H]("extract",null,L[1]):L[1]),"transform"===L[0]&&(C=!0)}}u.mobileHA&&i(V).transformCache.translate3d===a&&(i(V).transformCache.translate3d="(0px, 0px, 0px)",C=!0),C&&S.flushTransformCache(V)}}u.display!==a&&"none"!==u.display&&(b.State.calls[o][2].display=!1),u.visibility!==a&&"hidden"!==u.visibility&&(b.State.calls[o][2].visibility=!1),u.progress&&u.progress.call(s[1],s[1],h,Math.max(0,d+u.duration-t),d,y),1===h&&p(o)}}b.State.isTicking&&w(c)}function p(e,t){if(!b.State.calls[e])return!1;for(var r=b.State.calls[e][0],n=b.State.calls[e][1],o=b.State.calls[e][2],s=b.State.calls[e][4],l=!1,u=0,c=r.length;c>u;u++){var p=r[u].element;if(t||o.loop||("none"===o.display&&S.setPropertyValue(p,"display",o.display),"hidden"===o.visibility&&S.setPropertyValue(p,"visibility",o.visibility)),o.loop!==!0&&(f.queue(p)[1]===a||!/\.velocityQueueEntryFlag/i.test(f.queue(p)[1]))&&i(p)){i(p).isAnimating=!1,i(p).rootPropertyValueCache={};var d=!1;f.each(S.Lists.transforms3D,function(e,t){var r=/^scale/.test(t)?1:0,n=i(p).transformCache[t];i(p).transformCache[t]!==a&&new RegExp("^\\("+r+"[^.]").test(n)&&(d=!0,delete i(p).transformCache[t])}),o.mobileHA&&(d=!0,delete i(p).transformCache.translate3d),d&&S.flushTransformCache(p),S.Values.removeClass(p,"velocity-animating")}if(!t&&o.complete&&!o.loop&&u===c-1)try{o.complete.call(n,n)}catch(g){setTimeout(function(){throw g},1)}s&&o.loop!==!0&&s(n),i(p)&&o.loop===!0&&!t&&(f.each(i(p).tweensContainer,function(e,t){/^rotate/.test(e)&&360===parseFloat(t.endValue)&&(t.endValue=0,t.startValue=360),/^backgroundPosition/.test(e)&&100===parseFloat(t.endValue)&&"%"===t.unitType&&(t.endValue=0,t.startValue=100)}),b(p,"reverse",{loop:!0,delay:o.delay})),o.queue!==!1&&f.dequeue(p,o.queue)}b.State.calls[e]=!1;for(var m=0,y=b.State.calls.length;y>m;m++)if(b.State.calls[m]!==!1){l=!0;break}l===!1&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var f,d=function(){if(r.documentMode)return r.documentMode;for(var e=7;e>4;e--){var t=r.createElement("div");if(t.innerHTML="",t.getElementsByTagName("span").length)return t=null,e}return a}(),g=function(){var e=0;return t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||function(t){var r,a=(new Date).getTime();return r=Math.max(0,16-(a-e)),e=a+r,setTimeout(function(){t(a+r)},r)}}(),m={isString:function(e){return"string"==typeof e},isArray:Array.isArray||function(e){return"[object Array]"===Object.prototype.toString.call(e)},isFunction:function(e){return"[object Function]"===Object.prototype.toString.call(e)},isNode:function(e){return e&&e.nodeType},isNodeList:function(e){return"object"==typeof e&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e))&&e.length!==a&&(0===e.length||"object"==typeof e[0]&&e[0].nodeType>0)},isWrapped:function(e){return e&&(e.jquery||t.Zepto&&t.Zepto.zepto.isZ(e))},isSVG:function(e){return t.SVGElement&&e instanceof t.SVGElement},isEmptyObject:function(e){for(var t in e)return!1;return!0}},y=!1;if(e.fn&&e.fn.jquery?(f=e,y=!0):f=t.Velocity.Utilities,8>=d&&!y)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=d)return void(jQuery.fn.velocity=jQuery.fn.animate);var h=400,v="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:t.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:r.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:f,Redirects:{},Easings:{},Promise:t.Promise,defaults:{queue:"",duration:h,easing:v,begin:a,complete:a,progress:a,display:a,visibility:a,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(e){f.data(e,"velocity",{isSVG:m.isSVG(e),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};t.pageYOffset!==a?(b.State.scrollAnchor=t,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=r.documentElement||r.body.parentNode||r.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var x=function(){function e(e){return-e.tension*e.x-e.friction*e.v}function t(t,r,a){var n={x:t.x+a.dx*r,v:t.v+a.dv*r,tension:t.tension,friction:t.friction};return{dx:n.v,dv:e(n)}}function r(r,a){var n={dx:r.v,dv:e(r)},o=t(r,.5*a,n),i=t(r,.5*a,o),s=t(r,a,i),l=1/6*(n.dx+2*(o.dx+i.dx)+s.dx),u=1/6*(n.dv+2*(o.dv+i.dv)+s.dv);return r.x=r.x+l*a,r.v=r.v+u*a,r}return function a(e,t,n){var o,i,s,l={x:-1,v:0,tension:null,friction:null},u=[0],c=0,p=1e-4,f=.016;for(e=parseFloat(e)||500,t=parseFloat(t)||20,n=n||null,l.tension=e,l.friction=t,o=null!==n,o?(c=a(e,t),i=c/n*f):i=f;s=r(s||l,i),u.push(1+s.x),c+=16,Math.abs(s.x)>p&&Math.abs(s.v)>p;);return o?function(e){return u[e*(u.length-1)|0]}:c}}();b.Easings={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},spring:function(e){return 1-Math.cos(4.5*e*Math.PI)*Math.exp(6*-e)}},f.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(e,t){b.Easings[t[0]]=l.apply(null,t[1])});var S=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var e=0;e=d)switch(e){case"name":return"filter";case"extract":var a=r.toString().match(/alpha\(opacity=(.*)\)/i);return r=a?a[1]/100:1;case"inject":return t.style.zoom=1,parseFloat(r)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(r),10)+")"}else switch(e){case"name":return"opacity";case"extract":return r;case"inject":return r}}},register:function(){9>=d||b.State.isGingerbread||(S.Lists.transformsBase=S.Lists.transformsBase.concat(S.Lists.transforms3D));for(var e=0;en&&(n=1),o=!/(\d)$/i.test(n);break;case"skew":o=!/(deg|\d)$/i.test(n);break;case"rotate":o=!/(deg|\d)$/i.test(n)}return o||(i(r).transformCache[t]="("+n+")"),i(r).transformCache[t]}}}();for(var e=0;e=d||3!==o.split(" ").length||(o+=" 1"),o;case"inject":return 8>=d?4===n.split(" ").length&&(n=n.split(/\s+/).slice(0,3).join(" ")):3===n.split(" ").length&&(n+=" 1"),(8>=d?"rgb":"rgba")+"("+n.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(e){return e.replace(/-(\w)/g,function(e,t){return t.toUpperCase()})},SVGAttribute:function(e){var t="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(d||b.State.isAndroid&&!b.State.isChrome)&&(t+="|transform"),new RegExp("^("+t+")$","i").test(e)},prefixCheck:function(e){if(b.State.prefixMatches[e])return[b.State.prefixMatches[e],!0];for(var t=["","Webkit","Moz","ms","O"],r=0,a=t.length;a>r;r++){var n;if(n=0===r?e:t[r]+e.replace(/^\w/,function(e){return e.toUpperCase()}),m.isString(b.State.prefixElement.style[n]))return b.State.prefixMatches[e]=n,[n,!0]}return[e,!1]}},Values:{hexToRgb:function(e){var t,r=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,a=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e=e.replace(r,function(e,t,r,a){return t+t+r+r+a+a}),t=a.exec(e),t?[parseInt(t[1],16),parseInt(t[2],16),parseInt(t[3],16)]:[0,0,0]},isCSSNullValue:function(e){return 0==e||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e)},getUnitType:function(e){return/^(rotate|skew)/i.test(e)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e)?"":"px"},getDisplayType:function(e){var t=e&&e.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t)?"inline":/^(li)$/i.test(t)?"list-item":/^(tr)$/i.test(t)?"table-row":/^(table)$/i.test(t)?"table":/^(tbody)$/i.test(t)?"table-row-group":"block"},addClass:function(e,t){e.classList?e.classList.add(t):e.className+=(e.className.length?" ":"")+t},removeClass:function(e,t){e.classList?e.classList.remove(t):e.className=e.className.toString().replace(new RegExp("(^|\\s)"+t.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(e,r,n,o){function s(e,r){function n(){u&&S.setPropertyValue(e,"display","none")}var l=0;if(8>=d)l=f.css(e,r);else{var u=!1;if(/^(width|height)$/.test(r)&&0===S.getPropertyValue(e,"display")&&(u=!0,S.setPropertyValue(e,"display",S.Values.getDisplayType(e))),!o){if("height"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var c=e.offsetHeight-(parseFloat(S.getPropertyValue(e,"borderTopWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderBottomWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingTop"))||0)-(parseFloat(S.getPropertyValue(e,"paddingBottom"))||0);return n(),c}if("width"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var p=e.offsetWidth-(parseFloat(S.getPropertyValue(e,"borderLeftWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderRightWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingLeft"))||0)-(parseFloat(S.getPropertyValue(e,"paddingRight"))||0);return n(),p}}var g;g=i(e)===a?t.getComputedStyle(e,null):i(e).computedStyle?i(e).computedStyle:i(e).computedStyle=t.getComputedStyle(e,null),"borderColor"===r&&(r="borderTopColor"),l=9===d&&"filter"===r?g.getPropertyValue(r):g[r],(""===l||null===l)&&(l=e.style[r]),n()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(r)){var m=s(e,"position");("fixed"===m||"absolute"===m&&/top|left/i.test(r))&&(l=f(e).position()[r]+"px")}return l}var l;if(S.Hooks.registered[r]){var u=r,c=S.Hooks.getRoot(u);n===a&&(n=S.getPropertyValue(e,S.Names.prefixCheck(c)[0])),S.Normalizations.registered[c]&&(n=S.Normalizations.registered[c]("extract",e,n)),l=S.Hooks.extractValue(u,n)}else if(S.Normalizations.registered[r]){var p,g;p=S.Normalizations.registered[r]("name",e),"transform"!==p&&(g=s(e,S.Names.prefixCheck(p)[0]),S.Values.isCSSNullValue(g)&&S.Hooks.templates[r]&&(g=S.Hooks.templates[r][1])),l=S.Normalizations.registered[r]("extract",e,g)}if(!/^[\d-]/.test(l))if(i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r))if(/^(height|width)$/i.test(r))try{l=e.getBBox()[r]}catch(m){l=0}else l=e.getAttribute(r);else l=s(e,S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+r+": "+l),l},setPropertyValue:function(e,r,a,n,o){var s=r;if("scroll"===r)o.container?o.container["scroll"+o.direction]=a:"Left"===o.direction?t.scrollTo(a,o.alternateValue):t.scrollTo(o.alternateValue,a);else if(S.Normalizations.registered[r]&&"transform"===S.Normalizations.registered[r]("name",e))S.Normalizations.registered[r]("inject",e,a),s="transform",a=i(e).transformCache[r];else{if(S.Hooks.registered[r]){var l=r,u=S.Hooks.getRoot(r);n=n||S.getPropertyValue(e,u),a=S.Hooks.injectValue(l,a,n),r=u}if(S.Normalizations.registered[r]&&(a=S.Normalizations.registered[r]("inject",e,a),r=S.Normalizations.registered[r]("name",e)),s=S.Names.prefixCheck(r)[0],8>=d)try{e.style[s]=a}catch(c){b.debug&&console.log("Browser does not support ["+a+"] for ["+s+"]")}else i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r)?e.setAttribute(r,a):e.style[s]=a;b.debug>=2&&console.log("Set "+r+" ("+s+"): "+a)}return[s,a]},flushTransformCache:function(e){function t(t){return parseFloat(S.getPropertyValue(e,t))}var r="";if((d||b.State.isAndroid&&!b.State.isChrome)&&i(e).isSVG){var a={translate:[t("translateX"),t("translateY")],skewX:[t("skewX")],skewY:[t("skewY")],scale:1!==t("scale")?[t("scale"),t("scale")]:[t("scaleX"),t("scaleY")],rotate:[t("rotateZ"),0,0]};f.each(i(e).transformCache,function(e){/^translate/i.test(e)?e="translate":/^scale/i.test(e)?e="scale":/^rotate/i.test(e)&&(e="rotate"),a[e]&&(r+=e+"("+a[e].join(" ")+") ",delete a[e])})}else{var n,o;f.each(i(e).transformCache,function(t){return n=i(e).transformCache[t],"transformPerspective"===t?(o=n,!0):(9===d&&"rotateZ"===t&&(t="rotate"),void(r+=t+n+" "))}),o&&(r="perspective"+o+" "+r)}S.setPropertyValue(e,"transform",r)}};S.Hooks.register(),S.Normalizations.register(),b.hook=function(e,t,r){var n=a;return e=o(e),f.each(e,function(e,o){if(i(o)===a&&b.init(o),r===a)n===a&&(n=b.CSS.getPropertyValue(o,t));else{var s=b.CSS.setPropertyValue(o,t,r);"transform"===s[0]&&b.CSS.flushTransformCache(o),n=s}}),n};var P=function(){function e(){return s?k.promise||null:l}function n(){function e(e){function p(e,t){var r=a,n=a,i=a;return m.isArray(e)?(r=e[0],!m.isArray(e[1])&&/^[\d-]/.test(e[1])||m.isFunction(e[1])||S.RegEx.isHex.test(e[1])?i=e[1]:(m.isString(e[1])&&!S.RegEx.isHex.test(e[1])||m.isArray(e[1]))&&(n=t?e[1]:u(e[1],s.duration),e[2]!==a&&(i=e[2]))):r=e,t||(n=n||s.easing),m.isFunction(r)&&(r=r.call(o,V,w)),m.isFunction(i)&&(i=i.call(o,V,w)),[r||0,n,i]}function d(e,t){var r,a;return a=(t||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(e){return r=e,""}),r||(r=S.Values.getUnitType(e)),[a,r]}function h(){var e={myParent:o.parentNode||r.body,position:S.getPropertyValue(o,"position"),fontSize:S.getPropertyValue(o,"fontSize")},a=e.position===L.lastPosition&&e.myParent===L.lastParent,n=e.fontSize===L.lastFontSize;L.lastParent=e.myParent,L.lastPosition=e.position,L.lastFontSize=e.fontSize;var s=100,l={};if(n&&a)l.emToPx=L.lastEmToPx,l.percentToPxWidth=L.lastPercentToPxWidth,l.percentToPxHeight=L.lastPercentToPxHeight;else{var u=i(o).isSVG?r.createElementNS("http://www.w3.org/2000/svg","rect"):r.createElement("div");b.init(u),e.myParent.appendChild(u),f.each(["overflow","overflowX","overflowY"],function(e,t){b.CSS.setPropertyValue(u,t,"hidden")}),b.CSS.setPropertyValue(u,"position",e.position),b.CSS.setPropertyValue(u,"fontSize",e.fontSize),b.CSS.setPropertyValue(u,"boxSizing","content-box"),f.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(e,t){b.CSS.setPropertyValue(u,t,s+"%")}),b.CSS.setPropertyValue(u,"paddingLeft",s+"em"),l.percentToPxWidth=L.lastPercentToPxWidth=(parseFloat(S.getPropertyValue(u,"width",null,!0))||1)/s,l.percentToPxHeight=L.lastPercentToPxHeight=(parseFloat(S.getPropertyValue(u,"height",null,!0))||1)/s,l.emToPx=L.lastEmToPx=(parseFloat(S.getPropertyValue(u,"paddingLeft"))||1)/s,e.myParent.removeChild(u)}return null===L.remToPx&&(L.remToPx=parseFloat(S.getPropertyValue(r.body,"fontSize"))||16),null===L.vwToPx&&(L.vwToPx=parseFloat(t.innerWidth)/100,L.vhToPx=parseFloat(t.innerHeight)/100),l.remToPx=L.remToPx,l.vwToPx=L.vwToPx,l.vhToPx=L.vhToPx,b.debug>=1&&console.log("Unit ratios: "+JSON.stringify(l),o),l}if(s.begin&&0===V)try{s.begin.call(g,g)}catch(x){setTimeout(function(){throw x},1)}if("scroll"===A){var P,C,T,F=/^x$/i.test(s.axis)?"Left":"Top",j=parseFloat(s.offset)||0;s.container?m.isWrapped(s.container)||m.isNode(s.container)?(s.container=s.container[0]||s.container,P=s.container["scroll"+F],T=P+f(o).position()[F.toLowerCase()]+j):s.container=null:(P=b.State.scrollAnchor[b.State["scrollProperty"+F]],C=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===F?"Top":"Left")]],T=f(o).offset()[F.toLowerCase()]+j),l={scroll:{rootPropertyValue:!1,startValue:P,currentValue:P,endValue:T,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:F,alternateValue:C}},element:o},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,o)}else if("reverse"===A){if(!i(o).tweensContainer)return void f.dequeue(o,s.queue);"none"===i(o).opts.display&&(i(o).opts.display="auto"),"hidden"===i(o).opts.visibility&&(i(o).opts.visibility="visible"),i(o).opts.loop=!1,i(o).opts.begin=null,i(o).opts.complete=null,v.easing||delete s.easing,v.duration||delete s.duration,s=f.extend({},i(o).opts,s);var E=f.extend(!0,{},i(o).tweensContainer);for(var H in E)if("element"!==H){var N=E[H].startValue;E[H].startValue=E[H].currentValue=E[H].endValue,E[H].endValue=N,m.isEmptyObject(v)||(E[H].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+H+"): "+JSON.stringify(E[H]),o)}l=E}else if("start"===A){var E;i(o).tweensContainer&&i(o).isAnimating===!0&&(E=i(o).tweensContainer),f.each(y,function(e,t){if(RegExp("^"+S.Lists.colors.join("$|^")+"$").test(e)){var r=p(t,!0),n=r[0],o=r[1],i=r[2];if(S.RegEx.isHex.test(n)){for(var s=["Red","Green","Blue"],l=S.Values.hexToRgb(n),u=i?S.Values.hexToRgb(i):a,c=0;cO;O++){var q={delay:j.delay,progress:j.progress};O===z-1&&(q.display=j.display,q.visibility=j.visibility,q.complete=j.complete),P(g,"reverse",q)}return e()}};b=f.extend(P,b),b.animate=P;var w=t.requestAnimationFrame||g;return b.State.isMobile||r.hidden===a||r.addEventListener("visibilitychange",function(){r.hidden?(w=function(e){return setTimeout(function(){e(!0)},16)},c()):w=t.requestAnimationFrame||g}),e.Velocity=b,e!==t&&(e.fn.velocity=P,e.fn.velocity.defaults=b.defaults),f.each(["Down","Up"],function(e,t){b.Redirects["slide"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u=l.begin,c=l.complete,p={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},d={};l.display===a&&(l.display="Down"===t?"inline"===b.CSS.Values.getDisplayType(e)?"inline-block":"block":"none"),l.begin=function(){u&&u.call(i,i);for(var r in p){d[r]=e.style[r];var a=b.CSS.getPropertyValue(e,r);p[r]="Down"===t?[a,0]:[0,a]}d.overflow=e.style.overflow,e.style.overflow="hidden"},l.complete=function(){for(var t in d)e.style[t]=d[t];c&&c.call(i,i),s&&s.resolver(i)},b(e,p,l)}}),f.each(["In","Out"],function(e,t){b.Redirects["fade"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u={opacity:"In"===t?1:0},c=l.complete;l.complete=n!==o-1?l.begin=null:function(){c&&c.call(i,i),s&&s.resolver(i)},l.display===a&&(l.display="In"===t?"auto":"none"),b(this,u,l)}}),b}(window.jQuery||window.Zepto||window,window,document)})); +;!function(a,b,c,d){"use strict";function k(a,b,c){return setTimeout(q(a,c),b)}function l(a,b,c){return Array.isArray(a)?(m(a,c[b],c),!0):!1}function m(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e-1}function x(a){return a.trim().split(/\s+/g)}function y(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;dc[b]}):d.sort()),d}function B(a,b){for(var c,f,g=b[0].toUpperCase()+b.slice(1),h=0;h1&&!c.firstMultiple?c.firstMultiple=gb(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=hb(d);b.timeStamp=j(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=lb(h,i),b.distance=kb(h,i),eb(c,b),b.offsetDirection=jb(b.deltaX,b.deltaY),b.scale=g?nb(g.pointers,d):1,b.rotation=g?mb(g.pointers,d):0,fb(c,b);var k=a.element;v(b.srcEvent.target,k)&&(k=b.srcEvent.target),b.target=k}function eb(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===O||f.eventType===Q)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function fb(a,b){var f,g,h,j,c=a.lastInterval||b,e=b.timeStamp-c.timeStamp;if(b.eventType!=R&&(e>N||c.velocity===d)){var k=c.deltaX-b.deltaX,l=c.deltaY-b.deltaY,m=ib(e,k,l);g=m.x,h=m.y,f=i(m.x)>i(m.y)?m.x:m.y,j=jb(k,l),a.lastInterval=b}else f=c.velocity,g=c.velocityX,h=c.velocityY,j=c.direction;b.velocity=f,b.velocityX=g,b.velocityY=h,b.direction=j}function gb(a){for(var b=[],c=0;ce;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:h(c/b),y:h(d/b)}}function ib(a,b,c){return{x:b/a||0,y:c/a||0}}function jb(a,b){return a===b?S:i(a)>=i(b)?a>0?T:U:b>0?V:W}function kb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function lb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function mb(a,b){return lb(b[1],b[0],_)-lb(a[1],a[0],_)}function nb(a,b){return kb(b[0],b[1],_)/kb(a[0],a[1],_)}function rb(){this.evEl=pb,this.evWin=qb,this.allow=!0,this.pressed=!1,ab.apply(this,arguments)}function wb(){this.evEl=ub,this.evWin=vb,ab.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function Ab(){this.evTarget=yb,this.evWin=zb,this.started=!1,ab.apply(this,arguments)}function Bb(a,b){var c=z(a.touches),d=z(a.changedTouches);return b&(Q|R)&&(c=A(c.concat(d),"identifier",!0)),[c,d]}function Eb(){this.evTarget=Db,this.targetIds={},ab.apply(this,arguments)}function Fb(a,b){var c=z(a.touches),d=this.targetIds;if(b&(O|P)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=z(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return v(a.target,i)}),b===O)for(e=0;eh&&(b.push(a),h=b.length-1):e&(Q|R)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var xb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},yb="touchstart",zb="touchstart touchmove touchend touchcancel";p(Ab,ab,{handler:function(a){var b=xb[a.type];if(b===O&&(this.started=!0),this.started){var c=Bb.call(this,a,b);b&(Q|R)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}});var Cb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},Db="touchstart touchmove touchend touchcancel";p(Eb,ab,{handler:function(a){var b=Cb[a.type],c=Fb.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}),p(Gb,ab,{handler:function(a,b,c){var d=c.pointerType==J,e=c.pointerType==L;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Q|R)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Hb=B(f.style,"touchAction"),Ib=Hb!==d,Jb="compute",Kb="auto",Lb="manipulation",Mb="none",Nb="pan-x",Ob="pan-y";Pb.prototype={set:function(a){a==Jb&&(a=this.compute()),Ib&&(this.manager.element.style[Hb]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return m(this.manager.recognizers,function(b){r(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),Qb(a.join(" "))},preventDefaults:function(a){if(!Ib){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return b.preventDefault(),void 0;var d=this.actions,e=w(d,Mb),f=w(d,Ob),g=w(d,Nb);return e||f&&c&X||g&&c&Y?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var Rb=1,Sb=2,Tb=4,Ub=8,Vb=Ub,Wb=16,Xb=32;Yb.prototype={defaults:{},set:function(a){return n(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(l(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=_b(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return l(a,"dropRecognizeWith",this)?this:(a=_b(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(l(a,"requireFailure",this))return this;var b=this.requireFail;return a=_b(a,this),-1===y(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(l(a,"dropRequireFailure",this))return this;a=_b(a,this);var b=y(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function d(d){b.manager.emit(b.options.event+(d?Zb(c):""),a)}var b=this,c=this.state;Ub>c&&d(!0),d(),c>=Ub&&d(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):(this.state=Xb,void 0)},canEmit:function(){for(var a=0;af?T:U,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?S:0>g?V:W,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return ac.prototype.attrTest.call(this,a)&&(this.state&Sb||!(this.state&Sb)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),p(cc,ac,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&Sb)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),p(dc,Yb,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Kb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distanceb.time;if(this._input=a,!d||!c||a.eventType&(Q|R)&&!e)this.reset();else if(a.eventType&O)this.reset(),this._timer=k(function(){this.state=Vb,this.tryEmit()},b.time,this);else if(a.eventType&Q)return Vb;return Xb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===Vb&&(a&&a.eventType&Q?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=j(),this.manager.emit(this.options.event,this._input)))}}),p(ec,ac,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&Sb)}}),p(fc,ac,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:X|Y,pointers:1},getTouchAction:function(){return bc.prototype.getTouchAction.call(this)},attrTest:function(a){var c,b=this.options.direction;return b&(X|Y)?c=a.velocity:b&X?c=a.velocityX:b&Y&&(c=a.velocityY),this._super.attrTest.call(this,a)&&b&a.direction&&a.distance>this.options.threshold&&i(c)>this.options.velocity&&a.eventType&Q},emit:function(a){var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),p(gc,Yb,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Lb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance= 0 && !requestAnimationFrame) { + requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame']; + cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame']; + } + + // polyfill with setTimeout fallback + // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945 + if (!requestAnimationFrame || !cancelAnimationFrame) { + requestAnimationFrame = function(callback) { + var now = +Date.now(), + nextTime = Math.max(lastTime + 16, now); + return setTimeout(function() { + callback(lastTime = nextTime); + }, nextTime - now); + }; + + cancelAnimationFrame = clearTimeout; + } + + // export to window + window.requestAnimationFrame = requestAnimationFrame; + window.cancelAnimationFrame = cancelAnimationFrame; +}(window)); + + +// Unique ID +Materialize.guid = (function() { + function s4() { + return Math.floor((1 + Math.random()) * 0x10000) + .toString(16) + .substring(1); + } + return function() { + return s4() + s4() + '-' + s4() + '-' + s4() + '-' + + s4() + '-' + s4() + s4() + s4(); + }; +})(); + +/** + * Escapes hash from special characters + * @param {string} hash String returned from this.hash + * @returns {string} + */ +Materialize.escapeHash = function(hash) { + return hash.replace( /(:|\.|\[|\]|,|=)/g, "\\$1" ); +}; + +Materialize.elementOrParentIsFixed = function(element) { + var $element = $(element); + var $checkElements = $element.add($element.parents()); + var isFixed = false; + $checkElements.each(function(){ + if ($(this).css("position") === "fixed") { + isFixed = true; + return false; + } + }); + return isFixed; +}; + +// Velocity has conflicts when loaded with jQuery, this will check for it +// First, check if in noConflict mode +var Vel; +if (jQuery) { + Vel = jQuery.Velocity; +} else if ($) { + Vel = $.Velocity; +} else { + Vel = Velocity; +} +;(function ($) { + $.fn.collapsible = function(options) { + var defaults = { + accordion: undefined, + onOpen: undefined, + onClose: undefined + }; + + options = $.extend(defaults, options); + + + return this.each(function() { + + var $this = $(this); + + var $panel_headers = $(this).find('> li > .collapsible-header'); + + var collapsible_type = $this.data("collapsible"); + + // Turn off any existing event handlers + $this.off('click.collapse', '> li > .collapsible-header'); + $panel_headers.off('click.collapse'); + + + /**************** + Helper Functions + ****************/ + + // Accordion Open + function accordionOpen(object) { + $panel_headers = $this.find('> li > .collapsible-header'); + if (object.hasClass('active')) { + object.parent().addClass('active'); + } + else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')){ + object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + else{ + object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + + $panel_headers.not(object).removeClass('active').parent().removeClass('active'); + + // Close previously open accordion elements. + $panel_headers.not(object).parent().children('.collapsible-body').stop(true,false).each(function() { + if ($(this).is(':visible')) { + $(this).slideUp({ + duration: 350, + easing: "easeOutQuart", + queue: false, + complete: + function() { + $(this).css('height', ''); + execCallbacks($(this).siblings('.collapsible-header')); + } + }); + } + }); + } + + // Expandable Open + function expandableOpen(object) { + if (object.hasClass('active')) { + object.parent().addClass('active'); + } + else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')){ + object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + else { + object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + } + + // Open collapsible. object: .collapsible-header + function collapsibleOpen(object) { + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion + accordionOpen(object); + } else { // Handle Expandables + expandableOpen(object); + } + + execCallbacks(object); + } + + // Handle callbacks + function execCallbacks(object) { + if (object.hasClass('active')) { + if (typeof(options.onOpen) === "function") { + options.onOpen.call(this, object.parent()); + } + } else { + if (typeof(options.onClose) === "function") { + options.onClose.call(this, object.parent()); + } + } + } + + /** + * Check if object is children of panel header + * @param {Object} object Jquery object + * @return {Boolean} true if it is children + */ + function isChildrenOfPanelHeader(object) { + + var panelHeader = getPanelHeader(object); + + return panelHeader.length > 0; + } + + /** + * Get panel header from a children element + * @param {Object} object Jquery object + * @return {Object} panel header object + */ + function getPanelHeader(object) { + + return object.closest('li > .collapsible-header'); + } + + /***** End Helper Functions *****/ + + + + // Add click handler to only direct collapsible header children + $this.on('click.collapse', '> li > .collapsible-header', function(e) { + var element = $(e.target); + + if (isChildrenOfPanelHeader(element)) { + element = getPanelHeader(element); + } + + element.toggleClass('active'); + + collapsibleOpen(element); + }); + + + // Open first active + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion + collapsibleOpen($panel_headers.filter('.active').first()); + + } else { // Handle Expandables + $panel_headers.filter('.active').each(function() { + collapsibleOpen($(this)); + }); + } + + }); + }; + + $(document).ready(function(){ + $('.collapsible').collapsible(); + }); +}( jQuery ));;(function ($) { + + // Add posibility to scroll to selected option + // usefull for select for example + $.fn.scrollTo = function(elem) { + $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top); + return this; + }; + + $.fn.dropdown = function (options) { + var defaults = { + inDuration: 300, + outDuration: 225, + constrain_width: true, // Constrains width of dropdown to the activator + hover: false, + gutter: 0, // Spacing from edge + belowOrigin: false, + alignment: 'left', + stopPropagation: false + }; + + // Open dropdown. + if (options === "open") { + this.each(function() { + $(this).trigger('open'); + }); + return false; + } + + // Close dropdown. + if (options === "close") { + this.each(function() { + $(this).trigger('close'); + }); + return false; + } + + this.each(function(){ + var origin = $(this); + var curr_options = $.extend({}, defaults, options); + var isFocused = false; + + // Dropdown menu + var activates = $("#"+ origin.attr('data-activates')); + + function updateOptions() { + if (origin.data('induration') !== undefined) + curr_options.inDuration = origin.data('induration'); + if (origin.data('outduration') !== undefined) + curr_options.outDuration = origin.data('outduration'); + if (origin.data('constrainwidth') !== undefined) + curr_options.constrain_width = origin.data('constrainwidth'); + if (origin.data('hover') !== undefined) + curr_options.hover = origin.data('hover'); + if (origin.data('gutter') !== undefined) + curr_options.gutter = origin.data('gutter'); + if (origin.data('beloworigin') !== undefined) + curr_options.belowOrigin = origin.data('beloworigin'); + if (origin.data('alignment') !== undefined) + curr_options.alignment = origin.data('alignment'); + if (origin.data('stoppropagation') !== undefined) + curr_options.stopPropagation = origin.data('stoppropagation'); + } + + updateOptions(); + + // Attach dropdown to its activator + origin.after(activates); + + /* + Helper function to position and resize dropdown. + Used in hover and click handler. + */ + function placeDropdown(eventType) { + // Check for simultaneous focus and click events. + if (eventType === 'focus') { + isFocused = true; + } + + // Check html data attributes + updateOptions(); + + // Set Dropdown state + activates.addClass('active'); + origin.addClass('active'); + + // Constrain width + if (curr_options.constrain_width === true) { + activates.css('width', origin.outerWidth()); + + } else { + activates.css('white-space', 'nowrap'); + } + + // Offscreen detection + var windowHeight = window.innerHeight; + var originHeight = origin.innerHeight(); + var offsetLeft = origin.offset().left; + var offsetTop = origin.offset().top - $(window).scrollTop(); + var currAlignment = curr_options.alignment; + var gutterSpacing = 0; + var leftPosition = 0; + + // Below Origin + var verticalOffset = 0; + if (curr_options.belowOrigin === true) { + verticalOffset = originHeight; + } + + // Check for scrolling positioned container. + var scrollYOffset = 0; + var scrollXOffset = 0; + var wrapper = origin.parent(); + if (!wrapper.is('body')) { + if (wrapper[0].scrollHeight > wrapper[0].clientHeight) { + scrollYOffset = wrapper[0].scrollTop; + } + if (wrapper[0].scrollWidth > wrapper[0].clientWidth) { + scrollXOffset = wrapper[0].scrollLeft; + } + } + + + if (offsetLeft + activates.innerWidth() > $(window).width()) { + // Dropdown goes past screen on right, force right alignment + currAlignment = 'right'; + + } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) { + // Dropdown goes past screen on left, force left alignment + currAlignment = 'left'; + } + // Vertical bottom offscreen detection + if (offsetTop + activates.innerHeight() > windowHeight) { + // If going upwards still goes offscreen, just crop height of dropdown. + if (offsetTop + originHeight - activates.innerHeight() < 0) { + var adjustedHeight = windowHeight - offsetTop - verticalOffset; + activates.css('max-height', adjustedHeight); + } else { + // Flow upwards. + if (!verticalOffset) { + verticalOffset += originHeight; + } + verticalOffset -= activates.innerHeight(); + } + } + + // Handle edge alignment + if (currAlignment === 'left') { + gutterSpacing = curr_options.gutter; + leftPosition = origin.position().left + gutterSpacing; + } + else if (currAlignment === 'right') { + var offsetRight = origin.position().left + origin.outerWidth() - activates.outerWidth(); + gutterSpacing = -curr_options.gutter; + leftPosition = offsetRight + gutterSpacing; + } + + // Position dropdown + activates.css({ + position: 'absolute', + top: origin.position().top + verticalOffset + scrollYOffset, + left: leftPosition + scrollXOffset + }); + + + // Show dropdown + activates.stop(true, true).css('opacity', 0) + .slideDown({ + queue: false, + duration: curr_options.inDuration, + easing: 'easeOutCubic', + complete: function() { + $(this).css('height', ''); + } + }) + .animate( {opacity: 1}, {queue: false, duration: curr_options.inDuration, easing: 'easeOutSine'}); + } + + function hideDropdown() { + // Check for simultaneous focus and click events. + isFocused = false; + activates.fadeOut(curr_options.outDuration); + activates.removeClass('active'); + origin.removeClass('active'); + setTimeout(function() { activates.css('max-height', ''); }, curr_options.outDuration); + } + + // Hover + if (curr_options.hover) { + var open = false; + origin.unbind('click.' + origin.attr('id')); + // Hover handler to show dropdown + origin.on('mouseenter', function(e){ // Mouse over + if (open === false) { + placeDropdown(); + open = true; + } + }); + origin.on('mouseleave', function(e){ + // If hover on origin then to something other than dropdown content, then close + var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element + if(!$(toEl).closest('.dropdown-content').is(activates)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + activates.on('mouseleave', function(e){ // Mouse out + var toEl = e.toElement || e.relatedTarget; + if(!$(toEl).closest('.dropdown-button').is(origin)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + // Click + } else { + // Click handler to show dropdown + origin.unbind('click.' + origin.attr('id')); + origin.bind('click.'+origin.attr('id'), function(e){ + if (!isFocused) { + if ( origin[0] == e.currentTarget && + !origin.hasClass('active') && + ($(e.target).closest('.dropdown-content').length === 0)) { + e.preventDefault(); // Prevents button click from moving window + if (curr_options.stopPropagation) { + e.stopPropagation(); + } + placeDropdown('click'); + } + // If origin is clicked and menu is open, close menu + else if (origin.hasClass('active')) { + hideDropdown(); + $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id')); + } + // If menu open, add click close handler to document + if (activates.hasClass('active')) { + $(document).bind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'), function (e) { + if (!activates.is(e.target) && !origin.is(e.target) && (!origin.find(e.target).length) ) { + hideDropdown(); + $(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id')); + } + }); + } + } + }); + + } // End else + + // Listen to open and close event - useful for select component + origin.on('open', function(e, eventType) { + placeDropdown(eventType); + }); + origin.on('close', hideDropdown); + + + }); + }; // End dropdown plugin + + $(document).ready(function(){ + $('.dropdown-button').dropdown(); + }); +}( jQuery )); +;(function($) { + var _stack = 0, + _lastID = 0, + _generateID = function() { + _lastID++; + return 'materialize-modal-overlay-' + _lastID; + }; + + var methods = { + init : function(options) { + var defaults = { + opacity: 0.5, + in_duration: 350, + out_duration: 250, + ready: undefined, + complete: undefined, + dismissible: true, + starting_top: '4%', + ending_top: '10%' + }; + + // Override defaults + options = $.extend(defaults, options); + + return this.each(function() { + var $modal = $(this); + var modal_id = $(this).attr("id") || '#' + $(this).data('target'); + + var closeModal = function() { + var overlayID = $modal.data('overlay-id'); + var $overlay = $('#' + overlayID); + $modal.removeClass('open'); + + // Enable scrolling + $('body').css({ + overflow: '', + width: '' + }); + + $modal.find('.modal-close').off('click.close'); + $(document).off('keyup.modal' + overlayID); + + $overlay.velocity( { opacity: 0}, {duration: options.out_duration, queue: false, ease: "easeOutQuart"}); + + + // Define Bottom Sheet animation + var exitVelocityOptions = { + duration: options.out_duration, + queue: false, + ease: "easeOutCubic", + // Handle modal ready callback + complete: function() { + $(this).css({display:"none"}); + + // Call complete callback + if (typeof(options.complete) === "function") { + options.complete.call(this, $modal); + } + $overlay.remove(); + _stack--; + } + }; + if ($modal.hasClass('bottom-sheet')) { + $modal.velocity({bottom: "-100%", opacity: 0}, exitVelocityOptions); + } + else { + $modal.velocity( + { top: options.starting_top, opacity: 0, scaleX: 0.7}, + exitVelocityOptions + ); + } + }; + + var openModal = function($trigger) { + var $body = $('body'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + if ($modal.hasClass('open')) { + return; + } + + var overlayID = _generateID(); + var $overlay = $(''); + lStack = (++_stack); + + // Store a reference of the overlay + $overlay.attr('id', overlayID).css('z-index', 1000 + lStack * 2); + $modal.data('overlay-id', overlayID).css('z-index', 1000 + lStack * 2 + 1); + $modal.addClass('open'); + + $("body").append($overlay); + + if (options.dismissible) { + $overlay.click(function() { + closeModal(); + }); + // Return on ESC + $(document).on('keyup.modal' + overlayID, function(e) { + if (e.keyCode === 27) { // ESC key + closeModal(); + } + }); + } + + $modal.find(".modal-close").on('click.close', function(e) { + closeModal(); + }); + + $overlay.css({ display : "block", opacity : 0 }); + + $modal.css({ + display : "block", + opacity: 0 + }); + + $overlay.velocity({opacity: options.opacity}, {duration: options.in_duration, queue: false, ease: "easeOutCubic"}); + $modal.data('associated-overlay', $overlay[0]); + + // Define Bottom Sheet animation + var enterVelocityOptions = { + duration: options.in_duration, + queue: false, + ease: "easeOutCubic", + // Handle modal ready callback + complete: function() { + if (typeof(options.ready) === "function") { + options.ready.call(this, $modal, $trigger); + } + } + }; + if ($modal.hasClass('bottom-sheet')) { + $modal.velocity({bottom: "0", opacity: 1}, enterVelocityOptions); + } + else { + $.Velocity.hook($modal, "scaleX", 0.7); + $modal.css({ top: options.starting_top }); + $modal.velocity({top: options.ending_top, opacity: 1, scaleX: '1'}, enterVelocityOptions); + } + + }; + + // Reset handlers + $(document).off('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]'); + $(this).off('openModal'); + $(this).off('closeModal'); + + // Close Handlers + $(document).on('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]', function(e) { + options.starting_top = ($(this).offset().top - $(window).scrollTop()) /1.15; + openModal($(this)); + e.preventDefault(); + }); // done set on click + + $(this).on('openModal', function() { + var modal_id = $(this).attr("href") || '#' + $(this).data('target'); + openModal(); + }); + + $(this).on('closeModal', function() { + closeModal(); + }); + }); // done return + }, + open : function() { + $(this).trigger('openModal'); + }, + close : function() { + $(this).trigger('closeModal'); + } + }; + + $.fn.modal = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.modal' ); + } + }; +})(jQuery); +;(function ($) { + + $.fn.materialbox = function () { + + return this.each(function() { + + if ($(this).hasClass('initialized')) { + return; + } + + $(this).addClass('initialized'); + + var overlayActive = false; + var doneAnimating = true; + var inDuration = 275; + var outDuration = 200; + var origin = $(this); + var placeholder = $('
').addClass('material-placeholder'); + var originalWidth = 0; + var originalHeight = 0; + var ancestorsChanged; + var ancestor; + origin.wrap(placeholder); + + + origin.on('click', function(){ + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.width(); + var originalHeight = origin.height(); + + + // If already modal, return to original + if (doneAnimating === false) { + returnToOriginal(); + return false; + } + else if (overlayActive && doneAnimating===true) { + returnToOriginal(); + return false; + } + + + // Set states + doneAnimating = false; + origin.addClass('active'); + overlayActive = true; + + // Set positioning for placeholder + placeholder.css({ + width: placeholder[0].getBoundingClientRect().width, + height: placeholder[0].getBoundingClientRect().height, + position: 'relative', + top: 0, + left: 0 + }); + + // Find ancestor with overflow: hidden; and remove it + ancestorsChanged = undefined; + ancestor = placeholder[0].parentNode; + var count = 0; + while (ancestor !== null && !$(ancestor).is(document)) { + var curr = $(ancestor); + if (curr.css('overflow') !== 'visible') { + curr.css('overflow', 'visible'); + if (ancestorsChanged === undefined) { + ancestorsChanged = curr; + } + else { + ancestorsChanged = ancestorsChanged.add(curr); + } + } + ancestor = ancestor.parentNode; + } + + // Set css on origin + origin.css({position: 'absolute', 'z-index': 1000}) + .data('width', originalWidth) + .data('height', originalHeight); + + // Add overlay + var overlay = $('
') + .css({ + opacity: 0 + }) + .click(function(){ + if (doneAnimating === true) + returnToOriginal(); + }); + // Animate Overlay + // Put before in origin image to preserve z-index layering. + origin.before(overlay); + overlay.velocity({opacity: 1}, + {duration: inDuration, queue: false, easing: 'easeOutQuad'} ); + + // Add and animate caption if it exists + if (origin.data('caption') !== "") { + var $photo_caption = $('
'); + $photo_caption.text(origin.data('caption')); + $('body').append($photo_caption); + $photo_caption.css({ "display": "inline" }); + $photo_caption.velocity({opacity: 1}, {duration: inDuration, queue: false, easing: 'easeOutQuad'}); + } + + // Resize Image + var ratio = 0; + var widthPercent = originalWidth / windowWidth; + var heightPercent = originalHeight / windowHeight; + var newWidth = 0; + var newHeight = 0; + + if (widthPercent > heightPercent) { + ratio = originalHeight / originalWidth; + newWidth = windowWidth * 0.9; + newHeight = windowWidth * 0.9 * ratio; + } + else { + ratio = originalWidth / originalHeight; + newWidth = (windowHeight * 0.9) * ratio; + newHeight = windowHeight * 0.9; + } + + // Animate image + set z-index + if(origin.hasClass('responsive-img')) { + origin.velocity({'max-width': newWidth, 'width': originalWidth}, {duration: 0, queue: false, + complete: function(){ + origin.css({left: 0, top: 0}) + .velocity( + { + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2, + top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2 + }, + { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function(){doneAnimating = true;} + } + ); + } // End Complete + }); // End Velocity + } + else { + origin.css('left', 0) + .css('top', 0) + .velocity( + { + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2, + top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2 + }, + { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function(){doneAnimating = true;} + } + ); // End Velocity + } + + }); // End origin on click + + + // Return on scroll + $(window).scroll(function() { + if (overlayActive) { + returnToOriginal(); + } + }); + + // Return on ESC + $(document).keyup(function(e) { + + if (e.keyCode === 27 && doneAnimating === true) { // ESC key + if (overlayActive) { + returnToOriginal(); + } + } + }); + + + // This function returns the modaled image to the original spot + function returnToOriginal() { + + doneAnimating = false; + + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.data('width'); + var originalHeight = origin.data('height'); + + origin.velocity("stop", true); + $('#materialbox-overlay').velocity("stop", true); + $('.materialbox-caption').velocity("stop", true); + + + $('#materialbox-overlay').velocity({opacity: 0}, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function(){ + // Remove Overlay + overlayActive = false; + $(this).remove(); + } + }); + + // Resize Image + origin.velocity( + { + width: originalWidth, + height: originalHeight, + left: 0, + top: 0 + }, + { + duration: outDuration, + queue: false, easing: 'easeOutQuad' + } + ); + + // Remove Caption + reset css settings on image + $('.materialbox-caption').velocity({opacity: 0}, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function(){ + placeholder.css({ + height: '', + width: '', + position: '', + top: '', + left: '' + }); + + origin.css({ + height: '', + top: '', + left: '', + width: '', + 'max-width': '', + position: '', + 'z-index': '' + }); + + // Remove class + origin.removeClass('active'); + doneAnimating = true; + $(this).remove(); + + // Remove overflow overrides on ancestors + if (ancestorsChanged) { + ancestorsChanged.css('overflow', ''); + } + } + }); + + } + }); +}; + +$(document).ready(function(){ + $('.materialboxed').materialbox(); +}); + +}( jQuery )); +;(function ($) { + + $.fn.parallax = function () { + var window_width = $(window).width(); + // Parallax Scripts + return this.each(function(i) { + var $this = $(this); + $this.addClass('parallax'); + + function updateParallax(initial) { + var container_height; + if (window_width < 601) { + container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height(); + } + else { + container_height = ($this.height() > 0) ? $this.height() : 500; + } + var $img = $this.children("img").first(); + var img_height = $img.height(); + var parallax_dist = img_height - container_height; + var bottom = $this.offset().top + container_height; + var top = $this.offset().top; + var scrollTop = $(window).scrollTop(); + var windowHeight = window.innerHeight; + var windowBottom = scrollTop + windowHeight; + var percentScrolled = (windowBottom - top) / (container_height + windowHeight); + var parallax = Math.round((parallax_dist * percentScrolled)); + + if (initial) { + $img.css('display', 'block'); + } + if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) { + $img.css('transform', "translate3D(-50%," + parallax + "px, 0)"); + } + + } + + // Wait for image load + $this.children("img").one("load", function() { + updateParallax(true); + }).each(function() { + if (this.complete) $(this).trigger("load"); + }); + + $(window).scroll(function() { + window_width = $(window).width(); + updateParallax(false); + }); + + $(window).resize(function() { + window_width = $(window).width(); + updateParallax(false); + }); + + }); + + }; +}( jQuery )); +;(function ($) { + + var methods = { + init : function(options) { + var defaults = { + onShow: null + }; + options = $.extend(defaults, options); + + return this.each(function() { + + // For each set of tabs, we want to keep track of + // which tab is active and its associated content + var $this = $(this), + window_width = $(window).width(); + + var $active, $content, $links = $this.find('li.tab a'), + $tabs_width = $this.width(), + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length, + $index = 0; + + // Finds right attribute for indicator based on active tab. + // el: jQuery Object + var calcRightPos = function(el) { + return $tabs_width - el.position().left - el.outerWidth() - $this.scrollLeft(); + }; + + // Finds left attribute for indicator based on active tab. + // el: jQuery Object + var calcLeftPos = function(el) { + return el.position().left + $this.scrollLeft(); + }; + + // If the location.hash matches one of the links, use that as the active tab. + $active = $($links.filter('[href="'+location.hash+'"]')); + + // If no match is found, use the first link or any with class 'active' as the initial active tab. + if ($active.length === 0) { + $active = $(this).find('li.tab a.active').first(); + } + if ($active.length === 0) { + $active = $(this).find('li.tab a').first(); + } + + $active.addClass('active'); + $index = $links.index($active); + if ($index < 0) { + $index = 0; + } + + if ($active[0] !== undefined) { + $content = $($active[0].hash); + } + + // append indicator then set indicator width to tab width + $this.append('
'); + var $indicator = $this.find('.indicator'); + if ($this.is(":visible")) { + // $indicator.css({"right": $tabs_width - (($index + 1) * $tab_width)}); + // $indicator.css({"left": $index * $tab_width}); + setTimeout(function() { + $indicator.css({"right": calcRightPos($active) }); + $indicator.css({"left": calcLeftPos($active) }); + }, 0); + } + $(window).resize(function () { + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + if ($index < 0) { + $index = 0; + } + if ($tab_width !== 0 && $tabs_width !== 0) { + $indicator.css({"right": calcRightPos($active) }); + $indicator.css({"left": calcLeftPos($active) }); + } + }); + + // Hide the remaining content + $links.not($active).each(function () { + $(Materialize.escapeHash(this.hash)).hide(); + }); + + + // Bind the click event handler + $this.on('click', 'a', function(e) { + if ($(this).parent().hasClass('disabled')) { + e.preventDefault(); + return; + } + + // Act as regular link if target attribute is specified. + if (!!$(this).attr("target")) { + return; + } + + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + + // Make the old tab inactive. + $active.removeClass('active'); + if ($content !== undefined) { + $content.hide(); + } + + // Update the variables with the new link and content + $active = $(this); + $content = $(Materialize.escapeHash(this.hash)); + $links = $this.find('li.tab a'); + var activeRect = $active.position(); + + // Make the tab active. + $active.addClass('active'); + var $prev_index = $index; + $index = $links.index($(this)); + if ($index < 0) { + $index = 0; + } + // Change url to current tab + // window.location.hash = $active.attr('href'); + + if ($content !== undefined) { + $content.show(); + if (typeof(options.onShow) === "function") { + options.onShow.call(this, $content); + } + } + + // Update indicator + + if (($index - $prev_index) >= 0) { + $indicator.velocity({"right": calcRightPos($active) }, { duration: 300, queue: false, easing: 'easeOutQuad'}); + $indicator.velocity({"left": calcLeftPos($active) }, {duration: 300, queue: false, easing: 'easeOutQuad', delay: 90}); + + } else { + $indicator.velocity({"left": calcLeftPos($active) }, { duration: 300, queue: false, easing: 'easeOutQuad'}); + $indicator.velocity({"right": calcRightPos($active) }, {duration: 300, queue: false, easing: 'easeOutQuad', delay: 90}); + } + + // Prevent the anchor's default click action + e.preventDefault(); + }); + }); + + }, + select_tab : function( id ) { + this.find('a[href="#' + id + '"]').trigger('click'); + } + }; + + $.fn.tabs = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tabs' ); + } + }; + + $(document).ready(function(){ + $('ul.tabs').tabs(); + }); +}( jQuery )); +;(function ($) { + $.fn.tooltip = function (options) { + var timeout = null, + margin = 5; + + // Defaults + var defaults = { + delay: 350, + tooltip: '', + position: 'bottom', + html: false + }; + + // Remove tooltip from the activator + if (options === "remove") { + this.each(function() { + $('#' + $(this).attr('data-tooltip-id')).remove(); + $(this).off('mouseenter.tooltip mouseleave.tooltip'); + }); + return false; + } + + options = $.extend(defaults, options); + + return this.each(function() { + var tooltipId = Materialize.guid(); + var origin = $(this); + + // Destroy old tooltip + if (origin.attr('data-tooltip-id')) { + $('#' + origin.attr('data-tooltip-id')).remove(); + } + + origin.attr('data-tooltip-id', tooltipId); + + // Get attributes. + var allowHtml, + tooltipDelay, + tooltipPosition, + tooltipText, + tooltipEl, + backdrop; + var setAttributes = function() { + allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html; + tooltipDelay = origin.attr('data-delay'); + tooltipDelay = (tooltipDelay === undefined || tooltipDelay === '') ? + options.delay : tooltipDelay; + tooltipPosition = origin.attr('data-position'); + tooltipPosition = (tooltipPosition === undefined || tooltipPosition === '') ? + options.position : tooltipPosition; + tooltipText = origin.attr('data-tooltip'); + tooltipText = (tooltipText === undefined || tooltipText === '') ? + options.tooltip : tooltipText; + }; + setAttributes(); + + var renderTooltipEl = function() { + var tooltip = $('
'); + + // Create Text span + if (allowHtml) { + tooltipText = $('').html(tooltipText); + } else{ + tooltipText = $('').text(tooltipText); + } + + // Create tooltip + tooltip.append(tooltipText) + .appendTo($('body')) + .attr('id', tooltipId); + + // Create backdrop + backdrop = $('
'); + backdrop.appendTo(tooltip); + return tooltip; + }; + tooltipEl = renderTooltipEl(); + + // Destroy previously binded events + origin.off('mouseenter.tooltip mouseleave.tooltip'); + // Mouse In + var started = false, timeoutRef; + origin.on({'mouseenter.tooltip': function(e) { + var showTooltip = function() { + setAttributes(); + started = true; + tooltipEl.velocity('stop'); + backdrop.velocity('stop'); + tooltipEl.css({ display: 'block', left: '0px', top: '0px' }); + + // Tooltip positioning + var originWidth = origin.outerWidth(); + var originHeight = origin.outerHeight(); + + var tooltipHeight = tooltipEl.outerHeight(); + var tooltipWidth = tooltipEl.outerWidth(); + var tooltipVerticalMovement = '0px'; + var tooltipHorizontalMovement = '0px'; + var scaleXFactor = 8; + var scaleYFactor = 8; + var targetTop, targetLeft, newCoordinates; + + if (tooltipPosition === "top") { + // Top Position + targetTop = origin.offset().top - tooltipHeight - margin; + targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipVerticalMovement = '-10px'; + backdrop.css({ + bottom: 0, + left: 0, + borderRadius: '14px 14px 0 0', + transformOrigin: '50% 100%', + marginTop: tooltipHeight, + marginLeft: (tooltipWidth/2) - (backdrop.width()/2) + }); + } + // Left Position + else if (tooltipPosition === "left") { + targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2; + targetLeft = origin.offset().left - tooltipWidth - margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '-10px'; + backdrop.css({ + top: '-7px', + right: 0, + width: '14px', + height: '14px', + borderRadius: '14px 0 0 14px', + transformOrigin: '95% 50%', + marginTop: tooltipHeight/2, + marginLeft: tooltipWidth + }); + } + // Right Position + else if (tooltipPosition === "right") { + targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2; + targetLeft = origin.offset().left + originWidth + margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '+10px'; + backdrop.css({ + top: '-7px', + left: 0, + width: '14px', + height: '14px', + borderRadius: '0 14px 14px 0', + transformOrigin: '5% 50%', + marginTop: tooltipHeight/2, + marginLeft: '0px' + }); + } + else { + // Bottom Position + targetTop = origin.offset().top + origin.outerHeight() + margin; + targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '+10px'; + backdrop.css({ + top: 0, + left: 0, + marginLeft: (tooltipWidth/2) - (backdrop.width()/2) + }); + } + + // Set tooptip css placement + tooltipEl.css({ + top: newCoordinates.y, + left: newCoordinates.x + }); + + // Calculate Scale to fill + scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdrop.css('width')); + scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdrop.css('height')); + + tooltipEl.velocity({ marginTop: tooltipVerticalMovement, marginLeft: tooltipHorizontalMovement}, { duration: 350, queue: false }) + .velocity({opacity: 1}, {duration: 300, delay: 50, queue: false}); + backdrop.css({ display: 'block' }) + .velocity({opacity:1},{duration: 55, delay: 0, queue: false}) + .velocity({scaleX: scaleXFactor, scaleY: scaleYFactor}, {duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad'}); + }; + + timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval + + // Mouse Out + }, + 'mouseleave.tooltip': function(){ + // Reset State + started = false; + clearTimeout(timeoutRef); + + // Animate back + setTimeout(function() { + if (started !== true) { + tooltipEl.velocity({ + opacity: 0, marginTop: 0, marginLeft: 0}, { duration: 225, queue: false}); + backdrop.velocity({opacity: 0, scaleX: 1, scaleY: 1}, { + duration:225, + queue: false, + complete: function(){ + backdrop.css('display', 'none'); + tooltipEl.css('display', 'none'); + started = false;} + }); + } + },225); + } + }); + }); + }; + + var repositionWithinScreen = function(x, y, width, height) { + var newX = x; + var newY = y; + + if (newX < 0) { + newX = 4; + } else if (newX + width > window.innerWidth) { + newX -= newX + width - window.innerWidth; + } + + if (newY < 0) { + newY = 4; + } else if (newY + height > window.innerHeight + $(window).scrollTop) { + newY -= newY + height - window.innerHeight; + } + + return {x: newX, y: newY}; + }; + + $(document).ready(function(){ + $('.tooltipped').tooltip(); + }); +}( jQuery )); +;/*! + * Waves v0.6.4 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */ + +;(function(window) { + 'use strict'; + + var Waves = Waves || {}; + var $$ = document.querySelectorAll.bind(document); + + // Find exact position of element + function isWindow(obj) { + return obj !== null && obj === obj.window; + } + + function getWindow(elem) { + return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView; + } + + function offset(elem) { + var docElem, win, + box = {top: 0, left: 0}, + doc = elem && elem.ownerDocument; + + docElem = doc.documentElement; + + if (typeof elem.getBoundingClientRect !== typeof undefined) { + box = elem.getBoundingClientRect(); + } + win = getWindow(doc); + return { + top: box.top + win.pageYOffset - docElem.clientTop, + left: box.left + win.pageXOffset - docElem.clientLeft + }; + } + + function convertStyle(obj) { + var style = ''; + + for (var a in obj) { + if (obj.hasOwnProperty(a)) { + style += (a + ':' + obj[a] + ';'); + } + } + + return style; + } + + var Effect = { + + // Effect delay + duration: 750, + + show: function(e, element) { + + // Disable right click + if (e.button === 2) { + return false; + } + + var el = element || this; + + // Create ripple + var ripple = document.createElement('div'); + ripple.className = 'waves-ripple'; + el.appendChild(ripple); + + // Get click coordinate and element witdh + var pos = offset(el); + var relativeY = (e.pageY - pos.top); + var relativeX = (e.pageX - pos.left); + var scale = 'scale('+((el.clientWidth / 100) * 10)+')'; + + // Support for touch devices + if ('touches' in e) { + relativeY = (e.touches[0].pageY - pos.top); + relativeX = (e.touches[0].pageX - pos.left); + } + + // Attach data to element + ripple.setAttribute('data-hold', Date.now()); + ripple.setAttribute('data-scale', scale); + ripple.setAttribute('data-x', relativeX); + ripple.setAttribute('data-y', relativeY); + + // Set ripple position + var rippleStyle = { + 'top': relativeY+'px', + 'left': relativeX+'px' + }; + + ripple.className = ripple.className + ' waves-notransition'; + ripple.setAttribute('style', convertStyle(rippleStyle)); + ripple.className = ripple.className.replace('waves-notransition', ''); + + // Scale the ripple + rippleStyle['-webkit-transform'] = scale; + rippleStyle['-moz-transform'] = scale; + rippleStyle['-ms-transform'] = scale; + rippleStyle['-o-transform'] = scale; + rippleStyle.transform = scale; + rippleStyle.opacity = '1'; + + rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-o-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['transition-duration'] = Effect.duration + 'ms'; + + rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + + ripple.setAttribute('style', convertStyle(rippleStyle)); + }, + + hide: function(e) { + TouchHandler.touchup(e); + + var el = this; + var width = el.clientWidth * 1.4; + + // Get first ripple + var ripple = null; + var ripples = el.getElementsByClassName('waves-ripple'); + if (ripples.length > 0) { + ripple = ripples[ripples.length - 1]; + } else { + return false; + } + + var relativeX = ripple.getAttribute('data-x'); + var relativeY = ripple.getAttribute('data-y'); + var scale = ripple.getAttribute('data-scale'); + + // Get delay beetween mousedown and mouse leave + var diff = Date.now() - Number(ripple.getAttribute('data-hold')); + var delay = 350 - diff; + + if (delay < 0) { + delay = 0; + } + + // Fade out ripple after delay + setTimeout(function() { + var style = { + 'top': relativeY+'px', + 'left': relativeX+'px', + 'opacity': '0', + + // Duration + '-webkit-transition-duration': Effect.duration + 'ms', + '-moz-transition-duration': Effect.duration + 'ms', + '-o-transition-duration': Effect.duration + 'ms', + 'transition-duration': Effect.duration + 'ms', + '-webkit-transform': scale, + '-moz-transform': scale, + '-ms-transform': scale, + '-o-transform': scale, + 'transform': scale, + }; + + ripple.setAttribute('style', convertStyle(style)); + + setTimeout(function() { + try { + el.removeChild(ripple); + } catch(e) { + return false; + } + }, Effect.duration); + }, delay); + }, + + // Little hack to make can perform waves effect + wrapInput: function(elements) { + for (var a = 0; a < elements.length; a++) { + var el = elements[a]; + + if (el.tagName.toLowerCase() === 'input') { + var parent = el.parentNode; + + // If input already have parent just pass through + if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) { + continue; + } + + // Put element class and style to the specified parent + var wrapper = document.createElement('i'); + wrapper.className = el.className + ' waves-input-wrapper'; + + var elementStyle = el.getAttribute('style'); + + if (!elementStyle) { + elementStyle = ''; + } + + wrapper.setAttribute('style', elementStyle); + + el.className = 'waves-button-input'; + el.removeAttribute('style'); + + // Put element as child + parent.replaceChild(wrapper, el); + wrapper.appendChild(el); + } + } + } + }; + + + /** + * Disable mousedown event for 500ms during and after touch + */ + var TouchHandler = { + /* uses an integer rather than bool so there's no issues with + * needing to clear timeouts if another touch event occurred + * within the 500ms. Cannot mouseup between touchstart and + * touchend, nor in the 500ms after touchend. */ + touches: 0, + allowEvent: function(e) { + var allow = true; + + if (e.type === 'touchstart') { + TouchHandler.touches += 1; //push + } else if (e.type === 'touchend' || e.type === 'touchcancel') { + setTimeout(function() { + if (TouchHandler.touches > 0) { + TouchHandler.touches -= 1; //pop after 500ms + } + }, 500); + } else if (e.type === 'mousedown' && TouchHandler.touches > 0) { + allow = false; + } + + return allow; + }, + touchup: function(e) { + TouchHandler.allowEvent(e); + } + }; + + + /** + * Delegated click handler for .waves-effect element. + * returns null when .waves-effect element not in "click tree" + */ + function getWavesEffectElement(e) { + if (TouchHandler.allowEvent(e) === false) { + return null; + } + + var element = null; + var target = e.target || e.srcElement; + + while (target.parentElement !== null) { + if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) { + element = target; + break; + } else if (target.classList.contains('waves-effect')) { + element = target; + break; + } + target = target.parentElement; + } + + return element; + } + + /** + * Bubble the click and show effect if .waves-effect elem was found + */ + function showEffect(e) { + var element = getWavesEffectElement(e); + + if (element !== null) { + Effect.show(e, element); + + if ('ontouchstart' in window) { + element.addEventListener('touchend', Effect.hide, false); + element.addEventListener('touchcancel', Effect.hide, false); + } + + element.addEventListener('mouseup', Effect.hide, false); + element.addEventListener('mouseleave', Effect.hide, false); + } + } + + Waves.displayEffect = function(options) { + options = options || {}; + + if ('duration' in options) { + Effect.duration = options.duration; + } + + //Wrap input inside tag + Effect.wrapInput($$('.waves-effect')); + + if ('ontouchstart' in window) { + document.body.addEventListener('touchstart', showEffect, false); + } + + document.body.addEventListener('mousedown', showEffect, false); + }; + + /** + * Attach Waves to an input element (or any element which doesn't + * bubble mouseup/mousedown events). + * Intended to be used with dynamically loaded forms/inputs, or + * where the user doesn't want a delegated click handler. + */ + Waves.attach = function(element) { + //FUTURE: automatically add waves classes and allow users + // to specify them with an options param? Eg. light/classic/button + if (element.tagName.toLowerCase() === 'input') { + Effect.wrapInput([element]); + element = element.parentElement; + } + + if ('ontouchstart' in window) { + element.addEventListener('touchstart', showEffect, false); + } + + element.addEventListener('mousedown', showEffect, false); + }; + + window.Waves = Waves; + + document.addEventListener('DOMContentLoaded', function() { + Waves.displayEffect(); + }, false); + +})(window); +;Materialize.toast = function (message, displayLength, className, completeCallback) { + className = className || ""; + + var container = document.getElementById('toast-container'); + + // Create toast container if it does not exist + if (container === null) { + // create notification container + container = document.createElement('div'); + container.id = 'toast-container'; + document.body.appendChild(container); + } + + // Select and append toast + var newToast = createToast(message); + + // only append toast if message is not undefined + if(message){ + container.appendChild(newToast); + } + + newToast.style.top = '35px'; + newToast.style.opacity = 0; + + // Animate toast in + Vel(newToast, { "top" : "0px", opacity: 1 }, {duration: 300, + easing: 'easeOutCubic', + queue: false}); + + // Allows timer to be pause while being panned + var timeLeft = displayLength; + var counterInterval; + if (timeLeft != null) { + counterInterval = setInterval (function(){ + if (newToast.parentNode === null) + window.clearInterval(counterInterval); + + // If toast is not being dragged, decrease its time remaining + if (!newToast.classList.contains('panning')) { + timeLeft -= 20; + } + + if (timeLeft <= 0) { + // Animate toast out + Vel(newToast, {"opacity": 0, marginTop: '-40px'}, { duration: 375, + easing: 'easeOutExpo', + queue: false, + complete: function(){ + // Call the optional callback + if(typeof(completeCallback) === "function") + completeCallback(); + // Remove toast after it times out + this[0].parentNode.removeChild(this[0]); + } + }); + window.clearInterval(counterInterval); + } + }, 20); + } + + + + function createToast(html) { + + // Create toast + var toast = document.createElement('div'); + toast.classList.add('toast'); + if (className) { + var classes = className.split(' '); + + for (var i = 0, count = classes.length; i < count; i++) { + toast.classList.add(classes[i]); + } + } + // If type of parameter is HTML Element + if ( typeof HTMLElement === "object" ? html instanceof HTMLElement : html && typeof html === "object" && html !== null && html.nodeType === 1 && typeof html.nodeName==="string" +) { + toast.appendChild(html); + } + else if (html instanceof jQuery) { + // Check if it is jQuery object + toast.appendChild(html[0]); + } + else { + // Insert as text; + toast.innerHTML = html; + } + // Bind hammer + var hammerHandler = new Hammer(toast, {prevent_default: false}); + hammerHandler.on('pan', function(e) { + var deltaX = e.deltaX; + var activationDistance = 80; + + // Change toast state + if (!toast.classList.contains('panning')){ + toast.classList.add('panning'); + } + + var opacityPercent = 1-Math.abs(deltaX / activationDistance); + if (opacityPercent < 0) + opacityPercent = 0; + + Vel(toast, {left: deltaX, opacity: opacityPercent }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + + }); + + hammerHandler.on('panend', function(e) { + var deltaX = e.deltaX; + var activationDistance = 80; + + // If toast dragged past activation point + if (Math.abs(deltaX) > activationDistance) { + Vel(toast, {marginTop: '-40px'}, { duration: 375, + easing: 'easeOutExpo', + queue: false, + complete: function(){ + if(typeof(completeCallback) === "function") { + completeCallback(); + } + toast.parentNode.removeChild(toast); + } + }); + + } else { + toast.classList.remove('panning'); + // Put toast back into original position + Vel(toast, { left: 0, opacity: 1 }, { duration: 300, + easing: 'easeOutExpo', + queue: false + }); + + } + }); + + return toast; + } +}; +;(function ($) { + + var methods = { + init : function(options) { + var defaults = { + menuWidth: 300, + edge: 'left', + closeOnClick: false, + draggable: true + }; + options = $.extend(defaults, options); + + $(this).each(function(){ + var $this = $(this); + var menu_id = $("#"+ $this.attr('data-activates')); + + // Set to width + if (options.menuWidth != 300) { + menu_id.css('width', options.menuWidth); + } + + // Add Touch Area + var $dragTarget; + if (options.draggable) { + $dragTarget = $('
').attr('data-sidenav', $this.attr('data-activates')); + $('body').append($dragTarget); + } else { + $dragTarget = $(); + } + + if (options.edge == 'left') { + menu_id.css('transform', 'translateX(-100%)'); + $dragTarget.css({'left': 0}); // Add Touch Area + } + else { + menu_id.addClass('right-aligned') // Change text-alignment to right + .css('transform', 'translateX(100%)'); + $dragTarget.css({'right': 0}); // Add Touch Area + } + + // If fixed sidenav, bring menu out + if (menu_id.hasClass('fixed')) { + if (window.innerWidth > 992) { + menu_id.css('transform', 'translateX(0)'); + } + } + + // Window resize to reset on large screens fixed + if (menu_id.hasClass('fixed')) { + $(window).resize( function() { + if (window.innerWidth > 992) { + // Close menu if window is resized bigger than 992 and user has fixed sidenav + if ($('#sidenav-overlay').length !== 0 && menuOut) { + removeMenu(true); + } + else { + // menu_id.removeAttr('style'); + menu_id.css('transform', 'translateX(0%)'); + // menu_id.css('width', options.menuWidth); + } + } + else if (menuOut === false){ + if (options.edge === 'left') { + menu_id.css('transform', 'translateX(-100%)'); + } else { + menu_id.css('transform', 'translateX(100%)'); + } + + } + + }); + } + + // if closeOnClick, then add close event for all a tags in side sideNav + if (options.closeOnClick === true) { + menu_id.on("click.itemclick", "a:not(.collapsible-header)", function(){ + removeMenu(); + }); + } + + var removeMenu = function(restoreNav) { + panning = false; + menuOut = false; + // Reenable scrolling + $('body').css({ + overflow: '', + width: '' + }); + + $('#sidenav-overlay').velocity({opacity: 0}, {duration: 200, + queue: false, easing: 'easeOutQuad', + complete: function() { + $(this).remove(); + } }); + if (options.edge === 'left') { + // Reset phantom div + $dragTarget.css({width: '', right: '', left: '0'}); + menu_id.velocity( + {'translateX': '-100%'}, + { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function() { + if (restoreNav === true) { + // Restore Fixed sidenav + menu_id.removeAttr('style'); + menu_id.css('width', options.menuWidth); + } + } + + }); + } + else { + // Reset phantom div + $dragTarget.css({width: '', right: '0', left: ''}); + menu_id.velocity( + {'translateX': '100%'}, + { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function() { + if (restoreNav === true) { + // Restore Fixed sidenav + menu_id.removeAttr('style'); + menu_id.css('width', options.menuWidth); + } + } + }); + } + }; + + + + // Touch Event + var panning = false; + var menuOut = false; + + if (options.draggable) { + $dragTarget.on('click', function(){ + if (menuOut) { + removeMenu(); + } + }); + + $dragTarget.hammer({ + prevent_default: false + }).bind('pan', function(e) { + + if (e.gesture.pointerType == "touch") { + + var direction = e.gesture.direction; + var x = e.gesture.center.x; + var y = e.gesture.center.y; + var velocityX = e.gesture.velocityX; + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('#sidenav-overlay'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // If overlay does not exist, create one and if it is clicked, close menu + if ($overlay.length === 0) { + $overlay = $('
'); + $overlay.css('opacity', 0).click( function(){ + removeMenu(); + }); + $('body').append($overlay); + } + + // Keep within boundaries + if (options.edge === 'left') { + if (x > options.menuWidth) { x = options.menuWidth; } + else if (x < 0) { x = 0; } + } + + if (options.edge === 'left') { + // Left Direction + if (x < (options.menuWidth / 2)) { menuOut = false; } + // Right Direction + else if (x >= (options.menuWidth / 2)) { menuOut = true; } + menu_id.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)'); + } + else { + // Left Direction + if (x < (window.innerWidth - options.menuWidth / 2)) { + menuOut = true; + } + // Right Direction + else if (x >= (window.innerWidth - options.menuWidth / 2)) { + menuOut = false; + } + var rightPos = (x - options.menuWidth / 2); + if (rightPos < 0) { + rightPos = 0; + } + + menu_id.css('transform', 'translateX(' + rightPos + 'px)'); + } + + + // Percentage overlay + var overlayPerc; + if (options.edge === 'left') { + overlayPerc = x / options.menuWidth; + $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'}); + } + else { + overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth); + $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'}); + } + } + + }).bind('panend', function(e) { + + if (e.gesture.pointerType == "touch") { + var $overlay = $('
'); + var velocityX = e.gesture.velocityX; + var x = e.gesture.center.x; + var leftPos = x - options.menuWidth; + var rightPos = x - options.menuWidth / 2; + if (leftPos > 0 ) { + leftPos = 0; + } + if (rightPos < 0) { + rightPos = 0; + } + panning = false; + + if (options.edge === 'left') { + // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut + if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) { + // Return menu to open + if (leftPos !== 0) { + menu_id.velocity({'translateX': [0, leftPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + $dragTarget.css({width: '50%', right: 0, left: ''}); + menuOut = true; + } + else if (!menuOut || velocityX > 0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + // Slide menu closed + menu_id.velocity({'translateX': [-1 * options.menuWidth - 10, leftPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'}); + $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + }}); + $dragTarget.css({width: '10px', right: '', left: 0}); + } + } + else { + if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) { + // Return menu to open + if (rightPos !== 0) { + menu_id.velocity({'translateX': [0, rightPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + $dragTarget.css({width: '50%', right: '', left: 0}); + menuOut = true; + } + else if (!menuOut || velocityX < -0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + + // Slide menu closed + menu_id.velocity({'translateX': [options.menuWidth + 10, rightPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'}); + $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + }}); + $dragTarget.css({width: '10px', right: 0, left: ''}); + } + } + + } + }); + } + + $this.click(function() { + if (menuOut === true) { + menuOut = false; + panning = false; + removeMenu(); + } + else { + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('
'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // Push current drag target on top of DOM tree + $('body').append($dragTarget); + + if (options.edge === 'left') { + $dragTarget.css({width: '50%', right: 0, left: ''}); + menu_id.velocity({'translateX': [0, -1 * options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + else { + $dragTarget.css({width: '50%', right: '', left: 0}); + menu_id.velocity({'translateX': [0, options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + $overlay.css('opacity', 0) + .click(function(){ + menuOut = false; + panning = false; + removeMenu(); + $overlay.velocity({opacity: 0}, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function() { + $(this).remove(); + } }); + + }); + $('body').append($overlay); + $overlay.velocity({opacity: 1}, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + menuOut = true; + panning = false; + } + }); + } + + return false; + }); + }); + + + }, + destroy: function () { + var $overlay = $('#sidenav-overlay'); + var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]'); + $overlay.trigger('click'); + $dragTarget.remove(); + $(this).off('click'); + $overlay.remove(); + }, + show : function() { + this.trigger('click'); + }, + hide : function() { + $('#sidenav-overlay').trigger('click'); + } + }; + + + $.fn.sideNav = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.sideNav' ); + } + }; // Plugin end +}( jQuery )); +;/** + * Extend jquery with a scrollspy plugin. + * This watches the window scroll and fires events when elements are scrolled into viewport. + * + * throttle() and getTime() taken from Underscore.js + * https://github.com/jashkenas/underscore + * + * @author Copyright 2013 John Smart + * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE + * @see https://github.com/thesmart + * @version 0.1.2 + */ +(function($) { + + var jWindow = $(window); + var elements = []; + var elementsInView = []; + var isSpying = false; + var ticks = 0; + var unique_id = 1; + var offset = { + top : 0, + right : 0, + bottom : 0, + left : 0, + } + + /** + * Find elements that are within the boundary + * @param {number} top + * @param {number} right + * @param {number} bottom + * @param {number} left + * @return {jQuery} A collection of elements + */ + function findElements(top, right, bottom, left) { + var hits = $(); + $.each(elements, function(i, element) { + if (element.height() > 0) { + var elTop = element.offset().top, + elLeft = element.offset().left, + elRight = elLeft + element.width(), + elBottom = elTop + element.height(); + + var isIntersect = !(elLeft > right || + elRight < left || + elTop > bottom || + elBottom < top); + + if (isIntersect) { + hits.push(element); + } + } + }); + + return hits; + } + + + /** + * Called when the user scrolls the window + */ + function onScroll(scrollOffset) { + // unique tick id + ++ticks; + + // viewport rectangle + var top = jWindow.scrollTop(), + left = jWindow.scrollLeft(), + right = left + jWindow.width(), + bottom = top + jWindow.height(); + + // determine which elements are in view + var intersections = findElements(top+offset.top + scrollOffset || 200, right+offset.right, bottom+offset.bottom, left+offset.left); + $.each(intersections, function(i, element) { + + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick != 'number') { + // entered into view + element.triggerHandler('scrollSpy:enter'); + } + + // update tick id + element.data('scrollSpy:ticks', ticks); + }); + + // determine which elements are no longer in view + $.each(elementsInView, function(i, element) { + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick == 'number' && lastTick !== ticks) { + // exited from view + element.triggerHandler('scrollSpy:exit'); + element.data('scrollSpy:ticks', null); + } + }); + + // remember elements in view for next tick + elementsInView = intersections; + } + + /** + * Called when window is resized + */ + function onWinSize() { + jWindow.trigger('scrollSpy:winSize'); + } + + /** + * Get time in ms + * @license https://raw.github.com/jashkenas/underscore/master/LICENSE + * @type {function} + * @return {number} + */ + var getTime = (Date.now || function () { + return new Date().getTime(); + }); + + /** + * Returns a function, that, when invoked, will only be triggered at most once + * during a given window of time. Normally, the throttled function will run + * as much as it can, without ever going more than once per `wait` duration; + * but if you'd like to disable the execution on the leading edge, pass + * `{leading: false}`. To disable execution on the trailing edge, ditto. + * @license https://raw.github.com/jashkenas/underscore/master/LICENSE + * @param {function} func + * @param {number} wait + * @param {Object=} options + * @returns {Function} + */ + function throttle(func, wait, options) { + var context, args, result; + var timeout = null; + var previous = 0; + options || (options = {}); + var later = function () { + previous = options.leading === false ? 0 : getTime(); + timeout = null; + result = func.apply(context, args); + context = args = null; + }; + return function () { + var now = getTime(); + if (!previous && options.leading === false) previous = now; + var remaining = wait - (now - previous); + context = this; + args = arguments; + if (remaining <= 0) { + clearTimeout(timeout); + timeout = null; + previous = now; + result = func.apply(context, args); + context = args = null; + } else if (!timeout && options.trailing !== false) { + timeout = setTimeout(later, remaining); + } + return result; + }; + }; + + /** + * Enables ScrollSpy using a selector + * @param {jQuery|string} selector The elements collection, or a selector + * @param {Object=} options Optional. + throttle : number -> scrollspy throttling. Default: 100 ms + offsetTop : number -> offset from top. Default: 0 + offsetRight : number -> offset from right. Default: 0 + offsetBottom : number -> offset from bottom. Default: 0 + offsetLeft : number -> offset from left. Default: 0 + * @returns {jQuery} + */ + $.scrollSpy = function(selector, options) { + var defaults = { + throttle: 100, + scrollOffset: 200 // offset - 200 allows elements near bottom of page to scroll + }; + options = $.extend(defaults, options); + + var visible = []; + selector = $(selector); + selector.each(function(i, element) { + elements.push($(element)); + $(element).data("scrollSpy:id", i); + // Smooth scroll to section + $('a[href="#' + $(element).attr('id') + '"]').click(function(e) { + e.preventDefault(); + var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1; + $('html, body').animate({ scrollTop: offset - options.scrollOffset }, {duration: 400, queue: false, easing: 'easeOutCubic'}); + }); + }); + + offset.top = options.offsetTop || 0; + offset.right = options.offsetRight || 0; + offset.bottom = options.offsetBottom || 0; + offset.left = options.offsetLeft || 0; + + var throttledScroll = throttle(function() { + onScroll(options.scrollOffset); + }, options.throttle || 100); + var readyScroll = function(){ + $(document).ready(throttledScroll); + }; + + if (!isSpying) { + jWindow.on('scroll', readyScroll); + jWindow.on('resize', readyScroll); + isSpying = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(readyScroll, 0); + + + selector.on('scrollSpy:enter', function() { + visible = $.grep(visible, function(value) { + return value.height() != 0; + }); + + var $this = $(this); + + if (visible[0]) { + $('a[href="#' + visible[0].attr('id') + '"]').removeClass('active'); + if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) { + visible.unshift($(this)); + } + else { + visible.push($(this)); + } + } + else { + visible.push($(this)); + } + + + $('a[href="#' + visible[0].attr('id') + '"]').addClass('active'); + }); + selector.on('scrollSpy:exit', function() { + visible = $.grep(visible, function(value) { + return value.height() != 0; + }); + + if (visible[0]) { + $('a[href="#' + visible[0].attr('id') + '"]').removeClass('active'); + var $this = $(this); + visible = $.grep(visible, function(value) { + return value.attr('id') != $this.attr('id'); + }); + if (visible[0]) { // Check if empty + $('a[href="#' + visible[0].attr('id') + '"]').addClass('active'); + } + } + }); + + return selector; + }; + + /** + * Listen for window resize events + * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms + * @returns {jQuery} $(window) + */ + $.winSizeSpy = function(options) { + $.winSizeSpy = function() { return jWindow; }; // lock from multiple calls + options = options || { + throttle: 100 + }; + return jWindow.on('resize', throttle(onWinSize, options.throttle || 100)); + }; + + /** + * Enables ScrollSpy on a collection of elements + * e.g. $('.scrollSpy').scrollSpy() + * @param {Object=} options Optional. + throttle : number -> scrollspy throttling. Default: 100 ms + offsetTop : number -> offset from top. Default: 0 + offsetRight : number -> offset from right. Default: 0 + offsetBottom : number -> offset from bottom. Default: 0 + offsetLeft : number -> offset from left. Default: 0 + * @returns {jQuery} + */ + $.fn.scrollSpy = function(options) { + return $.scrollSpy($(this), options); + }; + +})(jQuery); +;(function ($) { + $(document).ready(function() { + + // Function to update labels of text fields + Materialize.updateTextFields = function() { + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + $(input_selector).each(function(index, element) { + if ($(element).val().length > 0 || element.autofocus ||$(this).attr('placeholder') !== undefined || $(element)[0].validity.badInput === true) { + $(this).siblings('label').addClass('active'); + } + else { + $(this).siblings('label').removeClass('active'); + } + }); + }; + + // Text based inputs + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + + // Add active if form auto complete + $(document).on('change', input_selector, function () { + if($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) { + $(this).siblings('label').addClass('active'); + } + validate_field($(this)); + }); + + // Add active if input element has been pre-populated on document ready + $(document).ready(function() { + Materialize.updateTextFields(); + }); + + // HTML DOM FORM RESET handling + $(document).on('reset', function(e) { + var formReset = $(e.target); + if (formReset.is('form')) { + formReset.find(input_selector).removeClass('valid').removeClass('invalid'); + formReset.find(input_selector).each(function () { + if ($(this).attr('value') === '') { + $(this).siblings('label').removeClass('active'); + } + }); + + // Reset select + formReset.find('select.initialized').each(function () { + var reset_text = formReset.find('option[selected]').text(); + formReset.siblings('input.select-dropdown').val(reset_text); + }); + } + }); + + // Add active when element has focus + $(document).on('focus', input_selector, function () { + $(this).siblings('label, .prefix').addClass('active'); + }); + + $(document).on('blur', input_selector, function () { + var $inputElement = $(this); + var selector = ".prefix"; + + if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) { + selector += ", label"; + } + + $inputElement.siblings(selector).removeClass('active'); + + validate_field($inputElement); + }); + + window.validate_field = function(object) { + var hasLength = object.attr('length') !== undefined; + var lenAttr = parseInt(object.attr('length')); + var len = object.val().length; + + if (object.val().length === 0 && object[0].validity.badInput === false) { + if (object.hasClass('validate')) { + object.removeClass('valid'); + object.removeClass('invalid'); + } + } + else { + if (object.hasClass('validate')) { + // Check for character counter attributes + if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) { + object.removeClass('invalid'); + object.addClass('valid'); + } + else { + object.removeClass('valid'); + object.addClass('invalid'); + } + } + } + }; + + // Radio and Checkbox focus class + var radio_checkbox = 'input[type=radio], input[type=checkbox]'; + $(document).on('keyup.radio', radio_checkbox, function(e) { + // TAB, check if tabbing to radio or checkbox. + if (e.which === 9) { + $(this).addClass('tabbed'); + var $this = $(this); + $this.one('blur', function(e) { + + $(this).removeClass('tabbed'); + }); + return; + } + }); + + // Textarea Auto Resize + var hiddenDiv = $('.hiddendiv').first(); + if (!hiddenDiv.length) { + hiddenDiv = $('
'); + $('body').append(hiddenDiv); + } + var text_area_selector = '.materialize-textarea'; + + function textareaAutoResize($textarea) { + // Set font properties of hiddenDiv + + var fontFamily = $textarea.css('font-family'); + var fontSize = $textarea.css('font-size'); + var lineHeight = $textarea.css('line-height'); + + if (fontSize) { hiddenDiv.css('font-size', fontSize); } + if (fontFamily) { hiddenDiv.css('font-family', fontFamily); } + if (lineHeight) { hiddenDiv.css('line-height', lineHeight); } + + if ($textarea.attr('wrap') === "off") { + hiddenDiv.css('overflow-wrap', "normal") + .css('white-space', "pre"); + } + + hiddenDiv.text($textarea.val() + '\n'); + var content = hiddenDiv.html().replace(/\n/g, '
'); + hiddenDiv.html(content); + + + // When textarea is hidden, width goes crazy. + // Approximate with half of window size + + if ($textarea.is(':visible')) { + hiddenDiv.css('width', $textarea.width()); + } + else { + hiddenDiv.css('width', $(window).width()/2); + } + + $textarea.css('height', hiddenDiv.height()); + } + + $(text_area_selector).each(function () { + var $textarea = $(this); + if ($textarea.val().length) { + textareaAutoResize($textarea); + } + }); + + $('body').on('keyup keydown autoresize', text_area_selector, function () { + textareaAutoResize($(this)); + }); + + // File Input Path + $(document).on('change', '.file-field input[type="file"]', function () { + var file_field = $(this).closest('.file-field'); + var path_input = file_field.find('input.file-path'); + var files = $(this)[0].files; + var file_names = []; + for (var i = 0; i < files.length; i++) { + file_names.push(files[i].name); + } + path_input.val(file_names.join(", ")); + path_input.trigger('change'); + }); + + /**************** + * Range Input * + ****************/ + + var range_type = 'input[type=range]'; + var range_mousedown = false; + var left; + + $(range_type).each(function () { + var thumb = $(''); + $(this).after(thumb); + }); + + var range_wrapper = '.range-field'; + $(document).on('change', range_type, function(e) { + var thumb = $(this).siblings('.thumb'); + thumb.find('.value').html($(this).val()); + }); + + $(document).on('input mousedown touchstart', range_type, function(e) { + var thumb = $(this).siblings('.thumb'); + var width = $(this).outerWidth(); + + // If thumb indicator does not exist yet, create it + if (thumb.length <= 0) { + thumb = $(''); + $(this).after(thumb); + } + + // Set indicator value + thumb.find('.value').html($(this).val()); + + range_mousedown = true; + $(this).addClass('active'); + + if (!thumb.hasClass('active')) { + thumb.velocity({ height: "30px", width: "30px", top: "-20px", marginLeft: "-15px"}, { duration: 300, easing: 'easeOutExpo' }); + } + + if (e.type !== 'input') { + if(e.pageX === undefined || e.pageX === null){//mobile + left = e.originalEvent.touches[0].pageX - $(this).offset().left; + } + else{ // desktop + left = e.pageX - $(this).offset().left; + } + if (left < 0) { + left = 0; + } + else if (left > width) { + left = width; + } + thumb.addClass('active').css('left', left); + } + + thumb.find('.value').html($(this).val()); + }); + + $(document).on('mouseup touchend', range_wrapper, function() { + range_mousedown = false; + $(this).removeClass('active'); + }); + + $(document).on('mousemove touchmove', range_wrapper, function(e) { + var thumb = $(this).children('.thumb'); + var left; + if (range_mousedown) { + if (!thumb.hasClass('active')) { + thumb.velocity({ height: '30px', width: '30px', top: '-20px', marginLeft: '-15px'}, { duration: 300, easing: 'easeOutExpo' }); + } + if (e.pageX === undefined || e.pageX === null) { //mobile + left = e.originalEvent.touches[0].pageX - $(this).offset().left; + } + else{ // desktop + left = e.pageX - $(this).offset().left; + } + var width = $(this).outerWidth(); + + if (left < 0) { + left = 0; + } + else if (left > width) { + left = width; + } + thumb.addClass('active').css('left', left); + thumb.find('.value').html(thumb.siblings(range_type).val()); + } + }); + + $(document).on('mouseout touchleave', range_wrapper, function() { + if (!range_mousedown) { + + var thumb = $(this).children('.thumb'); + + if (thumb.hasClass('active')) { + thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: '-6px'}, { duration: 100 }); + } + thumb.removeClass('active'); + } + }); + + /************************** + * Auto complete plugin * + *************************/ + $.fn.autocomplete = function (options) { + // Defaults + var defaults = { + data: {} + }; + + options = $.extend(defaults, options); + + return this.each(function() { + var $input = $(this); + var data = options.data, + $inputDiv = $input.closest('.input-field'); // Div to append on + + // Check if data isn't empty + if (!$.isEmptyObject(data)) { + // Create autocomplete element + var $autocomplete = $(''); + + // Append autocomplete element + if ($inputDiv.length) { + $inputDiv.append($autocomplete); // Set ul in body + } else { + $input.after($autocomplete); + } + + var highlight = function(string, $el) { + var img = $el.find('img'); + var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""), + matchEnd = matchStart + string.length - 1, + beforeMatch = $el.text().slice(0, matchStart), + matchText = $el.text().slice(matchStart, matchEnd + 1), + afterMatch = $el.text().slice(matchEnd + 1); + $el.html("" + beforeMatch + "" + matchText + "" + afterMatch + ""); + if (img.length) { + $el.prepend(img); + } + }; + + // Perform search + $input.on('keyup', function (e) { + // Capture Enter + if (e.which === 13) { + $autocomplete.find('li').first().click(); + return; + } + + var val = $input.val().toLowerCase(); + $autocomplete.empty(); + + // Check if the input isn't empty + if (val !== '') { + for(var key in data) { + if (data.hasOwnProperty(key) && + key.toLowerCase().indexOf(val) !== -1 && + key.toLowerCase() !== val) { + var autocompleteOption = $('
  • '); + if(!!data[key]) { + autocompleteOption.append(''+ key +''); + } else { + autocompleteOption.append(''+ key +''); + } + $autocomplete.append(autocompleteOption); + + highlight(val, autocompleteOption); + } + } + } + }); + + // Set input value + $autocomplete.on('click', 'li', function () { + $input.val($(this).text().trim()); + $input.trigger('change'); + $autocomplete.empty(); + }); + } + }); + }; + + }); // End of $(document).ready + + /******************* + * Select Plugin * + ******************/ + $.fn.material_select = function (callback) { + $(this).each(function(){ + var $select = $(this); + + if ($select.hasClass('browser-default')) { + return; // Continue to next (return false breaks out of entire loop) + } + + var multiple = $select.attr('multiple') ? true : false, + lastID = $select.data('select-id'); // Tear down structure if Select needs to be rebuilt + + if (lastID) { + $select.parent().find('span.caret').remove(); + $select.parent().find('input').remove(); + + $select.unwrap(); + $('ul#select-options-'+lastID).remove(); + } + + // If destroying the select, remove the selelct-id and reset it to it's uninitialized state. + if(callback === 'destroy') { + $select.data('select-id', null).removeClass('initialized'); + return; + } + + var uniqueID = Materialize.guid(); + $select.data('select-id', uniqueID); + var wrapper = $('
    '); + wrapper.addClass($select.attr('class')); + var options = $(''), + selectChildren = $select.children('option, optgroup'), + valuesSelected = [], + optionsHover = false; + + var label = $select.find('option:selected').html() || $select.find('option:first').html() || ""; + + // Function that renders and appends the option taking into + // account type and possible image icon. + var appendOptionWithIcon = function(select, option, type) { + // Add disabled attr if disabled + var disabledClass = (option.is(':disabled')) ? 'disabled ' : ''; + var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : ''; + + // add icons + var icon_url = option.data('icon'); + var classes = option.attr('class'); + if (!!icon_url) { + var classString = ''; + if (!!classes) classString = ' class="' + classes + '"'; + + // Check for multiple type. + if (type === 'multiple') { + options.append($('
  • ' + option.html() + '
  • ')); + } else { + options.append($('
  • ' + option.html() + '
  • ')); + } + return true; + } + + // Check for multiple type. + if (type === 'multiple') { + options.append($('
  • ' + option.html() + '
  • ')); + } else { + options.append($('
  • ' + option.html() + '
  • ')); + } + }; + + /* Create dropdown structure. */ + if (selectChildren.length) { + selectChildren.each(function() { + if ($(this).is('option')) { + // Direct descendant option. + if (multiple) { + appendOptionWithIcon($select, $(this), 'multiple'); + + } else { + appendOptionWithIcon($select, $(this)); + } + } else if ($(this).is('optgroup')) { + // Optgroup. + var selectOptions = $(this).children('option'); + options.append($('
  • ' + $(this).attr('label') + '
  • ')); + + selectOptions.each(function() { + appendOptionWithIcon($select, $(this), 'optgroup-option'); + }); + } + }); + } + + options.find('li:not(.optgroup)').each(function (i) { + $(this).click(function (e) { + // Check if option element is disabled + if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) { + var selected = true; + + if (multiple) { + $('input[type="checkbox"]', this).prop('checked', function(i, v) { return !v; }); + selected = toggleEntryFromArray(valuesSelected, $(this).index(), $select); + $newSelect.trigger('focus'); + } else { + options.find('li').removeClass('active'); + $(this).toggleClass('active'); + $newSelect.val($(this).text()); + } + + activateOption(options, $(this)); + $select.find('option').eq(i).prop('selected', selected); + // Trigger onchange() event + $select.trigger('change'); + if (typeof callback !== 'undefined') callback(); + } + + e.stopPropagation(); + }); + }); + + // Wrap Elements + $select.wrap(wrapper); + // Add Select Display Element + var dropdownIcon = $(''); + if ($select.is(':disabled')) + dropdownIcon.addClass('disabled'); + + // escape double quotes + var sanitizedLabelHtml = label.replace(/"/g, '"'); + + var $newSelect = $(''); + $select.before($newSelect); + $newSelect.before(dropdownIcon); + + $newSelect.after(options); + // Check if section element is disabled + if (!$select.is(':disabled')) { + $newSelect.dropdown({'hover': false, 'closeOnClick': false}); + } + + // Copy tabindex + if ($select.attr('tabindex')) { + $($newSelect[0]).attr('tabindex', $select.attr('tabindex')); + } + + $select.addClass('initialized'); + + $newSelect.on({ + 'focus': function (){ + if ($('ul.select-dropdown').not(options[0]).is(':visible')) { + $('input.select-dropdown').trigger('close'); + } + if (!options.is(':visible')) { + $(this).trigger('open', ['focus']); + var label = $(this).val(); + var selectedOption = options.find('li').filter(function() { + return $(this).text().toLowerCase() === label.toLowerCase(); + })[0]; + activateOption(options, selectedOption); + } + }, + 'click': function (e){ + e.stopPropagation(); + } + }); + + $newSelect.on('blur', function() { + if (!multiple) { + $(this).trigger('close'); + } + options.find('li.selected').removeClass('selected'); + }); + + options.hover(function() { + optionsHover = true; + }, function () { + optionsHover = false; + }); + + $(window).on({ + 'click': function () { + multiple && (optionsHover || $newSelect.trigger('close')); + } + }); + + // Add initial multiple selections. + if (multiple) { + $select.find("option:selected:not(:disabled)").each(function () { + var index = $(this).index(); + + toggleEntryFromArray(valuesSelected, index, $select); + options.find("li").eq(index).find(":checkbox").prop("checked", true); + }); + } + + // Make option as selected and scroll to selected position + var activateOption = function(collection, newOption) { + if (newOption) { + collection.find('li.selected').removeClass('selected'); + var option = $(newOption); + option.addClass('selected'); + options.scrollTo(option); + } + }; + + // Allow user to search by typing + // this array is cleared after 1 second + var filterQuery = [], + onKeyDown = function(e){ + // TAB - switch to another input + if(e.which == 9){ + $newSelect.trigger('close'); + return; + } + + // ARROW DOWN WHEN SELECT IS CLOSED - open select options + if(e.which == 40 && !options.is(':visible')){ + $newSelect.trigger('open'); + return; + } + + // ENTER WHEN SELECT IS CLOSED - submit form + if(e.which == 13 && !options.is(':visible')){ + return; + } + + e.preventDefault(); + + // CASE WHEN USER TYPE LETTERS + var letter = String.fromCharCode(e.which).toLowerCase(), + nonLetters = [9,13,27,38,40]; + if (letter && (nonLetters.indexOf(e.which) === -1)) { + filterQuery.push(letter); + + var string = filterQuery.join(''), + newOption = options.find('li').filter(function() { + return $(this).text().toLowerCase().indexOf(string) === 0; + })[0]; + + if (newOption) { + activateOption(options, newOption); + } + } + + // ENTER - select option and close when select options are opened + if (e.which == 13) { + var activeOption = options.find('li.selected:not(.disabled)')[0]; + if(activeOption){ + $(activeOption).trigger('click'); + if (!multiple) { + $newSelect.trigger('close'); + } + } + } + + // ARROW DOWN - move to next not disabled option + if (e.which == 40) { + if (options.find('li.selected').length) { + newOption = options.find('li.selected').next('li:not(.disabled)')[0]; + } else { + newOption = options.find('li:not(.disabled)')[0]; + } + activateOption(options, newOption); + } + + // ESC - close options + if (e.which == 27) { + $newSelect.trigger('close'); + } + + // ARROW UP - move to previous not disabled option + if (e.which == 38) { + newOption = options.find('li.selected').prev('li:not(.disabled)')[0]; + if(newOption) + activateOption(options, newOption); + } + + // Automaticaly clean filter query so user can search again by starting letters + setTimeout(function(){ filterQuery = []; }, 1000); + }; + + $newSelect.on('keydown', onKeyDown); + }); + + function toggleEntryFromArray(entriesArray, entryIndex, select) { + var index = entriesArray.indexOf(entryIndex), + notAdded = index === -1; + + if (notAdded) { + entriesArray.push(entryIndex); + } else { + entriesArray.splice(index, 1); + } + + select.siblings('ul.dropdown-content').find('li').eq(entryIndex).toggleClass('active'); + + // use notAdded instead of true (to detect if the option is selected or not) + select.find('option').eq(entryIndex).prop('selected', notAdded); + setValueToInput(entriesArray, select); + + return notAdded; + } + + function setValueToInput(entriesArray, select) { + var value = ''; + + for (var i = 0, count = entriesArray.length; i < count; i++) { + var text = select.find('option').eq(entriesArray[i]).text(); + + i === 0 ? value += text : value += ', ' + text; + } + + if (value === '') { + value = select.find('option:disabled').eq(0).text(); + } + + select.siblings('input.select-dropdown').val(value); + } + }; + +}( jQuery )); +;(function ($) { + + var methods = { + + init : function(options) { + var defaults = { + indicators: true, + height: 400, + transition: 500, + interval: 6000 + }; + options = $.extend(defaults, options); + + return this.each(function() { + + // For each slider, we want to keep track of + // which slide is active and its associated content + var $this = $(this); + var $slider = $this.find('ul.slides').first(); + var $slides = $slider.find('> li'); + var $active_index = $slider.find('.active').index(); + var $active, $indicators, $interval; + if ($active_index != -1) { $active = $slides.eq($active_index); } + + // Transitions the caption depending on alignment + function captionTransition(caption, duration) { + if (caption.hasClass("center-align")) { + caption.velocity({opacity: 0, translateY: -100}, {duration: duration, queue: false}); + } + else if (caption.hasClass("right-align")) { + caption.velocity({opacity: 0, translateX: 100}, {duration: duration, queue: false}); + } + else if (caption.hasClass("left-align")) { + caption.velocity({opacity: 0, translateX: -100}, {duration: duration, queue: false}); + } + } + + // This function will transition the slide to any index of the next slide + function moveToSlide(index) { + // Wrap around indices. + if (index >= $slides.length) index = 0; + else if (index < 0) index = $slides.length -1; + + $active_index = $slider.find('.active').index(); + + // Only do if index changes + if ($active_index != index) { + $active = $slides.eq($active_index); + $caption = $active.find('.caption'); + + $active.removeClass('active'); + $active.velocity({opacity: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad', + complete: function() { + $slides.not('.active').velocity({opacity: 0, translateX: 0, translateY: 0}, {duration: 0, queue: false}); + } }); + captionTransition($caption, options.transition); + + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).removeClass('active'); + } + + $slides.eq(index).velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'}); + $slides.eq(index).find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad'}); + $slides.eq(index).addClass('active'); + + + // Update indicators + if (options.indicators) { + $indicators.eq(index).addClass('active'); + } + } + } + + // Set height of slider + // If fullscreen, do nothing + if (!$this.hasClass('fullscreen')) { + if (options.indicators) { + // Add height if indicators are present + $this.height(options.height + 40); + } + else { + $this.height(options.height); + } + $slider.height(options.height); + } + + + // Set initial positions of captions + $slides.find('.caption').each(function () { + captionTransition($(this), 0); + }); + + // Move img src into background-image + $slides.find('img').each(function () { + var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw=='; + if ($(this).attr('src') !== placeholderBase64) { + $(this).css('background-image', 'url(' + $(this).attr('src') + ')' ); + $(this).attr('src', placeholderBase64); + } + }); + + // dynamically add indicators + if (options.indicators) { + $indicators = $('
      '); + $slides.each(function( index ) { + var $indicator = $('
    • '); + + // Handle clicks on indicators + $indicator.click(function () { + var $parent = $slider.parent(); + var curr_index = $parent.find($(this)).index(); + moveToSlide(curr_index); + + // reset interval + clearInterval($interval); + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + + }, options.transition + options.interval + ); + }); + $indicators.append($indicator); + }); + $this.append($indicators); + $indicators = $this.find('ul.indicators').find('li.indicator-item'); + } + + if ($active) { + $active.show(); + } + else { + $slides.first().addClass('active').velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'}); + + $active_index = 0; + $active = $slides.eq($active_index); + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).addClass('active'); + } + } + + // Adjust height to current slide + $active.find('img').each(function() { + $active.find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad'}); + }); + + // auto scroll + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + + }, options.transition + options.interval + ); + + + // HammerJS, Swipe navigation + + // Touch Event + var panning = false; + var swipeLeft = false; + var swipeRight = false; + + $this.hammer({ + prevent_default: false + }).bind('pan', function(e) { + if (e.gesture.pointerType === "touch") { + + // reset interval + clearInterval($interval); + + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + + $curr_slide = $slider.find('.active'); + $curr_slide.velocity({ translateX: x + }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + + // Swipe Left + if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) { + swipeRight = true; + } + // Swipe Right + else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) { + swipeLeft = true; + } + + // Make Slide Behind active slide visible + var next_slide; + if (swipeLeft) { + next_slide = $curr_slide.next(); + if (next_slide.length === 0) { + next_slide = $slides.first(); + } + next_slide.velocity({ opacity: 1 + }, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + if (swipeRight) { + next_slide = $curr_slide.prev(); + if (next_slide.length === 0) { + next_slide = $slides.last(); + } + next_slide.velocity({ opacity: 1 + }, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + + } + + }).bind('panend', function(e) { + if (e.gesture.pointerType === "touch") { + + $curr_slide = $slider.find('.active'); + panning = false; + curr_index = $slider.find('.active').index(); + + if (!swipeRight && !swipeLeft || $slides.length <=1) { + // Return to original spot + $curr_slide.velocity({ translateX: 0 + }, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + else if (swipeLeft) { + moveToSlide(curr_index + 1); + $curr_slide.velocity({translateX: -1 * $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function() { + $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false}); + } }); + } + else if (swipeRight) { + moveToSlide(curr_index - 1); + $curr_slide.velocity({translateX: $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function() { + $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false}); + } }); + } + swipeLeft = false; + swipeRight = false; + + // Restart interval + clearInterval($interval); + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + + }, options.transition + options.interval + ); + } + }); + + $this.on('sliderPause', function() { + clearInterval($interval); + }); + + $this.on('sliderStart', function() { + clearInterval($interval); + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + + }, options.transition + options.interval + ); + }); + + $this.on('sliderNext', function() { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + }); + + $this.on('sliderPrev', function() { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index - 1); + }); + + }); + + + + }, + pause : function() { + $(this).trigger('sliderPause'); + }, + start : function() { + $(this).trigger('sliderStart'); + }, + next : function() { + $(this).trigger('sliderNext'); + }, + prev : function() { + $(this).trigger('sliderPrev'); + } + }; + + + $.fn.slider = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tooltip' ); + } + }; // Plugin end +}( jQuery )); +;(function ($) { + $(document).ready(function() { + + $(document).on('click.card', '.card', function (e) { + if ($(this).find('> .card-reveal').length) { + if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) { + // Make Reveal animate down and display none + $(this).find('.card-reveal').velocity( + {translateY: 0}, { + duration: 225, + queue: false, + easing: 'easeInOutQuad', + complete: function() { $(this).css({ display: 'none'}); } + } + ); + } + else if ($(e.target).is($('.card .activator')) || + $(e.target).is($('.card .activator i')) ) { + $(e.target).closest('.card').css('overflow', 'hidden'); + $(this).find('.card-reveal').css({ display: 'block'}).velocity("stop", false).velocity({translateY: '-100%'}, {duration: 300, queue: false, easing: 'easeInOutQuad'}); + } + } + }); + + }); +}( jQuery ));;(function ($) { + var chipsHandleEvents = false; + var materialChipsDefaults = { + data: [], + placeholder: '', + secondaryPlaceholder: '', + }; + + $(document).ready(function() { + // Handle removal of static chips. + $(document).on('click', '.chip .close', function(e){ + var $chips = $(this).closest('.chips'); + if ($chips.attr('data-initialized')) { + return; + } + $(this).closest('.chip').remove(); + }); + }); + + $.fn.material_chip = function (options) { + var self = this; + this.$el = $(this); + this.$document = $(document); + this.SELS = { + CHIPS: '.chips', + CHIP: '.chip', + INPUT: 'input', + DELETE: '.material-icons', + SELECTED_CHIP: '.selected', + }; + + if ('data' === options) { + return this.$el.data('chips'); + } + + var curr_options = $.extend({}, materialChipsDefaults, options); + + + // Initialize + this.init = function() { + var i = 0; + var chips; + self.$el.each(function(){ + var $chips = $(this); + var chipId = Materialize.guid(); + + if (!curr_options.data || !(curr_options.data instanceof Array)) { + curr_options.data = []; + } + $chips.data('chips', curr_options.data); + $chips.attr('data-index', i); + $chips.attr('data-initialized', true); + + if (!$chips.hasClass(self.SELS.CHIPS)) { + $chips.addClass('chips'); + } + + self.chips($chips, chipId); + i++; + }); + }; + + this.handleEvents = function(){ + var SELS = self.SELS; + + self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function(e){ + $(e.target).find(SELS.INPUT).focus(); + }); + + self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function(e){ + $(SELS.CHIP).removeClass('selected'); + $(this).toggleClass('selected'); + }); + + self.$document.off('keydown.chips').on('keydown.chips', function(e){ + if ($(e.target).is('input, textarea')) { + return; + } + + // delete + var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP); + var $chips = $chip.closest(SELS.CHIPS); + var length = $chip.siblings(SELS.CHIP).length; + var index; + + if (!$chip.length) { + return; + } + + if (e.which === 8 || e.which === 46) { + e.preventDefault(); + + index = $chip.index(); + self.deleteChip(index, $chips); + + var selectIndex = null; + if ((index + 1) < length) { + selectIndex = index; + } else if (index === length || (index + 1) === length) { + selectIndex = length - 1; + } + + if (selectIndex < 0) selectIndex = null; + + if (null !== selectIndex) { + self.selectChip(selectIndex, $chips); + } + if (!length) $chips.find('input').focus(); + + // left + } else if (e.which === 37) { + index = $chip.index() - 1; + if (index < 0) { + return; + } + $(SELS.CHIP).removeClass('selected'); + self.selectChip(index, $chips); + + // right + } else if (e.which === 39) { + index = $chip.index() + 1; + $(SELS.CHIP).removeClass('selected'); + if (index > length) { + $chips.find('input').focus(); + return; + } + self.selectChip(index, $chips); + } + }); + + self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){ + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.addClass('focus'); + $currChips.siblings('label, .prefix').addClass('active'); + $(SELS.CHIP).removeClass('selected'); + }); + + self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){ + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.removeClass('focus'); + + // Remove active if empty + if (!$currChips.data('chips').length) { + $currChips.siblings('label').removeClass('active'); + } + $currChips.siblings('.prefix').removeClass('active'); + }); + + self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function(e){ + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var chipsLength = $chips.children(SELS.CHIP).length; + + // enter + if (13 === e.which) { + e.preventDefault(); + self.addChip({tag: $target.val()}, $chips); + $target.val(''); + return; + } + + // delete or left + if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) { + self.selectChip(chipsLength - 1, $chips); + $target.blur(); + return; + } + }); + + // Click on delete icon in chip. + self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function(e) { + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var $chip = $target.closest(SELS.CHIP); + e.stopPropagation(); + self.deleteChip($chip.index(), $chips); + $chips.find('input').focus(); + }); + }; + + this.chips = function($chips, chipId) { + var html = ''; + $chips.data('chips').forEach(function(elem){ + html += self.renderChip(elem); + }); + html += ''; + $chips.html(html); + self.setPlaceholder($chips); + + // Set for attribute for label + var label = $chips.next('label'); + if (label.length) { + label.attr('for', chipId); + + if ($chips.data('chips').length) { + label.addClass('active'); + } + } + }; + + this.renderChip = function(elem) { + if (!elem.tag) return; + + var html = '
      ' + elem.tag; + if (elem.image) { + html += ' '; + } + html += 'close'; + html += '
      '; + return html; + }; + + this.setPlaceholder = function($chips) { + if ($chips.data('chips').length && curr_options.placeholder) { + $chips.find('input').prop('placeholder', curr_options.placeholder); + + } else if (!$chips.data('chips').length && curr_options.secondaryPlaceholder) { + $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder); + } + }; + + this.isValid = function($chips, elem) { + var chips = $chips.data('chips'); + var exists = false; + for (var i=0; i < chips.length; i++) { + if (chips[i].tag === elem.tag) { + exists = true; + return; + } + } + return '' !== elem.tag && !exists; + }; + + this.addChip = function(elem, $chips) { + if (!self.isValid($chips, elem)) { + return; + } + var chipHtml = self.renderChip(elem); + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + newData.push(oldData[i]); + } + newData.push(elem); + + $chips.data('chips', newData); + $(chipHtml).insertBefore($chips.find('input')); + $chips.trigger('chip.add', elem); + self.setPlaceholder($chips); + }; + + this.deleteChip = function(chipIndex, $chips) { + var chip = $chips.data('chips')[chipIndex]; + $chips.find('.chip').eq(chipIndex).remove(); + + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + if (i !== chipIndex) { + newData.push(oldData[i]); + } + } + + $chips.data('chips', newData); + $chips.trigger('chip.delete', chip); + self.setPlaceholder($chips); + }; + + this.selectChip = function(chipIndex, $chips) { + var $chip = $chips.find('.chip').eq(chipIndex); + if ($chip && false === $chip.hasClass('selected')) { + $chip.addClass('selected'); + $chips.trigger('chip.select', $chips.data('chips')[chipIndex]); + } + }; + + this.getChipsElement = function(index, $chips) { + return $chips.eq(index); + }; + + // init + this.init(); + + if (!chipsHandleEvents) { + this.handleEvents(); + chipsHandleEvents = true; + } + }; +}( jQuery ));;(function ($) { + $.fn.pushpin = function (options) { + // Defaults + var defaults = { + top: 0, + bottom: Infinity, + offset: 0 + }; + + // Remove pushpin event and classes + if (options === "remove") { + this.each(function () { + if (id = $(this).data('pushpin-id')) { + $(window).off('scroll.' + id); + $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style'); + } + }); + return false; + } + + options = $.extend(defaults, options); + + + $index = 0; + return this.each(function() { + var $uniqueId = Materialize.guid(), + $this = $(this), + $original_offset = $(this).offset().top; + + function removePinClasses(object) { + object.removeClass('pin-top'); + object.removeClass('pinned'); + object.removeClass('pin-bottom'); + } + + function updateElements(objects, scrolled) { + objects.each(function () { + // Add position fixed (because its between top and bottom) + if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) { + removePinClasses($(this)); + $(this).css('top', options.offset); + $(this).addClass('pinned'); + } + + // Add pin-top (when scrolled position is above top) + if (scrolled < options.top && !$(this).hasClass('pin-top')) { + removePinClasses($(this)); + $(this).css('top', 0); + $(this).addClass('pin-top'); + } + + // Add pin-bottom (when scrolled position is below bottom) + if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) { + removePinClasses($(this)); + $(this).addClass('pin-bottom'); + $(this).css('top', options.bottom - $original_offset); + } + }); + } + + $(this).data('pushpin-id', $uniqueId); + updateElements($this, $(window).scrollTop()); + $(window).on('scroll.' + $uniqueId, function () { + var $scrolled = $(window).scrollTop() + options.offset; + updateElements($this, $scrolled); + }); + + }); + + }; +}( jQuery ));;(function ($) { + $(document).ready(function() { + + // jQuery reverse + $.fn.reverse = [].reverse; + + // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs! + $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) { + var $this = $(this); + openFABMenu($this); + }); + $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) { + var $this = $(this); + closeFABMenu($this); + }); + + // Toggle-on-click behaviour. + $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function(e) { + var $this = $(this); + var $menu = $this.parent(); + if ($menu.hasClass('active')) { + closeFABMenu($menu); + } else { + openFABMenu($menu); + } + }); + + // Toolbar transition behaviour. + $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function(e) { + var $this = $(this); + var $menu = $this.parent(); + FABtoToolbar($menu); + }); + + }); + + $.fn.extend({ + openFAB: function() { + openFABMenu($(this)); + }, + closeFAB: function() { + closeFABMenu($(this)); + }, + openToolbar: function() { + FABtoToolbar($(this)); + }, + closeToolbar: function() { + toolbarToFAB($(this)); + } + }); + + + var openFABMenu = function (btn) { + var $this = btn; + if ($this.hasClass('active') === false) { + + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.addClass('active'); + $this.find('ul .btn-floating').velocity( + { scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'}, + { duration: 0 }); + + var time = 0; + $this.find('ul .btn-floating').reverse().each( function () { + $(this).velocity( + { opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0'}, + { duration: 80, delay: time }); + time += 40; + }); + } + }; + + var closeFABMenu = function (btn) { + var $this = btn; + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.removeClass('active'); + var time = 0; + $this.find('ul .btn-floating').velocity("stop", true); + $this.find('ul .btn-floating').velocity( + { opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'}, + { duration: 80 } + ); + }; + + + /** + * Transform FAB into toolbar + * @param {Object} object jQuery object + */ + var FABtoToolbar = function(btn) { + if (btn.attr('data-open') === "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnRect = btn[0].getBoundingClientRect(); + var anchor = btn.find('> a').first(); + var menu = btn.find('> ul').first(); + var backdrop = $('
      '); + var fabColor = anchor.css('background-color'); + anchor.append(backdrop); + + offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2); + offsetY = windowHeight - btnRect.bottom; + scaleFactor = windowWidth / backdrop.width(); + btn.attr('data-origin-bottom', btnRect.bottom); + btn.attr('data-origin-left', btnRect.left); + btn.attr('data-origin-width', btnRect.width); + + // Set initial state + btn.addClass('active'); + btn.attr('data-open', true); + btn.css({ + 'text-align': 'center', + width: '100%', + bottom: 0, + left: 0, + transform: 'translateX(' + offsetX + 'px)', + transition: 'none' + }); + anchor.css({ + transform: 'translateY(' + -offsetY + 'px)', + transition: 'none' + }); + backdrop.css({ + 'background-color': fabColor + }); + + + setTimeout(function() { + btn.css({ + transform: '', + transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s' + }); + anchor.css({ + overflow: 'visible', + transform: '', + transition: 'transform .2s' + }); + + setTimeout(function() { + btn.css({ + overflow: 'hidden', + 'background-color': fabColor + }); + backdrop.css({ + transform: 'scale(' + scaleFactor + ')', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + menu.find('> li > a').css({ + opacity: 1 + }); + + // Scroll to close. + $(window).on('scroll.fabToolbarClose', function() { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + }); + + $(document).on('click.fabToolbarClose', function(e) { + if (!$(e.target).closest(menu).length) { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + } + }); + }, 100); + }, 0); + }; + + /** + * Transform toolbar back into FAB + * @param {Object} object jQuery object + */ + var toolbarToFAB = function(btn) { + if (btn.attr('data-open') !== "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnWidth = btn.attr('data-origin-width'); + var btnBottom = btn.attr('data-origin-bottom'); + var btnLeft = btn.attr('data-origin-left'); + var anchor = btn.find('> .btn-floating').first(); + var menu = btn.find('> ul').first(); + var backdrop = btn.find('.fab-backdrop'); + var fabColor = anchor.css('background-color'); + + offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2); + offsetY = windowHeight - btnBottom; + scaleFactor = windowWidth / backdrop.width(); + + + // Hide backdrop + btn.removeClass('active'); + btn.attr('data-open', false); + btn.css({ + 'background-color': 'transparent', + transition: 'none' + }); + anchor.css({ + transition: 'none' + }); + backdrop.css({ + transform: 'scale(0)', + 'background-color': fabColor + }); + menu.find('> li > a').css({ + opacity: '' + }); + + setTimeout(function() { + backdrop.remove(); + + // Set initial state. + btn.css({ + 'text-align': '', + width: '', + bottom: '', + left: '', + overflow: '', + 'background-color': '', + transform: 'translate3d(' + -offsetX + 'px,0,0)' + }); + anchor.css({ + overflow: '', + transform: 'translate3d(0,' + offsetY + 'px,0)' + }); + + setTimeout(function() { + btn.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s' + }); + anchor.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + }, 20); + }, 200); + }; + + +}( jQuery )); +;(function ($) { + // Image transition function + Materialize.fadeInImage = function(selectorOrEl) { + var element; + if (typeof(selectorOrEl) === 'string') { + element = $(selectorOrEl); + } else if (typeof(selectorOrEl) === 'object') { + element = selectorOrEl; + } else { + return; + } + element.css({opacity: 0}); + $(element).velocity({opacity: 1}, { + duration: 650, + queue: false, + easing: 'easeOutSine' + }); + $(element).velocity({opacity: 1}, { + duration: 1300, + queue: false, + easing: 'swing', + step: function(now, fx) { + fx.start = 100; + var grayscale_setting = now/100; + var brightness_setting = 150 - (100 - now)/1.75; + + if (brightness_setting < 100) { + brightness_setting = 100; + } + if (now >= 0) { + $(this).css({ + "-webkit-filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)", + "filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)" + }); + } + } + }); + }; + + // Horizontal staggered list + Materialize.showStaggeredList = function(selectorOrEl) { + var element; + if (typeof(selectorOrEl) === 'string') { + element = $(selectorOrEl); + } else if (typeof(selectorOrEl) === 'object') { + element = selectorOrEl; + } else { + return; + } + var time = 0; + element.find('li').velocity( + { translateX: "-100px"}, + { duration: 0 }); + + element.find('li').each(function() { + $(this).velocity( + { opacity: "1", translateX: "0"}, + { duration: 800, delay: time, easing: [60, 10] }); + time += 120; + }); + }; + + + $(document).ready(function() { + // Hardcoded .staggered-list scrollFire + // var staggeredListOptions = []; + // $('ul.staggered-list').each(function (i) { + + // var label = 'scrollFire-' + i; + // $(this).addClass(label); + // staggeredListOptions.push( + // {selector: 'ul.staggered-list.' + label, + // offset: 200, + // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'}); + // }); + // scrollFire(staggeredListOptions); + + // HammerJS, Swipe navigation + + // Touch Event + var swipeLeft = false; + var swipeRight = false; + + + // Dismissible Collections + $('.dismissable').each(function() { + $(this).hammer({ + prevent_default: false + }).bind('pan', function(e) { + if (e.gesture.pointerType === "touch") { + var $this = $(this); + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + + $this.velocity({ translateX: x + }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + + // Swipe Left + if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) { + swipeLeft = true; + } + + // Swipe Right + if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) { + swipeRight = true; + } + } + }).bind('panend', function(e) { + // Reset if collection is moved back into original position + if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) { + swipeRight = false; + swipeLeft = false; + } + + if (e.gesture.pointerType === "touch") { + var $this = $(this); + if (swipeLeft || swipeRight) { + var fullWidth; + if (swipeLeft) { fullWidth = $this.innerWidth(); } + else { fullWidth = -1 * $this.innerWidth(); } + + $this.velocity({ translateX: fullWidth, + }, {duration: 100, queue: false, easing: 'easeOutQuad', complete: + function() { + $this.css('border', 'none'); + $this.velocity({ height: 0, padding: 0, + }, {duration: 200, queue: false, easing: 'easeOutQuad', complete: + function() { $this.remove(); } + }); + } + }); + } + else { + $this.velocity({ translateX: 0, + }, {duration: 100, queue: false, easing: 'easeOutQuad'}); + } + swipeLeft = false; + swipeRight = false; + } + }); + + }); + + + // time = 0 + // // Vertical Staggered list + // $('ul.staggered-list.vertical li').velocity( + // { translateY: "100px"}, + // { duration: 0 }); + + // $('ul.staggered-list.vertical li').each(function() { + // $(this).velocity( + // { opacity: "1", translateY: "0"}, + // { duration: 800, delay: time, easing: [60, 25] }); + // time += 120; + // }); + + // // Fade in and Scale + // $('.fade-in.scale').velocity( + // { scaleX: .4, scaleY: .4, translateX: -600}, + // { duration: 0}); + // $('.fade-in').each(function() { + // $(this).velocity( + // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0}, + // { duration: 800, easing: [60, 10] }); + // }); + }); +}( jQuery )); +;(function($) { + + // Input: Array of JSON objects {selector, offset, callback} + + Materialize.scrollFire = function(options) { + + var didScroll = false; + + window.addEventListener("scroll", function() { + didScroll = true; + }); + + // Rate limit to 100ms + setInterval(function() { + if(didScroll) { + didScroll = false; + + var windowScroll = window.pageYOffset + window.innerHeight; + + for (var i = 0 ; i < options.length; i++) { + // Get options from each line + var value = options[i]; + var selector = value.selector, + offset = value.offset, + callback = value.callback; + + var currentElement = document.querySelector(selector); + if ( currentElement !== null) { + var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset; + + if (windowScroll > (elementOffset + offset)) { + if (value.done !== true) { + if (typeof(callback) === 'function') { + callback.call(this, currentElement); + } else if (typeof(callback) === 'string') { + var callbackFunc = new Function(callback); + callbackFunc(currentElement); + } + value.done = true; + } + } + } + } + } + }, 100); + }; + +})(jQuery); +;/*! + * pickadate.js v3.5.0, 2014/04/13 + * By Amsul, http://amsul.ca + * Hosted on http://amsul.github.io/pickadate.js + * Licensed under MIT + */ + +(function ( factory ) { + + // AMD. + if ( typeof define == 'function' && define.amd ) + define( 'picker', ['jquery'], factory ) + + // Node.js/browserify. + else if ( typeof exports == 'object' ) + module.exports = factory( require('jquery') ) + + // Browser globals. + else this.Picker = factory( jQuery ) + +}(function( $ ) { + +var $window = $( window ) +var $document = $( document ) +var $html = $( document.documentElement ) + + +/** + * The picker constructor that creates a blank picker. + */ +function PickerConstructor( ELEMENT, NAME, COMPONENT, OPTIONS ) { + + // If there’s no element, return the picker constructor. + if ( !ELEMENT ) return PickerConstructor + + + var + IS_DEFAULT_THEME = false, + + + // The state of the picker. + STATE = { + id: ELEMENT.id || 'P' + Math.abs( ~~(Math.random() * new Date()) ) + }, + + + // Merge the defaults and options passed. + SETTINGS = COMPONENT ? $.extend( true, {}, COMPONENT.defaults, OPTIONS ) : OPTIONS || {}, + + + // Merge the default classes with the settings classes. + CLASSES = $.extend( {}, PickerConstructor.klasses(), SETTINGS.klass ), + + + // The element node wrapper into a jQuery object. + $ELEMENT = $( ELEMENT ), + + + // Pseudo picker constructor. + PickerInstance = function() { + return this.start() + }, + + + // The picker prototype. + P = PickerInstance.prototype = { + + constructor: PickerInstance, + + $node: $ELEMENT, + + + /** + * Initialize everything + */ + start: function() { + + // If it’s already started, do nothing. + if ( STATE && STATE.start ) return P + + + // Update the picker states. + STATE.methods = {} + STATE.start = true + STATE.open = false + STATE.type = ELEMENT.type + + + // Confirm focus state, convert into text input to remove UA stylings, + // and set as readonly to prevent keyboard popup. + ELEMENT.autofocus = ELEMENT == getActiveElement() + ELEMENT.readOnly = !SETTINGS.editable + ELEMENT.id = ELEMENT.id || STATE.id + if ( ELEMENT.type != 'text' ) { + ELEMENT.type = 'text' + } + + + // Create a new picker component with the settings. + P.component = new COMPONENT(P, SETTINGS) + + + // Create the picker root with a holder and then prepare it. + P.$root = $( PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"') ) + prepareElementRoot() + + + // If there’s a format for the hidden input element, create the element. + if ( SETTINGS.formatSubmit ) { + prepareElementHidden() + } + + + // Prepare the input element. + prepareElement() + + + // Insert the root as specified in the settings. + if ( SETTINGS.container ) $( SETTINGS.container ).append( P.$root ) + else $ELEMENT.after( P.$root ) + + + // Bind the default component and settings events. + P.on({ + start: P.component.onStart, + render: P.component.onRender, + stop: P.component.onStop, + open: P.component.onOpen, + close: P.component.onClose, + set: P.component.onSet + }).on({ + start: SETTINGS.onStart, + render: SETTINGS.onRender, + stop: SETTINGS.onStop, + open: SETTINGS.onOpen, + close: SETTINGS.onClose, + set: SETTINGS.onSet + }) + + + // Once we’re all set, check the theme in use. + IS_DEFAULT_THEME = isUsingDefaultTheme( P.$root.children()[ 0 ] ) + + + // If the element has autofocus, open the picker. + if ( ELEMENT.autofocus ) { + P.open() + } + + + // Trigger queued the “start” and “render” events. + return P.trigger( 'start' ).trigger( 'render' ) + }, //start + + + /** + * Render a new picker + */ + render: function( entireComponent ) { + + // Insert a new component holder in the root or box. + if ( entireComponent ) P.$root.html( createWrappedComponent() ) + else P.$root.find( '.' + CLASSES.box ).html( P.component.nodes( STATE.open ) ) + + // Trigger the queued “render” events. + return P.trigger( 'render' ) + }, //render + + + /** + * Destroy everything + */ + stop: function() { + + // If it’s already stopped, do nothing. + if ( !STATE.start ) return P + + // Then close the picker. + P.close() + + // Remove the hidden field. + if ( P._hidden ) { + P._hidden.parentNode.removeChild( P._hidden ) + } + + // Remove the root. + P.$root.remove() + + // Remove the input class, remove the stored data, and unbind + // the events (after a tick for IE - see `P.close`). + $ELEMENT.removeClass( CLASSES.input ).removeData( NAME ) + setTimeout( function() { + $ELEMENT.off( '.' + STATE.id ) + }, 0) + + // Restore the element state + ELEMENT.type = STATE.type + ELEMENT.readOnly = false + + // Trigger the queued “stop” events. + P.trigger( 'stop' ) + + // Reset the picker states. + STATE.methods = {} + STATE.start = false + + return P + }, //stop + + + /** + * Open up the picker + */ + open: function( dontGiveFocus ) { + + // If it’s already open, do nothing. + if ( STATE.open ) return P + + // Add the “active” class. + $ELEMENT.addClass( CLASSES.active ) + aria( ELEMENT, 'expanded', true ) + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So add the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout( function() { + + // Add the “opened” class to the picker root. + P.$root.addClass( CLASSES.opened ) + aria( P.$root[0], 'hidden', false ) + + }, 0 ) + + // If we have to give focus, bind the element and doc events. + if ( dontGiveFocus !== false ) { + + // Set it as open. + STATE.open = true + + // Prevent the page from scrolling. + if ( IS_DEFAULT_THEME ) { + $html. + css( 'overflow', 'hidden' ). + css( 'padding-right', '+=' + getScrollbarWidth() ) + } + + // Pass focus to the root element’s jQuery object. + // * Workaround for iOS8 to bring the picker’s root into view. + P.$root.eq(0).focus() + + // Bind the document events. + $document.on( 'click.' + STATE.id + ' focusin.' + STATE.id, function( event ) { + + var target = event.target + + // If the target of the event is not the element, close the picker picker. + // * Don’t worry about clicks or focusins on the root because those don’t bubble up. + // Also, for Firefox, a click on an `option` element bubbles up directly + // to the doc. So make sure the target wasn't the doc. + // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling, + // which causes the picker to unexpectedly close when right-clicking it. So make + // sure the event wasn’t a right-click. + if ( target != ELEMENT && target != document && event.which != 3 ) { + + // If the target was the holder that covers the screen, + // keep the element focused to maintain tabindex. + P.close( target === P.$root.children()[0] ) + } + + }).on( 'keydown.' + STATE.id, function( event ) { + + var + // Get the keycode. + keycode = event.keyCode, + + // Translate that to a selection change. + keycodeToMove = P.component.key[ keycode ], + + // Grab the target. + target = event.target + + + // On escape, close the picker and give focus. + if ( keycode == 27 ) { + P.close( true ) + } + + + // Check if there is a key movement or “enter” keypress on the element. + else if ( target == P.$root[0] && ( keycodeToMove || keycode == 13 ) ) { + + // Prevent the default action to stop page movement. + event.preventDefault() + + // Trigger the key movement action. + if ( keycodeToMove ) { + PickerConstructor._.trigger( P.component.key.go, P, [ PickerConstructor._.trigger( keycodeToMove ) ] ) + } + + // On “enter”, if the highlighted item isn’t disabled, set the value and close. + else if ( !P.$root.find( '.' + CLASSES.highlighted ).hasClass( CLASSES.disabled ) ) { + P.set( 'select', P.component.item.highlight ).close() + } + } + + + // If the target is within the root and “enter” is pressed, + // prevent the default action and trigger a click on the target instead. + else if ( $.contains( P.$root[0], target ) && keycode == 13 ) { + event.preventDefault() + target.click() + } + }) + } + + // Trigger the queued “open” events. + return P.trigger( 'open' ) + }, //open + + + /** + * Close the picker + */ + close: function( giveFocus ) { + + // If we need to give focus, do it before changing states. + if ( giveFocus ) { + // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :| + // The focus is triggered *after* the close has completed - causing it + // to open again. So unbind and rebind the event at the next tick. + P.$root.off( 'focus.toOpen' ).eq(0).focus() + setTimeout( function() { + P.$root.on( 'focus.toOpen', handleFocusToOpenEvent ) + }, 0 ) + } + + // Remove the “active” class. + $ELEMENT.removeClass( CLASSES.active ) + aria( ELEMENT, 'expanded', false ) + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So remove the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout( function() { + + // Remove the “opened” and “focused” class from the picker root. + P.$root.removeClass( CLASSES.opened + ' ' + CLASSES.focused ) + aria( P.$root[0], 'hidden', true ) + + }, 0 ) + + // If it’s already closed, do nothing more. + if ( !STATE.open ) return P + + // Set it as closed. + STATE.open = false + + // Allow the page to scroll. + if ( IS_DEFAULT_THEME ) { + $html. + css( 'overflow', '' ). + css( 'padding-right', '-=' + getScrollbarWidth() ) + } + + // Unbind the document events. + $document.off( '.' + STATE.id ) + + // Trigger the queued “close” events. + return P.trigger( 'close' ) + }, //close + + + /** + * Clear the values + */ + clear: function( options ) { + return P.set( 'clear', null, options ) + }, //clear + + + /** + * Set something + */ + set: function( thing, value, options ) { + + var thingItem, thingValue, + thingIsObject = $.isPlainObject( thing ), + thingObject = thingIsObject ? thing : {} + + // Make sure we have usable options. + options = thingIsObject && $.isPlainObject( value ) ? value : options || {} + + if ( thing ) { + + // If the thing isn’t an object, make it one. + if ( !thingIsObject ) { + thingObject[ thing ] = value + } + + // Go through the things of items to set. + for ( thingItem in thingObject ) { + + // Grab the value of the thing. + thingValue = thingObject[ thingItem ] + + // First, if the item exists and there’s a value, set it. + if ( thingItem in P.component.item ) { + if ( thingValue === undefined ) thingValue = null + P.component.set( thingItem, thingValue, options ) + } + + // Then, check to update the element value and broadcast a change. + if ( thingItem == 'select' || thingItem == 'clear' ) { + $ELEMENT. + val( thingItem == 'clear' ? '' : P.get( thingItem, SETTINGS.format ) ). + trigger( 'change' ) + } + } + + // Render a new picker. + P.render() + } + + // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`. + return options.muted ? P : P.trigger( 'set', thingObject ) + }, //set + + + /** + * Get something + */ + get: function( thing, format ) { + + // Make sure there’s something to get. + thing = thing || 'value' + + // If a picker state exists, return that. + if ( STATE[ thing ] != null ) { + return STATE[ thing ] + } + + // Return the submission value, if that. + if ( thing == 'valueSubmit' ) { + if ( P._hidden ) { + return P._hidden.value + } + thing = 'value' + } + + // Return the value, if that. + if ( thing == 'value' ) { + return ELEMENT.value + } + + // Check if a component item exists, return that. + if ( thing in P.component.item ) { + if ( typeof format == 'string' ) { + var thingValue = P.component.get( thing ) + return thingValue ? + PickerConstructor._.trigger( + P.component.formats.toString, + P.component, + [ format, thingValue ] + ) : '' + } + return P.component.get( thing ) + } + }, //get + + + + /** + * Bind events on the things. + */ + on: function( thing, method, internal ) { + + var thingName, thingMethod, + thingIsObject = $.isPlainObject( thing ), + thingObject = thingIsObject ? thing : {} + + if ( thing ) { + + // If the thing isn’t an object, make it one. + if ( !thingIsObject ) { + thingObject[ thing ] = method + } + + // Go through the things to bind to. + for ( thingName in thingObject ) { + + // Grab the method of the thing. + thingMethod = thingObject[ thingName ] + + // If it was an internal binding, prefix it. + if ( internal ) { + thingName = '_' + thingName + } + + // Make sure the thing methods collection exists. + STATE.methods[ thingName ] = STATE.methods[ thingName ] || [] + + // Add the method to the relative method collection. + STATE.methods[ thingName ].push( thingMethod ) + } + } + + return P + }, //on + + + + /** + * Unbind events on the things. + */ + off: function() { + var i, thingName, + names = arguments; + for ( i = 0, namesCount = names.length; i < namesCount; i += 1 ) { + thingName = names[i] + if ( thingName in STATE.methods ) { + delete STATE.methods[thingName] + } + } + return P + }, + + + /** + * Fire off method events. + */ + trigger: function( name, data ) { + var _trigger = function( name ) { + var methodList = STATE.methods[ name ] + if ( methodList ) { + methodList.map( function( method ) { + PickerConstructor._.trigger( method, P, [ data ] ) + }) + } + } + _trigger( '_' + name ) + _trigger( name ) + return P + } //trigger + } //PickerInstance.prototype + + + /** + * Wrap the picker holder components together. + */ + function createWrappedComponent() { + + // Create a picker wrapper holder + return PickerConstructor._.node( 'div', + + // Create a picker wrapper node + PickerConstructor._.node( 'div', + + // Create a picker frame + PickerConstructor._.node( 'div', + + // Create a picker box node + PickerConstructor._.node( 'div', + + // Create the components nodes. + P.component.nodes( STATE.open ), + + // The picker box class + CLASSES.box + ), + + // Picker wrap class + CLASSES.wrap + ), + + // Picker frame class + CLASSES.frame + ), + + // Picker holder class + CLASSES.holder + ) //endreturn + } //createWrappedComponent + + + + /** + * Prepare the input element with all bindings. + */ + function prepareElement() { + + $ELEMENT. + + // Store the picker data by component name. + data(NAME, P). + + // Add the “input” class name. + addClass(CLASSES.input). + + // Remove the tabindex. + attr('tabindex', -1). + + // If there’s a `data-value`, update the value of the element. + val( $ELEMENT.data('value') ? + P.get('select', SETTINGS.format) : + ELEMENT.value + ) + + + // Only bind keydown events if the element isn’t editable. + if ( !SETTINGS.editable ) { + + $ELEMENT. + + // On focus/click, focus onto the root to open it up. + on( 'focus.' + STATE.id + ' click.' + STATE.id, function( event ) { + event.preventDefault() + P.$root.eq(0).focus() + }). + + // Handle keyboard event based on the picker being opened or not. + on( 'keydown.' + STATE.id, handleKeydownEvent ) + } + + + // Update the aria attributes. + aria(ELEMENT, { + haspopup: true, + expanded: false, + readonly: false, + owns: ELEMENT.id + '_root' + }) + } + + + /** + * Prepare the root picker element with all bindings. + */ + function prepareElementRoot() { + + P.$root. + + on({ + + // For iOS8. + keydown: handleKeydownEvent, + + // When something within the root is focused, stop from bubbling + // to the doc and remove the “focused” state from the root. + focusin: function( event ) { + P.$root.removeClass( CLASSES.focused ) + event.stopPropagation() + }, + + // When something within the root holder is clicked, stop it + // from bubbling to the doc. + 'mousedown click': function( event ) { + + var target = event.target + + // Make sure the target isn’t the root holder so it can bubble up. + if ( target != P.$root.children()[ 0 ] ) { + + event.stopPropagation() + + // * For mousedown events, cancel the default action in order to + // prevent cases where focus is shifted onto external elements + // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120). + // Also, for Firefox, don’t prevent action on the `option` element. + if ( event.type == 'mousedown' && !$( target ).is( 'input, select, textarea, button, option' )) { + + event.preventDefault() + + // Re-focus onto the root so that users can click away + // from elements focused within the picker. + P.$root.eq(0).focus() + } + } + } + }). + + // Add/remove the “target” class on focus and blur. + on({ + focus: function() { + $ELEMENT.addClass( CLASSES.target ) + }, + blur: function() { + $ELEMENT.removeClass( CLASSES.target ) + } + }). + + // Open the picker and adjust the root “focused” state + on( 'focus.toOpen', handleFocusToOpenEvent ). + + // If there’s a click on an actionable element, carry out the actions. + on( 'click', '[data-pick], [data-nav], [data-clear], [data-close]', function() { + + var $target = $( this ), + targetData = $target.data(), + targetDisabled = $target.hasClass( CLASSES.navDisabled ) || $target.hasClass( CLASSES.disabled ), + + // * For IE, non-focusable elements can be active elements as well + // (http://stackoverflow.com/a/2684561). + activeElement = getActiveElement() + activeElement = activeElement && ( activeElement.type || activeElement.href ) + + // If it’s disabled or nothing inside is actively focused, re-focus the element. + if ( targetDisabled || activeElement && !$.contains( P.$root[0], activeElement ) ) { + P.$root.eq(0).focus() + } + + // If something is superficially changed, update the `highlight` based on the `nav`. + if ( !targetDisabled && targetData.nav ) { + P.set( 'highlight', P.component.item.highlight, { nav: targetData.nav } ) + } + + // If something is picked, set `select` then close with focus. + else if ( !targetDisabled && 'pick' in targetData ) { + P.set( 'select', targetData.pick ) + } + + // If a “clear” button is pressed, empty the values and close with focus. + else if ( targetData.clear ) { + P.clear().close( true ) + } + + else if ( targetData.close ) { + P.close( true ) + } + + }) //P.$root + + aria( P.$root[0], 'hidden', true ) + } + + + /** + * Prepare the hidden input element along with all bindings. + */ + function prepareElementHidden() { + + var name + + if ( SETTINGS.hiddenName === true ) { + name = ELEMENT.name + ELEMENT.name = '' + } + else { + name = [ + typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', + typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit' + ] + name = name[0] + ELEMENT.name + name[1] + } + + P._hidden = $( + '' + )[0] + + $ELEMENT. + + // If the value changes, update the hidden input with the correct format. + on('change.' + STATE.id, function() { + P._hidden.value = ELEMENT.value ? + P.get('select', SETTINGS.formatSubmit) : + '' + }) + + + // Insert the hidden input as specified in the settings. + if ( SETTINGS.container ) $( SETTINGS.container ).append( P._hidden ) + else $ELEMENT.after( P._hidden ) + } + + + // For iOS8. + function handleKeydownEvent( event ) { + + var keycode = event.keyCode, + + // Check if one of the delete keys was pressed. + isKeycodeDelete = /^(8|46)$/.test(keycode) + + // For some reason IE clears the input value on “escape”. + if ( keycode == 27 ) { + P.close() + return false + } + + // Check if `space` or `delete` was pressed or the picker is closed with a key movement. + if ( keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode] ) { + + // Prevent it from moving the page and bubbling to doc. + event.preventDefault() + event.stopPropagation() + + // If `delete` was pressed, clear the values and close the picker. + // Otherwise open the picker. + if ( isKeycodeDelete ) { P.clear().close() } + else { P.open() } + } + } + + + // Separated for IE + function handleFocusToOpenEvent( event ) { + + // Stop the event from propagating to the doc. + event.stopPropagation() + + // If it’s a focus event, add the “focused” class to the root. + if ( event.type == 'focus' ) { + P.$root.addClass( CLASSES.focused ) + } + + // And then finally open the picker. + P.open() + } + + + // Return a new picker instance. + return new PickerInstance() +} //PickerConstructor + + + +/** + * The default classes and prefix to use for the HTML classes. + */ +PickerConstructor.klasses = function( prefix ) { + prefix = prefix || 'picker' + return { + + picker: prefix, + opened: prefix + '--opened', + focused: prefix + '--focused', + + input: prefix + '__input', + active: prefix + '__input--active', + target: prefix + '__input--target', + + holder: prefix + '__holder', + + frame: prefix + '__frame', + wrap: prefix + '__wrap', + + box: prefix + '__box' + } +} //PickerConstructor.klasses + + + +/** + * Check if the default theme is being used. + */ +function isUsingDefaultTheme( element ) { + + var theme, + prop = 'position' + + // For IE. + if ( element.currentStyle ) { + theme = element.currentStyle[prop] + } + + // For normal browsers. + else if ( window.getComputedStyle ) { + theme = getComputedStyle( element )[prop] + } + + return theme == 'fixed' +} + + + +/** + * Get the width of the browser’s scrollbar. + * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js + */ +function getScrollbarWidth() { + + if ( $html.height() <= $window.height() ) { + return 0 + } + + var $outer = $( '
      ' ). + appendTo( 'body' ) + + // Get the width without scrollbars. + var widthWithoutScroll = $outer[0].offsetWidth + + // Force adding scrollbars. + $outer.css( 'overflow', 'scroll' ) + + // Add the inner div. + var $inner = $( '
      ' ).appendTo( $outer ) + + // Get the width with scrollbars. + var widthWithScroll = $inner[0].offsetWidth + + // Remove the divs. + $outer.remove() + + // Return the difference between the widths. + return widthWithoutScroll - widthWithScroll +} + + + +/** + * PickerConstructor helper methods. + */ +PickerConstructor._ = { + + /** + * Create a group of nodes. Expects: + * ` + { + min: {Integer}, + max: {Integer}, + i: {Integer}, + node: {String}, + item: {Function} + } + * ` + */ + group: function( groupObject ) { + + var + // Scope for the looped object + loopObjectScope, + + // Create the nodes list + nodesList = '', + + // The counter starts from the `min` + counter = PickerConstructor._.trigger( groupObject.min, groupObject ) + + + // Loop from the `min` to `max`, incrementing by `i` + for ( ; counter <= PickerConstructor._.trigger( groupObject.max, groupObject, [ counter ] ); counter += groupObject.i ) { + + // Trigger the `item` function within scope of the object + loopObjectScope = PickerConstructor._.trigger( groupObject.item, groupObject, [ counter ] ) + + // Splice the subgroup and create nodes out of the sub nodes + nodesList += PickerConstructor._.node( + groupObject.node, + loopObjectScope[ 0 ], // the node + loopObjectScope[ 1 ], // the classes + loopObjectScope[ 2 ] // the attributes + ) + } + + // Return the list of nodes + return nodesList + }, //group + + + /** + * Create a dom node string + */ + node: function( wrapper, item, klass, attribute ) { + + // If the item is false-y, just return an empty string + if ( !item ) return '' + + // If the item is an array, do a join + item = $.isArray( item ) ? item.join( '' ) : item + + // Check for the class + klass = klass ? ' class="' + klass + '"' : '' + + // Check for any attributes + attribute = attribute ? ' ' + attribute : '' + + // Return the wrapped item + return '<' + wrapper + klass + attribute + '>' + item + '' + }, //node + + + /** + * Lead numbers below 10 with a zero. + */ + lead: function( number ) { + return ( number < 10 ? '0': '' ) + number + }, + + + /** + * Trigger a function otherwise return the value. + */ + trigger: function( callback, scope, args ) { + return typeof callback == 'function' ? callback.apply( scope, args || [] ) : callback + }, + + + /** + * If the second character is a digit, length is 2 otherwise 1. + */ + digits: function( string ) { + return ( /\d/ ).test( string[ 1 ] ) ? 2 : 1 + }, + + + /** + * Tell if something is a date object. + */ + isDate: function( value ) { + return {}.toString.call( value ).indexOf( 'Date' ) > -1 && this.isInteger( value.getDate() ) + }, + + + /** + * Tell if something is an integer. + */ + isInteger: function( value ) { + return {}.toString.call( value ).indexOf( 'Number' ) > -1 && value % 1 === 0 + }, + + + /** + * Create ARIA attribute strings. + */ + ariaAttr: ariaAttr +} //PickerConstructor._ + + + +/** + * Extend the picker with a component and defaults. + */ +PickerConstructor.extend = function( name, Component ) { + + // Extend jQuery. + $.fn[ name ] = function( options, action ) { + + // Grab the component data. + var componentData = this.data( name ) + + // If the picker is requested, return the data object. + if ( options == 'picker' ) { + return componentData + } + + // If the component data exists and `options` is a string, carry out the action. + if ( componentData && typeof options == 'string' ) { + return PickerConstructor._.trigger( componentData[ options ], componentData, [ action ] ) + } + + // Otherwise go through each matched element and if the component + // doesn’t exist, create a new picker using `this` element + // and merging the defaults and options with a deep copy. + return this.each( function() { + var $this = $( this ) + if ( !$this.data( name ) ) { + new PickerConstructor( this, name, Component, options ) + } + }) + } + + // Set the defaults. + $.fn[ name ].defaults = Component.defaults +} //PickerConstructor.extend + + + +function aria(element, attribute, value) { + if ( $.isPlainObject(attribute) ) { + for ( var key in attribute ) { + ariaSet(element, key, attribute[key]) + } + } + else { + ariaSet(element, attribute, value) + } +} +function ariaSet(element, attribute, value) { + element.setAttribute( + (attribute == 'role' ? '' : 'aria-') + attribute, + value + ) +} +function ariaAttr(attribute, data) { + if ( !$.isPlainObject(attribute) ) { + attribute = { attribute: data } + } + data = '' + for ( var key in attribute ) { + var attr = (key == 'role' ? '' : 'aria-') + key, + attrVal = attribute[key] + data += attrVal == null ? '' : attr + '="' + attribute[key] + '"' + } + return data +} + +// IE8 bug throws an error for activeElements within iframes. +function getActiveElement() { + try { + return document.activeElement + } catch ( err ) { } +} + + + +// Expose the picker constructor. +return PickerConstructor + + +})); + + +;/*! + * Date picker for pickadate.js v3.5.0 + * http://amsul.github.io/pickadate.js/date.htm + */ + +(function ( factory ) { + + // AMD. + if ( typeof define == 'function' && define.amd ) + define( ['picker', 'jquery'], factory ) + + // Node.js/browserify. + else if ( typeof exports == 'object' ) + module.exports = factory( require('./picker.js'), require('jquery') ) + + // Browser globals. + else factory( Picker, jQuery ) + +}(function( Picker, $ ) { + + +/** + * Globals and constants + */ +var DAYS_IN_WEEK = 7, + WEEKS_IN_CALENDAR = 6, + _ = Picker._ + + + +/** + * The date picker constructor + */ +function DatePicker( picker, settings ) { + + var calendar = this, + element = picker.$node[ 0 ], + elementValue = element.value, + elementDataValue = picker.$node.data( 'value' ), + valueString = elementDataValue || elementValue, + formatString = elementDataValue ? settings.formatSubmit : settings.format, + isRTL = function() { + + return element.currentStyle ? + + // For IE. + element.currentStyle.direction == 'rtl' : + + // For normal browsers. + getComputedStyle( picker.$root[0] ).direction == 'rtl' + } + + calendar.settings = settings + calendar.$node = picker.$node + + // The queue of methods that will be used to build item objects. + calendar.queue = { + min: 'measure create', + max: 'measure create', + now: 'now create', + select: 'parse create validate', + highlight: 'parse navigate create validate', + view: 'parse create validate viewset', + disable: 'deactivate', + enable: 'activate' + } + + // The component's item object. + calendar.item = {} + + calendar.item.clear = null + calendar.item.disable = ( settings.disable || [] ).slice( 0 ) + calendar.item.enable = -(function( collectionDisabled ) { + return collectionDisabled[ 0 ] === true ? collectionDisabled.shift() : -1 + })( calendar.item.disable ) + + calendar. + set( 'min', settings.min ). + set( 'max', settings.max ). + set( 'now' ) + + // When there’s a value, set the `select`, which in turn + // also sets the `highlight` and `view`. + if ( valueString ) { + calendar.set( 'select', valueString, { format: formatString }) + } + + // If there’s no value, default to highlighting “today”. + else { + calendar. + set( 'select', null ). + set( 'highlight', calendar.item.now ) + } + + + // The keycode to movement mapping. + calendar.key = { + 40: 7, // Down + 38: -7, // Up + 39: function() { return isRTL() ? -1 : 1 }, // Right + 37: function() { return isRTL() ? 1 : -1 }, // Left + go: function( timeChange ) { + var highlightedObject = calendar.item.highlight, + targetDate = new Date( highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange ) + calendar.set( + 'highlight', + targetDate, + { interval: timeChange } + ) + this.render() + } + } + + + // Bind some picker events. + picker. + on( 'render', function() { + picker.$root.find( '.' + settings.klass.selectMonth ).on( 'change', function() { + var value = this.value + if ( value ) { + picker.set( 'highlight', [ picker.get( 'view' ).year, value, picker.get( 'highlight' ).date ] ) + picker.$root.find( '.' + settings.klass.selectMonth ).trigger( 'focus' ) + } + }) + picker.$root.find( '.' + settings.klass.selectYear ).on( 'change', function() { + var value = this.value + if ( value ) { + picker.set( 'highlight', [ value, picker.get( 'view' ).month, picker.get( 'highlight' ).date ] ) + picker.$root.find( '.' + settings.klass.selectYear ).trigger( 'focus' ) + } + }) + }, 1 ). + on( 'open', function() { + var includeToday = '' + if ( calendar.disabled( calendar.get('now') ) ) { + includeToday = ':not(.' + settings.klass.buttonToday + ')' + } + picker.$root.find( 'button' + includeToday + ', select' ).attr( 'disabled', false ) + }, 1 ). + on( 'close', function() { + picker.$root.find( 'button, select' ).attr( 'disabled', true ) + }, 1 ) + +} //DatePicker + + +/** + * Set a datepicker item object. + */ +DatePicker.prototype.set = function( type, value, options ) { + + var calendar = this, + calendarItem = calendar.item + + // If the value is `null` just set it immediately. + if ( value === null ) { + if ( type == 'clear' ) type = 'select' + calendarItem[ type ] = value + return calendar + } + + // Otherwise go through the queue of methods, and invoke the functions. + // Update this as the time unit, and set the final value as this item. + // * In the case of `enable`, keep the queue but set `disable` instead. + // And in the case of `flip`, keep the queue but set `enable` instead. + calendarItem[ ( type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type ) ] = calendar.queue[ type ].split( ' ' ).map( function( method ) { + value = calendar[ method ]( type, value, options ) + return value + }).pop() + + // Check if we need to cascade through more updates. + if ( type == 'select' ) { + calendar.set( 'highlight', calendarItem.select, options ) + } + else if ( type == 'highlight' ) { + calendar.set( 'view', calendarItem.highlight, options ) + } + else if ( type.match( /^(flip|min|max|disable|enable)$/ ) ) { + if ( calendarItem.select && calendar.disabled( calendarItem.select ) ) { + calendar.set( 'select', calendarItem.select, options ) + } + if ( calendarItem.highlight && calendar.disabled( calendarItem.highlight ) ) { + calendar.set( 'highlight', calendarItem.highlight, options ) + } + } + + return calendar +} //DatePicker.prototype.set + + +/** + * Get a datepicker item object. + */ +DatePicker.prototype.get = function( type ) { + return this.item[ type ] +} //DatePicker.prototype.get + + +/** + * Create a picker date object. + */ +DatePicker.prototype.create = function( type, value, options ) { + + var isInfiniteValue, + calendar = this + + // If there’s no value, use the type as the value. + value = value === undefined ? type : value + + + // If it’s infinity, update the value. + if ( value == -Infinity || value == Infinity ) { + isInfiniteValue = value + } + + // If it’s an object, use the native date object. + else if ( $.isPlainObject( value ) && _.isInteger( value.pick ) ) { + value = value.obj + } + + // If it’s an array, convert it into a date and make sure + // that it’s a valid date – otherwise default to today. + else if ( $.isArray( value ) ) { + value = new Date( value[ 0 ], value[ 1 ], value[ 2 ] ) + value = _.isDate( value ) ? value : calendar.create().obj + } + + // If it’s a number or date object, make a normalized date. + else if ( _.isInteger( value ) || _.isDate( value ) ) { + value = calendar.normalize( new Date( value ), options ) + } + + // If it’s a literal true or any other case, set it to now. + else /*if ( value === true )*/ { + value = calendar.now( type, value, options ) + } + + // Return the compiled object. + return { + year: isInfiniteValue || value.getFullYear(), + month: isInfiniteValue || value.getMonth(), + date: isInfiniteValue || value.getDate(), + day: isInfiniteValue || value.getDay(), + obj: isInfiniteValue || value, + pick: isInfiniteValue || value.getTime() + } +} //DatePicker.prototype.create + + +/** + * Create a range limit object using an array, date object, + * literal “true”, or integer relative to another time. + */ +DatePicker.prototype.createRange = function( from, to ) { + + var calendar = this, + createDate = function( date ) { + if ( date === true || $.isArray( date ) || _.isDate( date ) ) { + return calendar.create( date ) + } + return date + } + + // Create objects if possible. + if ( !_.isInteger( from ) ) { + from = createDate( from ) + } + if ( !_.isInteger( to ) ) { + to = createDate( to ) + } + + // Create relative dates. + if ( _.isInteger( from ) && $.isPlainObject( to ) ) { + from = [ to.year, to.month, to.date + from ]; + } + else if ( _.isInteger( to ) && $.isPlainObject( from ) ) { + to = [ from.year, from.month, from.date + to ]; + } + + return { + from: createDate( from ), + to: createDate( to ) + } +} //DatePicker.prototype.createRange + + +/** + * Check if a date unit falls within a date range object. + */ +DatePicker.prototype.withinRange = function( range, dateUnit ) { + range = this.createRange(range.from, range.to) + return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick +} + + +/** + * Check if two date range objects overlap. + */ +DatePicker.prototype.overlapRanges = function( one, two ) { + + var calendar = this + + // Convert the ranges into comparable dates. + one = calendar.createRange( one.from, one.to ) + two = calendar.createRange( two.from, two.to ) + + return calendar.withinRange( one, two.from ) || calendar.withinRange( one, two.to ) || + calendar.withinRange( two, one.from ) || calendar.withinRange( two, one.to ) +} + + +/** + * Get the date today. + */ +DatePicker.prototype.now = function( type, value, options ) { + value = new Date() + if ( options && options.rel ) { + value.setDate( value.getDate() + options.rel ) + } + return this.normalize( value, options ) +} + + +/** + * Navigate to next/prev month. + */ +DatePicker.prototype.navigate = function( type, value, options ) { + + var targetDateObject, + targetYear, + targetMonth, + targetDate, + isTargetArray = $.isArray( value ), + isTargetObject = $.isPlainObject( value ), + viewsetObject = this.item.view/*, + safety = 100*/ + + + if ( isTargetArray || isTargetObject ) { + + if ( isTargetObject ) { + targetYear = value.year + targetMonth = value.month + targetDate = value.date + } + else { + targetYear = +value[0] + targetMonth = +value[1] + targetDate = +value[2] + } + + // If we’re navigating months but the view is in a different + // month, navigate to the view’s year and month. + if ( options && options.nav && viewsetObject && viewsetObject.month !== targetMonth ) { + targetYear = viewsetObject.year + targetMonth = viewsetObject.month + } + + // Figure out the expected target year and month. + targetDateObject = new Date( targetYear, targetMonth + ( options && options.nav ? options.nav : 0 ), 1 ) + targetYear = targetDateObject.getFullYear() + targetMonth = targetDateObject.getMonth() + + // If the month we’re going to doesn’t have enough days, + // keep decreasing the date until we reach the month’s last date. + while ( /*safety &&*/ new Date( targetYear, targetMonth, targetDate ).getMonth() !== targetMonth ) { + targetDate -= 1 + /*safety -= 1 + if ( !safety ) { + throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.' + }*/ + } + + value = [ targetYear, targetMonth, targetDate ] + } + + return value +} //DatePicker.prototype.navigate + + +/** + * Normalize a date by setting the hours to midnight. + */ +DatePicker.prototype.normalize = function( value/*, options*/ ) { + value.setHours( 0, 0, 0, 0 ) + return value +} + + +/** + * Measure the range of dates. + */ +DatePicker.prototype.measure = function( type, value/*, options*/ ) { + + var calendar = this + + // If it’s anything false-y, remove the limits. + if ( !value ) { + value = type == 'min' ? -Infinity : Infinity + } + + // If it’s a string, parse it. + else if ( typeof value == 'string' ) { + value = calendar.parse( type, value ) + } + + // If it's an integer, get a date relative to today. + else if ( _.isInteger( value ) ) { + value = calendar.now( type, value, { rel: value } ) + } + + return value +} ///DatePicker.prototype.measure + + +/** + * Create a viewset object based on navigation. + */ +DatePicker.prototype.viewset = function( type, dateObject/*, options*/ ) { + return this.create([ dateObject.year, dateObject.month, 1 ]) +} + + +/** + * Validate a date as enabled and shift if needed. + */ +DatePicker.prototype.validate = function( type, dateObject, options ) { + + var calendar = this, + + // Keep a reference to the original date. + originalDateObject = dateObject, + + // Make sure we have an interval. + interval = options && options.interval ? options.interval : 1, + + // Check if the calendar enabled dates are inverted. + isFlippedBase = calendar.item.enable === -1, + + // Check if we have any enabled dates after/before now. + hasEnabledBeforeTarget, hasEnabledAfterTarget, + + // The min & max limits. + minLimitObject = calendar.item.min, + maxLimitObject = calendar.item.max, + + // Check if we’ve reached the limit during shifting. + reachedMin, reachedMax, + + // Check if the calendar is inverted and at least one weekday is enabled. + hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter( function( value ) { + + // If there’s a date, check where it is relative to the target. + if ( $.isArray( value ) ) { + var dateTime = calendar.create( value ).pick + if ( dateTime < dateObject.pick ) hasEnabledBeforeTarget = true + else if ( dateTime > dateObject.pick ) hasEnabledAfterTarget = true + } + + // Return only integers for enabled weekdays. + return _.isInteger( value ) + }).length/*, + + safety = 100*/ + + + + // Cases to validate for: + // [1] Not inverted and date disabled. + // [2] Inverted and some dates enabled. + // [3] Not inverted and out of range. + // + // Cases to **not** validate for: + // • Navigating months. + // • Not inverted and date enabled. + // • Inverted and all dates disabled. + // • ..and anything else. + if ( !options || !options.nav ) if ( + /* 1 */ ( !isFlippedBase && calendar.disabled( dateObject ) ) || + /* 2 */ ( isFlippedBase && calendar.disabled( dateObject ) && ( hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget ) ) || + /* 3 */ ( !isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick) ) + ) { + + + // When inverted, flip the direction if there aren’t any enabled weekdays + // and there are no enabled dates in the direction of the interval. + if ( isFlippedBase && !hasEnabledWeekdays && ( ( !hasEnabledAfterTarget && interval > 0 ) || ( !hasEnabledBeforeTarget && interval < 0 ) ) ) { + interval *= -1 + } + + + // Keep looping until we reach an enabled date. + while ( /*safety &&*/ calendar.disabled( dateObject ) ) { + + /*safety -= 1 + if ( !safety ) { + throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.' + }*/ + + + // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval. + if ( Math.abs( interval ) > 1 && ( dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month ) ) { + dateObject = originalDateObject + interval = interval > 0 ? 1 : -1 + } + + + // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit. + if ( dateObject.pick <= minLimitObject.pick ) { + reachedMin = true + interval = 1 + dateObject = calendar.create([ + minLimitObject.year, + minLimitObject.month, + minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1) + ]) + } + else if ( dateObject.pick >= maxLimitObject.pick ) { + reachedMax = true + interval = -1 + dateObject = calendar.create([ + maxLimitObject.year, + maxLimitObject.month, + maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1) + ]) + } + + + // If we’ve reached both limits, just break out of the loop. + if ( reachedMin && reachedMax ) { + break + } + + + // Finally, create the shifted date using the interval and keep looping. + dateObject = calendar.create([ dateObject.year, dateObject.month, dateObject.date + interval ]) + } + + } //endif + + + // Return the date object settled on. + return dateObject +} //DatePicker.prototype.validate + + +/** + * Check if a date is disabled. + */ +DatePicker.prototype.disabled = function( dateToVerify ) { + + var + calendar = this, + + // Filter through the disabled dates to check if this is one. + isDisabledMatch = calendar.item.disable.filter( function( dateToDisable ) { + + // If the date is a number, match the weekday with 0index and `firstDay` check. + if ( _.isInteger( dateToDisable ) ) { + return dateToVerify.day === ( calendar.settings.firstDay ? dateToDisable : dateToDisable - 1 ) % 7 + } + + // If it’s an array or a native JS date, create and match the exact date. + if ( $.isArray( dateToDisable ) || _.isDate( dateToDisable ) ) { + return dateToVerify.pick === calendar.create( dateToDisable ).pick + } + + // If it’s an object, match a date within the “from” and “to” range. + if ( $.isPlainObject( dateToDisable ) ) { + return calendar.withinRange( dateToDisable, dateToVerify ) + } + }) + + // If this date matches a disabled date, confirm it’s not inverted. + isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function( dateToDisable ) { + return $.isArray( dateToDisable ) && dateToDisable[3] == 'inverted' || + $.isPlainObject( dateToDisable ) && dateToDisable.inverted + }).length + + // Check the calendar “enabled” flag and respectively flip the + // disabled state. Then also check if it’s beyond the min/max limits. + return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || + dateToVerify.pick < calendar.item.min.pick || + dateToVerify.pick > calendar.item.max.pick + +} //DatePicker.prototype.disabled + + +/** + * Parse a string into a usable type. + */ +DatePicker.prototype.parse = function( type, value, options ) { + + var calendar = this, + parsingObject = {} + + // If it’s already parsed, we’re good. + if ( !value || typeof value != 'string' ) { + return value + } + + // We need a `.format` to parse the value with. + if ( !( options && options.format ) ) { + options = options || {} + options.format = calendar.settings.format + } + + // Convert the format into an array and then map through it. + calendar.formats.toArray( options.format ).map( function( label ) { + + var + // Grab the formatting label. + formattingLabel = calendar.formats[ label ], + + // The format length is from the formatting label function or the + // label length without the escaping exclamation (!) mark. + formatLength = formattingLabel ? _.trigger( formattingLabel, calendar, [ value, parsingObject ] ) : label.replace( /^!/, '' ).length + + // If there's a format label, split the value up to the format length. + // Then add it to the parsing object with appropriate label. + if ( formattingLabel ) { + parsingObject[ label ] = value.substr( 0, formatLength ) + } + + // Update the value as the substring from format length to end. + value = value.substr( formatLength ) + }) + + // Compensate for month 0index. + return [ + parsingObject.yyyy || parsingObject.yy, + +( parsingObject.mm || parsingObject.m ) - 1, + parsingObject.dd || parsingObject.d + ] +} //DatePicker.prototype.parse + + +/** + * Various formats to display the object in. + */ +DatePicker.prototype.formats = (function() { + + // Return the length of the first word in a collection. + function getWordLengthFromCollection( string, collection, dateObject ) { + + // Grab the first word from the string. + var word = string.match( /\w+/ )[ 0 ] + + // If there's no month index, add it to the date object + if ( !dateObject.mm && !dateObject.m ) { + dateObject.m = collection.indexOf( word ) + 1 + } + + // Return the length of the word. + return word.length + } + + // Get the length of the first word in a string. + function getFirstWordLength( string ) { + return string.match( /\w+/ )[ 0 ].length + } + + return { + + d: function( string, dateObject ) { + + // If there's string, then get the digits length. + // Otherwise return the selected date. + return string ? _.digits( string ) : dateObject.date + }, + dd: function( string, dateObject ) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected date with a leading zero. + return string ? 2 : _.lead( dateObject.date ) + }, + ddd: function( string, dateObject ) { + + // If there's a string, then get the length of the first word. + // Otherwise return the short selected weekday. + return string ? getFirstWordLength( string ) : this.settings.weekdaysShort[ dateObject.day ] + }, + dddd: function( string, dateObject ) { + + // If there's a string, then get the length of the first word. + // Otherwise return the full selected weekday. + return string ? getFirstWordLength( string ) : this.settings.weekdaysFull[ dateObject.day ] + }, + m: function( string, dateObject ) { + + // If there's a string, then get the length of the digits + // Otherwise return the selected month with 0index compensation. + return string ? _.digits( string ) : dateObject.month + 1 + }, + mm: function( string, dateObject ) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected month with 0index and leading zero. + return string ? 2 : _.lead( dateObject.month + 1 ) + }, + mmm: function( string, dateObject ) { + + var collection = this.settings.monthsShort + + // If there's a string, get length of the relevant month from the short + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ] + }, + mmmm: function( string, dateObject ) { + + var collection = this.settings.monthsFull + + // If there's a string, get length of the relevant month from the full + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ] + }, + yy: function( string, dateObject ) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected year by slicing out the first 2 digits. + return string ? 2 : ( '' + dateObject.year ).slice( 2 ) + }, + yyyy: function( string, dateObject ) { + + // If there's a string, then the length is always 4. + // Otherwise return the selected year. + return string ? 4 : dateObject.year + }, + + // Create an array by splitting the formatting string passed. + toArray: function( formatString ) { return formatString.split( /(d{1,4}|m{1,4}|y{4}|yy|!.)/g ) }, + + // Format an object into a string using the formatting options. + toString: function ( formatString, itemObject ) { + var calendar = this + return calendar.formats.toArray( formatString ).map( function( label ) { + return _.trigger( calendar.formats[ label ], calendar, [ 0, itemObject ] ) || label.replace( /^!/, '' ) + }).join( '' ) + } + } +})() //DatePicker.prototype.formats + + + + +/** + * Check if two date units are the exact. + */ +DatePicker.prototype.isDateExact = function( one, two ) { + + var calendar = this + + // When we’re working with weekdays, do a direct comparison. + if ( + ( _.isInteger( one ) && _.isInteger( two ) ) || + ( typeof one == 'boolean' && typeof two == 'boolean' ) + ) { + return one === two + } + + // When we’re working with date representations, compare the “pick” value. + if ( + ( _.isDate( one ) || $.isArray( one ) ) && + ( _.isDate( two ) || $.isArray( two ) ) + ) { + return calendar.create( one ).pick === calendar.create( two ).pick + } + + // When we’re working with range objects, compare the “from” and “to”. + if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) { + return calendar.isDateExact( one.from, two.from ) && calendar.isDateExact( one.to, two.to ) + } + + return false +} + + +/** + * Check if two date units overlap. + */ +DatePicker.prototype.isDateOverlap = function( one, two ) { + + var calendar = this, + firstDay = calendar.settings.firstDay ? 1 : 0 + + // When we’re working with a weekday index, compare the days. + if ( _.isInteger( one ) && ( _.isDate( two ) || $.isArray( two ) ) ) { + one = one % 7 + firstDay + return one === calendar.create( two ).day + 1 + } + if ( _.isInteger( two ) && ( _.isDate( one ) || $.isArray( one ) ) ) { + two = two % 7 + firstDay + return two === calendar.create( one ).day + 1 + } + + // When we’re working with range objects, check if the ranges overlap. + if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) { + return calendar.overlapRanges( one, two ) + } + + return false +} + + +/** + * Flip the “enabled” state. + */ +DatePicker.prototype.flipEnable = function(val) { + var itemObject = this.item + itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1) +} + + +/** + * Mark a collection of dates as “disabled”. + */ +DatePicker.prototype.deactivate = function( type, datesToDisable ) { + + var calendar = this, + disabledItems = calendar.item.disable.slice(0) + + + // If we’re flipping, that’s all we need to do. + if ( datesToDisable == 'flip' ) { + calendar.flipEnable() + } + + else if ( datesToDisable === false ) { + calendar.flipEnable(1) + disabledItems = [] + } + + else if ( datesToDisable === true ) { + calendar.flipEnable(-1) + disabledItems = [] + } + + // Otherwise go through the dates to disable. + else { + + datesToDisable.map(function( unitToDisable ) { + + var matchFound + + // When we have disabled items, check for matches. + // If something is matched, immediately break out. + for ( var index = 0; index < disabledItems.length; index += 1 ) { + if ( calendar.isDateExact( unitToDisable, disabledItems[index] ) ) { + matchFound = true + break + } + } + + // If nothing was found, add the validated unit to the collection. + if ( !matchFound ) { + if ( + _.isInteger( unitToDisable ) || + _.isDate( unitToDisable ) || + $.isArray( unitToDisable ) || + ( $.isPlainObject( unitToDisable ) && unitToDisable.from && unitToDisable.to ) + ) { + disabledItems.push( unitToDisable ) + } + } + }) + } + + // Return the updated collection. + return disabledItems +} //DatePicker.prototype.deactivate + + +/** + * Mark a collection of dates as “enabled”. + */ +DatePicker.prototype.activate = function( type, datesToEnable ) { + + var calendar = this, + disabledItems = calendar.item.disable, + disabledItemsCount = disabledItems.length + + // If we’re flipping, that’s all we need to do. + if ( datesToEnable == 'flip' ) { + calendar.flipEnable() + } + + else if ( datesToEnable === true ) { + calendar.flipEnable(1) + disabledItems = [] + } + + else if ( datesToEnable === false ) { + calendar.flipEnable(-1) + disabledItems = [] + } + + // Otherwise go through the disabled dates. + else { + + datesToEnable.map(function( unitToEnable ) { + + var matchFound, + disabledUnit, + index, + isExactRange + + // Go through the disabled items and try to find a match. + for ( index = 0; index < disabledItemsCount; index += 1 ) { + + disabledUnit = disabledItems[index] + + // When an exact match is found, remove it from the collection. + if ( calendar.isDateExact( disabledUnit, unitToEnable ) ) { + matchFound = disabledItems[index] = null + isExactRange = true + break + } + + // When an overlapped match is found, add the “inverted” state to it. + else if ( calendar.isDateOverlap( disabledUnit, unitToEnable ) ) { + if ( $.isPlainObject( unitToEnable ) ) { + unitToEnable.inverted = true + matchFound = unitToEnable + } + else if ( $.isArray( unitToEnable ) ) { + matchFound = unitToEnable + if ( !matchFound[3] ) matchFound.push( 'inverted' ) + } + else if ( _.isDate( unitToEnable ) ) { + matchFound = [ unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted' ] + } + break + } + } + + // If a match was found, remove a previous duplicate entry. + if ( matchFound ) for ( index = 0; index < disabledItemsCount; index += 1 ) { + if ( calendar.isDateExact( disabledItems[index], unitToEnable ) ) { + disabledItems[index] = null + break + } + } + + // In the event that we’re dealing with an exact range of dates, + // make sure there are no “inverted” dates because of it. + if ( isExactRange ) for ( index = 0; index < disabledItemsCount; index += 1 ) { + if ( calendar.isDateOverlap( disabledItems[index], unitToEnable ) ) { + disabledItems[index] = null + break + } + } + + // If something is still matched, add it into the collection. + if ( matchFound ) { + disabledItems.push( matchFound ) + } + }) + } + + // Return the updated collection. + return disabledItems.filter(function( val ) { return val != null }) +} //DatePicker.prototype.activate + + +/** + * Create a string for the nodes in the picker. + */ +DatePicker.prototype.nodes = function( isOpen ) { + + var + calendar = this, + settings = calendar.settings, + calendarItem = calendar.item, + nowObject = calendarItem.now, + selectedObject = calendarItem.select, + highlightedObject = calendarItem.highlight, + viewsetObject = calendarItem.view, + disabledCollection = calendarItem.disable, + minLimitObject = calendarItem.min, + maxLimitObject = calendarItem.max, + + + // Create the calendar table head using a copy of weekday labels collection. + // * We do a copy so we don't mutate the original array. + tableHead = (function( collection, fullCollection ) { + + // If the first day should be Monday, move Sunday to the end. + if ( settings.firstDay ) { + collection.push( collection.shift() ) + fullCollection.push( fullCollection.shift() ) + } + + // Create and return the table head group. + return _.node( + 'thead', + _.node( + 'tr', + _.group({ + min: 0, + max: DAYS_IN_WEEK - 1, + i: 1, + node: 'th', + item: function( counter ) { + return [ + collection[ counter ], + settings.klass.weekdays, + 'scope=col title="' + fullCollection[ counter ] + '"' + ] + } + }) + ) + ) //endreturn + + // Materialize modified + })( ( settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter ).slice( 0 ), settings.weekdaysFull.slice( 0 ) ), //tableHead + + + // Create the nav for next/prev month. + createMonthNav = function( next ) { + + // Otherwise, return the created month tag. + return _.node( + 'div', + ' ', + settings.klass[ 'nav' + ( next ? 'Next' : 'Prev' ) ] + ( + + // If the focused month is outside the range, disabled the button. + ( next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month ) || + ( !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ) ? + ' ' + settings.klass.navDisabled : '' + ), + 'data-nav=' + ( next || -1 ) + ' ' + + _.ariaAttr({ + role: 'button', + controls: calendar.$node[0].id + '_table' + }) + ' ' + + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev ) + '"' + ) //endreturn + }, //createMonthNav + + + // Create the month label. + //Materialize modified + createMonthLabel = function(override) { + + var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull + + // Materialize modified + if (override == "short_months") { + monthsCollection = settings.monthsShort; + } + + // If there are months to select, add a dropdown menu. + if ( settings.selectMonths && override == undefined) { + + return _.node( 'select', + _.group({ + min: 0, + max: 11, + i: 1, + node: 'option', + item: function( loopedMonth ) { + + return [ + + // The looped month and no classes. + monthsCollection[ loopedMonth ], 0, + + // Set the value and selected index. + 'value=' + loopedMonth + + ( viewsetObject.month == loopedMonth ? ' selected' : '' ) + + ( + ( + ( viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month ) || + ( viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ) + ) ? + ' disabled' : '' + ) + ] + } + }), + settings.klass.selectMonth + ' browser-default', + ( isOpen ? '' : 'disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + + 'title="' + settings.labelMonthSelect + '"' + ) + } + + // Materialize modified + if (override == "short_months") + if (selectedObject != null) + return _.node( 'div', monthsCollection[ selectedObject.month ] ); + else return _.node( 'div', monthsCollection[ viewsetObject.month ] ); + + // If there's a need for a month selector + return _.node( 'div', monthsCollection[ viewsetObject.month ], settings.klass.month ) + }, //createMonthLabel + + + // Create the year label. + // Materialize modified + createYearLabel = function(override) { + + var focusedYear = viewsetObject.year, + + // If years selector is set to a literal "true", set it to 5. Otherwise + // divide in half to get half before and half after focused year. + numberYears = settings.selectYears === true ? 5 : ~~( settings.selectYears / 2 ) + + // If there are years to select, add a dropdown menu. + if ( numberYears ) { + + var + minYear = minLimitObject.year, + maxYear = maxLimitObject.year, + lowestYear = focusedYear - numberYears, + highestYear = focusedYear + numberYears + + // If the min year is greater than the lowest year, increase the highest year + // by the difference and set the lowest year to the min year. + if ( minYear > lowestYear ) { + highestYear += minYear - lowestYear + lowestYear = minYear + } + + // If the max year is less than the highest year, decrease the lowest year + // by the lower of the two: available and needed years. Then set the + // highest year to the max year. + if ( maxYear < highestYear ) { + + var availableYears = lowestYear - minYear, + neededYears = highestYear - maxYear + + lowestYear -= availableYears > neededYears ? neededYears : availableYears + highestYear = maxYear + } + + if ( settings.selectYears && override == undefined ) { + return _.node( 'select', + _.group({ + min: lowestYear, + max: highestYear, + i: 1, + node: 'option', + item: function( loopedYear ) { + return [ + + // The looped year and no classes. + loopedYear, 0, + + // Set the value and selected index. + 'value=' + loopedYear + ( focusedYear == loopedYear ? ' selected' : '' ) + ] + } + }), + settings.klass.selectYear + ' browser-default', + ( isOpen ? '' : 'disabled' ) + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + + 'title="' + settings.labelYearSelect + '"' + ) + } + } + + // Materialize modified + if (override == "raw") + return _.node( 'div', focusedYear ) + + // Otherwise just return the year focused + return _.node( 'div', focusedYear, settings.klass.year ) + } //createYearLabel + + + // Materialize modified + createDayLabel = function() { + if (selectedObject != null) + return _.node( 'div', selectedObject.date) + else return _.node( 'div', nowObject.date) + } + createWeekdayLabel = function() { + var display_day; + + if (selectedObject != null) + display_day = selectedObject.day; + else + display_day = nowObject.day; + var weekday = settings.weekdaysFull[ display_day ] + return weekday + } + + + // Create and return the entire calendar. +return _.node( + // Date presentation View + 'div', + _.node( + 'div', + createWeekdayLabel(), + "picker__weekday-display" + )+ + _.node( + // Div for short Month + 'div', + createMonthLabel("short_months"), + settings.klass.month_display + )+ + _.node( + // Div for Day + 'div', + createDayLabel() , + settings.klass.day_display + )+ + _.node( + // Div for Year + 'div', + createYearLabel("raw") , + settings.klass.year_display + ), + settings.klass.date_display + )+ + // Calendar container + _.node('div', + _.node('div', + ( settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel() ) + + createMonthNav() + createMonthNav( 1 ), + settings.klass.header + ) + _.node( + 'table', + tableHead + + _.node( + 'tbody', + _.group({ + min: 0, + max: WEEKS_IN_CALENDAR - 1, + i: 1, + node: 'tr', + item: function( rowCounter ) { + + // If Monday is the first day and the month starts on Sunday, shift the date back a week. + var shiftDateBy = settings.firstDay && calendar.create([ viewsetObject.year, viewsetObject.month, 1 ]).day === 0 ? -7 : 0 + + return [ + _.group({ + min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index + max: function() { + return this.min + DAYS_IN_WEEK - 1 + }, + i: 1, + node: 'td', + item: function( targetDate ) { + + // Convert the time date from a relative date to a target date. + targetDate = calendar.create([ viewsetObject.year, viewsetObject.month, targetDate + ( settings.firstDay ? 1 : 0 ) ]) + + var isSelected = selectedObject && selectedObject.pick == targetDate.pick, + isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick, + isDisabled = disabledCollection && calendar.disabled( targetDate ) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick, + formattedDate = _.trigger( calendar.formats.toString, calendar, [ settings.format, targetDate ] ) + + return [ + _.node( + 'div', + targetDate.date, + (function( klasses ) { + + // Add the `infocus` or `outfocus` classes based on month in view. + klasses.push( viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus ) + + // Add the `today` class if needed. + if ( nowObject.pick == targetDate.pick ) { + klasses.push( settings.klass.now ) + } + + // Add the `selected` class if something's selected and the time matches. + if ( isSelected ) { + klasses.push( settings.klass.selected ) + } + + // Add the `highlighted` class if something's highlighted and the time matches. + if ( isHighlighted ) { + klasses.push( settings.klass.highlighted ) + } + + // Add the `disabled` class if something's disabled and the object matches. + if ( isDisabled ) { + klasses.push( settings.klass.disabled ) + } + + return klasses.join( ' ' ) + })([ settings.klass.day ]), + 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({ + role: 'gridcell', + label: formattedDate, + selected: isSelected && calendar.$node.val() === formattedDate ? true : null, + activedescendant: isHighlighted ? true : null, + disabled: isDisabled ? true : null + }) + ), + '', + _.ariaAttr({ role: 'presentation' }) + ] //endreturn + } + }) + ] //endreturn + } + }) + ), + settings.klass.table, + 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({ + role: 'grid', + controls: calendar.$node[0].id, + readonly: true + }) + ) + , settings.klass.calendar_container) // end calendar + + + + + // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”. + _.node( + 'div', + _.node( 'button', settings.today, "btn-flat picker__today", + 'type=button data-pick=' + nowObject.pick + + ( isOpen && !calendar.disabled(nowObject) ? '' : ' disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id }) ) + + _.node( 'button', settings.clear, "btn-flat picker__clear", + 'type=button data-clear=1' + + ( isOpen ? '' : ' disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id }) ) + + _.node('button', settings.close, "btn-flat picker__close", + 'type=button data-close=true ' + + ( isOpen ? '' : ' disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id }) ), + settings.klass.footer + ) //endreturn +} //DatePicker.prototype.nodes + + + + +/** + * The date picker defaults. + */ +DatePicker.defaults = (function( prefix ) { + + return { + + // The title label to use for the month nav buttons + labelMonthNext: 'Next month', + labelMonthPrev: 'Previous month', + + // The title label to use for the dropdown selectors + labelMonthSelect: 'Select a month', + labelYearSelect: 'Select a year', + + // Months and weekdays + monthsFull: [ 'January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December' ], + monthsShort: [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec' ], + weekdaysFull: [ 'Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday' ], + weekdaysShort: [ 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat' ], + + // Materialize modified + weekdaysLetter: [ 'S', 'M', 'T', 'W', 'T', 'F', 'S' ], + + // Today and clear + today: 'Today', + clear: 'Clear', + close: 'Close', + + // The format to show on the `input` element + format: 'd mmmm, yyyy', + + // Classes + klass: { + + table: prefix + 'table', + + header: prefix + 'header', + + + // Materialize Added klasses + date_display: prefix + 'date-display', + day_display: prefix + 'day-display', + month_display: prefix + 'month-display', + year_display: prefix + 'year-display', + calendar_container: prefix + 'calendar-container', + // end + + + + navPrev: prefix + 'nav--prev', + navNext: prefix + 'nav--next', + navDisabled: prefix + 'nav--disabled', + + month: prefix + 'month', + year: prefix + 'year', + + selectMonth: prefix + 'select--month', + selectYear: prefix + 'select--year', + + weekdays: prefix + 'weekday', + + day: prefix + 'day', + disabled: prefix + 'day--disabled', + selected: prefix + 'day--selected', + highlighted: prefix + 'day--highlighted', + now: prefix + 'day--today', + infocus: prefix + 'day--infocus', + outfocus: prefix + 'day--outfocus', + + footer: prefix + 'footer', + + buttonClear: prefix + 'button--clear', + buttonToday: prefix + 'button--today', + buttonClose: prefix + 'button--close' + } + } +})( Picker.klasses().picker + '__' ) + + + + + +/** + * Extend the picker to add the date picker. + */ +Picker.extend( 'pickadate', DatePicker ) + + +})); + + +;(function ($) { + + $.fn.characterCounter = function(){ + return this.each(function(){ + var $input = $(this); + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + // character counter has already been added appended to the parent container + if ($counterElement.length) { + return; + } + + var itHasLengthAttribute = $input.attr('length') !== undefined; + + if(itHasLengthAttribute){ + $input.on('input', updateCounter); + $input.on('focus', updateCounter); + $input.on('blur', removeCounterElement); + + addCounterElement($input); + } + + }); + }; + + function updateCounter(){ + var maxLength = +$(this).attr('length'), + actualLength = +$(this).val().length, + isValidLength = actualLength <= maxLength; + + $(this).parent().find('span[class="character-counter"]') + .html( actualLength + '/' + maxLength); + + addInputStyle(isValidLength, $(this)); + } + + function addCounterElement($input) { + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + if ($counterElement.length) { + return; + } + + $counterElement = $('') + .addClass('character-counter') + .css('float','right') + .css('font-size','12px') + .css('height', 1); + + $input.parent().append($counterElement); + } + + function removeCounterElement(){ + $(this).parent().find('span[class="character-counter"]').html(''); + } + + function addInputStyle(isValidLength, $input){ + var inputHasInvalidClass = $input.hasClass('invalid'); + if (isValidLength && inputHasInvalidClass) { + $input.removeClass('invalid'); + } + else if(!isValidLength && !inputHasInvalidClass){ + $input.removeClass('valid'); + $input.addClass('invalid'); + } + } + + $(document).ready(function(){ + $('input, textarea').characterCounter(); + }); + +}( jQuery )); +;(function ($) { + + var methods = { + + init : function(options) { + var defaults = { + time_constant: 200, // ms + dist: -100, // zoom scale TODO: make this more intuitive as an option + shift: 0, // spacing for center image + padding: 0, // Padding between non center items + full_width: false, // Change to full width styles + indicators: false, // Toggle indicators + no_wrap: false // Don't wrap around and cycle through items. + }; + options = $.extend(defaults, options); + + return this.each(function() { + + var images, offset, center, pressed, dim, count, + reference, referenceY, amplitude, target, velocity, + xform, frame, timestamp, ticker, dragged, vertical_dragged; + var $indicators = $('
        '); + + + // Initialize + var view = $(this); + var showIndicators = view.attr('data-indicators') || options.indicators; + + // Don't double initialize. + if (view.hasClass('initialized')) { + // Redraw carousel. + $(this).trigger('carouselNext', [0.000001]); + return true; + } + + + // Options + if (options.full_width) { + options.dist = 0; + var firstImage = view.find('.carousel-item img').first(); + if (firstImage.length) { + imageHeight = firstImage.on('load', function(){ + view.css('height', $(this).height()); + }); + } else { + imageHeight = view.find('.carousel-item').first().height(); + view.css('height', imageHeight); + } + + // Offset fixed items when indicators. + if (showIndicators) { + view.find('.carousel-fixed-item').addClass('with-indicators'); + } + } + + + view.addClass('initialized'); + pressed = false; + offset = target = 0; + images = []; + item_width = view.find('.carousel-item').first().innerWidth(); + dim = item_width * 2 + options.padding; + + view.find('.carousel-item').each(function (i) { + images.push($(this)[0]); + if (showIndicators) { + var $indicator = $('
      • '); + + // Add active to first by default. + if (i === 0) { + $indicator.addClass('active'); + } + + // Handle clicks on indicators. + $indicator.click(function () { + var index = $(this).index(); + cycleTo(index); + }); + $indicators.append($indicator); + } + }); + + if (showIndicators) { + view.append($indicators); + } + count = images.length; + + + function setupEvents() { + if (typeof window.ontouchstart !== 'undefined') { + view[0].addEventListener('touchstart', tap); + view[0].addEventListener('touchmove', drag); + view[0].addEventListener('touchend', release); + } + view[0].addEventListener('mousedown', tap); + view[0].addEventListener('mousemove', drag); + view[0].addEventListener('mouseup', release); + view[0].addEventListener('mouseleave', release); + view[0].addEventListener('click', click); + } + + function xpos(e) { + // touch event + if (e.targetTouches && (e.targetTouches.length >= 1)) { + return e.targetTouches[0].clientX; + } + + // mouse event + return e.clientX; + } + + function ypos(e) { + // touch event + if (e.targetTouches && (e.targetTouches.length >= 1)) { + return e.targetTouches[0].clientY; + } + + // mouse event + return e.clientY; + } + + function wrap(x) { + return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x; + } + + function scroll(x) { + var i, half, delta, dir, tween, el, alignment, xTranslation; + + offset = (typeof x === 'number') ? x : offset; + center = Math.floor((offset + dim / 2) / dim); + delta = offset - center * dim; + dir = (delta < 0) ? 1 : -1; + tween = -dir * delta * 2 / dim; + half = count >> 1; + + if (!options.full_width) { + alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) '; + alignment += 'translateY(' + (view[0].clientHeight - item_width) / 2 + 'px)'; + } else { + alignment = 'translateX(0)'; + } + + // Set indicator active + if (showIndicators) { + var diff = (center % count); + var activeIndicator = $indicators.find('.indicator-item.active'); + if (activeIndicator.index() !== diff) { + activeIndicator.removeClass('active'); + $indicators.find('.indicator-item').eq(diff).addClass('active'); + } + } + + // center + // Don't show wrapped items. + if (!options.no_wrap || (center >= 0 && center < count)) { + el = images[wrap(center)]; + el.style[xform] = alignment + + ' translateX(' + (-delta / 2) + 'px)' + + ' translateX(' + (dir * options.shift * tween * i) + 'px)' + + ' translateZ(' + (options.dist * tween) + 'px)'; + el.style.zIndex = 0; + if (options.full_width) { tweenedOpacity = 1; } + else { tweenedOpacity = 1 - 0.2 * tween; } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + for (i = 1; i <= half; ++i) { + // right side + if (options.full_width) { + zTranslation = options.dist; + tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 + tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir); + } + // Don't show wrapped items. + if (!options.no_wrap || center + i < count) { + el = images[wrap(center + i)]; + el.style[xform] = alignment + + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + + // left side + if (options.full_width) { + zTranslation = options.dist; + tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 - tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir); + } + // Don't show wrapped items. + if (!options.no_wrap || center - i >= 0) { + el = images[wrap(center - i)]; + el.style[xform] = alignment + + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + } + + // center + // Don't show wrapped items. + if (!options.no_wrap || (center >= 0 && center < count)) { + el = images[wrap(center)]; + el.style[xform] = alignment + + ' translateX(' + (-delta / 2) + 'px)' + + ' translateX(' + (dir * options.shift * tween) + 'px)' + + ' translateZ(' + (options.dist * tween) + 'px)'; + el.style.zIndex = 0; + if (options.full_width) { tweenedOpacity = 1; } + else { tweenedOpacity = 1 - 0.2 * tween; } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + } + + function track() { + var now, elapsed, delta, v; + + now = Date.now(); + elapsed = now - timestamp; + timestamp = now; + delta = offset - frame; + frame = offset; + + v = 1000 * delta / (1 + elapsed); + velocity = 0.8 * v + 0.2 * velocity; + } + + function autoScroll() { + var elapsed, delta; + + if (amplitude) { + elapsed = Date.now() - timestamp; + delta = amplitude * Math.exp(-elapsed / options.time_constant); + if (delta > 2 || delta < -2) { + scroll(target - delta); + requestAnimationFrame(autoScroll); + } else { + scroll(target); + } + } + } + + function click(e) { + // Disable clicks if carousel was dragged. + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + return false; + + } else if (!options.full_width) { + var clickedIndex = $(e.target).closest('.carousel-item').index(); + var diff = (center % count) - clickedIndex; + + // Disable clicks if carousel was shifted by click + if (diff !== 0) { + e.preventDefault(); + e.stopPropagation(); + } + cycleTo(clickedIndex); + } + } + + function cycleTo(n) { + var diff = (center % count) - n; + + // Account for wraparound. + if (!options.no_wrap) { + if (diff < 0) { + if (Math.abs(diff + count) < Math.abs(diff)) { diff += count; } + + } else if (diff > 0) { + if (Math.abs(diff - count) < diff) { diff -= count; } + } + } + + // Call prev or next accordingly. + if (diff < 0) { + view.trigger('carouselNext', [Math.abs(diff)]); + + } else if (diff > 0) { + view.trigger('carouselPrev', [diff]); + } + } + + function tap(e) { + pressed = true; + dragged = false; + vertical_dragged = false; + reference = xpos(e); + referenceY = ypos(e); + + velocity = amplitude = 0; + frame = offset; + timestamp = Date.now(); + clearInterval(ticker); + ticker = setInterval(track, 100); + + } + + function drag(e) { + var x, delta, deltaY; + if (pressed) { + x = xpos(e); + y = ypos(e); + delta = reference - x; + deltaY = Math.abs(referenceY - y); + if (deltaY < 30 && !vertical_dragged) { + // If vertical scrolling don't allow dragging. + if (delta > 2 || delta < -2) { + dragged = true; + reference = x; + scroll(offset + delta); + } + + } else if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + + } else { + // Vertical scrolling. + vertical_dragged = true; + } + } + + if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + } + } + + function release(e) { + if (pressed) { + pressed = false; + } else { + return; + } + + clearInterval(ticker); + target = offset; + if (velocity > 10 || velocity < -10) { + amplitude = 0.9 * velocity; + target = offset + amplitude; + } + target = Math.round(target / dim) * dim; + + // No wrap of items. + if (options.no_wrap) { + if (target >= dim * (count - 1)) { + target = dim * (count - 1); + } else if (target < 0) { + target = 0; + } + } + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + } + return false; + } + + xform = 'transform'; + ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) { + var e = prefix + 'Transform'; + if (typeof document.body.style[e] !== 'undefined') { + xform = e; + return false; + } + return true; + }); + + + + window.onresize = scroll; + + setupEvents(); + scroll(offset); + + $(this).on('carouselNext', function(e, n) { + if (n === undefined) { + n = 1; + } + target = offset + dim * n; + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselPrev', function(e, n) { + if (n === undefined) { + n = 1; + } + target = offset - dim * n; + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselSet', function(e, n) { + if (n === undefined) { + n = 0; + } + cycleTo(n); + }); + + }); + + + + }, + next : function(n) { + $(this).trigger('carouselNext', [n]); + }, + prev : function(n) { + $(this).trigger('carouselPrev', [n]); + }, + set : function(n) { + $(this).trigger('carouselSet', [n]); + } + }; + + + $.fn.carousel = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.carousel' ); + } + }; // Plugin end +}( jQuery )); \ No newline at end of file diff --git a/js/materialize.min.js b/js/materialize.min.js new file mode 100644 index 0000000..9493303 --- /dev/null +++ b/js/materialize.min.js @@ -0,0 +1,10 @@ +/*! + * Materialize v0.97.8 (http://materializecss.com) + * Copyright 2014-2015 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +if("undefined"==typeof jQuery){var jQuery;jQuery="function"==typeof require?$=require("jquery"):$}jQuery.easing.jswing=jQuery.easing.swing,jQuery.extend(jQuery.easing,{def:"easeOutQuad",swing:function(a,b,c,d,e){return jQuery.easing[jQuery.easing.def](a,b,c,d,e)},easeInQuad:function(a,b,c,d,e){return d*(b/=e)*b+c},easeOutQuad:function(a,b,c,d,e){return-d*(b/=e)*(b-2)+c},easeInOutQuad:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:-d/2*(--b*(b-2)-1)+c},easeInCubic:function(a,b,c,d,e){return d*(b/=e)*b*b+c},easeOutCubic:function(a,b,c,d,e){return d*((b=b/e-1)*b*b+1)+c},easeInOutCubic:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b+c:d/2*((b-=2)*b*b+2)+c},easeInQuart:function(a,b,c,d,e){return d*(b/=e)*b*b*b+c},easeOutQuart:function(a,b,c,d,e){return-d*((b=b/e-1)*b*b*b-1)+c},easeInOutQuart:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b+c:-d/2*((b-=2)*b*b*b-2)+c},easeInQuint:function(a,b,c,d,e){return d*(b/=e)*b*b*b*b+c},easeOutQuint:function(a,b,c,d,e){return d*((b=b/e-1)*b*b*b*b+1)+c},easeInOutQuint:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b*b*b*b+c:d/2*((b-=2)*b*b*b*b+2)+c},easeInSine:function(a,b,c,d,e){return-d*Math.cos(b/e*(Math.PI/2))+d+c},easeOutSine:function(a,b,c,d,e){return d*Math.sin(b/e*(Math.PI/2))+c},easeInOutSine:function(a,b,c,d,e){return-d/2*(Math.cos(Math.PI*b/e)-1)+c},easeInExpo:function(a,b,c,d,e){return 0==b?c:d*Math.pow(2,10*(b/e-1))+c},easeOutExpo:function(a,b,c,d,e){return b==e?c+d:d*(-Math.pow(2,-10*b/e)+1)+c},easeInOutExpo:function(a,b,c,d,e){return 0==b?c:b==e?c+d:(b/=e/2)<1?d/2*Math.pow(2,10*(b-1))+c:d/2*(-Math.pow(2,-10*--b)+2)+c},easeInCirc:function(a,b,c,d,e){return-d*(Math.sqrt(1-(b/=e)*b)-1)+c},easeOutCirc:function(a,b,c,d,e){return d*Math.sqrt(1-(b=b/e-1)*b)+c},easeInOutCirc:function(a,b,c,d,e){return(b/=e/2)<1?-d/2*(Math.sqrt(1-b*b)-1)+c:d/2*(Math.sqrt(1-(b-=2)*b)+1)+c},easeInElastic:function(a,b,c,d,e){var f=1.70158,g=0,h=d;if(0==b)return c;if(1==(b/=e))return c+d;if(g||(g=.3*e),hb?-.5*(h*Math.pow(2,10*(b-=1))*Math.sin((b*e-f)*(2*Math.PI)/g))+c:h*Math.pow(2,-10*(b-=1))*Math.sin((b*e-f)*(2*Math.PI)/g)*.5+d+c},easeInBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),d*(b/=e)*b*((f+1)*b-f)+c},easeOutBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),d*((b=b/e-1)*b*((f+1)*b+f)+1)+c},easeInOutBack:function(a,b,c,d,e,f){return void 0==f&&(f=1.70158),(b/=e/2)<1?d/2*(b*b*(((f*=1.525)+1)*b-f))+c:d/2*((b-=2)*b*(((f*=1.525)+1)*b+f)+2)+c},easeInBounce:function(a,b,c,d,e){return d-jQuery.easing.easeOutBounce(a,e-b,0,d,e)+c},easeOutBounce:function(a,b,c,d,e){return(b/=e)<1/2.75?d*(7.5625*b*b)+c:2/2.75>b?d*(7.5625*(b-=1.5/2.75)*b+.75)+c:2.5/2.75>b?d*(7.5625*(b-=2.25/2.75)*b+.9375)+c:d*(7.5625*(b-=2.625/2.75)*b+.984375)+c},easeInOutBounce:function(a,b,c,d,e){return e/2>b?.5*jQuery.easing.easeInBounce(a,2*b,0,d,e)+c:.5*jQuery.easing.easeOutBounce(a,2*b-e,0,d,e)+.5*d+c}}),jQuery.extend(jQuery.easing,{easeInOutMaterial:function(a,b,c,d,e){return(b/=e/2)<1?d/2*b*b+c:d/4*((b-=2)*b*b+2)+c}}),jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(a){function b(a){var b=a.length,d=c.type(a);return"function"===d||c.isWindow(a)?!1:1===a.nodeType&&b?!0:"array"===d||0===b||"number"==typeof b&&b>0&&b-1 in a}if(!a.jQuery){var c=function(a,b){return new c.fn.init(a,b)};c.isWindow=function(a){return null!=a&&a==a.window},c.type=function(a){return null==a?a+"":"object"==typeof a||"function"==typeof a?e[g.call(a)]||"object":typeof a},c.isArray=Array.isArray||function(a){return"array"===c.type(a)},c.isPlainObject=function(a){var b;if(!a||"object"!==c.type(a)||a.nodeType||c.isWindow(a))return!1;try{if(a.constructor&&!f.call(a,"constructor")&&!f.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(d){return!1}for(b in a);return void 0===b||f.call(a,b)},c.each=function(a,c,d){var e,f=0,g=a.length,h=b(a);if(d){if(h)for(;g>f&&(e=c.apply(a[f],d),e!==!1);f++);else for(f in a)if(e=c.apply(a[f],d),e===!1)break}else if(h)for(;g>f&&(e=c.call(a[f],f,a[f]),e!==!1);f++);else for(f in a)if(e=c.call(a[f],f,a[f]),e===!1)break;return a},c.data=function(a,b,e){if(void 0===e){var f=a[c.expando],g=f&&d[f];if(void 0===b)return g;if(g&&b in g)return g[b]}else if(void 0!==b){var f=a[c.expando]||(a[c.expando]=++c.uuid);return d[f]=d[f]||{},d[f][b]=e,e}},c.removeData=function(a,b){var e=a[c.expando],f=e&&d[e];f&&c.each(b,function(a,b){delete f[b]})},c.extend=function(){var a,b,d,e,f,g,h=arguments[0]||{},i=1,j=arguments.length,k=!1;for("boolean"==typeof h&&(k=h,h=arguments[i]||{},i++),"object"!=typeof h&&"function"!==c.type(h)&&(h={}),i===j&&(h=this,i--);j>i;i++)if(null!=(f=arguments[i]))for(e in f)a=h[e],d=f[e],h!==d&&(k&&d&&(c.isPlainObject(d)||(b=c.isArray(d)))?(b?(b=!1,g=a&&c.isArray(a)?a:[]):g=a&&c.isPlainObject(a)?a:{},h[e]=c.extend(k,g,d)):void 0!==d&&(h[e]=d));return h},c.queue=function(a,d,e){function f(a,c){var d=c||[];return null!=a&&(b(Object(a))?!function(a,b){for(var c=+b.length,d=0,e=a.length;c>d;)a[e++]=b[d++];if(c!==c)for(;void 0!==b[d];)a[e++]=b[d++];return a.length=e,a}(d,"string"==typeof a?[a]:a):[].push.call(d,a)),d}if(a){d=(d||"fx")+"queue";var g=c.data(a,d);return e?(!g||c.isArray(e)?g=c.data(a,d,f(e)):g.push(e),g):g||[]}},c.dequeue=function(a,b){c.each(a.nodeType?[a]:a,function(a,d){b=b||"fx";var e=c.queue(d,b),f=e.shift();"inprogress"===f&&(f=e.shift()),f&&("fx"===b&&e.unshift("inprogress"),f.call(d,function(){c.dequeue(d,b)}))})},c.fn=c.prototype={init:function(a){if(a.nodeType)return this[0]=a,this;throw new Error("Not a DOM node.")},offset:function(){var b=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:b.top+(a.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:b.left+(a.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function a(){for(var a=this.offsetParent||document;a&&"html"===!a.nodeType.toLowerCase&&"static"===a.style.position;)a=a.offsetParent;return a||document}var b=this[0],a=a.apply(b),d=this.offset(),e=/^(?:body|html)$/i.test(a.nodeName)?{top:0,left:0}:c(a).offset();return d.top-=parseFloat(b.style.marginTop)||0,d.left-=parseFloat(b.style.marginLeft)||0,a.style&&(e.top+=parseFloat(a.style.borderTopWidth)||0,e.left+=parseFloat(a.style.borderLeftWidth)||0),{top:d.top-e.top,left:d.left-e.left}}};var d={};c.expando="velocity"+(new Date).getTime(),c.uuid=0;for(var e={},f=e.hasOwnProperty,g=e.toString,h="Boolean Number String Function Array Date RegExp Object Error".split(" "),i=0;ie;++e){var f=j(c,a,d);if(0===f)return c;var g=i(c,a,d)-b;c-=g/f}return c}function l(){for(var b=0;t>b;++b)x[b]=i(b*u,a,d)}function m(b,c,e){var f,g,h=0;do g=c+(e-c)/2,f=i(g,a,d)-b,f>0?e=g:c=g;while(Math.abs(f)>r&&++h=q?k(b,h):0==i?h:m(b,c,c+u)}function o(){y=!0,(a!=c||d!=e)&&l()}var p=4,q=.001,r=1e-7,s=10,t=11,u=1/(t-1),v="Float32Array"in b;if(4!==arguments.length)return!1;for(var w=0;4>w;++w)if("number"!=typeof arguments[w]||isNaN(arguments[w])||!isFinite(arguments[w]))return!1;a=Math.min(a,1),d=Math.min(d,1),a=Math.max(a,0),d=Math.max(d,0);var x=v?new Float32Array(t):new Array(t),y=!1,z=function(b){return y||o(),a===c&&d===e?b:0===b?0:1===b?1:i(n(b),c,e)};z.getControlPoints=function(){return[{x:a,y:c},{x:d,y:e}]};var A="generateBezier("+[a,c,d,e]+")";return z.toString=function(){return A},z}function j(a,b){var c=a;return p.isString(a)?t.Easings[a]||(c=!1):c=p.isArray(a)&&1===a.length?h.apply(null,a):p.isArray(a)&&2===a.length?u.apply(null,a.concat([b])):p.isArray(a)&&4===a.length?i.apply(null,a):!1,c===!1&&(c=t.Easings[t.defaults.easing]?t.defaults.easing:s),c}function k(a){if(a){var b=(new Date).getTime(),c=t.State.calls.length;c>1e4&&(t.State.calls=e(t.State.calls));for(var f=0;c>f;f++)if(t.State.calls[f]){var h=t.State.calls[f],i=h[0],j=h[2],n=h[3],o=!!n,q=null;n||(n=t.State.calls[f][3]=b-16);for(var r=Math.min((b-n)/j.duration,1),s=0,u=i.length;u>s;s++){var w=i[s],y=w.element;if(g(y)){var z=!1;if(j.display!==d&&null!==j.display&&"none"!==j.display){if("flex"===j.display){var A=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];m.each(A,function(a,b){v.setPropertyValue(y,"display",b)})}v.setPropertyValue(y,"display",j.display)}j.visibility!==d&&"hidden"!==j.visibility&&v.setPropertyValue(y,"visibility",j.visibility);for(var B in w)if("element"!==B){var C,D=w[B],E=p.isString(D.easing)?t.Easings[D.easing]:D.easing;if(1===r)C=D.endValue;else{var F=D.endValue-D.startValue;if(C=D.startValue+F*E(r,j,F),!o&&C===D.currentValue)continue}if(D.currentValue=C,"tween"===B)q=C;else{if(v.Hooks.registered[B]){var G=v.Hooks.getRoot(B),H=g(y).rootPropertyValueCache[G];H&&(D.rootPropertyValue=H)}var I=v.setPropertyValue(y,B,D.currentValue+(0===parseFloat(C)?"":D.unitType),D.rootPropertyValue,D.scrollData);v.Hooks.registered[B]&&(g(y).rootPropertyValueCache[G]=v.Normalizations.registered[G]?v.Normalizations.registered[G]("extract",null,I[1]):I[1]),"transform"===I[0]&&(z=!0)}}j.mobileHA&&g(y).transformCache.translate3d===d&&(g(y).transformCache.translate3d="(0px, 0px, 0px)",z=!0),z&&v.flushTransformCache(y)}}j.display!==d&&"none"!==j.display&&(t.State.calls[f][2].display=!1),j.visibility!==d&&"hidden"!==j.visibility&&(t.State.calls[f][2].visibility=!1),j.progress&&j.progress.call(h[1],h[1],r,Math.max(0,n+j.duration-b),n,q),1===r&&l(f)}}t.State.isTicking&&x(k)}function l(a,b){if(!t.State.calls[a])return!1;for(var c=t.State.calls[a][0],e=t.State.calls[a][1],f=t.State.calls[a][2],h=t.State.calls[a][4],i=!1,j=0,k=c.length;k>j;j++){var l=c[j].element;if(b||f.loop||("none"===f.display&&v.setPropertyValue(l,"display",f.display),"hidden"===f.visibility&&v.setPropertyValue(l,"visibility",f.visibility)),f.loop!==!0&&(m.queue(l)[1]===d||!/\.velocityQueueEntryFlag/i.test(m.queue(l)[1]))&&g(l)){g(l).isAnimating=!1,g(l).rootPropertyValueCache={};var n=!1;m.each(v.Lists.transforms3D,function(a,b){var c=/^scale/.test(b)?1:0,e=g(l).transformCache[b];g(l).transformCache[b]!==d&&new RegExp("^\\("+c+"[^.]").test(e)&&(n=!0,delete g(l).transformCache[b])}),f.mobileHA&&(n=!0,delete g(l).transformCache.translate3d),n&&v.flushTransformCache(l),v.Values.removeClass(l,"velocity-animating")}if(!b&&f.complete&&!f.loop&&j===k-1)try{f.complete.call(e,e)}catch(o){setTimeout(function(){throw o},1)}h&&f.loop!==!0&&h(e),g(l)&&f.loop===!0&&!b&&(m.each(g(l).tweensContainer,function(a,b){/^rotate/.test(a)&&360===parseFloat(b.endValue)&&(b.endValue=0,b.startValue=360),/^backgroundPosition/.test(a)&&100===parseFloat(b.endValue)&&"%"===b.unitType&&(b.endValue=0,b.startValue=100)}),t(l,"reverse",{loop:!0,delay:f.delay})),f.queue!==!1&&m.dequeue(l,f.queue)}t.State.calls[a]=!1;for(var p=0,q=t.State.calls.length;q>p;p++)if(t.State.calls[p]!==!1){i=!0;break}i===!1&&(t.State.isTicking=!1,delete t.State.calls,t.State.calls=[])}var m,n=function(){if(c.documentMode)return c.documentMode;for(var a=7;a>4;a--){var b=c.createElement("div");if(b.innerHTML="",b.getElementsByTagName("span").length)return b=null,a}return d}(),o=function(){var a=0;return b.webkitRequestAnimationFrame||b.mozRequestAnimationFrame||function(b){var c,d=(new Date).getTime();return c=Math.max(0,16-(d-a)),a=d+c,setTimeout(function(){b(d+c)},c)}}(),p={isString:function(a){return"string"==typeof a},isArray:Array.isArray||function(a){return"[object Array]"===Object.prototype.toString.call(a)},isFunction:function(a){return"[object Function]"===Object.prototype.toString.call(a)},isNode:function(a){return a&&a.nodeType},isNodeList:function(a){return"object"==typeof a&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(a))&&a.length!==d&&(0===a.length||"object"==typeof a[0]&&a[0].nodeType>0)},isWrapped:function(a){return a&&(a.jquery||b.Zepto&&b.Zepto.zepto.isZ(a))},isSVG:function(a){return b.SVGElement&&a instanceof b.SVGElement},isEmptyObject:function(a){for(var b in a)return!1;return!0}},q=!1;if(a.fn&&a.fn.jquery?(m=a,q=!0):m=b.Velocity.Utilities,8>=n&&!q)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=n)return void(jQuery.fn.velocity=jQuery.fn.animate);var r=400,s="swing",t={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:b.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:c.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:m,Redirects:{},Easings:{},Promise:b.Promise,defaults:{queue:"",duration:r,easing:s,begin:d,complete:d,progress:d,display:d,visibility:d,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(a){m.data(a,"velocity",{isSVG:p.isSVG(a),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};b.pageYOffset!==d?(t.State.scrollAnchor=b,t.State.scrollPropertyLeft="pageXOffset",t.State.scrollPropertyTop="pageYOffset"):(t.State.scrollAnchor=c.documentElement||c.body.parentNode||c.body,t.State.scrollPropertyLeft="scrollLeft",t.State.scrollPropertyTop="scrollTop");var u=function(){function a(a){return-a.tension*a.x-a.friction*a.v}function b(b,c,d){var e={x:b.x+d.dx*c,v:b.v+d.dv*c,tension:b.tension,friction:b.friction};return{dx:e.v,dv:a(e)}}function c(c,d){var e={dx:c.v,dv:a(c)},f=b(c,.5*d,e),g=b(c,.5*d,f),h=b(c,d,g),i=1/6*(e.dx+2*(f.dx+g.dx)+h.dx),j=1/6*(e.dv+2*(f.dv+g.dv)+h.dv);return c.x=c.x+i*d,c.v=c.v+j*d,c}return function d(a,b,e){var f,g,h,i={x:-1,v:0,tension:null,friction:null},j=[0],k=0,l=1e-4,m=.016;for(a=parseFloat(a)||500,b=parseFloat(b)||20,e=e||null,i.tension=a,i.friction=b,f=null!==e,f?(k=d(a,b),g=k/e*m):g=m;h=c(h||i,g),j.push(1+h.x),k+=16,Math.abs(h.x)>l&&Math.abs(h.v)>l;);return f?function(a){return j[a*(j.length-1)|0]}:k}}();t.Easings={linear:function(a){return a},swing:function(a){return.5-Math.cos(a*Math.PI)/2},spring:function(a){return 1-Math.cos(4.5*a*Math.PI)*Math.exp(6*-a)}},m.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(a,b){t.Easings[b[0]]=i.apply(null,b[1])});var v=t.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var a=0;a=n)switch(a){case"name":return"filter";case"extract":var d=c.toString().match(/alpha\(opacity=(.*)\)/i);return c=d?d[1]/100:1;case"inject":return b.style.zoom=1,parseFloat(c)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(c),10)+")"}else switch(a){case"name":return"opacity";case"extract":return c;case"inject":return c}}},register:function(){9>=n||t.State.isGingerbread||(v.Lists.transformsBase=v.Lists.transformsBase.concat(v.Lists.transforms3D));for(var a=0;ae&&(e=1),f=!/(\d)$/i.test(e);break;case"skew":f=!/(deg|\d)$/i.test(e);break;case"rotate":f=!/(deg|\d)$/i.test(e)}return f||(g(c).transformCache[b]="("+e+")"),g(c).transformCache[b]}}}();for(var a=0;a=n||3!==f.split(" ").length||(f+=" 1"),f;case"inject":return 8>=n?4===e.split(" ").length&&(e=e.split(/\s+/).slice(0,3).join(" ")):3===e.split(" ").length&&(e+=" 1"),(8>=n?"rgb":"rgba")+"("+e.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(a){return a.replace(/-(\w)/g,function(a,b){return b.toUpperCase()})},SVGAttribute:function(a){var b="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(n||t.State.isAndroid&&!t.State.isChrome)&&(b+="|transform"),new RegExp("^("+b+")$","i").test(a)},prefixCheck:function(a){if(t.State.prefixMatches[a])return[t.State.prefixMatches[a],!0];for(var b=["","Webkit","Moz","ms","O"],c=0,d=b.length;d>c;c++){var e;if(e=0===c?a:b[c]+a.replace(/^\w/,function(a){return a.toUpperCase()}),p.isString(t.State.prefixElement.style[e]))return t.State.prefixMatches[a]=e,[e,!0]}return[a,!1]}},Values:{hexToRgb:function(a){var b,c=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,d=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return a=a.replace(c,function(a,b,c,d){return b+b+c+c+d+d}),b=d.exec(a),b?[parseInt(b[1],16),parseInt(b[2],16),parseInt(b[3],16)]:[0,0,0]},isCSSNullValue:function(a){return 0==a||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(a)},getUnitType:function(a){return/^(rotate|skew)/i.test(a)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(a)?"":"px"},getDisplayType:function(a){var b=a&&a.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(b)?"inline":/^(li)$/i.test(b)?"list-item":/^(tr)$/i.test(b)?"table-row":/^(table)$/i.test(b)?"table":/^(tbody)$/i.test(b)?"table-row-group":"block"},addClass:function(a,b){a.classList?a.classList.add(b):a.className+=(a.className.length?" ":"")+b},removeClass:function(a,b){a.classList?a.classList.remove(b):a.className=a.className.toString().replace(new RegExp("(^|\\s)"+b.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(a,c,e,f){function h(a,c){function e(){j&&v.setPropertyValue(a,"display","none")}var i=0;if(8>=n)i=m.css(a,c);else{var j=!1;if(/^(width|height)$/.test(c)&&0===v.getPropertyValue(a,"display")&&(j=!0,v.setPropertyValue(a,"display",v.Values.getDisplayType(a))),!f){if("height"===c&&"border-box"!==v.getPropertyValue(a,"boxSizing").toString().toLowerCase()){var k=a.offsetHeight-(parseFloat(v.getPropertyValue(a,"borderTopWidth"))||0)-(parseFloat(v.getPropertyValue(a,"borderBottomWidth"))||0)-(parseFloat(v.getPropertyValue(a,"paddingTop"))||0)-(parseFloat(v.getPropertyValue(a,"paddingBottom"))||0);return e(),k}if("width"===c&&"border-box"!==v.getPropertyValue(a,"boxSizing").toString().toLowerCase()){var l=a.offsetWidth-(parseFloat(v.getPropertyValue(a,"borderLeftWidth"))||0)-(parseFloat(v.getPropertyValue(a,"borderRightWidth"))||0)-(parseFloat(v.getPropertyValue(a,"paddingLeft"))||0)-(parseFloat(v.getPropertyValue(a,"paddingRight"))||0);return e(),l}}var o;o=g(a)===d?b.getComputedStyle(a,null):g(a).computedStyle?g(a).computedStyle:g(a).computedStyle=b.getComputedStyle(a,null),"borderColor"===c&&(c="borderTopColor"),i=9===n&&"filter"===c?o.getPropertyValue(c):o[c],(""===i||null===i)&&(i=a.style[c]),e()}if("auto"===i&&/^(top|right|bottom|left)$/i.test(c)){var p=h(a,"position");("fixed"===p||"absolute"===p&&/top|left/i.test(c))&&(i=m(a).position()[c]+"px")}return i}var i;if(v.Hooks.registered[c]){var j=c,k=v.Hooks.getRoot(j);e===d&&(e=v.getPropertyValue(a,v.Names.prefixCheck(k)[0])),v.Normalizations.registered[k]&&(e=v.Normalizations.registered[k]("extract",a,e)),i=v.Hooks.extractValue(j,e)}else if(v.Normalizations.registered[c]){var l,o;l=v.Normalizations.registered[c]("name",a),"transform"!==l&&(o=h(a,v.Names.prefixCheck(l)[0]),v.Values.isCSSNullValue(o)&&v.Hooks.templates[c]&&(o=v.Hooks.templates[c][1])),i=v.Normalizations.registered[c]("extract",a,o)}if(!/^[\d-]/.test(i))if(g(a)&&g(a).isSVG&&v.Names.SVGAttribute(c))if(/^(height|width)$/i.test(c))try{i=a.getBBox()[c]}catch(p){i=0}else i=a.getAttribute(c);else i=h(a,v.Names.prefixCheck(c)[0]);return v.Values.isCSSNullValue(i)&&(i=0),t.debug>=2&&console.log("Get "+c+": "+i),i},setPropertyValue:function(a,c,d,e,f){var h=c;if("scroll"===c)f.container?f.container["scroll"+f.direction]=d:"Left"===f.direction?b.scrollTo(d,f.alternateValue):b.scrollTo(f.alternateValue,d);else if(v.Normalizations.registered[c]&&"transform"===v.Normalizations.registered[c]("name",a))v.Normalizations.registered[c]("inject",a,d),h="transform",d=g(a).transformCache[c];else{if(v.Hooks.registered[c]){var i=c,j=v.Hooks.getRoot(c);e=e||v.getPropertyValue(a,j),d=v.Hooks.injectValue(i,d,e),c=j}if(v.Normalizations.registered[c]&&(d=v.Normalizations.registered[c]("inject",a,d),c=v.Normalizations.registered[c]("name",a)),h=v.Names.prefixCheck(c)[0],8>=n)try{a.style[h]=d}catch(k){t.debug&&console.log("Browser does not support ["+d+"] for ["+h+"]")}else g(a)&&g(a).isSVG&&v.Names.SVGAttribute(c)?a.setAttribute(c,d):a.style[h]=d;t.debug>=2&&console.log("Set "+c+" ("+h+"): "+d)}return[h,d]},flushTransformCache:function(a){function b(b){return parseFloat(v.getPropertyValue(a,b))}var c="";if((n||t.State.isAndroid&&!t.State.isChrome)&&g(a).isSVG){var d={translate:[b("translateX"),b("translateY")],skewX:[b("skewX")],skewY:[b("skewY")],scale:1!==b("scale")?[b("scale"),b("scale")]:[b("scaleX"),b("scaleY")],rotate:[b("rotateZ"),0,0]};m.each(g(a).transformCache,function(a){/^translate/i.test(a)?a="translate":/^scale/i.test(a)?a="scale":/^rotate/i.test(a)&&(a="rotate"),d[a]&&(c+=a+"("+d[a].join(" ")+") ",delete d[a])})}else{var e,f;m.each(g(a).transformCache,function(b){return e=g(a).transformCache[b],"transformPerspective"===b?(f=e,!0):(9===n&&"rotateZ"===b&&(b="rotate"),void(c+=b+e+" "))}),f&&(c="perspective"+f+" "+c)}v.setPropertyValue(a,"transform",c)}};v.Hooks.register(),v.Normalizations.register(),t.hook=function(a,b,c){var e=d;return a=f(a),m.each(a,function(a,f){if(g(f)===d&&t.init(f),c===d)e===d&&(e=t.CSS.getPropertyValue(f,b));else{var h=t.CSS.setPropertyValue(f,b,c);"transform"===h[0]&&t.CSS.flushTransformCache(f),e=h}}),e};var w=function(){function a(){return h?B.promise||null:i}function e(){function a(a){function l(a,b){var c=d,e=d,g=d;return p.isArray(a)?(c=a[0],!p.isArray(a[1])&&/^[\d-]/.test(a[1])||p.isFunction(a[1])||v.RegEx.isHex.test(a[1])?g=a[1]:(p.isString(a[1])&&!v.RegEx.isHex.test(a[1])||p.isArray(a[1]))&&(e=b?a[1]:j(a[1],h.duration),a[2]!==d&&(g=a[2]))):c=a,b||(e=e||h.easing),p.isFunction(c)&&(c=c.call(f,y,x)),p.isFunction(g)&&(g=g.call(f,y,x)),[c||0,e,g]}function n(a,b){var c,d;return d=(b||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(a){return c=a,""}),c||(c=v.Values.getUnitType(a)),[d,c]}function r(){var a={myParent:f.parentNode||c.body,position:v.getPropertyValue(f,"position"),fontSize:v.getPropertyValue(f,"fontSize")},d=a.position===I.lastPosition&&a.myParent===I.lastParent,e=a.fontSize===I.lastFontSize;I.lastParent=a.myParent,I.lastPosition=a.position,I.lastFontSize=a.fontSize;var h=100,i={};if(e&&d)i.emToPx=I.lastEmToPx,i.percentToPxWidth=I.lastPercentToPxWidth,i.percentToPxHeight=I.lastPercentToPxHeight;else{var j=g(f).isSVG?c.createElementNS("http://www.w3.org/2000/svg","rect"):c.createElement("div");t.init(j),a.myParent.appendChild(j),m.each(["overflow","overflowX","overflowY"],function(a,b){t.CSS.setPropertyValue(j,b,"hidden")}),t.CSS.setPropertyValue(j,"position",a.position),t.CSS.setPropertyValue(j,"fontSize",a.fontSize),t.CSS.setPropertyValue(j,"boxSizing","content-box"),m.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(a,b){t.CSS.setPropertyValue(j,b,h+"%")}),t.CSS.setPropertyValue(j,"paddingLeft",h+"em"),i.percentToPxWidth=I.lastPercentToPxWidth=(parseFloat(v.getPropertyValue(j,"width",null,!0))||1)/h,i.percentToPxHeight=I.lastPercentToPxHeight=(parseFloat(v.getPropertyValue(j,"height",null,!0))||1)/h,i.emToPx=I.lastEmToPx=(parseFloat(v.getPropertyValue(j,"paddingLeft"))||1)/h,a.myParent.removeChild(j)}return null===I.remToPx&&(I.remToPx=parseFloat(v.getPropertyValue(c.body,"fontSize"))||16),null===I.vwToPx&&(I.vwToPx=parseFloat(b.innerWidth)/100,I.vhToPx=parseFloat(b.innerHeight)/100),i.remToPx=I.remToPx,i.vwToPx=I.vwToPx,i.vhToPx=I.vhToPx,t.debug>=1&&console.log("Unit ratios: "+JSON.stringify(i),f),i}if(h.begin&&0===y)try{h.begin.call(o,o)}catch(u){setTimeout(function(){throw u},1)}if("scroll"===C){var w,z,A,D=/^x$/i.test(h.axis)?"Left":"Top",E=parseFloat(h.offset)||0;h.container?p.isWrapped(h.container)||p.isNode(h.container)?(h.container=h.container[0]||h.container,w=h.container["scroll"+D],A=w+m(f).position()[D.toLowerCase()]+E):h.container=null:(w=t.State.scrollAnchor[t.State["scrollProperty"+D]],z=t.State.scrollAnchor[t.State["scrollProperty"+("Left"===D?"Top":"Left")]],A=m(f).offset()[D.toLowerCase()]+E),i={scroll:{rootPropertyValue:!1,startValue:w,currentValue:w,endValue:A,unitType:"",easing:h.easing,scrollData:{container:h.container,direction:D,alternateValue:z}},element:f},t.debug&&console.log("tweensContainer (scroll): ",i.scroll,f)}else if("reverse"===C){if(!g(f).tweensContainer)return void m.dequeue(f,h.queue);"none"===g(f).opts.display&&(g(f).opts.display="auto"),"hidden"===g(f).opts.visibility&&(g(f).opts.visibility="visible"),g(f).opts.loop=!1,g(f).opts.begin=null,g(f).opts.complete=null,s.easing||delete h.easing,s.duration||delete h.duration,h=m.extend({},g(f).opts,h);var F=m.extend(!0,{},g(f).tweensContainer);for(var G in F)if("element"!==G){var H=F[G].startValue;F[G].startValue=F[G].currentValue=F[G].endValue,F[G].endValue=H,p.isEmptyObject(s)||(F[G].easing=h.easing),t.debug&&console.log("reverse tweensContainer ("+G+"): "+JSON.stringify(F[G]),f)}i=F}else if("start"===C){var F;g(f).tweensContainer&&g(f).isAnimating===!0&&(F=g(f).tweensContainer),m.each(q,function(a,b){if(RegExp("^"+v.Lists.colors.join("$|^")+"$").test(a)){var c=l(b,!0),e=c[0],f=c[1],g=c[2];if(v.RegEx.isHex.test(e)){for(var h=["Red","Green","Blue"],i=v.Values.hexToRgb(e),j=g?v.Values.hexToRgb(g):d,k=0;kL;L++){var M={delay:E.delay,progress:E.progress};L===K-1&&(M.display=E.display,M.visibility=E.visibility,M.complete=E.complete),w(o,"reverse",M)}return a()}};t=m.extend(w,t),t.animate=w;var x=b.requestAnimationFrame||o;return t.State.isMobile||c.hidden===d||c.addEventListener("visibilitychange",function(){c.hidden?(x=function(a){return setTimeout(function(){a(!0)},16)},k()):x=b.requestAnimationFrame||o}),a.Velocity=t,a!==b&&(a.fn.velocity=w,a.fn.velocity.defaults=t.defaults),m.each(["Down","Up"],function(a,b){t.Redirects["slide"+b]=function(a,c,e,f,g,h){var i=m.extend({},c),j=i.begin,k=i.complete,l={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},n={};i.display===d&&(i.display="Down"===b?"inline"===t.CSS.Values.getDisplayType(a)?"inline-block":"block":"none"),i.begin=function(){j&&j.call(g,g);for(var c in l){n[c]=a.style[c];var d=t.CSS.getPropertyValue(a,c);l[c]="Down"===b?[d,0]:[0,d]}n.overflow=a.style.overflow,a.style.overflow="hidden"},i.complete=function(){for(var b in n)a.style[b]=n[b];k&&k.call(g,g),h&&h.resolver(g)},t(a,l,i)}}),m.each(["In","Out"],function(a,b){t.Redirects["fade"+b]=function(a,c,e,f,g,h){var i=m.extend({},c),j={opacity:"In"===b?1:0},k=i.complete;i.complete=e!==f-1?i.begin=null:function(){k&&k.call(g,g),h&&h.resolver(g)},i.display===d&&(i.display="In"===b?"auto":"none"),t(this,j,i)}}),t}(window.jQuery||window.Zepto||window,window,document)})),!function(a,b,c,d){"use strict";function e(a,b,c){return setTimeout(k(a,c),b)}function f(a,b,c){return Array.isArray(a)?(g(a,c[b],c),!0):!1}function g(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e-1}function r(a){return a.trim().split(/\s+/g)}function s(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;dc[b]}):d.sort()),d}function v(a,b){for(var c,e,f=b[0].toUpperCase()+b.slice(1),g=0;g1&&!c.firstMultiple?c.firstMultiple=E(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=F(d);b.timeStamp=na(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=J(h,i),b.distance=I(h,i),C(c,b),b.offsetDirection=H(b.deltaX,b.deltaY),b.scale=g?L(g.pointers,d):1,b.rotation=g?K(g.pointers,d):0,D(c,b);var j=a.element;p(b.srcEvent.target,j)&&(j=b.srcEvent.target),b.target=j}function C(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===ya||f.eventType===Aa)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function D(a,b){var c,e,f,g,h=a.lastInterval||b,i=b.timeStamp-h.timeStamp;if(b.eventType!=Ba&&(i>xa||h.velocity===d)){var j=h.deltaX-b.deltaX,k=h.deltaY-b.deltaY,l=G(i,j,k);e=l.x,f=l.y,c=ma(l.x)>ma(l.y)?l.x:l.y,g=H(j,k),a.lastInterval=b}else c=h.velocity,e=h.velocityX,f=h.velocityY,g=h.direction;b.velocity=c,b.velocityX=e,b.velocityY=f,b.direction=g}function E(a){for(var b=[],c=0;ce;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:la(c/b),y:la(d/b)}}function G(a,b,c){return{x:b/a||0,y:c/a||0}}function H(a,b){return a===b?Ca:ma(a)>=ma(b)?a>0?Da:Ea:b>0?Fa:Ga}function I(a,b,c){c||(c=Ka);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function J(a,b,c){c||(c=Ka);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function K(a,b){return J(b[1],b[0],La)-J(a[1],a[0],La)}function L(a,b){return I(b[0],b[1],La)/I(a[0],a[1],La)}function M(){this.evEl=Na,this.evWin=Oa,this.allow=!0,this.pressed=!1,y.apply(this,arguments)}function N(){this.evEl=Ra,this.evWin=Sa,y.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function O(){this.evTarget=Ua,this.evWin=Va,this.started=!1,y.apply(this,arguments)}function P(a,b){var c=t(a.touches),d=t(a.changedTouches);return b&(Aa|Ba)&&(c=u(c.concat(d),"identifier",!0)),[c,d]}function Q(){this.evTarget=Xa,this.targetIds={},y.apply(this,arguments)}function R(a,b){var c=t(a.touches),d=this.targetIds;if(b&(ya|za)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=t(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return p(a.target,i)}),b===ya)for(e=0;eh&&(b.push(a),h=b.length-1):e&(Aa|Ba)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var Ta={touchstart:ya,touchmove:za,touchend:Aa,touchcancel:Ba},Ua="touchstart",Va="touchstart touchmove touchend touchcancel";j(O,y,{handler:function(a){var b=Ta[a.type];if(b===ya&&(this.started=!0),this.started){var c=P.call(this,a,b);b&(Aa|Ba)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:ta,srcEvent:a})}}});var Wa={touchstart:ya,touchmove:za,touchend:Aa,touchcancel:Ba},Xa="touchstart touchmove touchend touchcancel";j(Q,y,{handler:function(a){var b=Wa[a.type],c=R.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:ta,srcEvent:a})}}),j(S,y,{handler:function(a,b,c){var d=c.pointerType==ta,e=c.pointerType==va;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Aa|Ba)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Ya=v(ja.style,"touchAction"),Za=Ya!==d,$a="compute",_a="auto",ab="manipulation",bb="none",cb="pan-x",db="pan-y";T.prototype={set:function(a){a==$a&&(a=this.compute()),Za&&(this.manager.element.style[Ya]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return g(this.manager.recognizers,function(b){l(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),U(a.join(" "))},preventDefaults:function(a){if(!Za){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return void b.preventDefault();var d=this.actions,e=q(d,bb),f=q(d,db),g=q(d,cb);return e||f&&c&Ha||g&&c&Ia?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var eb=1,fb=2,gb=4,hb=8,ib=hb,jb=16,kb=32;V.prototype={defaults:{},set:function(a){return h(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(f(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=Y(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return f(a,"dropRecognizeWith",this)?this:(a=Y(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(f(a,"requireFailure",this))return this;var b=this.requireFail;return a=Y(a,this),-1===s(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(f(a,"dropRequireFailure",this))return this;a=Y(a,this);var b=s(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function b(b){c.manager.emit(c.options.event+(b?W(d):""),a)}var c=this,d=this.state;hb>d&&b(!0),b(),d>=hb&&b(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):void(this.state=kb)},canEmit:function(){for(var a=0;af?Da:Ea,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?Ca:0>g?Fa:Ga,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return Z.prototype.attrTest.call(this,a)&&(this.state&fb||!(this.state&fb)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=X(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),j(_,Z,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[bb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&fb)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),j(aa,V,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[_a]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distanceb.time;if(this._input=a,!d||!c||a.eventType&(Aa|Ba)&&!f)this.reset();else if(a.eventType&ya)this.reset(),this._timer=e(function(){this.state=ib,this.tryEmit()},b.time,this);else if(a.eventType&Aa)return ib;return kb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===ib&&(a&&a.eventType&Aa?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=na(),this.manager.emit(this.options.event,this._input)))}}),j(ba,Z,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[bb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&fb)}}),j(ca,Z,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:Ha|Ia,pointers:1},getTouchAction:function(){return $.prototype.getTouchAction.call(this)},attrTest:function(a){var b,c=this.options.direction;return c&(Ha|Ia)?b=a.velocity:c&Ha?b=a.velocityX:c&Ia&&(b=a.velocityY),this._super.attrTest.call(this,a)&&c&a.direction&&a.distance>this.options.threshold&&ma(b)>this.options.velocity&&a.eventType&Aa},emit:function(a){var b=X(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),j(da,V,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[ab]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance=0&&!d;)d=a[c[f]+"RequestAnimationFrame"],e=a[c[f]+"CancelRequestAnimationFrame"];d&&e||(d=function(a){var c=+Date.now(),d=Math.max(b+16,c);return setTimeout(function(){a(b=d)},d-c)},e=clearTimeout),a.requestAnimationFrame=d,a.cancelAnimationFrame=e}(window),Materialize.guid=function(){function a(){return Math.floor(65536*(1+Math.random())).toString(16).substring(1)}return function(){return a()+a()+"-"+a()+"-"+a()+"-"+a()+"-"+a()+a()+a()}}(),Materialize.escapeHash=function(a){return a.replace(/(:|\.|\[|\]|,|=)/g,"\\$1")},Materialize.elementOrParentIsFixed=function(a){var b=$(a),c=b.add(b.parents()),d=!1;return c.each(function(){return"fixed"===$(this).css("position")?(d=!0,!1):void 0}),d};var Vel;Vel=jQuery?jQuery.Velocity:$?$.Velocity:Velocity,function(a){a.fn.collapsible=function(b){var c={accordion:void 0,onOpen:void 0,onClose:void 0};return b=a.extend(c,b),this.each(function(){function c(b){j=i.find("> li > .collapsible-header"),b.hasClass("active")?b.parent().addClass("active"):b.parent().removeClass("active"),b.parent().hasClass("active")?b.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}}):b.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}}),j.not(b).removeClass("active").parent().removeClass("active"),j.not(b).parent().children(".collapsible-body").stop(!0,!1).each(function(){a(this).is(":visible")&&a(this).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height",""),f(a(this).siblings(".collapsible-header"))}})})}function d(b){b.hasClass("active")?b.parent().addClass("active"):b.parent().removeClass("active"),b.parent().hasClass("active")?b.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}}):b.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){a(this).css("height","")}})}function e(a){b.accordion||"accordion"===k||void 0===k?c(a):d(a),f(a)}function f(a){a.hasClass("active")?"function"==typeof b.onOpen&&b.onOpen.call(this,a.parent()):"function"==typeof b.onClose&&b.onClose.call(this,a.parent())}function g(a){var b=h(a);return b.length>0}function h(a){return a.closest("li > .collapsible-header")}var i=a(this),j=a(this).find("> li > .collapsible-header"),k=i.data("collapsible");i.off("click.collapse","> li > .collapsible-header"),j.off("click.collapse"),i.on("click.collapse","> li > .collapsible-header",function(b){var c=a(b.target);g(c)&&(c=h(c)),c.toggleClass("active"),e(c)}),b.accordion||"accordion"===k||void 0===k?e(j.filter(".active").first()):j.filter(".active").each(function(){e(a(this))})})},a(document).ready(function(){a(".collapsible").collapsible()})}(jQuery),function(a){a.fn.scrollTo=function(b){return a(this).scrollTop(a(this).scrollTop()-a(this).offset().top+a(b).offset().top),this},a.fn.dropdown=function(b){var c={inDuration:300,outDuration:225,constrain_width:!0,hover:!1,gutter:0,belowOrigin:!1,alignment:"left",stopPropagation:!1};return"open"===b?(this.each(function(){a(this).trigger("open")}),!1):"close"===b?(this.each(function(){a(this).trigger("close")}),!1):void this.each(function(){function d(){void 0!==g.data("induration")&&(h.inDuration=g.data("induration")),void 0!==g.data("outduration")&&(h.outDuration=g.data("outduration")),void 0!==g.data("constrainwidth")&&(h.constrain_width=g.data("constrainwidth")),void 0!==g.data("hover")&&(h.hover=g.data("hover")),void 0!==g.data("gutter")&&(h.gutter=g.data("gutter")),void 0!==g.data("beloworigin")&&(h.belowOrigin=g.data("beloworigin")),void 0!==g.data("alignment")&&(h.alignment=g.data("alignment")),void 0!==g.data("stoppropagation")&&(h.stopPropagation=g.data("stoppropagation"))}function e(b){"focus"===b&&(i=!0),d(),j.addClass("active"),g.addClass("active"),h.constrain_width===!0?j.css("width",g.outerWidth()):j.css("white-space","nowrap");var c=window.innerHeight,e=g.innerHeight(),f=g.offset().left,k=g.offset().top-a(window).scrollTop(),l=h.alignment,m=0,n=0,o=0;h.belowOrigin===!0&&(o=e);var p=0,q=0,r=g.parent();if(r.is("body")||(r[0].scrollHeight>r[0].clientHeight&&(p=r[0].scrollTop),r[0].scrollWidth>r[0].clientWidth&&(q=r[0].scrollLeft)),f+j.innerWidth()>a(window).width()?l="right":f-j.innerWidth()+g.innerWidth()<0&&(l="left"),k+j.innerHeight()>c)if(k+e-j.innerHeight()<0){var s=c-k-o;j.css("max-height",s)}else o||(o+=e),o-=j.innerHeight();if("left"===l)m=h.gutter,n=g.position().left+m;else if("right"===l){var t=g.position().left+g.outerWidth()-j.outerWidth();m=-h.gutter,n=t+m}j.css({position:"absolute",top:g.position().top+o+p,left:n+q}),j.stop(!0,!0).css("opacity",0).slideDown({queue:!1,duration:h.inDuration,easing:"easeOutCubic",complete:function(){a(this).css("height","")}}).animate({opacity:1},{queue:!1,duration:h.inDuration,easing:"easeOutSine"})}function f(){i=!1,j.fadeOut(h.outDuration),j.removeClass("active"),g.removeClass("active"),setTimeout(function(){j.css("max-height","")},h.outDuration)}var g=a(this),h=a.extend({},c,b),i=!1,j=a("#"+g.attr("data-activates"));if(d(),g.after(j),h.hover){var k=!1;g.unbind("click."+g.attr("id")),g.on("mouseenter",function(a){k===!1&&(e(),k=!0)}),g.on("mouseleave",function(b){var c=b.toElement||b.relatedTarget;a(c).closest(".dropdown-content").is(j)||(j.stop(!0,!0),f(),k=!1)}),j.on("mouseleave",function(b){var c=b.toElement||b.relatedTarget;a(c).closest(".dropdown-button").is(g)||(j.stop(!0,!0),f(),k=!1)})}else g.unbind("click."+g.attr("id")),g.bind("click."+g.attr("id"),function(b){i||(g[0]!=b.currentTarget||g.hasClass("active")||0!==a(b.target).closest(".dropdown-content").length?g.hasClass("active")&&(f(),a(document).unbind("click."+j.attr("id")+" touchstart."+j.attr("id"))):(b.preventDefault(),h.stopPropagation&&b.stopPropagation(),e("click")),j.hasClass("active")&&a(document).bind("click."+j.attr("id")+" touchstart."+j.attr("id"),function(b){j.is(b.target)||g.is(b.target)||g.find(b.target).length||(f(),a(document).unbind("click."+j.attr("id")+" touchstart."+j.attr("id")))}))});g.on("open",function(a,b){e(b)}),g.on("close",f)})},a(document).ready(function(){a(".dropdown-button").dropdown()})}(jQuery),function(a){var b=0,c=0,d=function(){return c++,"materialize-modal-overlay-"+c},e={init:function(c){var e={opacity:.5,in_duration:350,out_duration:250,ready:void 0,complete:void 0,dismissible:!0,starting_top:"4%",ending_top:"10%"};return c=a.extend(e,c),this.each(function(){var e=a(this),f=a(this).attr("id")||"#"+a(this).data("target"),g=function(){var d=e.data("overlay-id"),f=a("#"+d);e.removeClass("open"),a("body").css({overflow:"",width:""}),e.find(".modal-close").off("click.close"),a(document).off("keyup.modal"+d),f.velocity({opacity:0},{duration:c.out_duration,queue:!1,ease:"easeOutQuart"});var g={ +duration:c.out_duration,queue:!1,ease:"easeOutCubic",complete:function(){a(this).css({display:"none"}),"function"==typeof c.complete&&c.complete.call(this,e),f.remove(),b--}};e.hasClass("bottom-sheet")?e.velocity({bottom:"-100%",opacity:0},g):e.velocity({top:c.starting_top,opacity:0,scaleX:.7},g)},h=function(f){var h=a("body"),i=h.innerWidth();if(h.css("overflow","hidden"),h.width(i),!e.hasClass("open")){var j=d(),k=a('');lStack=++b,k.attr("id",j).css("z-index",1e3+2*lStack),e.data("overlay-id",j).css("z-index",1e3+2*lStack+1),e.addClass("open"),a("body").append(k),c.dismissible&&(k.click(function(){g()}),a(document).on("keyup.modal"+j,function(a){27===a.keyCode&&g()})),e.find(".modal-close").on("click.close",function(a){g()}),k.css({display:"block",opacity:0}),e.css({display:"block",opacity:0}),k.velocity({opacity:c.opacity},{duration:c.in_duration,queue:!1,ease:"easeOutCubic"}),e.data("associated-overlay",k[0]);var l={duration:c.in_duration,queue:!1,ease:"easeOutCubic",complete:function(){"function"==typeof c.ready&&c.ready.call(this,e,f)}};e.hasClass("bottom-sheet")?e.velocity({bottom:"0",opacity:1},l):(a.Velocity.hook(e,"scaleX",.7),e.css({top:c.starting_top}),e.velocity({top:c.ending_top,opacity:1,scaleX:"1"},l))}};a(document).off("click.modalTrigger",'a[href="#'+f+'"], [data-target="'+f+'"]'),a(this).off("openModal"),a(this).off("closeModal"),a(document).on("click.modalTrigger",'a[href="#'+f+'"], [data-target="'+f+'"]',function(b){c.starting_top=(a(this).offset().top-a(window).scrollTop())/1.15,h(a(this)),b.preventDefault()}),a(this).on("openModal",function(){a(this).attr("href")||"#"+a(this).data("target");h()}),a(this).on("closeModal",function(){g()})})},open:function(){a(this).trigger("openModal")},close:function(){a(this).trigger("closeModal")}};a.fn.modal=function(b){return e[b]?e[b].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof b&&b?void a.error("Method "+b+" does not exist on jQuery.modal"):e.init.apply(this,arguments)}}(jQuery),function(a){a.fn.materialbox=function(){return this.each(function(){function b(){f=!1;var b=i.parent(".material-placeholder"),d=(window.innerWidth,window.innerHeight,i.data("width")),g=i.data("height");i.velocity("stop",!0),a("#materialbox-overlay").velocity("stop",!0),a(".materialbox-caption").velocity("stop",!0),a("#materialbox-overlay").velocity({opacity:0},{duration:h,queue:!1,easing:"easeOutQuad",complete:function(){e=!1,a(this).remove()}}),i.velocity({width:d,height:g,left:0,top:0},{duration:h,queue:!1,easing:"easeOutQuad"}),a(".materialbox-caption").velocity({opacity:0},{duration:h,queue:!1,easing:"easeOutQuad",complete:function(){b.css({height:"",width:"",position:"",top:"",left:""}),i.css({height:"",top:"",left:"",width:"","max-width":"",position:"","z-index":""}),i.removeClass("active"),f=!0,a(this).remove(),c&&c.css("overflow","")}})}if(!a(this).hasClass("initialized")){a(this).addClass("initialized");var c,d,e=!1,f=!0,g=275,h=200,i=a(this),j=a("
        ").addClass("material-placeholder");i.wrap(j),i.on("click",function(){var h=i.parent(".material-placeholder"),j=window.innerWidth,k=window.innerHeight,l=i.width(),m=i.height();if(f===!1)return b(),!1;if(e&&f===!0)return b(),!1;f=!1,i.addClass("active"),e=!0,h.css({width:h[0].getBoundingClientRect().width,height:h[0].getBoundingClientRect().height,position:"relative",top:0,left:0}),c=void 0,d=h[0].parentNode;for(;null!==d&&!a(d).is(document);){var n=a(d);"visible"!==n.css("overflow")&&(n.css("overflow","visible"),c=void 0===c?n:c.add(n)),d=d.parentNode}i.css({position:"absolute","z-index":1e3}).data("width",l).data("height",m);var o=a('
        ').css({opacity:0}).click(function(){f===!0&&b()});if(i.before(o),o.velocity({opacity:1},{duration:g,queue:!1,easing:"easeOutQuad"}),""!==i.data("caption")){var p=a('
        ');p.text(i.data("caption")),a("body").append(p),p.css({display:"inline"}),p.velocity({opacity:1},{duration:g,queue:!1,easing:"easeOutQuad"})}var q=0,r=l/j,s=m/k,t=0,u=0;r>s?(q=m/l,t=.9*j,u=.9*j*q):(q=l/m,t=.9*k*q,u=.9*k),i.hasClass("responsive-img")?i.velocity({"max-width":t,width:l},{duration:0,queue:!1,complete:function(){i.css({left:0,top:0}).velocity({height:u,width:t,left:a(document).scrollLeft()+j/2-i.parent(".material-placeholder").offset().left-t/2,top:a(document).scrollTop()+k/2-i.parent(".material-placeholder").offset().top-u/2},{duration:g,queue:!1,easing:"easeOutQuad",complete:function(){f=!0}})}}):i.css("left",0).css("top",0).velocity({height:u,width:t,left:a(document).scrollLeft()+j/2-i.parent(".material-placeholder").offset().left-t/2,top:a(document).scrollTop()+k/2-i.parent(".material-placeholder").offset().top-u/2},{duration:g,queue:!1,easing:"easeOutQuad",complete:function(){f=!0}})}),a(window).scroll(function(){e&&b()}),a(document).keyup(function(a){27===a.keyCode&&f===!0&&e&&b()})}})},a(document).ready(function(){a(".materialboxed").materialbox()})}(jQuery),function(a){a.fn.parallax=function(){var b=a(window).width();return this.each(function(c){function d(c){var d;d=601>b?e.height()>0?e.height():e.children("img").height():e.height()>0?e.height():500;var f=e.children("img").first(),g=f.height(),h=g-d,i=e.offset().top+d,j=e.offset().top,k=a(window).scrollTop(),l=window.innerHeight,m=k+l,n=(m-j)/(d+l),o=Math.round(h*n);c&&f.css("display","block"),i>k&&k+l>j&&f.css("transform","translate3D(-50%,"+o+"px, 0)")}var e=a(this);e.addClass("parallax"),e.children("img").one("load",function(){d(!0)}).each(function(){this.complete&&a(this).trigger("load")}),a(window).scroll(function(){b=a(window).width(),d(!1)}),a(window).resize(function(){b=a(window).width(),d(!1)})})}}(jQuery),function(a){var b={init:function(b){var c={onShow:null};return b=a.extend(c,b),this.each(function(){var c,d,e=a(this),f=(a(window).width(),e.find("li.tab a")),g=e.width(),h=Math.max(g,e[0].scrollWidth)/f.length,i=0,j=function(a){return g-a.position().left-a.outerWidth()-e.scrollLeft()},k=function(a){return a.position().left+e.scrollLeft()};c=a(f.filter('[href="'+location.hash+'"]')),0===c.length&&(c=a(this).find("li.tab a.active").first()),0===c.length&&(c=a(this).find("li.tab a").first()),c.addClass("active"),i=f.index(c),0>i&&(i=0),void 0!==c[0]&&(d=a(c[0].hash)),e.append('
        ');var l=e.find(".indicator");e.is(":visible")&&setTimeout(function(){l.css({right:j(c)}),l.css({left:k(c)})},0),a(window).resize(function(){g=e.width(),h=Math.max(g,e[0].scrollWidth)/f.length,0>i&&(i=0),0!==h&&0!==g&&(l.css({right:j(c)}),l.css({left:k(c)}))}),f.not(c).each(function(){a(Materialize.escapeHash(this.hash)).hide()}),e.on("click","a",function(m){if(a(this).parent().hasClass("disabled"))return void m.preventDefault();if(!a(this).attr("target")){g=e.width(),h=Math.max(g,e[0].scrollWidth)/f.length,c.removeClass("active"),void 0!==d&&d.hide(),c=a(this),d=a(Materialize.escapeHash(this.hash)),f=e.find("li.tab a");c.position();c.addClass("active");var n=i;i=f.index(a(this)),0>i&&(i=0),void 0!==d&&(d.show(),"function"==typeof b.onShow&&b.onShow.call(this,d)),i-n>=0?(l.velocity({right:j(c)},{duration:300,queue:!1,easing:"easeOutQuad"}),l.velocity({left:k(c)},{duration:300,queue:!1,easing:"easeOutQuad",delay:90})):(l.velocity({left:k(c)},{duration:300,queue:!1,easing:"easeOutQuad"}),l.velocity({right:j(c)},{duration:300,queue:!1,easing:"easeOutQuad",delay:90})),m.preventDefault()}})})},select_tab:function(a){this.find('a[href="#'+a+'"]').trigger("click")}};a.fn.tabs=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.tabs"):b.init.apply(this,arguments)},a(document).ready(function(){a("ul.tabs").tabs()})}(jQuery),function(a){a.fn.tooltip=function(c){var d=5,e={delay:350,tooltip:"",position:"bottom",html:!1};return"remove"===c?(this.each(function(){a("#"+a(this).attr("data-tooltip-id")).remove(),a(this).off("mouseenter.tooltip mouseleave.tooltip")}),!1):(c=a.extend(e,c),this.each(function(){var e=Materialize.guid(),f=a(this);f.attr("data-tooltip-id")&&a("#"+f.attr("data-tooltip-id")).remove(),f.attr("data-tooltip-id",e);var g,h,i,j,k,l,m=function(){g=f.attr("data-html")?"true"===f.attr("data-html"):c.html,h=f.attr("data-delay"),h=void 0===h||""===h?c.delay:h,i=f.attr("data-position"),i=void 0===i||""===i?c.position:i,j=f.attr("data-tooltip"),j=void 0===j||""===j?c.tooltip:j};m();var n=function(){var b=a('
        ');return j=g?a("").html(j):a("").text(j),b.append(j).appendTo(a("body")).attr("id",e),l=a('
        '),l.appendTo(b),b};k=n(),f.off("mouseenter.tooltip mouseleave.tooltip");var o,p=!1;f.on({"mouseenter.tooltip":function(a){var c=function(){m(),p=!0,k.velocity("stop"),l.velocity("stop"),k.css({display:"block",left:"0px",top:"0px"});var a,c,e,g=f.outerWidth(),h=f.outerHeight(),j=k.outerHeight(),n=k.outerWidth(),o="0px",q="0px",r=8,s=8;"top"===i?(a=f.offset().top-j-d,c=f.offset().left+g/2-n/2,e=b(c,a,n,j),o="-10px",l.css({bottom:0,left:0,borderRadius:"14px 14px 0 0",transformOrigin:"50% 100%",marginTop:j,marginLeft:n/2-l.width()/2})):"left"===i?(a=f.offset().top+h/2-j/2,c=f.offset().left-n-d,e=b(c,a,n,j),q="-10px",l.css({top:"-7px",right:0,width:"14px",height:"14px",borderRadius:"14px 0 0 14px",transformOrigin:"95% 50%",marginTop:j/2,marginLeft:n})):"right"===i?(a=f.offset().top+h/2-j/2,c=f.offset().left+g+d,e=b(c,a,n,j),q="+10px",l.css({top:"-7px",left:0,width:"14px",height:"14px",borderRadius:"0 14px 14px 0",transformOrigin:"5% 50%",marginTop:j/2,marginLeft:"0px"})):(a=f.offset().top+f.outerHeight()+d,c=f.offset().left+g/2-n/2,e=b(c,a,n,j),o="+10px",l.css({top:0,left:0,marginLeft:n/2-l.width()/2})),k.css({top:e.y,left:e.x}),r=Math.SQRT2*n/parseInt(l.css("width")),s=Math.SQRT2*j/parseInt(l.css("height")),k.velocity({marginTop:o,marginLeft:q},{duration:350,queue:!1}).velocity({opacity:1},{duration:300,delay:50,queue:!1}),l.css({display:"block"}).velocity({opacity:1},{duration:55,delay:0,queue:!1}).velocity({scaleX:r,scaleY:s},{duration:300,delay:0,queue:!1,easing:"easeInOutQuad"})};o=setTimeout(c,h)},"mouseleave.tooltip":function(){p=!1,clearTimeout(o),setTimeout(function(){p!==!0&&(k.velocity({opacity:0,marginTop:0,marginLeft:0},{duration:225,queue:!1}),l.velocity({opacity:0,scaleX:1,scaleY:1},{duration:225,queue:!1,complete:function(){l.css("display","none"),k.css("display","none"),p=!1}}))},225)}})}))};var b=function(b,c,d,e){var f=b,g=c;return 0>f?f=4:f+d>window.innerWidth&&(f-=f+d-window.innerWidth),0>g?g=4:g+e>window.innerHeight+a(window).scrollTop&&(g-=g+e-window.innerHeight),{x:f,y:g}};a(document).ready(function(){a(".tooltipped").tooltip()})}(jQuery),function(a){"use strict";function b(a){return null!==a&&a===a.window}function c(a){return b(a)?a:9===a.nodeType&&a.defaultView}function d(a){var b,d,e={top:0,left:0},f=a&&a.ownerDocument;return b=f.documentElement,"undefined"!=typeof a.getBoundingClientRect&&(e=a.getBoundingClientRect()),d=c(f),{top:e.top+d.pageYOffset-b.clientTop,left:e.left+d.pageXOffset-b.clientLeft}}function e(a){var b="";for(var c in a)a.hasOwnProperty(c)&&(b+=c+":"+a[c]+";");return b}function f(a){if(k.allowEvent(a)===!1)return null;for(var b=null,c=a.target||a.srcElement;null!==c.parentElement;){if(!(c instanceof SVGElement||-1===c.className.indexOf("waves-effect"))){b=c;break}if(c.classList.contains("waves-effect")){b=c;break}c=c.parentElement}return b}function g(b){var c=f(b);null!==c&&(j.show(b,c),"ontouchstart"in a&&(c.addEventListener("touchend",j.hide,!1),c.addEventListener("touchcancel",j.hide,!1)),c.addEventListener("mouseup",j.hide,!1),c.addEventListener("mouseleave",j.hide,!1))}var h=h||{},i=document.querySelectorAll.bind(document),j={duration:750,show:function(a,b){if(2===a.button)return!1;var c=b||this,f=document.createElement("div");f.className="waves-ripple",c.appendChild(f);var g=d(c),h=a.pageY-g.top,i=a.pageX-g.left,k="scale("+c.clientWidth/100*10+")";"touches"in a&&(h=a.touches[0].pageY-g.top,i=a.touches[0].pageX-g.left),f.setAttribute("data-hold",Date.now()),f.setAttribute("data-scale",k),f.setAttribute("data-x",i),f.setAttribute("data-y",h);var l={top:h+"px",left:i+"px"};f.className=f.className+" waves-notransition",f.setAttribute("style",e(l)),f.className=f.className.replace("waves-notransition",""),l["-webkit-transform"]=k,l["-moz-transform"]=k,l["-ms-transform"]=k,l["-o-transform"]=k,l.transform=k,l.opacity="1",l["-webkit-transition-duration"]=j.duration+"ms",l["-moz-transition-duration"]=j.duration+"ms",l["-o-transition-duration"]=j.duration+"ms",l["transition-duration"]=j.duration+"ms",l["-webkit-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["-moz-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["-o-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",l["transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",f.setAttribute("style",e(l))},hide:function(a){k.touchup(a);var b=this,c=(1.4*b.clientWidth,null),d=b.getElementsByClassName("waves-ripple");if(!(d.length>0))return!1;c=d[d.length-1];var f=c.getAttribute("data-x"),g=c.getAttribute("data-y"),h=c.getAttribute("data-scale"),i=Date.now()-Number(c.getAttribute("data-hold")),l=350-i;0>l&&(l=0),setTimeout(function(){var a={top:g+"px",left:f+"px",opacity:"0","-webkit-transition-duration":j.duration+"ms","-moz-transition-duration":j.duration+"ms","-o-transition-duration":j.duration+"ms","transition-duration":j.duration+"ms","-webkit-transform":h,"-moz-transform":h,"-ms-transform":h,"-o-transform":h,transform:h};c.setAttribute("style",e(a)),setTimeout(function(){try{b.removeChild(c)}catch(a){return!1}},j.duration)},l)},wrapInput:function(a){for(var b=0;b0&&(k.touches-=1)},500):"mousedown"===a.type&&k.touches>0&&(b=!1),b},touchup:function(a){k.allowEvent(a)}};h.displayEffect=function(b){b=b||{},"duration"in b&&(j.duration=b.duration),j.wrapInput(i(".waves-effect")),"ontouchstart"in a&&document.body.addEventListener("touchstart",g,!1),document.body.addEventListener("mousedown",g,!1)},h.attach=function(b){"input"===b.tagName.toLowerCase()&&(j.wrapInput([b]),b=b.parentElement),"ontouchstart"in a&&b.addEventListener("touchstart",g,!1),b.addEventListener("mousedown",g,!1)},a.Waves=h,document.addEventListener("DOMContentLoaded",function(){h.displayEffect()},!1)}(window),Materialize.toast=function(a,b,c,d){function e(a){var b=document.createElement("div");if(b.classList.add("toast"),c)for(var e=c.split(" "),f=0,g=e.length;g>f;f++)b.classList.add(e[f]);("object"==typeof HTMLElement?a instanceof HTMLElement:a&&"object"==typeof a&&null!==a&&1===a.nodeType&&"string"==typeof a.nodeName)?b.appendChild(a):a instanceof jQuery?b.appendChild(a[0]):b.innerHTML=a;var h=new Hammer(b,{prevent_default:!1});return h.on("pan",function(a){var c=a.deltaX,d=80;b.classList.contains("panning")||b.classList.add("panning");var e=1-Math.abs(c/d);0>e&&(e=0),Vel(b,{left:c,opacity:e},{duration:50,queue:!1,easing:"easeOutQuad"})}),h.on("panend",function(a){var c=a.deltaX,e=80;Math.abs(c)>e?Vel(b,{marginTop:"-40px"},{duration:375,easing:"easeOutExpo",queue:!1,complete:function(){"function"==typeof d&&d(),b.parentNode.removeChild(b)}}):(b.classList.remove("panning"),Vel(b,{left:0,opacity:1},{duration:300,easing:"easeOutExpo",queue:!1}))}),b}c=c||"";var f=document.getElementById("toast-container");null===f&&(f=document.createElement("div"),f.id="toast-container",document.body.appendChild(f));var g=e(a);a&&f.appendChild(g),g.style.top="35px",g.style.opacity=0,Vel(g,{top:"0px",opacity:1},{duration:300,easing:"easeOutCubic",queue:!1});var h,i=b;null!=i&&(h=setInterval(function(){null===g.parentNode&&window.clearInterval(h),g.classList.contains("panning")||(i-=20),0>=i&&(Vel(g,{opacity:0,marginTop:"-40px"},{duration:375,easing:"easeOutExpo",queue:!1,complete:function(){"function"==typeof d&&d(),this[0].parentNode.removeChild(this[0])}}),window.clearInterval(h))},20))},function(a){var b={init:function(b){var c={menuWidth:300,edge:"left",closeOnClick:!1,draggable:!0};b=a.extend(c,b),a(this).each(function(){var c=a(this),d=a("#"+c.attr("data-activates"));300!=b.menuWidth&&d.css("width",b.menuWidth);var e;b.draggable?(e=a('
        ').attr("data-sidenav",c.attr("data-activates")),a("body").append(e)):e=a(),"left"==b.edge?(d.css("transform","translateX(-100%)"),e.css({left:0})):(d.addClass("right-aligned").css("transform","translateX(100%)"),e.css({right:0})),d.hasClass("fixed")&&window.innerWidth>992&&d.css("transform","translateX(0)"),d.hasClass("fixed")&&a(window).resize(function(){window.innerWidth>992?0!==a("#sidenav-overlay").length&&h?f(!0):d.css("transform","translateX(0%)"):h===!1&&("left"===b.edge?d.css("transform","translateX(-100%)"):d.css("transform","translateX(100%)"))}),b.closeOnClick===!0&&d.on("click.itemclick","a:not(.collapsible-header)",function(){f()});var f=function(c){g=!1,h=!1,a("body").css({overflow:"",width:""}),a("#sidenav-overlay").velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),"left"===b.edge?(e.css({width:"",right:"",left:"0"}),d.velocity({translateX:"-100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){c===!0&&(d.removeAttr("style"),d.css("width",b.menuWidth))}})):(e.css({width:"",right:"0",left:""}),d.velocity({translateX:"100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){c===!0&&(d.removeAttr("style"),d.css("width",b.menuWidth))}}))},g=!1,h=!1;b.draggable&&(e.on("click",function(){h&&f()}),e.hammer({prevent_default:!1}).bind("pan",function(c){if("touch"==c.gesture.pointerType){var e=(c.gesture.direction,c.gesture.center.x),g=(c.gesture.center.y,c.gesture.velocityX,a("body")),i=a("#sidenav-overlay"),j=g.innerWidth();if(g.css("overflow","hidden"),g.width(j),0===i.length&&(i=a('
        '),i.css("opacity",0).click(function(){f()}),a("body").append(i)),"left"===b.edge&&(e>b.menuWidth?e=b.menuWidth:0>e&&(e=0)),"left"===b.edge)e=b.menuWidth/2&&(h=!0),d.css("transform","translateX("+(e-b.menuWidth)+"px)");else{e=window.innerWidth-b.menuWidth/2&&(h=!1);var k=e-b.menuWidth/2;0>k&&(k=0),d.css("transform","translateX("+k+"px)")}var l;"left"===b.edge?(l=e/b.menuWidth,i.velocity({opacity:l},{duration:10,queue:!1,easing:"easeOutQuad"})):(l=Math.abs((e-window.innerWidth)/b.menuWidth),i.velocity({opacity:l},{duration:10,queue:!1,easing:"easeOutQuad"}))}}).bind("panend",function(c){if("touch"==c.gesture.pointerType){var f=a('
        '),i=c.gesture.velocityX,j=c.gesture.center.x,k=j-b.menuWidth,l=j-b.menuWidth/2;k>0&&(k=0),0>l&&(l=0),g=!1,"left"===b.edge?h&&.3>=i||-.5>i?(0!==k&&d.velocity({translateX:[0,k]},{duration:300,queue:!1,easing:"easeOutQuad"}),f.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),e.css({width:"50%",right:0,left:""}),h=!0):(!h||i>.3)&&(a("body").css({overflow:"",width:""}),d.velocity({translateX:[-1*b.menuWidth-10,k]},{duration:200,queue:!1,easing:"easeOutQuad"}),f.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),e.css({width:"10px",right:"",left:0})):h&&i>=-.3||i>.5?(0!==l&&d.velocity({translateX:[0,l]},{duration:300,queue:!1,easing:"easeOutQuad"}),f.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),e.css({width:"50%",right:"",left:0}),h=!0):(!h||-.3>i)&&(a("body").css({overflow:"",width:""}),d.velocity({translateX:[b.menuWidth+10,l]},{duration:200,queue:!1,easing:"easeOutQuad"}),f.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}}),e.css({width:"10px",right:0,left:""}))}})),c.click(function(){if(h===!0)h=!1,g=!1,f();else{var c=a("body"),i=a('
        '),j=c.innerWidth();c.css("overflow","hidden"),c.width(j),a("body").append(e),"left"===b.edge?(e.css({width:"50%",right:0,left:""}),d.velocity({translateX:[0,-1*b.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})):(e.css({width:"50%",right:"",left:0}),d.velocity({translateX:[0,b.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})),i.css("opacity",0).click(function(){h=!1,g=!1,f(),i.velocity({opacity:0},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){a(this).remove()}})}),a("body").append(i),i.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){h=!0,g=!1}})}return!1})})},destroy:function(){var b=a("#sidenav-overlay"),c=a('.drag-target[data-sidenav="'+a(this).attr("data-activates")+'"]');b.trigger("click"),c.remove(),a(this).off("click"),b.remove()},show:function(){this.trigger("click")},hide:function(){a("#sidenav-overlay").trigger("click")}};a.fn.sideNav=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.sideNav"):b.init.apply(this,arguments)}}(jQuery),function(a){function b(b,c,d,e){var f=a();return a.each(g,function(a,g){if(g.height()>0){var h=g.offset().top,i=g.offset().left,j=i+g.width(),k=h+g.height(),l=!(i>c||e>j||h>d||b>k);l&&f.push(g)}}),f}function c(c){++j;var d=f.scrollTop(),e=f.scrollLeft(),g=e+f.width(),i=d+f.height(),l=b(d+k.top+c||200,g+k.right,i+k.bottom,e+k.left);a.each(l,function(a,b){var c=b.data("scrollSpy:ticks");"number"!=typeof c&&b.triggerHandler("scrollSpy:enter"),b.data("scrollSpy:ticks",j)}),a.each(h,function(a,b){var c=b.data("scrollSpy:ticks");"number"==typeof c&&c!==j&&(b.triggerHandler("scrollSpy:exit"),b.data("scrollSpy:ticks",null))}),h=l}function d(){f.trigger("scrollSpy:winSize")}function e(a,b,c){var d,e,f,g=null,h=0;c||(c={});var i=function(){h=c.leading===!1?0:l(),g=null,f=a.apply(d,e),d=e=null};return function(){var j=l();h||c.leading!==!1||(h=j);var k=b-(j-h);return d=this,e=arguments,0>=k?(clearTimeout(g),g=null,h=j,f=a.apply(d,e),d=e=null):g||c.trailing===!1||(g=setTimeout(i,k)),f}}var f=a(window),g=[],h=[],i=!1,j=0,k={top:0,right:0,bottom:0,left:0},l=Date.now||function(){return(new Date).getTime()};a.scrollSpy=function(b,d){var h={throttle:100,scrollOffset:200};d=a.extend(h,d);var j=[];b=a(b),b.each(function(b,c){g.push(a(c)),a(c).data("scrollSpy:id",b),a('a[href="#'+a(c).attr("id")+'"]').click(function(b){b.preventDefault();var c=a(Materialize.escapeHash(this.hash)).offset().top+1;a("html, body").animate({scrollTop:c-d.scrollOffset},{duration:400,queue:!1,easing:"easeOutCubic"})})}),k.top=d.offsetTop||0,k.right=d.offsetRight||0,k.bottom=d.offsetBottom||0,k.left=d.offsetLeft||0;var l=e(function(){c(d.scrollOffset)},d.throttle||100),m=function(){a(document).ready(l)};return i||(f.on("scroll",m),f.on("resize",m),i=!0),setTimeout(m,0),b.on("scrollSpy:enter",function(){j=a.grep(j,function(a){return 0!=a.height()});var b=a(this);j[0]?(a('a[href="#'+j[0].attr("id")+'"]').removeClass("active"),b.data("scrollSpy:id")");e.html(g),b.is(":visible")?e.css("width",b.width()):e.css("width",a(window).width()/2),b.css("height",e.height())}Materialize.updateTextFields=function(){var b="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";a(b).each(function(b,c){a(c).val().length>0||c.autofocus||void 0!==a(this).attr("placeholder")||a(c)[0].validity.badInput===!0?a(this).siblings("label").addClass("active"):a(this).siblings("label").removeClass("active")})};var c="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";a(document).on("change",c,function(){(0!==a(this).val().length||void 0!==a(this).attr("placeholder"))&&a(this).siblings("label").addClass("active"),validate_field(a(this))}),a(document).ready(function(){Materialize.updateTextFields()}),a(document).on("reset",function(b){var d=a(b.target);d.is("form")&&(d.find(c).removeClass("valid").removeClass("invalid"),d.find(c).each(function(){""===a(this).attr("value")&&a(this).siblings("label").removeClass("active")}),d.find("select.initialized").each(function(){var a=d.find("option[selected]").text();d.siblings("input.select-dropdown").val(a)}))}),a(document).on("focus",c,function(){a(this).siblings("label, .prefix").addClass("active")}),a(document).on("blur",c,function(){var b=a(this),c=".prefix";0===b.val().length&&b[0].validity.badInput!==!0&&void 0===b.attr("placeholder")&&(c+=", label"),b.siblings(c).removeClass("active"),validate_field(b)}),window.validate_field=function(a){var b=void 0!==a.attr("length"),c=parseInt(a.attr("length")),d=a.val().length;0===a.val().length&&a[0].validity.badInput===!1?a.hasClass("validate")&&(a.removeClass("valid"),a.removeClass("invalid")):a.hasClass("validate")&&(a.is(":valid")&&b&&c>=d||a.is(":valid")&&!b?(a.removeClass("invalid"),a.addClass("valid")):(a.removeClass("valid"),a.addClass("invalid")))};var d="input[type=radio], input[type=checkbox]";a(document).on("keyup.radio",d,function(b){if(9===b.which){a(this).addClass("tabbed");var c=a(this);return void c.one("blur",function(b){a(this).removeClass("tabbed")})}});var e=a(".hiddendiv").first();e.length||(e=a('
        '),a("body").append(e));var f=".materialize-textarea";a(f).each(function(){var c=a(this);c.val().length&&b(c)}),a("body").on("keyup keydown autoresize",f,function(){b(a(this))}),a(document).on("change",'.file-field input[type="file"]',function(){for(var b=a(this).closest(".file-field"),c=b.find("input.file-path"),d=a(this)[0].files,e=[],f=0;f
        ');a(this).after(b)});var j=".range-field";a(document).on("change",h,function(b){var c=a(this).siblings(".thumb");c.find(".value").html(a(this).val())}),a(document).on("input mousedown touchstart",h,function(b){var c=a(this).siblings(".thumb"),d=a(this).outerWidth();c.length<=0&&(c=a(''),a(this).after(c)),c.find(".value").html(a(this).val()),i=!0,a(this).addClass("active"),c.hasClass("active")||c.velocity({height:"30px",width:"30px",top:"-20px",marginLeft:"-15px"},{duration:300,easing:"easeOutExpo"}),"input"!==b.type&&(g=void 0===b.pageX||null===b.pageX?b.originalEvent.touches[0].pageX-a(this).offset().left:b.pageX-a(this).offset().left,0>g?g=0:g>d&&(g=d),c.addClass("active").css("left",g)),c.find(".value").html(a(this).val())}),a(document).on("mouseup touchend",j,function(){i=!1,a(this).removeClass("active")}),a(document).on("mousemove touchmove",j,function(b){var c,d=a(this).children(".thumb");if(i){d.hasClass("active")||d.velocity({height:"30px",width:"30px",top:"-20px",marginLeft:"-15px"},{duration:300,easing:"easeOutExpo"}),c=void 0===b.pageX||null===b.pageX?b.originalEvent.touches[0].pageX-a(this).offset().left:b.pageX-a(this).offset().left;var e=a(this).outerWidth();0>c?c=0:c>e&&(c=e),d.addClass("active").css("left",c),d.find(".value").html(d.siblings(h).val())}}),a(document).on("mouseout touchleave",j,function(){if(!i){var b=a(this).children(".thumb");b.hasClass("active")&&b.velocity({height:"0",width:"0",top:"10px",marginLeft:"-6px"},{duration:100}),b.removeClass("active")}}),a.fn.autocomplete=function(b){var c={data:{}};return b=a.extend(c,b),this.each(function(){var c=a(this),d=b.data,e=c.closest(".input-field");if(!a.isEmptyObject(d)){var f=a('');e.length?e.append(f):c.after(f);var g=function(a,b){var c=b.find("img"),d=b.text().toLowerCase().indexOf(""+a.toLowerCase()),e=d+a.length-1,f=b.text().slice(0,d),g=b.text().slice(d,e+1),h=b.text().slice(e+1);b.html(""+f+""+g+""+h+""),c.length&&b.prepend(c)};c.on("keyup",function(b){if(13===b.which)return void f.find("li").first().click();var e=c.val().toLowerCase();if(f.empty(),""!==e)for(var h in d)if(d.hasOwnProperty(h)&&-1!==h.toLowerCase().indexOf(e)&&h.toLowerCase()!==e){var i=a("
      • ");d[h]?i.append(''+h+""):i.append(""+h+""),f.append(i),g(e,i)}}),f.on("click","li",function(){c.val(a(this).text().trim()),c.trigger("change"),f.empty()})}})}}),a.fn.material_select=function(b){function c(a,b,c){var e=a.indexOf(b),f=-1===e;return f?a.push(b):a.splice(e,1),c.siblings("ul.dropdown-content").find("li").eq(b).toggleClass("active"),c.find("option").eq(b).prop("selected",f),d(a,c),f}function d(a,b){for(var c="",d=0,e=a.length;e>d;d++){var f=b.find("option").eq(a[d]).text();c+=0===d?f:", "+f}""===c&&(c=b.find("option:disabled").eq(0).text()),b.siblings("input.select-dropdown").val(c)}a(this).each(function(){var d=a(this);if(!d.hasClass("browser-default")){var e=d.attr("multiple")?!0:!1,f=d.data("select-id");if(f&&(d.parent().find("span.caret").remove(),d.parent().find("input").remove(),d.unwrap(),a("ul#select-options-"+f).remove()),"destroy"===b)return void d.data("select-id",null).removeClass("initialized");var g=Materialize.guid();d.data("select-id",g);var h=a('
        ');h.addClass(d.attr("class"));var i=a(''),j=d.children("option, optgroup"),k=[],l=!1,m=d.find("option:selected").html()||d.find("option:first").html()||"",n=function(b,c,d){var e=c.is(":disabled")?"disabled ":"",f="optgroup-option"===d?"optgroup-option ":"",g=c.data("icon"),h=c.attr("class");if(g){var j="";return h&&(j=' class="'+h+'"'),"multiple"===d?i.append(a('
      • "+c.html()+"
      • ")):i.append(a('
      • "+c.html()+"
      • ")),!0}"multiple"===d?i.append(a('
      • "+c.html()+"
      • ")):i.append(a('
      • '+c.html()+"
      • "))};j.length&&j.each(function(){if(a(this).is("option"))e?n(d,a(this),"multiple"):n(d,a(this));else if(a(this).is("optgroup")){var b=a(this).children("option");i.append(a('
      • '+a(this).attr("label")+"
      • ")),b.each(function(){n(d,a(this),"optgroup-option")})}}),i.find("li:not(.optgroup)").each(function(f){a(this).click(function(g){if(!a(this).hasClass("disabled")&&!a(this).hasClass("optgroup")){ +var h=!0;e?(a('input[type="checkbox"]',this).prop("checked",function(a,b){return!b}),h=c(k,a(this).index(),d),q.trigger("focus")):(i.find("li").removeClass("active"),a(this).toggleClass("active"),q.val(a(this).text())),r(i,a(this)),d.find("option").eq(f).prop("selected",h),d.trigger("change"),"undefined"!=typeof b&&b()}g.stopPropagation()})}),d.wrap(h);var o=a('');d.is(":disabled")&&o.addClass("disabled");var p=m.replace(/"/g,"""),q=a('');d.before(q),q.before(o),q.after(i),d.is(":disabled")||q.dropdown({hover:!1,closeOnClick:!1}),d.attr("tabindex")&&a(q[0]).attr("tabindex",d.attr("tabindex")),d.addClass("initialized"),q.on({focus:function(){if(a("ul.select-dropdown").not(i[0]).is(":visible")&&a("input.select-dropdown").trigger("close"),!i.is(":visible")){a(this).trigger("open",["focus"]);var b=a(this).val(),c=i.find("li").filter(function(){return a(this).text().toLowerCase()===b.toLowerCase()})[0];r(i,c)}},click:function(a){a.stopPropagation()}}),q.on("blur",function(){e||a(this).trigger("close"),i.find("li.selected").removeClass("selected")}),i.hover(function(){l=!0},function(){l=!1}),a(window).on({click:function(){e&&(l||q.trigger("close"))}}),e&&d.find("option:selected:not(:disabled)").each(function(){var b=a(this).index();c(k,b,d),i.find("li").eq(b).find(":checkbox").prop("checked",!0)});var r=function(b,c){if(c){b.find("li.selected").removeClass("selected");var d=a(c);d.addClass("selected"),i.scrollTo(d)}},s=[],t=function(b){if(9==b.which)return void q.trigger("close");if(40==b.which&&!i.is(":visible"))return void q.trigger("open");if(13!=b.which||i.is(":visible")){b.preventDefault();var c=String.fromCharCode(b.which).toLowerCase(),d=[9,13,27,38,40];if(c&&-1===d.indexOf(b.which)){s.push(c);var f=s.join(""),g=i.find("li").filter(function(){return 0===a(this).text().toLowerCase().indexOf(f)})[0];g&&r(i,g)}if(13==b.which){var h=i.find("li.selected:not(.disabled)")[0];h&&(a(h).trigger("click"),e||q.trigger("close"))}40==b.which&&(g=i.find("li.selected").length?i.find("li.selected").next("li:not(.disabled)")[0]:i.find("li:not(.disabled)")[0],r(i,g)),27==b.which&&q.trigger("close"),38==b.which&&(g=i.find("li.selected").prev("li:not(.disabled)")[0],g&&r(i,g)),setTimeout(function(){s=[]},1e3)}};q.on("keydown",t)}})}}(jQuery),function(a){var b={init:function(b){var c={indicators:!0,height:400,transition:500,interval:6e3};return b=a.extend(c,b),this.each(function(){function c(a,b){a.hasClass("center-align")?a.velocity({opacity:0,translateY:-100},{duration:b,queue:!1}):a.hasClass("right-align")?a.velocity({opacity:0,translateX:100},{duration:b,queue:!1}):a.hasClass("left-align")&&a.velocity({opacity:0,translateX:-100},{duration:b,queue:!1})}function d(a){a>=j.length?a=0:0>a&&(a=j.length-1),k=i.find(".active").index(),k!=a&&(e=j.eq(k),$caption=e.find(".caption"),e.removeClass("active"),e.velocity({opacity:0},{duration:b.transition,queue:!1,easing:"easeOutQuad",complete:function(){j.not(".active").velocity({opacity:0,translateX:0,translateY:0},{duration:0,queue:!1})}}),c($caption,b.transition),b.indicators&&f.eq(k).removeClass("active"),j.eq(a).velocity({opacity:1},{duration:b.transition,queue:!1,easing:"easeOutQuad"}),j.eq(a).find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:b.transition,delay:b.transition,queue:!1,easing:"easeOutQuad"}),j.eq(a).addClass("active"),b.indicators&&f.eq(a).addClass("active"))}var e,f,g,h=a(this),i=h.find("ul.slides").first(),j=i.find("> li"),k=i.find(".active").index();-1!=k&&(e=j.eq(k)),h.hasClass("fullscreen")||(b.indicators?h.height(b.height+40):h.height(b.height),i.height(b.height)),j.find(".caption").each(function(){c(a(this),0)}),j.find("img").each(function(){var b="data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==";a(this).attr("src")!==b&&(a(this).css("background-image","url("+a(this).attr("src")+")"),a(this).attr("src",b))}),b.indicators&&(f=a('
          '),j.each(function(c){var e=a('
        • ');e.click(function(){var c=i.parent(),e=c.find(a(this)).index();d(e),clearInterval(g),g=setInterval(function(){k=i.find(".active").index(),j.length==k+1?k=0:k+=1,d(k)},b.transition+b.interval)}),f.append(e)}),h.append(f),f=h.find("ul.indicators").find("li.indicator-item")),e?e.show():(j.first().addClass("active").velocity({opacity:1},{duration:b.transition,queue:!1,easing:"easeOutQuad"}),k=0,e=j.eq(k),b.indicators&&f.eq(k).addClass("active")),e.find("img").each(function(){e.find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:b.transition,queue:!1,easing:"easeOutQuad"})}),g=setInterval(function(){k=i.find(".active").index(),d(k+1)},b.transition+b.interval);var l=!1,m=!1,n=!1;h.hammer({prevent_default:!1}).bind("pan",function(a){if("touch"===a.gesture.pointerType){clearInterval(g);var b=a.gesture.direction,c=a.gesture.deltaX,d=a.gesture.velocityX;$curr_slide=i.find(".active"),$curr_slide.velocity({translateX:c},{duration:50,queue:!1,easing:"easeOutQuad"}),4===b&&(c>h.innerWidth()/2||-.65>d)?n=!0:2===b&&(c<-1*h.innerWidth()/2||d>.65)&&(m=!0);var e;m&&(e=$curr_slide.next(),0===e.length&&(e=j.first()),e.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"})),n&&(e=$curr_slide.prev(),0===e.length&&(e=j.last()),e.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"}))}}).bind("panend",function(a){"touch"===a.gesture.pointerType&&($curr_slide=i.find(".active"),l=!1,curr_index=i.find(".active").index(),!n&&!m||j.length<=1?$curr_slide.velocity({translateX:0},{duration:300,queue:!1,easing:"easeOutQuad"}):m?(d(curr_index+1),$curr_slide.velocity({translateX:-1*h.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})):n&&(d(curr_index-1),$curr_slide.velocity({translateX:h.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})),m=!1,n=!1,clearInterval(g),g=setInterval(function(){k=i.find(".active").index(),j.length==k+1?k=0:k+=1,d(k)},b.transition+b.interval))}),h.on("sliderPause",function(){clearInterval(g)}),h.on("sliderStart",function(){clearInterval(g),g=setInterval(function(){k=i.find(".active").index(),j.length==k+1?k=0:k+=1,d(k)},b.transition+b.interval)}),h.on("sliderNext",function(){k=i.find(".active").index(),d(k+1)}),h.on("sliderPrev",function(){k=i.find(".active").index(),d(k-1)})})},pause:function(){a(this).trigger("sliderPause")},start:function(){a(this).trigger("sliderStart")},next:function(){a(this).trigger("sliderNext")},prev:function(){a(this).trigger("sliderPrev")}};a.fn.slider=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.tooltip"):b.init.apply(this,arguments)}}(jQuery),function(a){a(document).ready(function(){a(document).on("click.card",".card",function(b){a(this).find("> .card-reveal").length&&(a(b.target).is(a(".card-reveal .card-title"))||a(b.target).is(a(".card-reveal .card-title i"))?a(this).find(".card-reveal").velocity({translateY:0},{duration:225,queue:!1,easing:"easeInOutQuad",complete:function(){a(this).css({display:"none"})}}):(a(b.target).is(a(".card .activator"))||a(b.target).is(a(".card .activator i")))&&(a(b.target).closest(".card").css("overflow","hidden"),a(this).find(".card-reveal").css({display:"block"}).velocity("stop",!1).velocity({translateY:"-100%"},{duration:300,queue:!1,easing:"easeInOutQuad"})))})})}(jQuery),function(a){var b=!1,c={data:[],placeholder:"",secondaryPlaceholder:""};a(document).ready(function(){a(document).on("click",".chip .close",function(b){var c=a(this).closest(".chips");c.attr("data-initialized")||a(this).closest(".chip").remove()})}),a.fn.material_chip=function(d){var e=this;if(this.$el=a(this),this.$document=a(document),this.SELS={CHIPS:".chips",CHIP:".chip",INPUT:"input",DELETE:".material-icons",SELECTED_CHIP:".selected"},"data"===d)return this.$el.data("chips");var f=a.extend({},c,d);this.init=function(){var b=0;e.$el.each(function(){var c=a(this),d=Materialize.guid();f.data&&f.data instanceof Array||(f.data=[]),c.data("chips",f.data),c.attr("data-index",b),c.attr("data-initialized",!0),c.hasClass(e.SELS.CHIPS)||c.addClass("chips"),e.chips(c,d),b++})},this.handleEvents=function(){var b=e.SELS;e.$document.off("click.chips-focus",b.CHIPS).on("click.chips-focus",b.CHIPS,function(c){a(c.target).find(b.INPUT).focus()}),e.$document.off("click.chips-select",b.CHIP).on("click.chips-select",b.CHIP,function(c){a(b.CHIP).removeClass("selected"),a(this).toggleClass("selected")}),e.$document.off("keydown.chips").on("keydown.chips",function(c){if(!a(c.target).is("input, textarea")){var d,f=e.$document.find(b.CHIP+b.SELECTED_CHIP),g=f.closest(b.CHIPS),h=f.siblings(b.CHIP).length;if(f.length)if(8===c.which||46===c.which){c.preventDefault(),d=f.index(),e.deleteChip(d,g);var i=null;h>d+1?i=d:(d===h||d+1===h)&&(i=h-1),0>i&&(i=null),null!==i&&e.selectChip(i,g),h||g.find("input").focus()}else if(37===c.which){if(d=f.index()-1,0>d)return;a(b.CHIP).removeClass("selected"),e.selectChip(d,g)}else if(39===c.which){if(d=f.index()+1,a(b.CHIP).removeClass("selected"),d>h)return void g.find("input").focus();e.selectChip(d,g)}}}),e.$document.off("focusin.chips",b.CHIPS+" "+b.INPUT).on("focusin.chips",b.CHIPS+" "+b.INPUT,function(c){var d=a(c.target).closest(b.CHIPS);d.addClass("focus"),d.siblings("label, .prefix").addClass("active"),a(b.CHIP).removeClass("selected")}),e.$document.off("focusout.chips",b.CHIPS+" "+b.INPUT).on("focusout.chips",b.CHIPS+" "+b.INPUT,function(c){var d=a(c.target).closest(b.CHIPS);d.removeClass("focus"),d.data("chips").length||d.siblings("label").removeClass("active"),d.siblings(".prefix").removeClass("active")}),e.$document.off("keydown.chips-add",b.CHIPS+" "+b.INPUT).on("keydown.chips-add",b.CHIPS+" "+b.INPUT,function(c){var d=a(c.target),f=d.closest(b.CHIPS),g=f.children(b.CHIP).length;return 13===c.which?(c.preventDefault(),e.addChip({tag:d.val()},f),void d.val("")):8!==c.keyCode&&37!==c.keyCode||""!==d.val()||!g?void 0:(e.selectChip(g-1,f),void d.blur())}),e.$document.off("click.chips-delete",b.CHIPS+" "+b.DELETE).on("click.chips-delete",b.CHIPS+" "+b.DELETE,function(c){var d=a(c.target),f=d.closest(b.CHIPS),g=d.closest(b.CHIP);c.stopPropagation(),e.deleteChip(g.index(),f),f.find("input").focus()})},this.chips=function(a,b){var c="";a.data("chips").forEach(function(a){c+=e.renderChip(a)}),c+='',a.html(c),e.setPlaceholder(a);var d=a.next("label");d.length&&(d.attr("for",b),a.data("chips").length&&d.addClass("active"))},this.renderChip=function(a){if(a.tag){var b='
          '+a.tag;return a.image&&(b+=' '),b+='close',b+="
          "}},this.setPlaceholder=function(a){a.data("chips").length&&f.placeholder?a.find("input").prop("placeholder",f.placeholder):!a.data("chips").length&&f.secondaryPlaceholder&&a.find("input").prop("placeholder",f.secondaryPlaceholder)},this.isValid=function(a,b){for(var c=a.data("chips"),d=!1,e=0;e=e&&!a(this).hasClass("pinned")&&(c(a(this)),a(this).css("top",b.offset),a(this).addClass("pinned")),eb.bottom&&!a(this).hasClass("pin-bottom")&&(c(a(this)),a(this).addClass("pin-bottom"),a(this).css("top",b.bottom-g))})}var e=Materialize.guid(),f=a(this),g=a(this).offset().top;a(this).data("pushpin-id",e),d(f,a(window).scrollTop()),a(window).on("scroll."+e,function(){var c=a(window).scrollTop()+b.offset;d(f,c)})}))}}(jQuery),function(a){a(document).ready(function(){a.fn.reverse=[].reverse,a(document).on("mouseenter.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(c){var d=a(this);b(d)}),a(document).on("mouseleave.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(b){var d=a(this);c(d)}),a(document).on("click.fabClickToggle",".fixed-action-btn.click-to-toggle > a",function(d){var e=a(this),f=e.parent();f.hasClass("active")?c(f):b(f)}),a(document).on("click.fabToolbar",".fixed-action-btn.toolbar > a",function(b){var c=a(this),e=c.parent();d(e)})}),a.fn.extend({openFAB:function(){b(a(this))},closeFAB:function(){c(a(this))},openToolbar:function(){d(a(this))},closeToolbar:function(){e(a(this))}});var b=function(b){var c=b;if(c.hasClass("active")===!1){var d,e,f=c.hasClass("horizontal");f===!0?e=40:d=40,c.addClass("active"),c.find("ul .btn-floating").velocity({scaleY:".4",scaleX:".4",translateY:d+"px",translateX:e+"px"},{duration:0});var g=0;c.find("ul .btn-floating").reverse().each(function(){a(this).velocity({opacity:"1",scaleX:"1",scaleY:"1",translateY:"0",translateX:"0"},{duration:80,delay:g}),g+=40})}},c=function(a){var b,c,d=a,e=d.hasClass("horizontal");e===!0?c=40:b=40,d.removeClass("active");d.find("ul .btn-floating").velocity("stop",!0),d.find("ul .btn-floating").velocity({opacity:"0",scaleX:".4",scaleY:".4",translateY:b+"px",translateX:c+"px"},{duration:80})},d=function(b){if("true"!==b.attr("data-open")){var c,d,f,g=window.innerWidth,h=window.innerHeight,i=b[0].getBoundingClientRect(),j=b.find("> a").first(),k=b.find("> ul").first(),l=a('
          '),m=j.css("background-color");j.append(l),c=i.left-g/2+i.width/2,d=h-i.bottom,f=g/l.width(),b.attr("data-origin-bottom",i.bottom),b.attr("data-origin-left",i.left),b.attr("data-origin-width",i.width),b.addClass("active"),b.attr("data-open",!0),b.css({"text-align":"center",width:"100%",bottom:0,left:0,transform:"translateX("+c+"px)",transition:"none"}),j.css({transform:"translateY("+-d+"px)",transition:"none"}),l.css({"background-color":m}),setTimeout(function(){b.css({transform:"",transition:"transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s"}),j.css({overflow:"visible",transform:"",transition:"transform .2s"}),setTimeout(function(){b.css({overflow:"hidden","background-color":m}),l.css({transform:"scale("+f+")",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"}),k.find("> li > a").css({opacity:1}),a(window).on("scroll.fabToolbarClose",function(){e(b),a(window).off("scroll.fabToolbarClose"),a(document).off("click.fabToolbarClose")}),a(document).on("click.fabToolbarClose",function(c){a(c.target).closest(k).length||(e(b),a(window).off("scroll.fabToolbarClose"),a(document).off("click.fabToolbarClose"))})},100)},0)}},e=function(a){if("true"===a.attr("data-open")){var b,c,d,e=window.innerWidth,f=window.innerHeight,g=a.attr("data-origin-width"),h=a.attr("data-origin-bottom"),i=a.attr("data-origin-left"),j=a.find("> .btn-floating").first(),k=a.find("> ul").first(),l=a.find(".fab-backdrop"),m=j.css("background-color");b=i-e/2+g/2,c=f-h,d=e/l.width(),a.removeClass("active"),a.attr("data-open",!1),a.css({"background-color":"transparent",transition:"none"}),j.css({transition:"none"}),l.css({transform:"scale(0)","background-color":m}),k.find("> li > a").css({opacity:""}),setTimeout(function(){l.remove(),a.css({"text-align":"",width:"",bottom:"",left:"",overflow:"","background-color":"",transform:"translate3d("+-b+"px,0,0)"}),j.css({overflow:"",transform:"translate3d(0,"+c+"px,0)"}),setTimeout(function(){a.css({transform:"translate3d(0,0,0)",transition:"transform .2s"}),j.css({transform:"translate3d(0,0,0)",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"})},20)},200)}}}(jQuery),function(a){Materialize.fadeInImage=function(b){var c;if("string"==typeof b)c=a(b);else{if("object"!=typeof b)return;c=b}c.css({opacity:0}),a(c).velocity({opacity:1},{duration:650,queue:!1,easing:"easeOutSine"}),a(c).velocity({opacity:1},{duration:1300,queue:!1,easing:"swing",step:function(b,c){c.start=100;var d=b/100,e=150-(100-b)/1.75;100>e&&(e=100),b>=0&&a(this).css({"-webkit-filter":"grayscale("+d+")brightness("+e+"%)",filter:"grayscale("+d+")brightness("+e+"%)"})}})},Materialize.showStaggeredList=function(b){var c;if("string"==typeof b)c=a(b);else{if("object"!=typeof b)return;c=b}var d=0;c.find("li").velocity({translateX:"-100px"},{duration:0}),c.find("li").each(function(){a(this).velocity({opacity:"1",translateX:"0"},{duration:800,delay:d,easing:[60,10]}),d+=120})},a(document).ready(function(){var b=!1,c=!1;a(".dismissable").each(function(){a(this).hammer({prevent_default:!1}).bind("pan",function(d){if("touch"===d.gesture.pointerType){var e=a(this),f=d.gesture.direction,g=d.gesture.deltaX,h=d.gesture.velocityX;e.velocity({translateX:g},{duration:50,queue:!1,easing:"easeOutQuad"}),4===f&&(g>e.innerWidth()/2||-.75>h)&&(b=!0),2===f&&(g<-1*e.innerWidth()/2||h>.75)&&(c=!0)}}).bind("panend",function(d){if(Math.abs(d.gesture.deltaX)j+g&&e.done!==!0){if("function"==typeof h)h.call(this,i);else if("string"==typeof h){var k=new Function(h);k(i)}e.done=!0}}}}},100)}}(jQuery),function(a){"function"==typeof define&&define.amd?define("picker",["jquery"],a):"object"==typeof exports?module.exports=a(require("jquery")):this.Picker=a(jQuery)}(function(a){function b(f,g,i,l){function m(){return b._.node("div",b._.node("div",b._.node("div",b._.node("div",y.component.nodes(t.open),v.box),v.wrap),v.frame),v.holder)}function n(){w.data(g,y).addClass(v.input).attr("tabindex",-1).val(w.data("value")?y.get("select",u.format):f.value),u.editable||w.on("focus."+t.id+" click."+t.id,function(a){a.preventDefault(),y.$root.eq(0).focus()}).on("keydown."+t.id,q),e(f,{haspopup:!0,expanded:!1,readonly:!1,owns:f.id+"_root"})}function o(){y.$root.on({keydown:q,focusin:function(a){y.$root.removeClass(v.focused),a.stopPropagation()},"mousedown click":function(b){var c=b.target;c!=y.$root.children()[0]&&(b.stopPropagation(),"mousedown"!=b.type||a(c).is("input, select, textarea, button, option")||(b.preventDefault(),y.$root.eq(0).focus()))}}).on({focus:function(){w.addClass(v.target)},blur:function(){w.removeClass(v.target)}}).on("focus.toOpen",r).on("click","[data-pick], [data-nav], [data-clear], [data-close]",function(){var b=a(this),c=b.data(),d=b.hasClass(v.navDisabled)||b.hasClass(v.disabled),e=h();e=e&&(e.type||e.href),(d||e&&!a.contains(y.$root[0],e))&&y.$root.eq(0).focus(),!d&&c.nav?y.set("highlight",y.component.item.highlight,{nav:c.nav}):!d&&"pick"in c?y.set("select",c.pick):c.clear?y.clear().close(!0):c.close&&y.close(!0)}),e(y.$root[0],"hidden",!0)}function p(){var b;u.hiddenName===!0?(b=f.name,f.name=""):(b=["string"==typeof u.hiddenPrefix?u.hiddenPrefix:"","string"==typeof u.hiddenSuffix?u.hiddenSuffix:"_submit"],b=b[0]+f.name+b[1]),y._hidden=a('")[0],w.on("change."+t.id,function(){y._hidden.value=f.value?y.get("select",u.formatSubmit):""}),u.container?a(u.container).append(y._hidden):w.after(y._hidden)}function q(a){var b=a.keyCode,c=/^(8|46)$/.test(b);return 27==b?(y.close(),!1):void((32==b||c||!t.open&&y.component.key[b])&&(a.preventDefault(),a.stopPropagation(),c?y.clear().close():y.open()))}function r(a){a.stopPropagation(),"focus"==a.type&&y.$root.addClass(v.focused),y.open()}if(!f)return b;var s=!1,t={id:f.id||"P"+Math.abs(~~(Math.random()*new Date))},u=i?a.extend(!0,{},i.defaults,l):l||{},v=a.extend({},b.klasses(),u.klass),w=a(f),x=function(){return this.start()},y=x.prototype={constructor:x,$node:w,start:function(){return t&&t.start?y:(t.methods={},t.start=!0,t.open=!1,t.type=f.type,f.autofocus=f==h(),f.readOnly=!u.editable,f.id=f.id||t.id,"text"!=f.type&&(f.type="text"),y.component=new i(y,u),y.$root=a(b._.node("div",m(),v.picker,'id="'+f.id+'_root" tabindex="0"')),o(),u.formatSubmit&&p(),n(),u.container?a(u.container).append(y.$root):w.after(y.$root),y.on({start:y.component.onStart,render:y.component.onRender,stop:y.component.onStop,open:y.component.onOpen,close:y.component.onClose,set:y.component.onSet}).on({start:u.onStart,render:u.onRender,stop:u.onStop,open:u.onOpen,close:u.onClose,set:u.onSet}),s=c(y.$root.children()[0]),f.autofocus&&y.open(),y.trigger("start").trigger("render"))},render:function(a){return a?y.$root.html(m()):y.$root.find("."+v.box).html(y.component.nodes(t.open)),y.trigger("render")},stop:function(){return t.start?(y.close(),y._hidden&&y._hidden.parentNode.removeChild(y._hidden),y.$root.remove(),w.removeClass(v.input).removeData(g),setTimeout(function(){w.off("."+t.id)},0),f.type=t.type,f.readOnly=!1,y.trigger("stop"),t.methods={},t.start=!1,y):y},open:function(c){return t.open?y:(w.addClass(v.active),e(f,"expanded",!0),setTimeout(function(){y.$root.addClass(v.opened),e(y.$root[0],"hidden",!1)},0),c!==!1&&(t.open=!0,s&&k.css("overflow","hidden").css("padding-right","+="+d()),y.$root.eq(0).focus(),j.on("click."+t.id+" focusin."+t.id,function(a){var b=a.target;b!=f&&b!=document&&3!=a.which&&y.close(b===y.$root.children()[0])}).on("keydown."+t.id,function(c){var d=c.keyCode,e=y.component.key[d],f=c.target;27==d?y.close(!0):f!=y.$root[0]||!e&&13!=d?a.contains(y.$root[0],f)&&13==d&&(c.preventDefault(),f.click()):(c.preventDefault(),e?b._.trigger(y.component.key.go,y,[b._.trigger(e)]):y.$root.find("."+v.highlighted).hasClass(v.disabled)||y.set("select",y.component.item.highlight).close())})),y.trigger("open"))},close:function(a){return a&&(y.$root.off("focus.toOpen").eq(0).focus(),setTimeout(function(){y.$root.on("focus.toOpen",r)},0)),w.removeClass(v.active),e(f,"expanded",!1),setTimeout(function(){y.$root.removeClass(v.opened+" "+v.focused),e(y.$root[0],"hidden",!0)},0),t.open?(t.open=!1,s&&k.css("overflow","").css("padding-right","-="+d()),j.off("."+t.id),y.trigger("close")):y},clear:function(a){return y.set("clear",null,a)},set:function(b,c,d){var e,f,g=a.isPlainObject(b),h=g?b:{};if(d=g&&a.isPlainObject(c)?c:d||{},b){g||(h[b]=c);for(e in h)f=h[e],e in y.component.item&&(void 0===f&&(f=null),y.component.set(e,f,d)),("select"==e||"clear"==e)&&w.val("clear"==e?"":y.get(e,u.format)).trigger("change");y.render()}return d.muted?y:y.trigger("set",h)},get:function(a,c){if(a=a||"value",null!=t[a])return t[a];if("valueSubmit"==a){if(y._hidden)return y._hidden.value;a="value"}if("value"==a)return f.value;if(a in y.component.item){if("string"==typeof c){var d=y.component.get(a);return d?b._.trigger(y.component.formats.toString,y.component,[c,d]):""}return y.component.get(a)}},on:function(b,c,d){var e,f,g=a.isPlainObject(b),h=g?b:{};if(b){g||(h[b]=c);for(e in h)f=h[e],d&&(e="_"+e),t.methods[e]=t.methods[e]||[],t.methods[e].push(f)}return y},off:function(){var a,b,c=arguments;for(a=0,namesCount=c.length;a').appendTo("body"),c=b[0].offsetWidth;b.css("overflow","scroll");var d=a('
          ').appendTo(b),e=d[0].offsetWidth;return b.remove(),c-e}function e(b,c,d){if(a.isPlainObject(c))for(var e in c)f(b,e,c[e]);else f(b,c,d)}function f(a,b,c){a.setAttribute(("role"==b?"":"aria-")+b,c)}function g(b,c){a.isPlainObject(b)||(b={attribute:c}),c="";for(var d in b){var e=("role"==d?"":"aria-")+d,f=b[d];c+=null==f?"":e+'="'+b[d]+'"'}return c}function h(){try{return document.activeElement}catch(a){}}var i=a(window),j=a(document),k=a(document.documentElement);return b.klasses=function(a){return a=a||"picker",{picker:a,opened:a+"--opened",focused:a+"--focused",input:a+"__input",active:a+"__input--active",target:a+"__input--target",holder:a+"__holder",frame:a+"__frame",wrap:a+"__wrap",box:a+"__box"}},b._={group:function(a){for(var c,d="",e=b._.trigger(a.min,a);e<=b._.trigger(a.max,a,[e]);e+=a.i)c=b._.trigger(a.item,a,[e]),d+=b._.node(a.node,c[0],c[1],c[2]);return d},node:function(b,c,d,e){return c?(c=a.isArray(c)?c.join(""):c,d=d?' class="'+d+'"':"",e=e?" "+e:"","<"+b+d+e+">"+c+""):""},lead:function(a){return(10>a?"0":"")+a},trigger:function(a,b,c){return"function"==typeof a?a.apply(b,c||[]):a},digits:function(a){return/\d/.test(a[1])?2:1},isDate:function(a){return{}.toString.call(a).indexOf("Date")>-1&&this.isInteger(a.getDate())},isInteger:function(a){return{}.toString.call(a).indexOf("Number")>-1&&a%1===0},ariaAttr:g},b.extend=function(c,d){a.fn[c]=function(e,f){var g=this.data(c);return"picker"==e?g:g&&"string"==typeof e?b._.trigger(g[e],g,[f]):this.each(function(){var f=a(this);f.data(c)||new b(this,c,d,e)})},a.fn[c].defaults=d.defaults},b}),function(a){"function"==typeof define&&define.amd?define(["picker","jquery"],a):"object"==typeof exports?module.exports=a(require("./picker.js"),require("jquery")):a(Picker,jQuery)}(function(a,b){function c(a,b){var c=this,d=a.$node[0],e=d.value,f=a.$node.data("value"),g=f||e,h=f?b.formatSubmit:b.format,i=function(){return d.currentStyle?"rtl"==d.currentStyle.direction:"rtl"==getComputedStyle(a.$root[0]).direction};c.settings=b,c.$node=a.$node,c.queue={min:"measure create",max:"measure create",now:"now create",select:"parse create validate",highlight:"parse navigate create validate",view:"parse create validate viewset",disable:"deactivate",enable:"activate"},c.item={},c.item.clear=null,c.item.disable=(b.disable||[]).slice(0),c.item.enable=-function(a){return a[0]===!0?a.shift():-1}(c.item.disable),c.set("min",b.min).set("max",b.max).set("now"),g?c.set("select",g,{format:h}):c.set("select",null).set("highlight",c.item.now),c.key={40:7,38:-7,39:function(){return i()?-1:1},37:function(){return i()?1:-1},go:function(a){var b=c.item.highlight,d=new Date(b.year,b.month,b.date+a);c.set("highlight",d,{interval:a}),this.render()}},a.on("render",function(){a.$root.find("."+b.klass.selectMonth).on("change",function(){var c=this.value;c&&(a.set("highlight",[a.get("view").year,c,a.get("highlight").date]),a.$root.find("."+b.klass.selectMonth).trigger("focus"))}),a.$root.find("."+b.klass.selectYear).on("change",function(){var c=this.value;c&&(a.set("highlight",[c,a.get("view").month,a.get("highlight").date]),a.$root.find("."+b.klass.selectYear).trigger("focus"))})},1).on("open",function(){var d="";c.disabled(c.get("now"))&&(d=":not(."+b.klass.buttonToday+")"),a.$root.find("button"+d+", select").attr("disabled",!1)},1).on("close",function(){a.$root.find("button, select").attr("disabled",!0)},1)}var d=7,e=6,f=a._;c.prototype.set=function(a,b,c){var d=this,e=d.item;return null===b?("clear"==a&&(a="select"),e[a]=b,d):(e["enable"==a?"disable":"flip"==a?"enable":a]=d.queue[a].split(" ").map(function(e){return b=d[e](a,b,c)}).pop(),"select"==a?d.set("highlight",e.select,c):"highlight"==a?d.set("view",e.highlight,c):a.match(/^(flip|min|max|disable|enable)$/)&&(e.select&&d.disabled(e.select)&&d.set("select",e.select,c),e.highlight&&d.disabled(e.highlight)&&d.set("highlight",e.highlight,c)),d)},c.prototype.get=function(a){return this.item[a]},c.prototype.create=function(a,c,d){var e,g=this;return c=void 0===c?a:c,c==-(1/0)||c==1/0?e=c:b.isPlainObject(c)&&f.isInteger(c.pick)?c=c.obj:b.isArray(c)?(c=new Date(c[0],c[1],c[2]),c=f.isDate(c)?c:g.create().obj):c=f.isInteger(c)||f.isDate(c)?g.normalize(new Date(c),d):g.now(a,c,d),{year:e||c.getFullYear(),month:e||c.getMonth(),date:e||c.getDate(),day:e||c.getDay(),obj:e||c,pick:e||c.getTime()}},c.prototype.createRange=function(a,c){var d=this,e=function(a){return a===!0||b.isArray(a)||f.isDate(a)?d.create(a):a};return f.isInteger(a)||(a=e(a)),f.isInteger(c)||(c=e(c)),f.isInteger(a)&&b.isPlainObject(c)?a=[c.year,c.month,c.date+a]:f.isInteger(c)&&b.isPlainObject(a)&&(c=[a.year,a.month,a.date+c]),{from:e(a),to:e(c)}},c.prototype.withinRange=function(a,b){return a=this.createRange(a.from,a.to),b.pick>=a.from.pick&&b.pick<=a.to.pick},c.prototype.overlapRanges=function(a,b){var c=this;return a=c.createRange(a.from,a.to),b=c.createRange(b.from,b.to),c.withinRange(a,b.from)||c.withinRange(a,b.to)||c.withinRange(b,a.from)||c.withinRange(b,a.to)},c.prototype.now=function(a,b,c){return b=new Date,c&&c.rel&&b.setDate(b.getDate()+c.rel),this.normalize(b,c)},c.prototype.navigate=function(a,c,d){var e,f,g,h,i=b.isArray(c),j=b.isPlainObject(c),k=this.item.view;if(i||j){for(j?(f=c.year,g=c.month,h=c.date):(f=+c[0],g=+c[1],h=+c[2]),d&&d.nav&&k&&k.month!==g&&(f=k.year,g=k.month),e=new Date(f,g+(d&&d.nav?d.nav:0),1),f=e.getFullYear(),g=e.getMonth();new Date(f,g,h).getMonth()!==g;)h-=1;c=[f,g,h]}return c},c.prototype.normalize=function(a){return a.setHours(0,0,0,0),a},c.prototype.measure=function(a,b){var c=this;return b?"string"==typeof b?b=c.parse(a,b):f.isInteger(b)&&(b=c.now(a,b,{rel:b})):b="min"==a?-(1/0):1/0,b},c.prototype.viewset=function(a,b){return this.create([b.year,b.month,1])},c.prototype.validate=function(a,c,d){var e,g,h,i,j=this,k=c,l=d&&d.interval?d.interval:1,m=-1===j.item.enable,n=j.item.min,o=j.item.max,p=m&&j.item.disable.filter(function(a){if(b.isArray(a)){var d=j.create(a).pick;dc.pick&&(g=!0)}return f.isInteger(a)}).length;if((!d||!d.nav)&&(!m&&j.disabled(c)||m&&j.disabled(c)&&(p||e||g)||!m&&(c.pick<=n.pick||c.pick>=o.pick)))for(m&&!p&&(!g&&l>0||!e&&0>l)&&(l*=-1);j.disabled(c)&&(Math.abs(l)>1&&(c.monthk.month)&&(c=k,l=l>0?1:-1),c.pick<=n.pick?(h=!0,l=1,c=j.create([n.year,n.month,n.date+(c.pick===n.pick?0:-1)])):c.pick>=o.pick&&(i=!0,l=-1,c=j.create([o.year,o.month,o.date+(c.pick===o.pick?0:1)])),!h||!i);)c=j.create([c.year,c.month,c.date+l]);return c},c.prototype.disabled=function(a){var c=this,d=c.item.disable.filter(function(d){return f.isInteger(d)?a.day===(c.settings.firstDay?d:d-1)%7:b.isArray(d)||f.isDate(d)?a.pick===c.create(d).pick:b.isPlainObject(d)?c.withinRange(d,a):void 0; +});return d=d.length&&!d.filter(function(a){return b.isArray(a)&&"inverted"==a[3]||b.isPlainObject(a)&&a.inverted}).length,-1===c.item.enable?!d:d||a.pickc.item.max.pick},c.prototype.parse=function(a,b,c){var d=this,e={};return b&&"string"==typeof b?(c&&c.format||(c=c||{},c.format=d.settings.format),d.formats.toArray(c.format).map(function(a){var c=d.formats[a],g=c?f.trigger(c,d,[b,e]):a.replace(/^!/,"").length;c&&(e[a]=b.substr(0,g)),b=b.substr(g)}),[e.yyyy||e.yy,+(e.mm||e.m)-1,e.dd||e.d]):b},c.prototype.formats=function(){function a(a,b,c){var d=a.match(/\w+/)[0];return c.mm||c.m||(c.m=b.indexOf(d)+1),d.length}function b(a){return a.match(/\w+/)[0].length}return{d:function(a,b){return a?f.digits(a):b.date},dd:function(a,b){return a?2:f.lead(b.date)},ddd:function(a,c){return a?b(a):this.settings.weekdaysShort[c.day]},dddd:function(a,c){return a?b(a):this.settings.weekdaysFull[c.day]},m:function(a,b){return a?f.digits(a):b.month+1},mm:function(a,b){return a?2:f.lead(b.month+1)},mmm:function(b,c){var d=this.settings.monthsShort;return b?a(b,d,c):d[c.month]},mmmm:function(b,c){var d=this.settings.monthsFull;return b?a(b,d,c):d[c.month]},yy:function(a,b){return a?2:(""+b.year).slice(2)},yyyy:function(a,b){return a?4:b.year},toArray:function(a){return a.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)},toString:function(a,b){var c=this;return c.formats.toArray(a).map(function(a){return f.trigger(c.formats[a],c,[0,b])||a.replace(/^!/,"")}).join("")}}}(),c.prototype.isDateExact=function(a,c){var d=this;return f.isInteger(a)&&f.isInteger(c)||"boolean"==typeof a&&"boolean"==typeof c?a===c:(f.isDate(a)||b.isArray(a))&&(f.isDate(c)||b.isArray(c))?d.create(a).pick===d.create(c).pick:b.isPlainObject(a)&&b.isPlainObject(c)?d.isDateExact(a.from,c.from)&&d.isDateExact(a.to,c.to):!1},c.prototype.isDateOverlap=function(a,c){var d=this,e=d.settings.firstDay?1:0;return f.isInteger(a)&&(f.isDate(c)||b.isArray(c))?(a=a%7+e,a===d.create(c).day+1):f.isInteger(c)&&(f.isDate(a)||b.isArray(a))?(c=c%7+e,c===d.create(a).day+1):b.isPlainObject(a)&&b.isPlainObject(c)?d.overlapRanges(a,c):!1},c.prototype.flipEnable=function(a){var b=this.item;b.enable=a||(-1==b.enable?1:-1)},c.prototype.deactivate=function(a,c){var d=this,e=d.item.disable.slice(0);return"flip"==c?d.flipEnable():c===!1?(d.flipEnable(1),e=[]):c===!0?(d.flipEnable(-1),e=[]):c.map(function(a){for(var c,g=0;gi;i+=1){if(h=e[i],d.isDateExact(h,a)){c=e[i]=null,j=!0;break}if(d.isDateOverlap(h,a)){b.isPlainObject(a)?(a.inverted=!0,c=a):b.isArray(a)?(c=a,c[3]||c.push("inverted")):f.isDate(a)&&(c=[a.getFullYear(),a.getMonth(),a.getDate(),"inverted"]);break}}if(c)for(i=0;g>i;i+=1)if(d.isDateExact(e[i],a)){e[i]=null;break}if(j)for(i=0;g>i;i+=1)if(d.isDateOverlap(e[i],a)){e[i]=null;break}c&&e.push(c)}),e.filter(function(a){return null!=a})},c.prototype.nodes=function(a){var b=this,c=b.settings,g=b.item,h=g.now,i=g.select,j=g.highlight,k=g.view,l=g.disable,m=g.min,n=g.max,o=function(a,b){return c.firstDay&&(a.push(a.shift()),b.push(b.shift())),f.node("thead",f.node("tr",f.group({min:0,max:d-1,i:1,node:"th",item:function(d){return[a[d],c.klass.weekdays,'scope=col title="'+b[d]+'"']}})))}((c.showWeekdaysFull?c.weekdaysFull:c.weekdaysLetter).slice(0),c.weekdaysFull.slice(0)),p=function(a){return f.node("div"," ",c.klass["nav"+(a?"Next":"Prev")]+(a&&k.year>=n.year&&k.month>=n.month||!a&&k.year<=m.year&&k.month<=m.month?" "+c.klass.navDisabled:""),"data-nav="+(a||-1)+" "+f.ariaAttr({role:"button",controls:b.$node[0].id+"_table"})+' title="'+(a?c.labelMonthNext:c.labelMonthPrev)+'"')},q=function(d){var e=c.showMonthsShort?c.monthsShort:c.monthsFull;return"short_months"==d&&(e=c.monthsShort),c.selectMonths&&void 0==d?f.node("select",f.group({min:0,max:11,i:1,node:"option",item:function(a){return[e[a],0,"value="+a+(k.month==a?" selected":"")+(k.year==m.year&&an.month?" disabled":"")]}}),c.klass.selectMonth+" browser-default",(a?"":"disabled")+" "+f.ariaAttr({controls:b.$node[0].id+"_table"})+' title="'+c.labelMonthSelect+'"'):"short_months"==d?null!=i?f.node("div",e[i.month]):f.node("div",e[k.month]):f.node("div",e[k.month],c.klass.month)},r=function(d){var e=k.year,g=c.selectYears===!0?5:~~(c.selectYears/2);if(g){var h=m.year,i=n.year,j=e-g,l=e+g;if(h>j&&(l+=h-j,j=h),l>i){var o=j-h,p=l-i;j-=o>p?p:o,l=i}if(c.selectYears&&void 0==d)return f.node("select",f.group({min:j,max:l,i:1,node:"option",item:function(a){return[a,0,"value="+a+(e==a?" selected":"")]}}),c.klass.selectYear+" browser-default",(a?"":"disabled")+" "+f.ariaAttr({controls:b.$node[0].id+"_table"})+' title="'+c.labelYearSelect+'"')}return"raw"==d?f.node("div",e):f.node("div",e,c.klass.year)};return createDayLabel=function(){return null!=i?f.node("div",i.date):f.node("div",h.date)},createWeekdayLabel=function(){var a;a=null!=i?i.day:h.day;var b=c.weekdaysFull[a];return b},f.node("div",f.node("div",createWeekdayLabel(),"picker__weekday-display")+f.node("div",q("short_months"),c.klass.month_display)+f.node("div",createDayLabel(),c.klass.day_display)+f.node("div",r("raw"),c.klass.year_display),c.klass.date_display)+f.node("div",f.node("div",(c.selectYears?q()+r():q()+r())+p()+p(1),c.klass.header)+f.node("table",o+f.node("tbody",f.group({min:0,max:e-1,i:1,node:"tr",item:function(a){var e=c.firstDay&&0===b.create([k.year,k.month,1]).day?-7:0;return[f.group({min:d*a-k.day+e+1,max:function(){return this.min+d-1},i:1,node:"td",item:function(a){a=b.create([k.year,k.month,a+(c.firstDay?1:0)]);var d=i&&i.pick==a.pick,e=j&&j.pick==a.pick,g=l&&b.disabled(a)||a.pickn.pick,o=f.trigger(b.formats.toString,b,[c.format,a]);return[f.node("div",a.date,function(b){return b.push(k.month==a.month?c.klass.infocus:c.klass.outfocus),h.pick==a.pick&&b.push(c.klass.now),d&&b.push(c.klass.selected),e&&b.push(c.klass.highlighted),g&&b.push(c.klass.disabled),b.join(" ")}([c.klass.day]),"data-pick="+a.pick+" "+f.ariaAttr({role:"gridcell",label:o,selected:d&&b.$node.val()===o?!0:null,activedescendant:e?!0:null,disabled:g?!0:null})),"",f.ariaAttr({role:"presentation"})]}})]}})),c.klass.table,'id="'+b.$node[0].id+'_table" '+f.ariaAttr({role:"grid",controls:b.$node[0].id,readonly:!0})),c.klass.calendar_container)+f.node("div",f.node("button",c.today,"btn-flat picker__today","type=button data-pick="+h.pick+(a&&!b.disabled(h)?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id}))+f.node("button",c.clear,"btn-flat picker__clear","type=button data-clear=1"+(a?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id}))+f.node("button",c.close,"btn-flat picker__close","type=button data-close=true "+(a?"":" disabled")+" "+f.ariaAttr({controls:b.$node[0].id})),c.klass.footer)},c.defaults=function(a){return{labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],weekdaysFull:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],weekdaysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],weekdaysLetter:["S","M","T","W","T","F","S"],today:"Today",clear:"Clear",close:"Close",format:"d mmmm, yyyy",klass:{table:a+"table",header:a+"header",date_display:a+"date-display",day_display:a+"day-display",month_display:a+"month-display",year_display:a+"year-display",calendar_container:a+"calendar-container",navPrev:a+"nav--prev",navNext:a+"nav--next",navDisabled:a+"nav--disabled",month:a+"month",year:a+"year",selectMonth:a+"select--month",selectYear:a+"select--year",weekdays:a+"weekday",day:a+"day",disabled:a+"day--disabled",selected:a+"day--selected",highlighted:a+"day--highlighted",now:a+"day--today",infocus:a+"day--infocus",outfocus:a+"day--outfocus",footer:a+"footer",buttonClear:a+"button--clear",buttonToday:a+"button--today",buttonClose:a+"button--close"}}}(a.klasses().picker+"__"),a.extend("pickadate",c)}),function(a){function b(){var b=+a(this).attr("length"),c=+a(this).val().length,d=b>=c;a(this).parent().find('span[class="character-counter"]').html(c+"/"+b),e(d,a(this))}function c(b){var c=b.parent().find('span[class="character-counter"]');c.length||(c=a("").addClass("character-counter").css("float","right").css("font-size","12px").css("height",1),b.parent().append(c))}function d(){a(this).parent().find('span[class="character-counter"]').html("")}function e(a,b){var c=b.hasClass("invalid");a&&c?b.removeClass("invalid"):a||c||(b.removeClass("valid"),b.addClass("invalid"))}a.fn.characterCounter=function(){return this.each(function(){var e=a(this),f=e.parent().find('span[class="character-counter"]');if(!f.length){var g=void 0!==e.attr("length");g&&(e.on("input",b),e.on("focus",b),e.on("blur",d),c(e))}})},a(document).ready(function(){a("input, textarea").characterCounter()})}(jQuery),function(a){var b={init:function(b){var c={time_constant:200,dist:-100,shift:0,padding:0,full_width:!1,indicators:!1,no_wrap:!1};return b=a.extend(c,b),this.each(function(){function c(){"undefined"!=typeof window.ontouchstart&&(H[0].addEventListener("touchstart",l),H[0].addEventListener("touchmove",m),H[0].addEventListener("touchend",n)),H[0].addEventListener("mousedown",l),H[0].addEventListener("mousemove",m),H[0].addEventListener("mouseup",n),H[0].addEventListener("mouseleave",n),H[0].addEventListener("click",j)}function d(a){return a.targetTouches&&a.targetTouches.length>=1?a.targetTouches[0].clientX:a.clientX}function e(a){return a.targetTouches&&a.targetTouches.length>=1?a.targetTouches[0].clientY:a.clientY}function f(a){return a>=t?a%t:0>a?f(t+a%t):a}function g(a){var c,d,e,g,h,i,j;if(p="number"==typeof a?a:p,q=Math.floor((p+s/2)/s),e=p-q*s,g=0>e?1:-1,h=-g*e*2/s,d=t>>1,b.full_width?j="translateX(0)":(j="translateX("+(H[0].clientWidth-item_width)/2+"px) ",j+="translateY("+(H[0].clientHeight-item_width)/2+"px)"),I){var k=q%t,l=G.find(".indicator-item.active");l.index()!==k&&(l.removeClass("active"),G.find(".indicator-item").eq(k).addClass("active"))}for((!b.no_wrap||q>=0&&t>q)&&(i=o[f(q)],i.style[A]=j+" translateX("+-e/2+"px) translateX("+g*b.shift*h*c+"px) translateZ("+b.dist*h+"px)",i.style.zIndex=0,b.full_width?tweenedOpacity=1:tweenedOpacity=1-.2*h,i.style.opacity=tweenedOpacity,i.style.display="block"),c=1;d>=c;++c)b.full_width?(zTranslation=b.dist,tweenedOpacity=c===d&&0>e?1-h:1):(zTranslation=b.dist*(2*c+h*g),tweenedOpacity=1-.2*(2*c+h*g)),(!b.no_wrap||t>q+c)&&(i=o[f(q+c)],i.style[A]=j+" translateX("+(b.shift+(s*c-e)/2)+"px) translateZ("+zTranslation+"px)",i.style.zIndex=-c,i.style.opacity=tweenedOpacity,i.style.display="block"),b.full_width?(zTranslation=b.dist,tweenedOpacity=c===d&&e>0?1-h:1):(zTranslation=b.dist*(2*c-h*g),tweenedOpacity=1-.2*(2*c-h*g)),(!b.no_wrap||q-c>=0)&&(i=o[f(q-c)],i.style[A]=j+" translateX("+(-b.shift+(-s*c-e)/2)+"px) translateZ("+zTranslation+"px)",i.style.zIndex=-c,i.style.opacity=tweenedOpacity,i.style.display="block");(!b.no_wrap||q>=0&&t>q)&&(i=o[f(q)],i.style[A]=j+" translateX("+-e/2+"px) translateX("+g*b.shift*h+"px) translateZ("+b.dist*h+"px)",i.style.zIndex=0,b.full_width?tweenedOpacity=1:tweenedOpacity=1-.2*h,i.style.opacity=tweenedOpacity,i.style.display="block")}function h(){var a,b,c,d;a=Date.now(),b=a-C,C=a,c=p-B,B=p,d=1e3*c/(1+b),z=.8*d+.2*z}function i(){var a,c;w&&(a=Date.now()-C,c=w*Math.exp(-a/b.time_constant),c>2||-2>c?(g(x-c),requestAnimationFrame(i)):g(x))}function j(c){if(E)return c.preventDefault(),c.stopPropagation(),!1;if(!b.full_width){var d=a(c.target).closest(".carousel-item").index(),e=q%t-d;0!==e&&(c.preventDefault(),c.stopPropagation()),k(d)}}function k(a){var c=q%t-a;b.no_wrap||(0>c?Math.abs(c+t)0&&Math.abs(c-t)c?H.trigger("carouselNext",[Math.abs(c)]):c>0&&H.trigger("carouselPrev",[c])}function l(a){r=!0,E=!1,F=!1,u=d(a),v=e(a),z=w=0,B=p,C=Date.now(),clearInterval(D),D=setInterval(h,100)}function m(a){var b,c,f;if(r)if(b=d(a),y=e(a),c=u-b,f=Math.abs(v-y),30>f&&!F)(c>2||-2>c)&&(E=!0,u=b,g(p+c));else{if(E)return a.preventDefault(),a.stopPropagation(),!1;F=!0}return E?(a.preventDefault(),a.stopPropagation(),!1):void 0}function n(a){return r?(r=!1,clearInterval(D),x=p,(z>10||-10>z)&&(w=.9*z,x=p+w),x=Math.round(x/s)*s,b.no_wrap&&(x>=s*(t-1)?x=s*(t-1):0>x&&(x=0)),w=x-p,C=Date.now(),requestAnimationFrame(i),E&&(a.preventDefault(),a.stopPropagation()),!1):void 0}var o,p,q,r,s,t,u,v,w,x,z,A,B,C,D,E,F,G=a('
            '),H=a(this),I=H.attr("data-indicators")||b.indicators;if(H.hasClass("initialized"))return a(this).trigger("carouselNext",[1e-6]),!0;if(b.full_width){b.dist=0;var J=H.find(".carousel-item img").first();J.length?imageHeight=J.on("load",function(){H.css("height",a(this).height())}):(imageHeight=H.find(".carousel-item").first().height(),H.css("height",imageHeight)),I&&H.find(".carousel-fixed-item").addClass("with-indicators")}H.addClass("initialized"),r=!1,p=x=0,o=[],item_width=H.find(".carousel-item").first().innerWidth(),s=2*item_width+b.padding,H.find(".carousel-item").each(function(b){if(o.push(a(this)[0]),I){var c=a('
          • ');0===b&&c.addClass("active"),c.click(function(){var b=a(this).index();k(b)}),G.append(c)}}),I&&H.append(G),t=o.length,A="transform",["webkit","Moz","O","ms"].every(function(a){var b=a+"Transform";return"undefined"!=typeof document.body.style[b]?(A=b,!1):!0}),window.onresize=g,c(),g(p),a(this).on("carouselNext",function(a,b){void 0===b&&(b=1),x=p+s*b,p!==x&&(w=x-p,C=Date.now(),requestAnimationFrame(i))}),a(this).on("carouselPrev",function(a,b){void 0===b&&(b=1),x=p-s*b,p!==x&&(w=x-p,C=Date.now(),requestAnimationFrame(i))}),a(this).on("carouselSet",function(a,b){void 0===b&&(b=0),k(b)})})},next:function(b){a(this).trigger("carouselNext",[b])},prev:function(b){a(this).trigger("carouselPrev",[b])},set:function(b){a(this).trigger("carouselSet",[b])}};a.fn.carousel=function(c){return b[c]?b[c].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof c&&c?void a.error("Method "+c+" does not exist on jQuery.carousel"):b.init.apply(this,arguments)}}(jQuery); \ No newline at end of file